DE2507864A1 - Verfahren zur herstellung von silan - Google Patents
Verfahren zur herstellung von silanInfo
- Publication number
- DE2507864A1 DE2507864A1 DE19752507864 DE2507864A DE2507864A1 DE 2507864 A1 DE2507864 A1 DE 2507864A1 DE 19752507864 DE19752507864 DE 19752507864 DE 2507864 A DE2507864 A DE 2507864A DE 2507864 A1 DE2507864 A1 DE 2507864A1
- Authority
- DE
- Germany
- Prior art keywords
- bed
- silane
- trichlorosilane
- resin
- sih
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 title claims description 25
- 238000000034 method Methods 0.000 title claims description 24
- 229910000077 silane Inorganic materials 0.000 title claims description 24
- 238000004519 manufacturing process Methods 0.000 title description 8
- 239000011347 resin Substances 0.000 claims description 27
- 229920005989 resin Polymers 0.000 claims description 27
- ZDHXKXAHOVTTAH-UHFFFAOYSA-N trichlorosilane Chemical compound Cl[SiH](Cl)Cl ZDHXKXAHOVTTAH-UHFFFAOYSA-N 0.000 claims description 23
- 239000005052 trichlorosilane Substances 0.000 claims description 23
- 239000000047 product Substances 0.000 claims description 14
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical compound Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 claims description 12
- 238000009835 boiling Methods 0.000 claims description 11
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 claims description 10
- 239000005049 silicon tetrachloride Substances 0.000 claims description 10
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 8
- 239000003957 anion exchange resin Substances 0.000 claims description 6
- 125000001302 tertiary amino group Chemical group 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 239000007795 chemical reaction product Substances 0.000 claims description 5
- 239000005046 Chlorosilane Substances 0.000 claims description 4
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims 3
- 238000002360 preparation method Methods 0.000 claims 1
- MROCJMGDEKINLD-UHFFFAOYSA-N dichlorosilane Chemical compound Cl[SiH2]Cl MROCJMGDEKINLD-UHFFFAOYSA-N 0.000 description 12
- 238000010992 reflux Methods 0.000 description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000007788 liquid Substances 0.000 description 8
- 239000007791 liquid phase Substances 0.000 description 8
- 239000010703 silicon Substances 0.000 description 8
- 229910052710 silicon Inorganic materials 0.000 description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
- 125000003277 amino group Chemical group 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- 238000007323 disproportionation reaction Methods 0.000 description 7
- -1 halogen ions Chemical class 0.000 description 7
- 239000000463 material Substances 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- 239000012808 vapor phase Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 4
- 229920001429 chelating resin Polymers 0.000 description 4
- 229920001577 copolymer Polymers 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- SLLGVCUQYRMELA-UHFFFAOYSA-N chlorosilicon Chemical compound Cl[Si] SLLGVCUQYRMELA-UHFFFAOYSA-N 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- 238000005342 ion exchange Methods 0.000 description 3
- 239000003456 ion exchange resin Substances 0.000 description 3
- 229920003303 ion-exchange polymer Polymers 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 239000011148 porous material Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Natural products CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000013065 commercial product Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 230000008961 swelling Effects 0.000 description 2
- WVAFEFUPWRPQSY-UHFFFAOYSA-N 1,2,3-tris(ethenyl)benzene Chemical compound C=CC1=CC=CC(C=C)=C1C=C WVAFEFUPWRPQSY-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- QLLUAUADIMPKIH-UHFFFAOYSA-N 1,2-bis(ethenyl)naphthalene Chemical class C1=CC=CC2=C(C=C)C(C=C)=CC=C21 QLLUAUADIMPKIH-UHFFFAOYSA-N 0.000 description 1
- WEERVPDNCOGWJF-UHFFFAOYSA-N 1,4-bis(ethenyl)benzene Chemical compound C=CC1=CC=C(C=C)C=C1 WEERVPDNCOGWJF-UHFFFAOYSA-N 0.000 description 1
- ZRZHXNCATOYMJH-UHFFFAOYSA-N 1-(chloromethyl)-4-ethenylbenzene Chemical compound ClCC1=CC=C(C=C)C=C1 ZRZHXNCATOYMJH-UHFFFAOYSA-N 0.000 description 1
- BOVQCIDBZXNFEJ-UHFFFAOYSA-N 1-chloro-3-ethenylbenzene Chemical compound ClC1=CC=CC(C=C)=C1 BOVQCIDBZXNFEJ-UHFFFAOYSA-N 0.000 description 1
- KTZVZZJJVJQZHV-UHFFFAOYSA-N 1-chloro-4-ethenylbenzene Chemical compound ClC1=CC=C(C=C)C=C1 KTZVZZJJVJQZHV-UHFFFAOYSA-N 0.000 description 1
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 1
- FCMUPMSEVHVOSE-UHFFFAOYSA-N 2,3-bis(ethenyl)pyridine Chemical compound C=CC1=CC=CN=C1C=C FCMUPMSEVHVOSE-UHFFFAOYSA-N 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- XFYWZIQAXBZBAL-UHFFFAOYSA-N 4-ethenyl-4-methyl-3h-quinoline Chemical compound C1=CC=C2C(C)(C=C)CC=NC2=C1 XFYWZIQAXBZBAL-UHFFFAOYSA-N 0.000 description 1
- LKLNVHRUXQQEII-UHFFFAOYSA-N 5-ethenyl-2,3-dimethylpyridine Chemical compound CC1=CC(C=C)=CN=C1C LKLNVHRUXQQEII-UHFFFAOYSA-N 0.000 description 1
- VJOWMORERYNYON-UHFFFAOYSA-N 5-ethenyl-2-methylpyridine Chemical compound CC1=CC=C(C=C)C=N1 VJOWMORERYNYON-UHFFFAOYSA-N 0.000 description 1
- ARRVYTMZYDBFHC-UHFFFAOYSA-N 5-ethenyl-2-methylquinoline Chemical compound C=CC1=CC=CC2=NC(C)=CC=C21 ARRVYTMZYDBFHC-UHFFFAOYSA-N 0.000 description 1
- SFIFMPZUHOERJV-UHFFFAOYSA-N 5-ethenyl-3-ethyl-2-methylpyridine Chemical compound CCC1=CC(C=C)=CN=C1C SFIFMPZUHOERJV-UHFFFAOYSA-N 0.000 description 1
- IWLYAVJYGSHMLI-UHFFFAOYSA-N 5-ethenyl-3-methylisoquinoline Chemical compound C1=CC=C2C=NC(C)=CC2=C1C=C IWLYAVJYGSHMLI-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229910003902 SiCl 4 Inorganic materials 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000005349 anion exchange Methods 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000001502 aryl halides Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- HYGWNUKOUCZBND-UHFFFAOYSA-N azanide Chemical group [NH2-] HYGWNUKOUCZBND-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 125000005266 diarylamine group Chemical group 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 230000017525 heat dissipation Effects 0.000 description 1
- RBBOWEDMXHTEPA-UHFFFAOYSA-N hexane;toluene Chemical compound CCCCCC.CC1=CC=CC=C1 RBBOWEDMXHTEPA-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 235000015243 ice cream Nutrition 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- DBSDMAPJGHBWAL-UHFFFAOYSA-N penta-1,4-dien-3-ylbenzene Chemical class C=CC(C=C)C1=CC=CC=C1 DBSDMAPJGHBWAL-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 238000005956 quaternization reaction Methods 0.000 description 1
- 238000012827 research and development Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 125000000467 secondary amino group Chemical class [H]N([*:1])[*:2] 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 238000005029 sieve analysis Methods 0.000 description 1
- 150000004756 silanes Chemical class 0.000 description 1
- 150000003377 silicon compounds Chemical class 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000012798 spherical particle Substances 0.000 description 1
- 125000003011 styrenyl group Chemical group [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B33/00—Silicon; Compounds thereof
- C01B33/08—Compounds containing halogen
- C01B33/107—Halogenated silanes
- C01B33/10773—Halogenated silanes obtained by disproportionation and molecular rearrangement of halogenated silanes
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B33/00—Silicon; Compounds thereof
- C01B33/04—Hydrides of silicon
- C01B33/043—Monosilane
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Silicon Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/445,667 US3968199A (en) | 1974-02-25 | 1974-02-25 | Process for making silane |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2507864A1 true DE2507864A1 (de) | 1975-08-28 |
Family
ID=23769769
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752507864 Pending DE2507864A1 (de) | 1974-02-25 | 1975-02-24 | Verfahren zur herstellung von silan |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3968199A (enExample) |
| JP (1) | JPS50119798A (enExample) |
| BE (1) | BE825872A (enExample) |
| DE (1) | DE2507864A1 (enExample) |
| FR (1) | FR2261977B1 (enExample) |
| GB (1) | GB1499137A (enExample) |
Cited By (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4554141A (en) * | 1984-05-14 | 1985-11-19 | Ethyl Corporation | Gas stream purification |
| US5094831A (en) * | 1989-07-31 | 1992-03-10 | Degussa Aktiengesellschaft | Process for the dismutation of chlorosilanes |
| WO2000039027A1 (de) * | 1998-12-24 | 2000-07-06 | Bayer Aktiengesellschaft | Verfahren und anlage zur herstellung von silan |
| WO2001077017A1 (de) * | 2000-04-07 | 2001-10-18 | Solarworld Aktiengesellschaft | Verfahren und anlage zur herstellung von silan |
| WO2002042206A1 (de) * | 2000-11-21 | 2002-05-30 | Solarworld Aktiengesellschaft | Verfahren zur herstellung von silanen |
| DE10061682A1 (de) * | 2000-12-11 | 2002-07-04 | Solarworld Ag | Verfahren zur Herstellung von Reinstsilicium |
| US6843972B2 (en) | 2000-11-20 | 2005-01-18 | Solarworld Aktiengesellschaft | Method for purifying trichlorosilane |
| US6852301B2 (en) | 2000-12-11 | 2005-02-08 | Solarworld Aktiengesellschaft | Method for producing silane |
| DE102005046105B3 (de) * | 2005-09-27 | 2007-04-26 | Degussa Gmbh | Verfahren zur Herstellung von Monosilan |
| DE10057522B4 (de) * | 2000-11-21 | 2009-04-16 | Evonik Degussa Gmbh | Verfahren zur Herstellung von Silanen |
| DE10057521B4 (de) * | 2000-11-21 | 2009-04-16 | Evonik Degussa Gmbh | Verfahren zur Herstellung von Silanen |
| DE102007059170A1 (de) | 2007-12-06 | 2009-06-10 | Evonik Degussa Gmbh | Katalysator und Verfahren zur Dismutierung von Wasserstoff enthaltenden Halogensilanen |
| DE102008017304A1 (de) * | 2008-03-31 | 2009-10-01 | Schmid Silicon Technology Gmbh | Verfahren und Anlage zur Herstellung von Reinstsilizium |
| DE102009032833A1 (de) | 2009-07-08 | 2011-01-13 | Schmid Silicon Technology Gmbh | Verfahren und Anlage zur Herstellung von Monosilan |
| DE102010034469A1 (de) | 2010-08-06 | 2012-02-09 | Schmid Silicon Technology Gmbh | Anlage zur Herstellung von Monosilan |
| US8147656B2 (en) | 2005-05-25 | 2012-04-03 | Spawnt Private S.A.R.L. | Method for the production of silicon from silyl halides |
| WO2012110275A1 (de) * | 2011-02-14 | 2012-08-23 | Evonik Degussa Gmbh | Monochlorsilan, verfahren und vorrichtung zu dessen herstellung |
| DE102015203618A1 (de) | 2015-02-27 | 2016-09-01 | Schmid Silicon Technology Gmbh | Kolonne und Verfahren zur Disproportionierung von Chlorsilanen zu Monosilan und Tetrachlorsilan sowie Anlage zur Gewinnung von Monosilan |
| US12209019B2 (en) | 2018-11-28 | 2025-01-28 | Hysilabs, Sas | Catalysed process of production of hydrogen from silylated derivatives as hydrogen carrier compounds |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4676967A (en) * | 1978-08-23 | 1987-06-30 | Union Carbide Corporation | High purity silane and silicon production |
| US4340574A (en) * | 1980-08-28 | 1982-07-20 | Union Carbide Corporation | Process for the production of ultrahigh purity silane with recycle from separation columns |
| FR2503125A1 (fr) * | 1981-04-03 | 1982-10-08 | Rhone Poulenc Spec Chim | Procede de fabrication de silane |
| US4395389A (en) * | 1982-03-01 | 1983-07-26 | Ethyl Corporation | Chlorosilane disproportionation process |
| FR2526003A1 (fr) * | 1982-05-03 | 1983-11-04 | Rhone Poulenc Spec Chim | Procede de fabrication de silane a partir de trichlorosilane |
| FR2541666B1 (fr) * | 1983-02-25 | 1985-06-21 | Rhone Poulenc Spec Chim | Procede de dismutation de silanes |
| JPS6042216A (ja) * | 1983-08-10 | 1985-03-06 | Osaka Titanium Seizo Kk | トリクロロシラン・ジクロロシラン・モノクロロシランの不均斉化方法 |
| FR2552435B1 (fr) * | 1983-09-28 | 1985-10-25 | Rhone Poulenc Spec Chim | Procede de fabrication de silanes hydrogenes par redistribution |
| FR2552434B1 (fr) * | 1983-09-28 | 1985-10-25 | Rhone Poulenc Spec Chim | Procede de fabrication de silane a partir de methyldichlorosilane et de chlorosilanes |
| US4613491A (en) * | 1984-05-17 | 1986-09-23 | Korea Advanced Institute Of Science And Technology | Redistribution catalyst and methods for its preparation and use to convert chlorosilicon hydrides to silane |
| JPH0753574B2 (ja) * | 1985-06-11 | 1995-06-07 | 三井東圧化学株式会社 | シラン類の不均化方法 |
| US4778668A (en) * | 1986-12-22 | 1988-10-18 | Ethyl Corporation | Preparation of silane and metal aluminum halide co-product |
| DE3712098A1 (de) * | 1987-04-10 | 1988-10-20 | Wacker Chemie Gmbh | Verfahren zur herstellung von disproportionierungsprodukten von dichlormethylsilan in gegenwart eines katalysators |
| US5290342A (en) * | 1990-12-05 | 1994-03-01 | Ethyl Corporation | Silane compositions and process |
| US5211931A (en) * | 1992-03-27 | 1993-05-18 | Ethyl Corporation | Removal of ethylene from silane using a distillation step after separation using a zeolite molecular sieve |
| US5529935A (en) * | 1995-05-17 | 1996-06-25 | Hemlock Semiconductor Corporation | Method for determining organoamines concentrations in chlorosilane |
| RU2152902C2 (ru) * | 1998-05-13 | 2000-07-20 | Товарищество с ограниченной ответственностью фирма "ХОРСТ" | Способ получения силанов |
| RU2174950C1 (ru) * | 2000-08-15 | 2001-10-20 | Общество с ограниченной ответственностью "Ц.Е.С. - Украина" | Способ получения силана |
| DE102004045245B4 (de) * | 2004-09-17 | 2007-11-15 | Degussa Gmbh | Vorrichtung und Verfahren zur Herstellung von Silanen |
| DE102006043929B4 (de) * | 2006-09-14 | 2016-10-06 | Spawnt Private S.À.R.L. | Verfahren zur Herstellung von festen Polysilanmischungen |
| US20100074824A1 (en) * | 2006-09-27 | 2010-03-25 | Denki Kagaku Kogyo Kabushiki Kaisha | Process for continuously producing monosilane |
| US20100150809A1 (en) * | 2008-12-11 | 2010-06-17 | Bill Jr Jon M | enhancements for a chlorosilane redistribution reactor |
| DE102009027729A1 (de) * | 2009-07-15 | 2011-01-27 | Evonik Degussa Gmbh | Entfernung von Fremdmetallen aus anorganischen Silanen |
| DE102009027730A1 (de) * | 2009-07-15 | 2011-01-27 | Evonik Degussa Gmbh | Verahren und Verwendung von aminofunktionellen Harzen zur Dismutierung von Halogensilanen und zur Entfernung von Fremdmetallen |
| US20120148471A1 (en) * | 2009-08-27 | 2012-06-14 | Denki Kagaku Kogyo Kabushiki Kaisha | Method for purifying chlorosilane |
| US8298490B2 (en) | 2009-11-06 | 2012-10-30 | Gtat Corporation | Systems and methods of producing trichlorosilane |
| US8590705B2 (en) | 2010-06-11 | 2013-11-26 | Air Products And Chemicals, Inc. | Cylinder surface treated container for monochlorosilane |
| CN102344145B (zh) * | 2010-07-29 | 2013-05-08 | 比亚迪股份有限公司 | 一种三氯氢硅制备硅烷的方法 |
| RU2440293C1 (ru) | 2010-09-09 | 2012-01-20 | Закрытое акционерное общество "ЭЛЛИНА-НТ" | Способ получения высокочистого трихлорсилана |
| CN103112860B (zh) * | 2013-02-26 | 2015-09-02 | 天津大学 | 改良西门子法联产制备高纯硅烷的方法 |
| CN103449439A (zh) * | 2013-08-23 | 2013-12-18 | 天津大学 | 硅烷法制多晶硅安全生产方法 |
| CN105036137B (zh) * | 2015-07-17 | 2020-04-24 | 江苏中能硅业科技发展有限公司 | 以二氯二氢硅为原料歧化制备硅烷的方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3069239A (en) * | 1958-10-28 | 1962-12-18 | Westinghouse Electric Corp | Purification of halogenated silicon compounds |
-
1974
- 1974-02-25 US US05/445,667 patent/US3968199A/en not_active Expired - Lifetime
-
1975
- 1975-02-24 DE DE19752507864 patent/DE2507864A1/de active Pending
- 1975-02-24 FR FR7505662A patent/FR2261977B1/fr not_active Expired
- 1975-02-24 BE BE153644A patent/BE825872A/xx not_active IP Right Cessation
- 1975-02-24 JP JP50021977A patent/JPS50119798A/ja active Pending
- 1975-02-24 GB GB7661/75A patent/GB1499137A/en not_active Expired
Cited By (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4554141A (en) * | 1984-05-14 | 1985-11-19 | Ethyl Corporation | Gas stream purification |
| US5094831A (en) * | 1989-07-31 | 1992-03-10 | Degussa Aktiengesellschaft | Process for the dismutation of chlorosilanes |
| WO2000039027A1 (de) * | 1998-12-24 | 2000-07-06 | Bayer Aktiengesellschaft | Verfahren und anlage zur herstellung von silan |
| US6942844B2 (en) | 2000-04-07 | 2005-09-13 | Solarworld Aktiengesellschaft | Method and facility for producing silane |
| WO2001077017A1 (de) * | 2000-04-07 | 2001-10-18 | Solarworld Aktiengesellschaft | Verfahren und anlage zur herstellung von silan |
| US6843972B2 (en) | 2000-11-20 | 2005-01-18 | Solarworld Aktiengesellschaft | Method for purifying trichlorosilane |
| WO2002042206A1 (de) * | 2000-11-21 | 2002-05-30 | Solarworld Aktiengesellschaft | Verfahren zur herstellung von silanen |
| DE10057522B4 (de) * | 2000-11-21 | 2009-04-16 | Evonik Degussa Gmbh | Verfahren zur Herstellung von Silanen |
| DE10057521B4 (de) * | 2000-11-21 | 2009-04-16 | Evonik Degussa Gmbh | Verfahren zur Herstellung von Silanen |
| DE10061682A1 (de) * | 2000-12-11 | 2002-07-04 | Solarworld Ag | Verfahren zur Herstellung von Reinstsilicium |
| US6852301B2 (en) | 2000-12-11 | 2005-02-08 | Solarworld Aktiengesellschaft | Method for producing silane |
| US6887448B2 (en) | 2000-12-11 | 2005-05-03 | Solarworld Ag | Method for production of high purity silicon |
| US8147656B2 (en) | 2005-05-25 | 2012-04-03 | Spawnt Private S.A.R.L. | Method for the production of silicon from silyl halides |
| US9382122B2 (en) | 2005-05-25 | 2016-07-05 | Spawnt Private S.À.R.L. | Method for the production of silicon from silyl halides |
| DE102005046105B3 (de) * | 2005-09-27 | 2007-04-26 | Degussa Gmbh | Verfahren zur Herstellung von Monosilan |
| EP2591856A1 (de) | 2007-12-06 | 2013-05-15 | Evonik Degussa GmbH | Anlage mit Katalysator zur Dismutierung von Wasserstoff enthaltenden Halogensilanen |
| DE102007059170A1 (de) | 2007-12-06 | 2009-06-10 | Evonik Degussa Gmbh | Katalysator und Verfahren zur Dismutierung von Wasserstoff enthaltenden Halogensilanen |
| DE102008017304A1 (de) * | 2008-03-31 | 2009-10-01 | Schmid Silicon Technology Gmbh | Verfahren und Anlage zur Herstellung von Reinstsilizium |
| WO2011003949A1 (de) | 2009-07-08 | 2011-01-13 | Schmid Silicon Technology Gmbh | Verfahren und anlage zur herstellung von monosilan |
| DE102009032833A1 (de) | 2009-07-08 | 2011-01-13 | Schmid Silicon Technology Gmbh | Verfahren und Anlage zur Herstellung von Monosilan |
| US9023297B2 (en) | 2009-07-08 | 2015-05-05 | Schmid Silicon Technology Gmbh | Method and system for producing monosilane |
| DE102010034469A1 (de) | 2010-08-06 | 2012-02-09 | Schmid Silicon Technology Gmbh | Anlage zur Herstellung von Monosilan |
| WO2012017053A1 (de) | 2010-08-06 | 2012-02-09 | Schmid Silicon Technology Gmbh | Anlage zur herstellung von monosilan |
| WO2012110275A1 (de) * | 2011-02-14 | 2012-08-23 | Evonik Degussa Gmbh | Monochlorsilan, verfahren und vorrichtung zu dessen herstellung |
| US9221689B2 (en) | 2011-02-14 | 2015-12-29 | Evonik Degussa Gmbh | Monochlorosilane, process and apparatus for the preparation thereof |
| DE102015203618A1 (de) | 2015-02-27 | 2016-09-01 | Schmid Silicon Technology Gmbh | Kolonne und Verfahren zur Disproportionierung von Chlorsilanen zu Monosilan und Tetrachlorsilan sowie Anlage zur Gewinnung von Monosilan |
| US10384182B2 (en) | 2015-02-27 | 2019-08-20 | Schmid Silicon Technology Gmbh | Column and process for disproportionation of chlorosilanes into monosilane and tetrachlorosilane and plant for production of monosilane |
| US12209019B2 (en) | 2018-11-28 | 2025-01-28 | Hysilabs, Sas | Catalysed process of production of hydrogen from silylated derivatives as hydrogen carrier compounds |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS50119798A (enExample) | 1975-09-19 |
| US3968199A (en) | 1976-07-06 |
| BE825872A (fr) | 1975-08-25 |
| FR2261977B1 (enExample) | 1979-03-16 |
| FR2261977A1 (enExample) | 1975-09-19 |
| GB1499137A (en) | 1978-01-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2507864A1 (de) | Verfahren zur herstellung von silan | |
| DE2822783C2 (enExample) | ||
| DE69105046T2 (de) | Verfahren zur Herstellung von Dekabromdiphenylalkan. | |
| DE2708406A1 (de) | Spaltung von silicium-kohlenstoffbindungen mittels halogenwasserstoff | |
| DE69016852T2 (de) | Integriertes Verfahren zur Alkylierung und Disproportionierung von Halosilanen. | |
| DE3650008T2 (de) | Katalytische Zusammensetzung und Verfahren zur Herstellung von Silanen. | |
| EP0519181B1 (de) | Verfahren zur Herstellung von 3-Chlorpropylsilanen | |
| DE893198C (de) | Verfahren zur Herstellung von Organohalogensilanen | |
| DE69109211T2 (de) | Trifluoropropyl-substituierte Silanverbindungen enthaltende Katalysator für Alpha-Olefinpolymerisation. | |
| EP0205891A1 (de) | Phenylengruppen-haltige Organosilane, Verfahren zu ihrer Herstellung | |
| EP0286074B1 (de) | Verfahren zur Herstellung von Disproportionierungsprodukten von Dichlormethylsilan in Gegenwart eines Katalysators | |
| DE4208152A1 (de) | Verfahren zur herstellung von dimethylchlorsilan | |
| DE2351258A1 (de) | Verfahren zum umlagern von alkylsilanen und alkylhydrogensilanen | |
| DE1767905A1 (de) | Verfahren zur Disproportionierung von Chlorsilanen und Organosilanen | |
| DE1158066B (de) | Verfahren zur Herstellung von p-Styryldiphenylphosphin | |
| DE3717265A1 (de) | Verfahren zum herstellen von disilylmethanen | |
| DE2600387B2 (de) | Verfahren zur herstellung von phosgen | |
| DE69008382T2 (de) | Verfahren zur Herstellung von Organosiliziumverbindungen. | |
| DE69424503T2 (de) | Verfahren zur Herstellung von Dimethylchlorsilan und Triorganochlorsilan | |
| DE3783866T2 (de) | Herstellung von silan und amin-alanen. | |
| DE3017130C2 (de) | Verfahren zur Herstellung von Organosiloxanen und Methylchlorid | |
| DE4419270A1 (de) | Verfahren zur Herstellung von Alkyl- oder Aryldichlorsilanen | |
| DE3017832C2 (enExample) | ||
| DE10057522B4 (de) | Verfahren zur Herstellung von Silanen | |
| DE2032664C3 (de) | Verfahren zur Alkylierung von Organosiliciumchloriden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHW | Rejection |