DE2460937C2 - Flammhemmende aromatische Polycarbonatzusammensetzung - Google Patents
Flammhemmende aromatische PolycarbonatzusammensetzungInfo
- Publication number
- DE2460937C2 DE2460937C2 DE2460937A DE2460937A DE2460937C2 DE 2460937 C2 DE2460937 C2 DE 2460937C2 DE 2460937 A DE2460937 A DE 2460937A DE 2460937 A DE2460937 A DE 2460937A DE 2460937 C2 DE2460937 C2 DE 2460937C2
- Authority
- DE
- Germany
- Prior art keywords
- udf54
- udf53
- electron
- oxygen
- nitrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000515 polycarbonate Polymers 0.000 title claims description 30
- 239000004417 polycarbonate Substances 0.000 title claims description 30
- 239000003063 flame retardant Substances 0.000 title claims description 27
- 239000000203 mixture Substances 0.000 title claims description 26
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 24
- 150000003839 salts Chemical class 0.000 claims description 19
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 16
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 14
- 125000003118 aryl group Chemical group 0.000 claims description 14
- 150000002391 heterocyclic compounds Chemical class 0.000 claims description 13
- 150000003460 sulfonic acids Chemical class 0.000 claims description 13
- -1 alkaline earth metal salt Chemical class 0.000 claims description 12
- 229910052751 metal Inorganic materials 0.000 claims description 12
- 239000002184 metal Substances 0.000 claims description 12
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- 239000003513 alkali Substances 0.000 claims description 6
- 125000005842 heteroatom Chemical group 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 4
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 3
- 101150019923 GLYR1 gene Proteins 0.000 claims description 3
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 125000004953 trihalomethyl group Chemical group 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 150000004395 organic heterocyclic compounds Chemical class 0.000 claims description 2
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 claims description 2
- 239000005864 Sulphur Substances 0.000 claims 1
- POGORCRGBUMDAW-UHFFFAOYSA-N [Cu].[Na].[Na].[Na].[Na] Chemical compound [Cu].[Na].[Na].[Na].[Na] POGORCRGBUMDAW-UHFFFAOYSA-N 0.000 claims 1
- OECOWKIDRFHHET-UHFFFAOYSA-L calcium;2,5-dichlorothiophene-3-sulfonate Chemical compound [Ca+2].[O-]S(=O)(=O)C=1C=C(Cl)SC=1Cl.[O-]S(=O)(=O)C=1C=C(Cl)SC=1Cl OECOWKIDRFHHET-UHFFFAOYSA-L 0.000 claims 1
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical compound N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 claims 1
- BJARKKWOYBVMCZ-UHFFFAOYSA-M sodium;2,5-dichlorothiophene-3-sulfonate Chemical compound [Na+].[O-]S(=O)(=O)C=1C=C(Cl)SC=1Cl BJARKKWOYBVMCZ-UHFFFAOYSA-M 0.000 claims 1
- OFIWWJGNQPISSB-UHFFFAOYSA-M sodium;2,6-dichloropyridine-3-sulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC=C(Cl)N=C1Cl OFIWWJGNQPISSB-UHFFFAOYSA-M 0.000 claims 1
- 239000000654 additive Substances 0.000 description 35
- 230000000996 additive effect Effects 0.000 description 16
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 9
- 230000000052 comparative effect Effects 0.000 description 8
- 150000003254 radicals Chemical class 0.000 description 8
- 230000000694 effects Effects 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 230000006866 deterioration Effects 0.000 description 4
- 239000002243 precursor Substances 0.000 description 4
- DEIGXXQKDWULML-UHFFFAOYSA-N 1,2,5,6,9,10-hexabromocyclododecane Chemical compound BrC1CCC(Br)C(Br)CCC(Br)C(Br)CCC1Br DEIGXXQKDWULML-UHFFFAOYSA-N 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- 239000000370 acceptor Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 238000010998 test method Methods 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 229910052701 rubidium Inorganic materials 0.000 description 2
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052712 strontium Inorganic materials 0.000 description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- UMQSLMSNBMTPJY-UHFFFAOYSA-N 2,5-dichlorothiophene-3-sulfonic acid Chemical compound OS(=O)(=O)C=1C=C(Cl)SC=1Cl UMQSLMSNBMTPJY-UHFFFAOYSA-N 0.000 description 1
- YMTYZTXUZLQUSF-UHFFFAOYSA-N 3,3'-Dimethylbisphenol A Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=CC=2)=C1 YMTYZTXUZLQUSF-UHFFFAOYSA-N 0.000 description 1
- AJVLKCJOICYVQS-UHFFFAOYSA-N 3,4,5-trifluorothiophene-2-sulfonic acid Chemical compound OS(=O)(=O)C=1SC(F)=C(F)C=1F AJVLKCJOICYVQS-UHFFFAOYSA-N 0.000 description 1
- MLDIQALUMKMHCC-UHFFFAOYSA-N 4,4-Bis(4-hydroxyphenyl)heptane Chemical compound C=1C=C(O)C=CC=1C(CCC)(CCC)C1=CC=C(O)C=C1 MLDIQALUMKMHCC-UHFFFAOYSA-N 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- COOXDTKNHGEXPW-UHFFFAOYSA-L ClC1=C(C2=C(C=3C(N2)=C(C(=C(C=3S(=O)(=O)[O-])S(=O)(=O)[O-])Cl)Cl)C=C1)Cl.[K+].[K+] Chemical compound ClC1=C(C2=C(C=3C(N2)=C(C(=C(C=3S(=O)(=O)[O-])S(=O)(=O)[O-])Cl)Cl)C=C1)Cl.[K+].[K+] COOXDTKNHGEXPW-UHFFFAOYSA-L 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 159000000009 barium salts Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 159000000006 cesium salts Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- AILORBDEYWOXPL-UHFFFAOYSA-L disodium pyridine-3,5-disulfonate Chemical compound N1=CC(=CC(=C1)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] AILORBDEYWOXPL-UHFFFAOYSA-L 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- NUSQOFAKCBLANB-UHFFFAOYSA-N phthalocyanine tetrasulfonic acid Chemical compound C12=CC(S(=O)(=O)O)=CC=C2C(N=C2NC(C3=CC=C(C=C32)S(O)(=O)=O)=N2)=NC1=NC([C]1C=CC(=CC1=1)S(O)(=O)=O)=NC=1N=C1[C]3C=CC(S(O)(=O)=O)=CC3=C2N1 NUSQOFAKCBLANB-UHFFFAOYSA-N 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- WFRUBUQWJYMMRQ-UHFFFAOYSA-M potassium;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate Chemical compound [K+].[O-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F WFRUBUQWJYMMRQ-UHFFFAOYSA-M 0.000 description 1
- GLGXXYFYZWQGEL-UHFFFAOYSA-M potassium;trifluoromethanesulfonate Chemical compound [K+].[O-]S(=O)(=O)C(F)(F)F GLGXXYFYZWQGEL-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- PGNWIWKMXVDXHP-UHFFFAOYSA-L zinc;1,3-benzothiazole-2-thiolate Chemical compound [Zn+2].C1=CC=C2SC([S-])=NC2=C1.C1=CC=C2SC([S-])=NC2=C1 PGNWIWKMXVDXHP-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/41—Compounds containing sulfur bound to oxygen
- C08K5/42—Sulfonic acids; Derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Fireproofing Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US429166A US3919167A (en) | 1973-12-28 | 1973-12-28 | Flame retardant polycarbonate composition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2460937A1 DE2460937A1 (de) | 1975-07-03 |
| DE2460937C2 true DE2460937C2 (de) | 1987-04-16 |
Family
ID=23702085
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2460937A Expired DE2460937C2 (de) | 1973-12-28 | 1974-12-21 | Flammhemmende aromatische Polycarbonatzusammensetzung |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3919167A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5728427B2 (cg-RX-API-DMAC10.html) |
| CA (1) | CA1048678A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2460937C2 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2256219B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1496680A (cg-RX-API-DMAC10.html) |
| IT (1) | IT1027816B (cg-RX-API-DMAC10.html) |
| NL (1) | NL174841C (cg-RX-API-DMAC10.html) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4039509A (en) * | 1973-12-28 | 1977-08-02 | General Electric Company | Non-opaque flame retardant polycarbonate composition |
| US4093589A (en) * | 1977-02-03 | 1978-06-06 | General Electric Company | Non-opaque flame retardant polycarbonate composition |
| GB2019422B (en) * | 1978-04-20 | 1982-07-14 | Gen Electric | Flame retardant crystalline polycarbonate compositions |
| US4254015A (en) * | 1979-01-22 | 1981-03-03 | The Dow Chemical Company | Polycarbonate containing an aromatic sulfonamide as an ignition depressant |
| DE2903100A1 (de) * | 1979-01-27 | 1980-07-31 | Gen Electric | Flammhemmende thermoplastische zusammensetzungen |
| US4320049A (en) * | 1980-07-14 | 1982-03-16 | Mobay Chemical Corporation | Flame retarding agents for polycarbonates |
| DE3203905A1 (de) * | 1982-02-05 | 1983-08-11 | Bayer Ag, 5090 Leverkusen | Polycarbonat-formmassen mit verbesserter flammwidrigkeit |
| JPS58190929A (ja) * | 1982-04-30 | 1983-11-08 | Copal Co Ltd | オ−トアイリスにおける絞り切り装置 |
| US4416924A (en) * | 1982-09-23 | 1983-11-22 | Celanese Corporation | Polycarbonate sizing finish and method of application thereof |
| US4464497A (en) * | 1982-12-15 | 1984-08-07 | General Electric Company | Carbon black filled flame retardant polycarbonate compositions |
| US4476275A (en) * | 1983-01-10 | 1984-10-09 | The Standard Oil Company | Metal dodecylbenzenesulfonates as processing aids for polycarbonates |
| DE3322057A1 (de) * | 1983-06-18 | 1984-12-20 | Bayer Ag, 5090 Leverkusen | Neue flammschutzmittel, ihre herstellung und ihre verwendung zur flammfestausruestung in polycarbonat |
| DE3334822A1 (de) * | 1983-09-26 | 1985-04-04 | Bayer Ag, 5090 Leverkusen | Neue flammschutzmittel, ihre herstellung und ihre verwendung zur flammfestausruestung von polycarbonaten |
| US4600742A (en) * | 1984-08-17 | 1986-07-15 | The Lubrizol Corporation | Polycarbonate compositions |
| US4632949A (en) * | 1984-12-31 | 1986-12-30 | Mobay Chemical Corporation | Flame retarding agents for polycarbonates |
| US4578409A (en) * | 1985-01-14 | 1986-03-25 | Mobay Chemical Corporation | Flame retarding silanes |
| US4902737A (en) * | 1986-12-23 | 1990-02-20 | General Electric Company | Resin blends exhibiting improved impact properties |
| US5037889A (en) * | 1986-12-23 | 1991-08-06 | General Electric Company | Resin blends exhibiting improved impact properties |
| US4994510A (en) * | 1990-04-05 | 1991-02-19 | General Electric Company | Poly(carbonate-siloxane) with reduced tendency to burn |
| US5118739A (en) * | 1990-06-20 | 1992-06-02 | Ethyl Corporation | Flame retardant macromolecular materials containing brominated aromatic sulfonic acid salts |
| US5424344A (en) * | 1994-01-05 | 1995-06-13 | E. I. Dupont De Nemours And Company | Flame retardant polyamide compositions |
| US5494997A (en) | 1994-08-01 | 1996-02-27 | General Electric Company | Preparation of by the bischloroformate process of soft segment polycarbonate |
| DE19907831A1 (de) * | 1999-02-24 | 2000-08-31 | Bayer Ag | Flammwidrige thermoplastische Formmasse |
| US6995212B2 (en) | 2003-08-08 | 2006-02-07 | Bayer Materialscience Llc | Flame retardant, thermoplastic polycarbonate molding compositions |
| KR100904055B1 (ko) * | 2004-12-21 | 2009-06-23 | 미쓰이 가가쿠 가부시키가이샤 | 변성 페놀 수지, 그것을 포함하는 에폭시 수지 조성물 및이것을 사용한 프리프레그 |
| KR20120089680A (ko) | 2009-10-19 | 2012-08-13 | 테이진 카세이 가부시키가이샤 | 방향족 폴리카보네이트 수지 조성물 |
| EP2497800A4 (en) | 2009-11-05 | 2013-09-04 | Teijin Chemicals Ltd | EXTRUSION-CREATED ARTICLES WITH AN AROMATIC POLYCARBONATE RESIN COMPOSITION |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3535300A (en) * | 1967-10-12 | 1970-10-20 | Mobay Chemical Corp | Flame resistant polycarbonates |
| AT297333B (de) * | 1969-06-13 | 1972-03-27 | Bayer Ag | Verfahren zur Herstellung von Polycarbonaten mit verminderter Brennbarkeit |
| DE2149311A1 (de) * | 1971-10-02 | 1973-04-05 | Bayer Ag | Flammwidrige polycarbonate |
| BE790919R (fr) * | 1971-11-03 | 1973-05-03 | Bayer Ag | Polycarbonates thermoplastiques a poids moleculaire eleve de phenols |
-
1973
- 1973-12-28 US US429166A patent/US3919167A/en not_active Expired - Lifetime
-
1974
- 1974-11-05 CA CA74212992A patent/CA1048678A/en not_active Expired
- 1974-12-16 GB GB54242/74A patent/GB1496680A/en not_active Expired
- 1974-12-19 IT IT30739/74A patent/IT1027816B/it active
- 1974-12-20 NL NLAANVRAGE7416656,A patent/NL174841C/xx not_active IP Right Cessation
- 1974-12-21 DE DE2460937A patent/DE2460937C2/de not_active Expired
- 1974-12-27 JP JP751072A patent/JPS5728427B2/ja not_active Expired
- 1974-12-27 FR FR7443098A patent/FR2256219B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA1048678A (en) | 1979-02-13 |
| US3919167A (en) | 1975-11-11 |
| NL174841C (nl) | 1984-08-16 |
| AU7570574A (en) | 1976-05-27 |
| JPS50116542A (cg-RX-API-DMAC10.html) | 1975-09-11 |
| GB1496680A (en) | 1977-12-30 |
| NL174841B (nl) | 1984-03-16 |
| DE2460937A1 (de) | 1975-07-03 |
| IT1027816B (it) | 1978-12-20 |
| JPS5728427B2 (cg-RX-API-DMAC10.html) | 1982-06-16 |
| FR2256219B1 (cg-RX-API-DMAC10.html) | 1979-03-16 |
| NL7416656A (nl) | 1975-07-01 |
| FR2256219A1 (cg-RX-API-DMAC10.html) | 1975-07-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2460937C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461063C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461077C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2460786C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461146C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2458968C2 (de) | Flammhemmende Polycarbonatzusammensetzung | |
| DE2458527C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461145A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2461144A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460787A1 (de) | Flammhemmende polycarbonat-zusammensetzung | |
| DE2948871A1 (de) | Flammhemmende polycarbonat-zusammensetzung | |
| DE2535262C2 (cg-RX-API-DMAC10.html) | ||
| DE2460788A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460935A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2148598A1 (de) | Flammfeste thermoplastische formmassen und formkoerper mit hoher schlagzaehigkeit | |
| DE68925794T2 (de) | Verfahren zur Verteilung von entzündungsfesten Zusätzen in Carbonatpolymeren | |
| DE2744018A1 (de) | Verbesserte, nicht opake, flammhemmende polycarbonat-zusammensetzung | |
| DE2460946A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2644114A1 (de) | Nicht-opake, flammhemmende polycarbonat-zusammensetzung | |
| DE2744017A1 (de) | Nicht-opake, feuerhemmende polycarbonat-zusammensetzung | |
| DE2745592A1 (de) | Verbesserte flammhemmende polycarbonat-zusammensetzung | |
| DE2643256A1 (de) | Flammhemmende polycarbonat-zusammensetzung | |
| DE2460944C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2647271A1 (de) | Nicht opake flammhemmende polycarbonat-zusammensetzung | |
| DE2744015A1 (de) | Nicht-opake, feuerhemmende polycarbonat-zusammensetzung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |