DE2503187C3 - Verfahren zur Herstellung durch Chlor meta-substituierte Aniline - Google Patents
Verfahren zur Herstellung durch Chlor meta-substituierte AnilineInfo
- Publication number
- DE2503187C3 DE2503187C3 DE2503187A DE2503187A DE2503187C3 DE 2503187 C3 DE2503187 C3 DE 2503187C3 DE 2503187 A DE2503187 A DE 2503187A DE 2503187 A DE2503187 A DE 2503187A DE 2503187 C3 DE2503187 C3 DE 2503187C3
- Authority
- DE
- Germany
- Prior art keywords
- aniline
- chlorine
- dichloro
- reaction
- catalyst
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 35
- 238000002360 preparation method Methods 0.000 title claims description 9
- -1 chlorine-meta-substituted anilines Chemical class 0.000 title description 21
- 239000000460 chlorine Substances 0.000 claims description 28
- 229910052801 chlorine Inorganic materials 0.000 claims description 24
- KUDPGZONDFORKU-UHFFFAOYSA-N n-chloroaniline Chemical compound ClNC1=CC=CC=C1 KUDPGZONDFORKU-UHFFFAOYSA-N 0.000 claims description 9
- 150000001448 anilines Chemical class 0.000 claims description 8
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- 239000001257 hydrogen Substances 0.000 description 27
- 229910052739 hydrogen Inorganic materials 0.000 description 27
- 239000003054 catalyst Substances 0.000 description 26
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 25
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 21
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 19
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 19
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 16
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 16
- 150000003254 radicals Chemical class 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- UQRLKWGPEVNVHT-UHFFFAOYSA-N 3,5-dichloroaniline Chemical class NC1=CC(Cl)=CC(Cl)=C1 UQRLKWGPEVNVHT-UHFFFAOYSA-N 0.000 description 14
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- 239000002253 acid Substances 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 229910000510 noble metal Inorganic materials 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 238000006298 dechlorination reaction Methods 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 8
- 229910052763 palladium Inorganic materials 0.000 description 8
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical class NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 7
- 125000003118 aryl group Chemical group 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 125000003545 alkoxy group Chemical group 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 125000003710 aryl alkyl group Chemical group 0.000 description 6
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 125000000547 substituted alkyl group Chemical group 0.000 description 5
- KHCZSJXTDDHLGJ-UHFFFAOYSA-N 2,3,4,5,6-pentachloroaniline Chemical compound NC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl KHCZSJXTDDHLGJ-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 238000004508 fractional distillation Methods 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- AVYGCQXNNJPXSS-UHFFFAOYSA-N 2,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC=C1Cl AVYGCQXNNJPXSS-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 150000001555 benzenes Chemical class 0.000 description 3
- 239000012876 carrier material Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 239000003586 protic polar solvent Substances 0.000 description 3
- 229910052715 tantalum Inorganic materials 0.000 description 3
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- 238000005695 dehalogenation reaction Methods 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- RNABGKOKSBUFHW-UHFFFAOYSA-N 1,3-dichloro-5-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC(Cl)=C1 RNABGKOKSBUFHW-UHFFFAOYSA-N 0.000 description 1
- GBKZRUCVLTWAML-UHFFFAOYSA-N 2,3,4,5-tetrachloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C(Cl)=C1Cl GBKZRUCVLTWAML-UHFFFAOYSA-N 0.000 description 1
- AMKZKITUPXRCRX-UHFFFAOYSA-N 2,3,4,6-tetrachloro-5-phenoxyaniline Chemical compound NC1=C(Cl)C(Cl)=C(Cl)C(OC=2C=CC=CC=2)=C1Cl AMKZKITUPXRCRX-UHFFFAOYSA-N 0.000 description 1
- WUIMAOZZLPNIMF-UHFFFAOYSA-N 2,3,4-trichloro-5-methoxyaniline Chemical compound COC1=CC(N)=C(Cl)C(Cl)=C1Cl WUIMAOZZLPNIMF-UHFFFAOYSA-N 0.000 description 1
- FBHJFDRYHRDILH-UHFFFAOYSA-N 2,3,4-trichloro-6-methylaniline Chemical compound CC1=CC(Cl)=C(Cl)C(Cl)=C1N FBHJFDRYHRDILH-UHFFFAOYSA-N 0.000 description 1
- AMROFTJFMUYVTB-UHFFFAOYSA-N 2,3,5,6-tetrachloro-4-methylaniline Chemical compound CC1=C(Cl)C(Cl)=C(N)C(Cl)=C1Cl AMROFTJFMUYVTB-UHFFFAOYSA-N 0.000 description 1
- YTDHEFNWWHSXSU-UHFFFAOYSA-N 2,3,5,6-tetrachloroaniline Chemical compound NC1=C(Cl)C(Cl)=CC(Cl)=C1Cl YTDHEFNWWHSXSU-UHFFFAOYSA-N 0.000 description 1
- ZJMMPUVJZQBMEM-UHFFFAOYSA-N 2,3,6-trichloroaniline Chemical compound NC1=C(Cl)C=CC(Cl)=C1Cl ZJMMPUVJZQBMEM-UHFFFAOYSA-N 0.000 description 1
- NGQZFSHSIJZJNX-UHFFFAOYSA-N 2,3-dichloro-6-methoxyaniline Chemical compound COC1=CC=C(Cl)C(Cl)=C1N NGQZFSHSIJZJNX-UHFFFAOYSA-N 0.000 description 1
- BRPSAOUFIJSKOT-UHFFFAOYSA-N 2,3-dichloroaniline Chemical compound NC1=CC=CC(Cl)=C1Cl BRPSAOUFIJSKOT-UHFFFAOYSA-N 0.000 description 1
- JHZWCHORDSEJQD-UHFFFAOYSA-N 2,5-dichloro-3-methoxyaniline Chemical compound COC1=CC(Cl)=CC(N)=C1Cl JHZWCHORDSEJQD-UHFFFAOYSA-N 0.000 description 1
- VCMXIPGKIUDONN-UHFFFAOYSA-N 2,5-dichloro-4-methoxyaniline Chemical compound COC1=CC(Cl)=C(N)C=C1Cl VCMXIPGKIUDONN-UHFFFAOYSA-N 0.000 description 1
- QXDILMJTDWNTAV-UHFFFAOYSA-N 2,5-dichloro-4-phenoxyaniline Chemical compound C1=C(Cl)C(N)=CC(Cl)=C1OC1=CC=CC=C1 QXDILMJTDWNTAV-UHFFFAOYSA-N 0.000 description 1
- YCJWTHYCBOTYAL-UHFFFAOYSA-N 2,5-dichloro-4-propylaniline Chemical compound CCCC1=CC(Cl)=C(N)C=C1Cl YCJWTHYCBOTYAL-UHFFFAOYSA-N 0.000 description 1
- SBXPKMDRNSXSJZ-UHFFFAOYSA-N 2-benzyl-3,4,6-trichloroaniline Chemical compound NC1=C(Cl)C=C(Cl)C(Cl)=C1CC1=CC=CC=C1 SBXPKMDRNSXSJZ-UHFFFAOYSA-N 0.000 description 1
- XOGYQVITULCUGU-UHFFFAOYSA-N 3,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C(Cl)=C1 XOGYQVITULCUGU-UHFFFAOYSA-N 0.000 description 1
- FBKQCRAVAOUMHN-UHFFFAOYSA-N 3,4,6-trichloro-2-methoxyaniline Chemical compound COC1=C(N)C(Cl)=CC(Cl)=C1Cl FBKQCRAVAOUMHN-UHFFFAOYSA-N 0.000 description 1
- RLTUJGIRWIFRLO-UHFFFAOYSA-N 3,4-dichloro-5-methoxyaniline Chemical compound COC1=CC(N)=CC(Cl)=C1Cl RLTUJGIRWIFRLO-UHFFFAOYSA-N 0.000 description 1
- GNFMBCBDTFAEHM-UHFFFAOYSA-N 3,5-dichloro-4-methoxyaniline Chemical compound COC1=C(Cl)C=C(N)C=C1Cl GNFMBCBDTFAEHM-UHFFFAOYSA-N 0.000 description 1
- GTEUMCIATAHZFK-UHFFFAOYSA-N 3,5-dichloro-4-methylaniline Chemical compound CC1=C(Cl)C=C(N)C=C1Cl GTEUMCIATAHZFK-UHFFFAOYSA-N 0.000 description 1
- KFAAKHZTICEVTO-UHFFFAOYSA-N 3,5-dichloro-4-phenoxyaniline Chemical compound ClC1=CC(N)=CC(Cl)=C1OC1=CC=CC=C1 KFAAKHZTICEVTO-UHFFFAOYSA-N 0.000 description 1
- DSTYKCDGDXOVOZ-UHFFFAOYSA-N 3,6-dichloro-2-methoxyaniline Chemical compound COC1=C(N)C(Cl)=CC=C1Cl DSTYKCDGDXOVOZ-UHFFFAOYSA-N 0.000 description 1
- VPZJHTWLWKFPQW-UHFFFAOYSA-N 3-chloro-2-methoxyaniline Chemical compound COC1=C(N)C=CC=C1Cl VPZJHTWLWKFPQW-UHFFFAOYSA-N 0.000 description 1
- LVFXXXPXOSABGF-UHFFFAOYSA-N 3-chloro-2-phenoxyaniline Chemical compound NC1=CC=CC(Cl)=C1OC1=CC=CC=C1 LVFXXXPXOSABGF-UHFFFAOYSA-N 0.000 description 1
- LBGGMEGRRIBANG-UHFFFAOYSA-N 3-chloro-4-ethylaniline Chemical compound CCC1=CC=C(N)C=C1Cl LBGGMEGRRIBANG-UHFFFAOYSA-N 0.000 description 1
- XQVCBOLNTSUFGD-UHFFFAOYSA-N 3-chloro-4-methoxyaniline Chemical compound COC1=CC=C(N)C=C1Cl XQVCBOLNTSUFGD-UHFFFAOYSA-N 0.000 description 1
- XLAVBRTYEPFKSD-UHFFFAOYSA-N 3-chloro-5-methoxyaniline Chemical compound COC1=CC(N)=CC(Cl)=C1 XLAVBRTYEPFKSD-UHFFFAOYSA-N 0.000 description 1
- XUZCJDBXXYJXDD-UHFFFAOYSA-N 3-chloro-5-methylaniline Chemical compound CC1=CC(N)=CC(Cl)=C1 XUZCJDBXXYJXDD-UHFFFAOYSA-N 0.000 description 1
- RQKFYFNZSHWXAW-UHFFFAOYSA-N 3-chloro-p-toluidine Chemical compound CC1=CC=C(N)C=C1Cl RQKFYFNZSHWXAW-UHFFFAOYSA-N 0.000 description 1
- PDOWROQDIXWGIV-UHFFFAOYSA-N 4,5-dichloro-2-phenoxyaniline Chemical compound NC1=CC(Cl)=C(Cl)C=C1OC1=CC=CC=C1 PDOWROQDIXWGIV-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- WBSMIPLNPSCJFS-UHFFFAOYSA-N 5-chloro-2-methoxyaniline Chemical compound COC1=CC=C(Cl)C=C1N WBSMIPLNPSCJFS-UHFFFAOYSA-N 0.000 description 1
- SXEBHIMOUHBBOS-UHFFFAOYSA-N 5-chloro-2-phenoxyaniline Chemical compound NC1=CC(Cl)=CC=C1OC1=CC=CC=C1 SXEBHIMOUHBBOS-UHFFFAOYSA-N 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- ZHZZWIQPCAMTIM-UHFFFAOYSA-N [C]1=CC=CC2=CC=CC=C12 Chemical compound [C]1=CC=CC2=CC=CC=C12 ZHZZWIQPCAMTIM-UHFFFAOYSA-N 0.000 description 1
- YFGRSOGKVQIGKG-UHFFFAOYSA-N [Cl].NC1=CC=CC=C1 Chemical class [Cl].NC1=CC=CC=C1 YFGRSOGKVQIGKG-UHFFFAOYSA-N 0.000 description 1
- ZDVDCDLBOLSVGM-UHFFFAOYSA-N [chloro(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(Cl)C1=CC=CC=C1 ZDVDCDLBOLSVGM-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- AVMNFQHJOOYCAP-UHFFFAOYSA-N acetic acid;propanoic acid Chemical compound CC(O)=O.CCC(O)=O AVMNFQHJOOYCAP-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- NQOJWOIPQBVKKX-UHFFFAOYSA-N cyclooctane Chemical compound [CH]1CCCCCCC1 NQOJWOIPQBVKKX-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001887 cyclopentyloxy group Chemical group C1(CCCC1)O* 0.000 description 1
- JHAYEQICABJSTP-UHFFFAOYSA-N decoquinate Chemical group N1C=C(C(=O)OCC)C(=O)C2=C1C=C(OCC)C(OCCCCCCCCCC)=C2 JHAYEQICABJSTP-UHFFFAOYSA-N 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- BIXZHMJUSMUDOQ-UHFFFAOYSA-N dichloran Chemical compound NC1=C(Cl)C=C([N+]([O-])=O)C=C1Cl BIXZHMJUSMUDOQ-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical compound O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 229940035339 tri-chlor Drugs 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/68—Preparation of compounds containing amino groups bound to a carbon skeleton from amines, by reactions not involving amino groups, e.g. reduction of unsaturated amines, aromatisation, or substitution of the carbon skeleton
- C07C209/74—Preparation of compounds containing amino groups bound to a carbon skeleton from amines, by reactions not involving amino groups, e.g. reduction of unsaturated amines, aromatisation, or substitution of the carbon skeleton by halogenation, hydrohalogenation, dehalogenation, or dehydrohalogenation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2503187A DE2503187C3 (de) | 1975-01-27 | 1975-01-27 | Verfahren zur Herstellung durch Chlor meta-substituierte Aniline |
| US05/647,967 US4085141A (en) | 1975-01-27 | 1976-01-09 | Process for the preparation of anilines meta-substituted by chlorine |
| JP51006384A JPS5848540B2 (ja) | 1975-01-27 | 1976-01-24 | 塩素でメタ置換されたアニリンの製造方法 |
| GB284976A GB1477988A (en) | 1975-01-27 | 1976-01-26 | Process for the preparation of anilines meta-substituted by chlorine |
| NL7600773A NL7600773A (nl) | 1975-01-27 | 1976-01-26 | Werkwijze voor het bereiden van door chloor meta- -gesubstitueerde anilinen. |
| FR7602150A FR2298531A1 (fr) | 1975-01-27 | 1976-01-27 | Procede de preparation d'anilines substituees par le chlore en position meta |
| BE2054777A BE837923A (fr) | 1975-01-27 | 1976-01-27 | Procede de preparation d'anilines substituees par le chlore en position meta |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2503187A DE2503187C3 (de) | 1975-01-27 | 1975-01-27 | Verfahren zur Herstellung durch Chlor meta-substituierte Aniline |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2503187A1 DE2503187A1 (de) | 1976-07-29 |
| DE2503187B2 DE2503187B2 (de) | 1978-10-05 |
| DE2503187C3 true DE2503187C3 (de) | 1979-05-31 |
Family
ID=5937382
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2503187A Expired DE2503187C3 (de) | 1975-01-27 | 1975-01-27 | Verfahren zur Herstellung durch Chlor meta-substituierte Aniline |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4085141A (en:Method) |
| JP (1) | JPS5848540B2 (en:Method) |
| BE (1) | BE837923A (en:Method) |
| DE (1) | DE2503187C3 (en:Method) |
| FR (1) | FR2298531A1 (en:Method) |
| GB (1) | GB1477988A (en:Method) |
| NL (1) | NL7600773A (en:Method) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH609959A5 (en:Method) * | 1976-12-17 | 1979-03-30 | Basf Ag | |
| FR2403990A1 (fr) * | 1977-09-22 | 1979-04-20 | Philagro Sa | Procede de deshalogenation d'amines aromatiques halogenees |
| FR2403991A1 (fr) * | 1977-09-22 | 1979-04-20 | Philagro Sa | Procede de deshalogenation d'amines aromatiques halogenees |
| DE2758111A1 (de) * | 1977-12-24 | 1979-07-05 | Basf Ag | Verfahren zur herstellung von halogenanilinen |
| FR2449077A2 (fr) * | 1979-02-15 | 1980-09-12 | Rhone Poulenc Agrochimie | Procede de preparation d'anilines metachlorees |
| FR2449075A1 (fr) * | 1979-02-15 | 1980-09-12 | Rhone Poulenc Agrochimie | Procede de preparation d'anilines metachlorees |
| FR2449076A2 (fr) * | 1979-02-15 | 1980-09-12 | Rhone Poulenc Agrochimie | Procede de preparation d'anilines metachlorees |
| US4282380A (en) * | 1979-07-05 | 1981-08-04 | American Cyanamid Company | Reductive alkylation and dehalogenation of m-nitrobenzyl halides |
| DE3017542A1 (de) * | 1980-05-08 | 1981-11-12 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 2-trifluormethylanilin |
| IL63297A (en) * | 1980-08-01 | 1984-05-31 | Rhone Poulenc Agrochimie | Selective preparation of meta-chloroanilines |
| FR2487824A1 (fr) * | 1980-08-01 | 1982-02-05 | Rhone Poulenc Agrochimie | Procede de preparation selective d'anilines metachlorees |
| DE3127026A1 (de) * | 1981-07-09 | 1983-01-20 | Bayer Ag, 5090 Leverkusen | Verrfahren zur herstellung von m-chlorsubstituiertenanilinen |
| FR2521132A1 (fr) * | 1982-02-05 | 1983-08-12 | Rhone Poulenc Agrochimie | Procede de preparation de metahalogeno-anilines |
| FR2532305A1 (fr) * | 1982-08-24 | 1984-03-02 | Rhone Poulenc Agrochimie | Procede de preparation d'anilines metachlorees |
| JPS59172441A (ja) * | 1983-03-23 | 1984-09-29 | Mitsui Toatsu Chem Inc | 3,3′−または3,4′−ジアミノベンゾフエノンの製造方法 |
| JPH0565250A (ja) * | 1991-01-28 | 1993-03-19 | Ishihara Sangyo Kaisha Ltd | 3,5−ジフルオロアニリンの製造方法 |
| US5089653A (en) * | 1991-04-04 | 1992-02-18 | Dow Elanco | Process for the selective reduction of the 4-halogen in 2,4-dihaloanilines |
| JPH0535677U (ja) * | 1991-05-14 | 1993-05-14 | バンドー化学株式会社 | ゴム製袋体の口金取付構造 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE792080A (fr) * | 1971-11-30 | 1973-05-29 | Rhone Progil | Procede de deshalogenation de composes aromatiques polyhalogenes |
| US3912783A (en) * | 1972-12-05 | 1975-10-14 | Bayer Ag | Process and catalyst for preparing of 3-halogen-and 3,5-dihalogen-phenols |
| GB1458633A (en) * | 1974-09-17 | 1976-12-15 | Ici Ltd | Process for dehalogenating aromatic compounds |
-
1975
- 1975-01-27 DE DE2503187A patent/DE2503187C3/de not_active Expired
-
1976
- 1976-01-09 US US05/647,967 patent/US4085141A/en not_active Expired - Lifetime
- 1976-01-24 JP JP51006384A patent/JPS5848540B2/ja not_active Expired
- 1976-01-26 NL NL7600773A patent/NL7600773A/xx not_active Application Discontinuation
- 1976-01-26 GB GB284976A patent/GB1477988A/en not_active Expired
- 1976-01-27 BE BE2054777A patent/BE837923A/xx not_active IP Right Cessation
- 1976-01-27 FR FR7602150A patent/FR2298531A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5848540B2 (ja) | 1983-10-28 |
| FR2298531A1 (fr) | 1976-08-20 |
| FR2298531B1 (en:Method) | 1979-05-18 |
| DE2503187A1 (de) | 1976-07-29 |
| JPS51125328A (en) | 1976-11-01 |
| BE837923A (fr) | 1976-07-27 |
| GB1477988A (en) | 1977-06-29 |
| DE2503187B2 (de) | 1978-10-05 |
| US4085141A (en) | 1978-04-18 |
| NL7600773A (nl) | 1976-07-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2503187C3 (de) | Verfahren zur Herstellung durch Chlor meta-substituierte Aniline | |
| EP0784049A1 (de) | Verfahren zur Herstellung von gegebenenfalls substituierten 4-Aminodiphenylaminen | |
| DE2502893C2 (de) | Cycloaliphatische Amine | |
| EP0385210B1 (de) | Amidierung von Pyridinen | |
| EP0347796B1 (de) | Verfahren zur Herstellung von 4-Chlor-2,5-dimethoxyanilin | |
| DE2447824A1 (de) | Herstellung von c tief 1 -c tief 7 aliphatischen hydrocarbylestern von n- eckige klammer auf 2,6-di(c tief 1 -c tief 7 -alkyl)phenyl eckige klammer zu alpha-aminocarbonsaeuren | |
| DE3104310A1 (de) | Verfahren zur herstellung von 5-chlor-2-nitroanilin | |
| EP0173202B1 (de) | Verfahren zur Herstellung von Chlor-o-nitroanilinen | |
| EP0479877B1 (de) | Verfahren zur herstellung von n-alkyl-halogenanilinen | |
| EP0051782B1 (de) | Verfahren zur Herstellung von m-halogensubstituierten Anilinen | |
| EP0369420B1 (de) | Verfahren zur Herstellung von 4,4'-Dinitrodiphenylamin | |
| DE3445644A1 (de) | Neue diaminoalkyldiphenylether, ein verfahren zu ihrer herstellung sowie deren verwendung | |
| EP0069907B1 (de) | Verfahren zur Herstellung von m-chlorsubstituierten Anilinen | |
| DE2810666B2 (de) | Verfahren zur Herstellung von p-Amino-diphenylamin | |
| DE3879351T2 (de) | Verfahren zur herstellung von bis(4-amino-phenyl)hexafluoropropan. | |
| EP0396134A1 (de) | Verfahren zur Herstellung von 5H-Dibenz (b,f) azepin | |
| DE2503145A1 (de) | Verfahren zur herstellung von 3- chlor- bzw. 3,5-dichloranilinen | |
| DE2804263A1 (de) | Verfahren zur herstellung von indolin-derivaten | |
| EP0513640B1 (de) | Verfahren zur Herstellung von Dicyclohexylaminen | |
| CH622240A5 (en) | Process for the preparation of 1,5- and/or 1,8-diaminonaphthalene | |
| DD210254A5 (de) | Verfahren zur herstellung m-chlorsubstituierter aniline | |
| DE1720884C3 (de) | Verfahren zur Herstellung stickstoffhaltiger Polykondensate | |
| DE333157C (de) | Verfahren zur Darstellung von Reduktionserzeugnissen der Nitrotetrahydronaphthaline | |
| DE3342462A1 (de) | Verfahren zur herstellung von 4,4'-diaminobenzophenonen | |
| DE2100057A1 (de) | Verfahren zur Herstellung von 1,3,4 Thiadiazol 2 yl harnstoffverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |