DE2506431A1 - Algizide und wasserherbizide - Google Patents
Algizide und wasserherbizideInfo
- Publication number
- DE2506431A1 DE2506431A1 DE19752506431 DE2506431A DE2506431A1 DE 2506431 A1 DE2506431 A1 DE 2506431A1 DE 19752506431 DE19752506431 DE 19752506431 DE 2506431 A DE2506431 A DE 2506431A DE 2506431 A1 DE2506431 A1 DE 2506431A1
- Authority
- DE
- Germany
- Prior art keywords
- copper
- complex
- amine
- carbon atoms
- moles
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 title claims description 25
- 239000004009 herbicide Substances 0.000 title description 12
- 239000003619 algicide Substances 0.000 title description 6
- 239000010949 copper Substances 0.000 claims description 56
- 229910052802 copper Inorganic materials 0.000 claims description 40
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 37
- 150000001412 amines Chemical class 0.000 claims description 22
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 20
- JJLJMEJHUUYSSY-UHFFFAOYSA-L copper(II) hydroxide Inorganic materials [OH-].[OH-].[Cu+2] JJLJMEJHUUYSSY-UHFFFAOYSA-L 0.000 claims description 20
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical class [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- 241000195493 Cryptophyta Species 0.000 claims description 10
- 241000196324 Embryophyta Species 0.000 claims description 10
- 230000009918 complex formation Effects 0.000 claims description 10
- 239000004480 active ingredient Substances 0.000 claims description 8
- AEJIMXVJZFYIHN-UHFFFAOYSA-N copper;dihydrate Chemical compound O.O.[Cu] AEJIMXVJZFYIHN-UHFFFAOYSA-N 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 7
- 125000004429 atom Chemical group 0.000 claims description 6
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 claims description 6
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 claims description 6
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- YEOCHZFPBYUXMC-UHFFFAOYSA-L copper benzoate Chemical compound [Cu+2].[O-]C(=O)C1=CC=CC=C1.[O-]C(=O)C1=CC=CC=C1 YEOCHZFPBYUXMC-UHFFFAOYSA-L 0.000 claims description 4
- 229910000366 copper(II) sulfate Inorganic materials 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 229910002651 NO3 Inorganic materials 0.000 claims description 3
- -1 copper (II) compound Chemical class 0.000 claims description 3
- GEZOTWYUIKXWOA-UHFFFAOYSA-L copper;carbonate Chemical compound [Cu+2].[O-]C([O-])=O GEZOTWYUIKXWOA-UHFFFAOYSA-L 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- OCUCCJIRFHNWBP-IYEMJOQQSA-L Copper gluconate Chemical compound [Cu+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O OCUCCJIRFHNWBP-IYEMJOQQSA-L 0.000 claims description 2
- 229910021592 Copper(II) chloride Inorganic materials 0.000 claims description 2
- 125000006294 amino alkylene group Chemical group 0.000 claims description 2
- QTMDXZNDVAMKGV-UHFFFAOYSA-L copper(II) bromide Substances [Cu+2].[Br-].[Br-] QTMDXZNDVAMKGV-UHFFFAOYSA-L 0.000 claims description 2
- 229910000009 copper(II) carbonate Inorganic materials 0.000 claims description 2
- MAUZTCHAIPUZJB-OLXYHTOASA-L copper;(2r,3r)-2,3-dihydroxybutanedioate;hydrate Chemical compound O.[Cu+2].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O MAUZTCHAIPUZJB-OLXYHTOASA-L 0.000 claims description 2
- HFDWIMBEIXDNQS-UHFFFAOYSA-L copper;diformate Chemical compound [Cu+2].[O-]C=O.[O-]C=O HFDWIMBEIXDNQS-UHFFFAOYSA-L 0.000 claims description 2
- 239000011646 cupric carbonate Substances 0.000 claims description 2
- 235000019854 cupric carbonate Nutrition 0.000 claims description 2
- 239000011642 cupric gluconate Substances 0.000 claims description 2
- 235000019856 cupric gluconate Nutrition 0.000 claims description 2
- STDMRMREKPZQFJ-UHFFFAOYSA-H tricopper;2-hydroxypropane-1,2,3-tricarboxylate Chemical compound [Cu+2].[Cu+2].[Cu+2].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O.[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O STDMRMREKPZQFJ-UHFFFAOYSA-H 0.000 claims description 2
- 229910021590 Copper(II) bromide Inorganic materials 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- IJCCOEGCVILSMZ-UHFFFAOYSA-L copper;dichlorate Chemical compound [Cu+2].[O-]Cl(=O)=O.[O-]Cl(=O)=O IJCCOEGCVILSMZ-UHFFFAOYSA-L 0.000 claims 1
- ZQLBQWDYEGOYSW-UHFFFAOYSA-L copper;disulfamate Chemical compound [Cu+2].NS([O-])(=O)=O.NS([O-])(=O)=O ZQLBQWDYEGOYSW-UHFFFAOYSA-L 0.000 claims 1
- 239000000243 solution Substances 0.000 description 35
- 239000002253 acid Substances 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 239000000047 product Substances 0.000 description 11
- JZCCFEFSEZPSOG-UHFFFAOYSA-L copper(II) sulfate pentahydrate Chemical compound O.O.O.O.O.[Cu+2].[O-]S([O-])(=O)=O JZCCFEFSEZPSOG-UHFFFAOYSA-L 0.000 description 10
- 230000002363 herbicidal effect Effects 0.000 description 10
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- 229910052500 inorganic mineral Inorganic materials 0.000 description 6
- 239000011707 mineral Substances 0.000 description 6
- 235000010755 mineral Nutrition 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 5
- 235000013601 eggs Nutrition 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 239000008096 xylene Substances 0.000 description 5
- 241000498251 Hydrilla Species 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 230000002353 algacidal effect Effects 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 4
- GXEKYRXVRROBEV-FBXFSONDSA-N (1r,2s,3r,4s)-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid Chemical compound C1C[C@@H]2[C@@H](C(O)=O)[C@@H](C(=O)O)[C@H]1O2 GXEKYRXVRROBEV-FBXFSONDSA-N 0.000 description 3
- 241000251468 Actinopterygii Species 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 150000001879 copper Chemical class 0.000 description 3
- 239000002283 diesel fuel Substances 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 239000003643 water by type Substances 0.000 description 3
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 2
- GEHMBYLTCISYNY-UHFFFAOYSA-N Ammonium sulfamate Chemical compound [NH4+].NS([O-])(=O)=O GEHMBYLTCISYNY-UHFFFAOYSA-N 0.000 description 2
- 239000005750 Copper hydroxide Substances 0.000 description 2
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 2
- 239000005630 Diquat Substances 0.000 description 2
- 241000544053 Egeria densa Species 0.000 description 2
- 241000169203 Eichhornia Species 0.000 description 2
- 241001113556 Elodea Species 0.000 description 2
- 241001134698 Lyngbya Species 0.000 description 2
- 241000192701 Microcystis Species 0.000 description 2
- 241000342009 Pithophora Species 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 229940116318 copper carbonate Drugs 0.000 description 2
- 229910001956 copper hydroxide Inorganic materials 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- SYJFEGQWDCRVNX-UHFFFAOYSA-N diquat Chemical compound C1=CC=[N+]2CC[N+]3=CC=CC=C3C2=C1 SYJFEGQWDCRVNX-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- KFIGICHILYTCJF-UHFFFAOYSA-N n'-methylethane-1,2-diamine Chemical compound CNCCN KFIGICHILYTCJF-UHFFFAOYSA-N 0.000 description 2
- QHJABUZHRJTCAR-UHFFFAOYSA-N n'-methylpropane-1,3-diamine Chemical compound CNCCCN QHJABUZHRJTCAR-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 230000035699 permeability Effects 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- FAGUFWYHJQFNRV-UHFFFAOYSA-N tetraethylenepentamine Chemical compound NCCNCCNCCNCCN FAGUFWYHJQFNRV-UHFFFAOYSA-N 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 229960001124 trientine Drugs 0.000 description 2
- AZTLMCLHSLWTFK-UHFFFAOYSA-N 2-aminoethanol;ethenamine Chemical compound NC=C.NCCO AZTLMCLHSLWTFK-UHFFFAOYSA-N 0.000 description 1
- MPNXSZJPSVBLHP-UHFFFAOYSA-N 2-chloro-n-phenylpyridine-3-carboxamide Chemical compound ClC1=NC=CC=C1C(=O)NC1=CC=CC=C1 MPNXSZJPSVBLHP-UHFFFAOYSA-N 0.000 description 1
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 1
- 241000192542 Anabaena Species 0.000 description 1
- 241000269817 Centrarchidae Species 0.000 description 1
- 241000180279 Chlorococcum Species 0.000 description 1
- 241001478778 Cladophora Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 239000005749 Copper compound Substances 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 241001035792 Dictyosphaerium Species 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- 241000544050 Egeria Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241001632576 Hyacinthus Species 0.000 description 1
- 241000196173 Hydrodictyon Species 0.000 description 1
- 241000721654 Lepomis macrochirus Species 0.000 description 1
- 229910001209 Low-carbon steel Inorganic materials 0.000 description 1
- 241001244589 Myriophyllum verticillatum Species 0.000 description 1
- 241000546131 Oedogonium Species 0.000 description 1
- 241000199919 Phaeophyceae Species 0.000 description 1
- 241000206572 Rhodophyta Species 0.000 description 1
- 241000196294 Spirogyra Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- DPRMFUAMSRXGDE-UHFFFAOYSA-N ac1o530g Chemical compound NCCN.NCCN DPRMFUAMSRXGDE-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000005263 alkylenediamine group Chemical group 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-M chlorate Inorganic materials [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 238000013270 controlled release Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- VCTISDHTSRYNQM-UHFFFAOYSA-N copper 2-[bis(2-hydroxyethyl)amino]ethanolate Chemical compound [Cu++].OCCN(CCO)CC[O-].OCCN(CCO)CC[O-] VCTISDHTSRYNQM-UHFFFAOYSA-N 0.000 description 1
- 150000004699 copper complex Chemical class 0.000 description 1
- 150000001880 copper compounds Chemical class 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- GPNKJBLELXHFFQ-UHFFFAOYSA-L copper;ethane-1,2-diamine;sulfate Chemical compound [Cu+2].NCCN.NCCN.[O-]S([O-])(=O)=O GPNKJBLELXHFFQ-UHFFFAOYSA-L 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 229960004643 cupric oxide Drugs 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical class [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 238000009533 lab test Methods 0.000 description 1
- GKQPCPXONLDCMU-CCEZHUSRSA-N lacidipine Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C1=CC=CC=C1\C=C\C(=O)OC(C)(C)C GKQPCPXONLDCMU-CCEZHUSRSA-N 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- WJKIGWPCVFLGAT-UHFFFAOYSA-N pyridine;dihydrobromide Chemical compound [Br-].[Br-].C1=CC=[NH+]C=C1.C1=CC=[NH+]C=C1 WJKIGWPCVFLGAT-UHFFFAOYSA-N 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 230000009182 swimming Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
Landscapes
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US44349374A | 1974-02-19 | 1974-02-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2506431A1 true DE2506431A1 (de) | 1975-09-18 |
Family
ID=23761000
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752506431 Withdrawn DE2506431A1 (de) | 1974-02-19 | 1975-02-15 | Algizide und wasserherbizide |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS50117921A (OSRAM) |
| BR (1) | BR7500983A (OSRAM) |
| CH (1) | CH604509A5 (OSRAM) |
| DE (1) | DE2506431A1 (OSRAM) |
| FR (1) | FR2260950B1 (OSRAM) |
| GB (1) | GB1491137A (OSRAM) |
| HU (2) | HU176873B (OSRAM) |
| IN (1) | IN144623B (OSRAM) |
| IT (1) | IT1054605B (OSRAM) |
| KE (1) | KE3119A (OSRAM) |
| MX (1) | MX3820E (OSRAM) |
| NZ (1) | NZ176684A (OSRAM) |
| SU (1) | SU559614A3 (OSRAM) |
| TR (1) | TR19082A (OSRAM) |
| YU (1) | YU38475A (OSRAM) |
| ZA (1) | ZA751041B (OSRAM) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4098602A (en) * | 1976-06-28 | 1978-07-04 | Applied Biochemists, Inc. | Algaecidal composition |
| US4324578A (en) * | 1977-09-15 | 1982-04-13 | Applied Biochemists, Inc. | Method of preparing a copper complex for use as an algaecide |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE459164B (sv) * | 1981-05-08 | 1989-06-12 | Kenogard Ab | Traeskyddsmedel baserade paa konserverande metaller och organiska kvaeveinnehaallande foereningar samt anvaendning av medlet |
| US5426121A (en) * | 1994-10-04 | 1995-06-20 | Akzo Nobel N.V. | Wood preservation formulation comprising complex of a copper cation and alkoxylated diamine |
| ES2248511T3 (es) * | 2002-03-08 | 2006-03-16 | Bms Micro-Nutrients N.V. | Formulacion fitosanitaria que contiene un quelato de cobre-poliamina. |
-
1975
- 1975-02-07 CH CH154675A patent/CH604509A5/xx not_active IP Right Cessation
- 1975-02-15 DE DE19752506431 patent/DE2506431A1/de not_active Withdrawn
- 1975-02-17 NZ NZ17668475A patent/NZ176684A/xx unknown
- 1975-02-17 GB GB656775A patent/GB1491137A/en not_active Expired
- 1975-02-17 FR FR7504884A patent/FR2260950B1/fr not_active Expired
- 1975-02-17 MX MX465675U patent/MX3820E/es unknown
- 1975-02-18 TR TR1908275A patent/TR19082A/xx unknown
- 1975-02-18 IT IT2037875A patent/IT1054605B/it active
- 1975-02-18 HU HUSA003049 patent/HU176873B/hu unknown
- 1975-02-18 SU SU2110614A patent/SU559614A3/ru active
- 1975-02-18 JP JP50020812A patent/JPS50117921A/ja active Pending
- 1975-02-18 BR BR7500983A patent/BR7500983A/pt unknown
- 1975-02-18 HU HU75SA00002750A patent/HU170893B/hu unknown
- 1975-02-18 YU YU38475A patent/YU38475A/xx unknown
- 1975-02-19 ZA ZA00751041A patent/ZA751041B/xx unknown
-
1976
- 1976-02-16 IN IN277/CAL/1976A patent/IN144623B/en unknown
-
1981
- 1981-02-26 KE KE311981A patent/KE3119A/xx unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4098602A (en) * | 1976-06-28 | 1978-07-04 | Applied Biochemists, Inc. | Algaecidal composition |
| US4324578A (en) * | 1977-09-15 | 1982-04-13 | Applied Biochemists, Inc. | Method of preparing a copper complex for use as an algaecide |
Also Published As
| Publication number | Publication date |
|---|---|
| NZ176684A (en) | 1978-03-06 |
| HU170893B (hu) | 1977-09-28 |
| TR19082A (tr) | 1978-05-01 |
| JPS50117921A (OSRAM) | 1975-09-16 |
| ZA751041B (en) | 1976-09-29 |
| SU559614A3 (ru) | 1977-05-25 |
| GB1491137A (en) | 1977-11-09 |
| MX3820E (es) | 1981-07-30 |
| HU176873B (en) | 1981-05-28 |
| BR7500983A (pt) | 1975-12-02 |
| IN144623B (OSRAM) | 1978-05-20 |
| KE3119A (en) | 1981-04-10 |
| CH604509A5 (OSRAM) | 1978-09-15 |
| FR2260950B1 (OSRAM) | 1979-01-05 |
| IT1054605B (it) | 1981-11-30 |
| AU7827375A (en) | 1976-08-19 |
| YU38475A (en) | 1982-02-28 |
| FR2260950A1 (OSRAM) | 1975-09-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69022441T2 (de) | Polymere quaternäre Ammoniumtrihalogenide, nützlich als Mikrobizide, Sterilisations- und Desinfektionsmittel. | |
| DE69322363T2 (de) | Synergistische antimikrobielle Kombination von Polyether Phosphanaten und nicht-oxidierenden Bioziden | |
| DE2522249A1 (de) | Verfahren zur behandlung unerwuenschter organismen mit metallen und dafuer geeignete zubereitungen | |
| DE2461613C2 (de) | Fungicides Mittel | |
| DE2309747A1 (de) | Verbindungen und verfahren zur behandlung von wasser | |
| DE2002764A1 (de) | Thiadiazolharnstoffderivate | |
| DE2944296C2 (de) | Bekämpfung von pflanzlichen Viruserkrankungen | |
| DE69005464T2 (de) | Biozide Mittel und Behandlungsverfahren. | |
| DE1033655B (de) | Verfahren zur Herstellung von Bisbiguaniden | |
| DE2608135A1 (de) | Pesticide und ihre verwendung | |
| DE2506431A1 (de) | Algizide und wasserherbizide | |
| DE2445741A1 (de) | Antichlorose-zusammensetzungen fuer pflanzen | |
| DE2555730A1 (de) | 8-oxychinolinat-metall-n,n-dimethyldithiocarbamat-komplexe sowie solche enthaltende antimikrobielle mittel und verfahren zur herstellung derselben | |
| EP0017611B1 (de) | Verfahren zum Bekämpfen von Schadorganismen und Mittel für diese Bekämpfung | |
| EP0108039B1 (de) | Neue Ammonium-Stannate-(IV) | |
| CH604513A5 (en) | Herbicide for controlling aquatic weeds | |
| DE1542868A1 (de) | Verfahren zur Herstellung substituierter Benzimidazole | |
| DE2447547C2 (de) | Antibakterielles Mittel | |
| CH646429A5 (de) | 4-halogen-oxetan-2-one und verfahren zu deren herstellung. | |
| DE2443890A1 (de) | Bekaempfung von algen und wasserunkraeutern | |
| DE1542859A1 (de) | Vielseitig verwendbares Pflanzenschutzmittel,insbesondere zur Behandlung von Bananenbaeumen und Verfahren zu seiner Herstellung | |
| DE2263596A1 (de) | Mikrobicid wirksames gemisch | |
| DE1098281B (de) | Fungicides Mittel | |
| DE2117431B2 (de) | Propiolsaeureester und ihre verwendung als mikrobizide | |
| DE2814453A1 (de) | Carbamoyloxyphenyl-verbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8126 | Change of the secondary classification |
Ipc: A01N 59/20 |
|
| 8141 | Disposal/no request for examination | ||
| 8110 | Request for examination paragraph 44 | ||
| 8125 | Change of the main classification |
Ipc: A01N 33/04 |
|
| 8126 | Change of the secondary classification |
Ipc: A01N 59/20 |
|
| 8139 | Disposal/non-payment of the annual fee |