DE2459667C3 - Verfahren zur Herstellung einer Gaserzeugungszusammensetzung - Google Patents
Verfahren zur Herstellung einer GaserzeugungszusammensetzungInfo
- Publication number
- DE2459667C3 DE2459667C3 DE2459667A DE2459667A DE2459667C3 DE 2459667 C3 DE2459667 C3 DE 2459667C3 DE 2459667 A DE2459667 A DE 2459667A DE 2459667 A DE2459667 A DE 2459667A DE 2459667 C3 DE2459667 C3 DE 2459667C3
- Authority
- DE
- Germany
- Prior art keywords
- azide
- oxide
- granules
- composition
- gas
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims description 58
- 238000000034 method Methods 0.000 title claims description 15
- 230000008569 process Effects 0.000 title description 4
- 239000007789 gas Substances 0.000 claims description 35
- 239000002245 particle Substances 0.000 claims description 33
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 claims description 21
- 239000000463 material Substances 0.000 claims description 19
- 239000008187 granular material Substances 0.000 claims description 17
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 claims description 16
- 229910000480 nickel oxide Inorganic materials 0.000 claims description 14
- 239000007787 solid Substances 0.000 claims description 12
- 239000007788 liquid Substances 0.000 claims description 11
- 150000001540 azides Chemical class 0.000 claims description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- -1 alkaline earth metal azide Chemical class 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 238000002156 mixing Methods 0.000 claims description 4
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 239000007864 aqueous solution Substances 0.000 claims 1
- 239000004927 clay Substances 0.000 claims 1
- 238000002485 combustion reaction Methods 0.000 description 19
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 16
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 15
- 239000000047 product Substances 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 13
- 239000003826 tablet Substances 0.000 description 9
- 239000011734 sodium Substances 0.000 description 8
- 235000013980 iron oxide Nutrition 0.000 description 7
- 229910044991 metal oxide Inorganic materials 0.000 description 7
- 150000004706 metal oxides Chemical class 0.000 description 7
- 239000000843 powder Substances 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 230000008859 change Effects 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 238000001035 drying Methods 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 239000012265 solid product Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 238000001354 calcination Methods 0.000 description 3
- 229910001873 dinitrogen Inorganic materials 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 238000005550 wet granulation Methods 0.000 description 3
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 238000005469 granulation Methods 0.000 description 2
- 230000003179 granulation Effects 0.000 description 2
- LIKBJVNGSGBSGK-UHFFFAOYSA-N iron(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Fe+3].[Fe+3] LIKBJVNGSGBSGK-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910000008 nickel(II) carbonate Inorganic materials 0.000 description 2
- ZULUUIKRFGGGTL-UHFFFAOYSA-L nickel(ii) carbonate Chemical compound [Ni+2].[O-]C([O-])=O ZULUUIKRFGGGTL-UHFFFAOYSA-L 0.000 description 2
- NDLPOXTZKUMGOV-UHFFFAOYSA-N oxo(oxoferriooxy)iron hydrate Chemical compound O.O=[Fe]O[Fe]=O NDLPOXTZKUMGOV-UHFFFAOYSA-N 0.000 description 2
- 238000010422 painting Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 2
- 229910001948 sodium oxide Inorganic materials 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 2
- 239000005751 Copper oxide Substances 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- UUXFWHMUNNXFHD-UHFFFAOYSA-N barium azide Chemical compound [Ba+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] UUXFWHMUNNXFHD-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- UETLMBWMVIQIGU-UHFFFAOYSA-N calcium azide Chemical compound [Ca+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] UETLMBWMVIQIGU-UHFFFAOYSA-N 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- AYTVLULEEPNWAX-UHFFFAOYSA-N cesium;azide Chemical compound [Cs+].[N-]=[N+]=[N-] AYTVLULEEPNWAX-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- 238000005056 compaction Methods 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 229910000431 copper oxide Inorganic materials 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000001739 density measurement Methods 0.000 description 1
- AXZAYXJCENRGIM-UHFFFAOYSA-J dipotassium;tetrabromoplatinum(2-) Chemical compound [K+].[K+].[Br-].[Br-].[Br-].[Br-].[Pt+2] AXZAYXJCENRGIM-UHFFFAOYSA-J 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 229960002089 ferrous chloride Drugs 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 239000002241 glass-ceramic Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000003721 gunpowder Substances 0.000 description 1
- 239000000383 hazardous chemical Substances 0.000 description 1
- 231100000206 health hazard Toxicity 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- NMCUIPGRVMDVDB-UHFFFAOYSA-L iron dichloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 description 1
- VBMVTYDPPZVILR-UHFFFAOYSA-N iron(2+);oxygen(2-) Chemical class [O-2].[Fe+2] VBMVTYDPPZVILR-UHFFFAOYSA-N 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229910000464 lead oxide Inorganic materials 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- GUWHRJQTTVADPB-UHFFFAOYSA-N lithium azide Chemical compound [Li+].[N-]=[N+]=[N-] GUWHRJQTTVADPB-UHFFFAOYSA-N 0.000 description 1
- TWRAJPCQPHBABR-UHFFFAOYSA-N magnesium;diazide Chemical compound [Mg+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] TWRAJPCQPHBABR-UHFFFAOYSA-N 0.000 description 1
- 229910001511 metal iodide Inorganic materials 0.000 description 1
- 229910052976 metal sulfide Inorganic materials 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- 150000002815 nickel Chemical class 0.000 description 1
- MWUXSHHQAYIFBG-UHFFFAOYSA-N nitrogen oxide Inorganic materials O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 230000007096 poisonous effect Effects 0.000 description 1
- 229910001487 potassium perchlorate Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- GEWQYWRSUXOTOL-UHFFFAOYSA-N rubidium(1+);azide Chemical compound [Rb+].[N-]=[N+]=[N-] GEWQYWRSUXOTOL-UHFFFAOYSA-N 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- PDEROVFZLWBVSG-UHFFFAOYSA-N strontium;diazide Chemical compound [Sr+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] PDEROVFZLWBVSG-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
- 229910000859 α-Fe Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B21/00—Nitrogen; Compounds thereof
- C01B21/02—Preparation of nitrogen
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B35/00—Compositions containing a metal azide
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06D—MEANS FOR GENERATING SMOKE OR MIST; GAS-ATTACK COMPOSITIONS; GENERATION OF GAS FOR BLASTING OR PROPULSION (CHEMICAL PART)
- C06D5/00—Generation of pressure gas, e.g. for blasting cartridges, starting cartridges, rockets
- C06D5/06—Generation of pressure gas, e.g. for blasting cartridges, starting cartridges, rockets by reaction of two or more solids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Combustion & Propulsion (AREA)
- Air Bags (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5826973A GB1443547A (en) | 1973-12-17 | 1973-12-17 | Metal oxide/azide gas generating compositions |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2459667A1 DE2459667A1 (de) | 1975-06-19 |
| DE2459667B2 DE2459667B2 (de) | 1977-12-08 |
| DE2459667C3 true DE2459667C3 (de) | 1978-10-05 |
Family
ID=10481179
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2459667A Expired DE2459667C3 (de) | 1973-12-17 | 1974-12-17 | Verfahren zur Herstellung einer Gaserzeugungszusammensetzung |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3996079A (enExample) |
| JP (1) | JPS5423680B2 (enExample) |
| AR (1) | AR204260A1 (enExample) |
| BR (1) | BR7410485D0 (enExample) |
| CA (1) | CA1101215A (enExample) |
| DE (1) | DE2459667C3 (enExample) |
| FR (1) | FR2254618B1 (enExample) |
| GB (1) | GB1443547A (enExample) |
| IT (1) | IT1024474B (enExample) |
| SE (1) | SE7415557L (enExample) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2551921A1 (de) * | 1974-11-29 | 1976-08-12 | Eaton Corp | Gaserzeugendes azid-verbindungsgemisch |
| CA1070351A (en) * | 1975-06-30 | 1980-01-22 | George W. Goetz | Fluid generator |
| US4214438A (en) * | 1978-02-03 | 1980-07-29 | Allied Chemical Corporation | Pyrotechnic composition and method of inflating an inflatable device |
| CA1087851A (en) * | 1978-07-17 | 1980-10-21 | Lechoslaw A.M. Utracki | Gas generating composition |
| US4203787A (en) * | 1978-12-18 | 1980-05-20 | Thiokol Corporation | Pelletizable, rapid and cool burning solid nitrogen gas generant |
| US4604151A (en) * | 1985-01-30 | 1986-08-05 | Talley Defense Systems, Inc. | Method and compositions for generating nitrogen gas |
| IL76874A0 (en) * | 1985-10-29 | 1986-02-28 | Yeda Res & Dev | Source of nitrogen based on alkali metal azides |
| US4758287A (en) * | 1987-06-15 | 1988-07-19 | Talley Industries, Inc. | Porous propellant grain and method of making same |
| US4836255A (en) * | 1988-02-19 | 1989-06-06 | Morton Thiokol, Inc. | Azide gas generant formulations |
| US6977167B2 (en) * | 1988-09-07 | 2005-12-20 | Martek Biosciences Corporation | Mixtures of omega-3 and omega-6 highly unsaturated fatty acids from euryhaline microorganisms |
| US4931111A (en) * | 1989-11-06 | 1990-06-05 | Automotive Systems Laboratory, Inc. | Azide gas generating composition for inflatable devices |
| US4994212A (en) * | 1990-05-24 | 1991-02-19 | Trw Vehicle Safety Systems Inc. | Process for manufacturing a gas generating material |
| US5084218A (en) * | 1990-05-24 | 1992-01-28 | Trw Vehicle Safety Systems Inc. | Spheronizing process |
| US4999063A (en) * | 1990-06-07 | 1991-03-12 | Trw Vehicle Safety Systems Inc. | Process for manufacturing a gas generating material |
| US5074940A (en) * | 1990-06-19 | 1991-12-24 | Nippon Oil And Fats Co., Ltd. | Composition for gas generating |
| US5223184A (en) * | 1990-08-06 | 1993-06-29 | Morton International, Inc. | Enhanced thermal and ignition stability azide gas generant |
| US5019220A (en) * | 1990-08-06 | 1991-05-28 | Morton International, Inc. | Process for making an enhanced thermal and ignition stability azide gas generant |
| DE4218531C1 (enExample) * | 1991-10-11 | 1993-07-15 | Bayern-Chemie Gesellschaft Fuer Flugchemische Antriebe Mbh, 8261 Aschau, De | |
| US5125684A (en) * | 1991-10-15 | 1992-06-30 | Hercules Incorporated | Extrudable gas generating propellants, method and apparatus |
| US5160386A (en) * | 1991-11-04 | 1992-11-03 | Morton International, Inc. | Gas generant formulations containing poly(nitrito) metal complexes as oxidants and method |
| JP2800875B2 (ja) * | 1993-01-21 | 1998-09-21 | ティーアールダブリュー・インコーポレーテッド | 車両搭乗者衝撃抑制具のためのガス発生器 |
| US5682014A (en) * | 1993-08-02 | 1997-10-28 | Thiokol Corporation | Bitetrazoleamine gas generant compositions |
| US5472647A (en) * | 1993-08-02 | 1995-12-05 | Thiokol Corporation | Method for preparing anhydrous tetrazole gas generant compositions |
| CA2167386C (en) * | 1993-08-02 | 1999-10-05 | Alliant Techsystems Inc. | Method for preparing anhydrous tetrazole gas generant compositions |
| US5401340A (en) * | 1993-08-10 | 1995-03-28 | Thiokol Corporation | Borohydride fuels in gas generant compositions |
| US5439537A (en) * | 1993-08-10 | 1995-08-08 | Thiokol Corporation | Thermite compositions for use as gas generants |
| US5429691A (en) * | 1993-08-10 | 1995-07-04 | Thiokol Corporation | Thermite compositions for use as gas generants comprising basic metal carbonates and/or basic metal nitrates |
| US5695216A (en) * | 1993-09-28 | 1997-12-09 | Bofors Explosives Ab | Airbag device and propellant for airbags |
| US5531845A (en) * | 1994-01-10 | 1996-07-02 | Thiokol Corporation | Methods of preparing gas generant formulations |
| US5725699A (en) * | 1994-01-19 | 1998-03-10 | Thiokol Corporation | Metal complexes for use as gas generants |
| EP0740645B1 (en) * | 1994-01-19 | 2012-08-22 | Alliant Techsystems Inc. | Metal complexes for use as gas generants |
| US6969435B1 (en) | 1994-01-19 | 2005-11-29 | Alliant Techsystems Inc. | Metal complexes for use as gas generants |
| US20050067074A1 (en) | 1994-01-19 | 2005-03-31 | Hinshaw Jerald C. | Metal complexes for use as gas generants |
| DE4402047C2 (de) * | 1994-01-25 | 1995-12-07 | Bayern Chemie Gmbh Flugchemie | Verfahren zur Herstellung einer gaserzeugenden Masse |
| DE4423088A1 (de) | 1994-07-01 | 1996-01-04 | Temic Bayern Chem Airbag Gmbh | Gaserzeugendes, azidfreies Stoffgemisch |
| RU2138470C1 (ru) * | 1995-05-30 | 1999-09-27 | Самарский государственный технический университет | Газогенерирующий состав |
| DE19617538C1 (de) * | 1996-05-02 | 1997-10-30 | Temic Bayern Chem Airbag Gmbh | Gaserzeugendes, azidfreies Stoffgemisch |
| US6007736A (en) * | 1996-05-15 | 1999-12-28 | Be Intellectual Property | Oxygen generating compositions catalyzed by copper and nickel oxides |
| EP0958264B1 (en) | 1996-07-25 | 2011-06-01 | Alliant Techsystems Inc. | Metal complexes for use as gas generants |
| DE19643468A1 (de) * | 1996-10-22 | 1998-04-23 | Temic Bayern Chem Airbag Gmbh | Gaserzeugendes, azidfreies Feststoffgemisch |
| RU2257930C1 (ru) * | 2004-01-20 | 2005-08-10 | Федеральное государственное унитарное предприятие "Тамбовский научно-исследовательский химический институт" (ФГУП "ТамбовНИХИ") | Твердый источник азота для дыхательных смесей |
| RU2484075C2 (ru) * | 2011-04-21 | 2013-06-10 | Открытое акционерное общество "Федеральный научно-производственный центр "Научно-исследовательский институт прикладной химии" | Способ изготовления пиротехнических зарядов |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2981616A (en) * | 1956-10-01 | 1961-04-25 | North American Aviation Inc | Gas generator grain |
| US3122462A (en) * | 1961-11-24 | 1964-02-25 | Martin H Kaufman | Novel pyrotechnics |
| US3797854A (en) * | 1971-06-14 | 1974-03-19 | Rocket Research Corp | Crash restraint air generating inflation system |
| US3785674A (en) * | 1971-06-14 | 1974-01-15 | Rocket Research Corp | Crash restraint nitrogen generating inflation system |
| US3741585A (en) * | 1971-06-29 | 1973-06-26 | Thiokol Chemical Corp | Low temperature nitrogen gas generating composition |
| US3904221A (en) | 1972-05-19 | 1975-09-09 | Asahi Chemical Ind | Gas generating system for the inflation of a protective bag |
| US3895098A (en) * | 1972-05-31 | 1975-07-15 | Talley Industries | Method and composition for generating nitrogen gas |
| GB1391310A (en) * | 1972-07-24 | 1975-04-23 | Canadian Ind | Gas generating compositions |
| JPS5713485B2 (enExample) * | 1973-07-23 | 1982-03-17 | ||
| US3931040A (en) * | 1973-08-09 | 1976-01-06 | United Technologies Corporation | Gas generating composition |
-
1973
- 1973-12-17 GB GB5826973A patent/GB1443547A/en not_active Expired
-
1974
- 1974-01-01 AR AR256952A patent/AR204260A1/es active
- 1974-12-03 US US05/529,035 patent/US3996079A/en not_active Expired - Lifetime
- 1974-12-06 CA CA215,427A patent/CA1101215A/en not_active Expired
- 1974-12-11 SE SE7415557A patent/SE7415557L/xx unknown
- 1974-12-16 BR BR10485/74A patent/BR7410485D0/pt unknown
- 1974-12-16 FR FR7441342A patent/FR2254618B1/fr not_active Expired
- 1974-12-16 IT IT7454573A patent/IT1024474B/it active
- 1974-12-17 DE DE2459667A patent/DE2459667C3/de not_active Expired
- 1974-12-17 JP JP14416374A patent/JPS5423680B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA1101215A (en) | 1981-05-19 |
| FR2254618A1 (enExample) | 1975-07-11 |
| GB1443547A (en) | 1976-07-21 |
| JPS5095192A (enExample) | 1975-07-29 |
| AU7627874A (en) | 1976-06-17 |
| US3996079A (en) | 1976-12-07 |
| JPS5423680B2 (enExample) | 1979-08-15 |
| DE2459667A1 (de) | 1975-06-19 |
| BR7410485D0 (pt) | 1975-09-16 |
| IT1024474B (it) | 1978-06-20 |
| SE7415557L (enExample) | 1975-06-18 |
| DE2459667B2 (de) | 1977-12-08 |
| FR2254618B1 (enExample) | 1978-07-13 |
| AR204260A1 (es) | 1975-12-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2459667C3 (de) | Verfahren zur Herstellung einer Gaserzeugungszusammensetzung | |
| DE3820443C2 (de) | Poröses Treibmittelkorn und Verfahren zu seiner Herstellung | |
| DE2551921C2 (enExample) | ||
| DE69004787T2 (de) | Gaserzeugende Azid enthaltende Zusammensetzung für aufblasbare Vorrichtungen. | |
| DE3602731C2 (de) | Zusammensetzung zur Erzeugung von Stickstoffgas | |
| DE3132674C2 (de) | Verfahren zur Herstellung von Preßlingen | |
| DE19681514B4 (de) | Sprengstoff-Zusammensetzung für einen Airbag und Verfahren zu ihrer Herstellung | |
| DE4209878C2 (de) | Gaserzeugendes Korn mit einer Beschichtung auf Wasserbasis sowie Verfahren zu dessen Herstellung | |
| DE69220412T2 (de) | Verfahren zur Kontrolle der Menge von Stickoxiden im generierten Gas für Airbags | |
| DE69106667T2 (de) | Gaserzeugende, azidfreie Zusammensetzung, die leicht zu filternde Verbrennungsprodukte ergibt. | |
| DE60121242T2 (de) | Molybdän-Kupfer-Verbundpulver sowie dessen Herstellung und Verarbeitung zu einer Pseudolegierung | |
| DE69609793T2 (de) | Heterogene gaserzeugende Treibladungen | |
| DE10064285C1 (de) | Gasgeneratortreibstoff-Zusammensetzung und deren Verwendung | |
| DE69705520T2 (de) | Sauerstoff-erzeugende zusammensetzungen | |
| CH630320A5 (de) | Brennstofffreies, durch katalytische reaktion sauerstoff erzeugendes gemisch. | |
| DE19646931A1 (de) | Eisenoxid als ein Kühlmittel und Restebildner in einem organischen Antriebsmittel | |
| EP0560095B1 (de) | Aerosolbildendes Feuerlöschmittel | |
| EP1089955A1 (de) | Verfahren zur herstellung pyrotechnischer anzündsätze | |
| DE3935869C1 (enExample) | ||
| DE69210145T2 (de) | Verfahren zur Regulierung der Brenngeschwindigkeit und des Schmelzpunktes der Schlacke durch Inkorporation von Zusätzen zu Azid enthaltenden gaserzeugenden Zusammensetzungen | |
| EP1162183A1 (de) | Anzündmischung zur Verwendung in Gasgeneratoren | |
| DE60012933T2 (de) | Zusammengesetztes, gaserzeugendes material für gasbetriebene fahrzeugsicherheitseinrichtungen | |
| DE19516818A1 (de) | Gasentwickler-Zusammensetzungen | |
| DE69318280T2 (de) | Gasgenerator für ein Fahrzeug-Insassenrückhaltesystem | |
| DE19531130A1 (de) | Gaserzeugende Masse mit einem Verschlackungsmittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |