CA1101215A - Metal oxide/azide gas generating compositions - Google Patents
Metal oxide/azide gas generating compositionsInfo
- Publication number
- CA1101215A CA1101215A CA215,427A CA215427A CA1101215A CA 1101215 A CA1101215 A CA 1101215A CA 215427 A CA215427 A CA 215427A CA 1101215 A CA1101215 A CA 1101215A
- Authority
- CA
- Canada
- Prior art keywords
- oxide
- gas generating
- nitrogen gas
- azide
- alkali metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 67
- 150000001540 azides Chemical class 0.000 title claims description 11
- 229910044991 metal oxide Inorganic materials 0.000 title claims description 7
- 150000004706 metal oxides Chemical class 0.000 title claims description 7
- 239000007789 gas Substances 0.000 claims abstract description 42
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 20
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 claims abstract description 19
- 239000008187 granular material Substances 0.000 claims abstract description 15
- -1 alkaline earth metal azide Chemical class 0.000 claims abstract description 12
- 229910001873 dinitrogen Inorganic materials 0.000 claims abstract description 12
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 claims abstract description 12
- 229910000480 nickel oxide Inorganic materials 0.000 claims abstract description 11
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 10
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims abstract description 4
- 239000002245 particle Substances 0.000 claims description 25
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 20
- 238000002485 combustion reaction Methods 0.000 claims description 17
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 14
- 239000000463 material Substances 0.000 claims description 14
- 239000000047 product Substances 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 12
- 239000007787 solid Chemical group 0.000 claims description 12
- 239000012530 fluid Substances 0.000 claims description 10
- 239000000843 powder Substances 0.000 claims description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- 229910052742 iron Inorganic materials 0.000 claims description 7
- 238000002156 mixing Methods 0.000 claims description 7
- 238000001035 drying Methods 0.000 claims description 6
- 230000008569 process Effects 0.000 claims description 6
- 229910052759 nickel Inorganic materials 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 238000009826 distribution Methods 0.000 claims description 3
- 238000001914 filtration Methods 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims description 2
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 claims description 2
- 239000004927 clay Substances 0.000 claims description 2
- 238000012856 packing Methods 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 239000008188 pellet Substances 0.000 claims 7
- 239000000376 reactant Substances 0.000 claims 6
- 230000001427 coherent effect Effects 0.000 claims 4
- 229910052757 nitrogen Inorganic materials 0.000 claims 3
- 230000007717 exclusion Effects 0.000 claims 2
- 239000007864 aqueous solution Substances 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 230000002939 deleterious effect Effects 0.000 claims 1
- 238000005453 pelletization Methods 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- 239000011164 primary particle Substances 0.000 claims 1
- 238000012216 screening Methods 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 19
- 239000012265 solid product Substances 0.000 abstract description 9
- 150000001340 alkali metals Chemical class 0.000 abstract description 3
- 230000000717 retained effect Effects 0.000 abstract 1
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 16
- 239000004615 ingredient Substances 0.000 description 9
- 239000003826 tablet Substances 0.000 description 9
- 238000001354 calcination Methods 0.000 description 4
- 235000013980 iron oxide Nutrition 0.000 description 4
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 230000008859 change Effects 0.000 description 3
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 3
- NDLPOXTZKUMGOV-UHFFFAOYSA-N oxo(oxoferriooxy)iron hydrate Chemical compound O.O=[Fe]O[Fe]=O NDLPOXTZKUMGOV-UHFFFAOYSA-N 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000005550 wet granulation Methods 0.000 description 3
- LHJQIRIGXXHNLA-UHFFFAOYSA-N calcium peroxide Chemical compound [Ca+2].[O-][O-] LHJQIRIGXXHNLA-UHFFFAOYSA-N 0.000 description 2
- 238000005469 granulation Methods 0.000 description 2
- 230000003179 granulation Effects 0.000 description 2
- 238000009413 insulation Methods 0.000 description 2
- 229910000008 nickel(II) carbonate Inorganic materials 0.000 description 2
- ZULUUIKRFGGGTL-UHFFFAOYSA-L nickel(ii) carbonate Chemical compound [Ni+2].[O-]C([O-])=O ZULUUIKRFGGGTL-UHFFFAOYSA-L 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 101100348017 Drosophila melanogaster Nazo gene Proteins 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- BICLVNGVIUNNTB-UHFFFAOYSA-N [N-]=[N+]=[N-].[Na+].[O-2].[Fe+2] Chemical compound [N-]=[N+]=[N-].[Na+].[O-2].[Fe+2] BICLVNGVIUNNTB-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- UUXFWHMUNNXFHD-UHFFFAOYSA-N barium azide Chemical compound [Ba+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] UUXFWHMUNNXFHD-UHFFFAOYSA-N 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000011362 coarse particle Substances 0.000 description 1
- 238000005056 compaction Methods 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000001739 density measurement Methods 0.000 description 1
- AXZAYXJCENRGIM-UHFFFAOYSA-J dipotassium;tetrabromoplatinum(2-) Chemical compound [K+].[K+].[Br-].[Br-].[Br-].[Br-].[Pt+2] AXZAYXJCENRGIM-UHFFFAOYSA-J 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 231100000206 health hazard Toxicity 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- VBMVTYDPPZVILR-UHFFFAOYSA-N iron(2+);oxygen(2-) Chemical class [O-2].[Fe+2] VBMVTYDPPZVILR-UHFFFAOYSA-N 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- GUWHRJQTTVADPB-UHFFFAOYSA-N lithium azide Chemical compound [Li+].[N-]=[N+]=[N-] GUWHRJQTTVADPB-UHFFFAOYSA-N 0.000 description 1
- TWRAJPCQPHBABR-UHFFFAOYSA-N magnesium;diazide Chemical compound [Mg+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] TWRAJPCQPHBABR-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 150000002815 nickel Chemical class 0.000 description 1
- MWUXSHHQAYIFBG-UHFFFAOYSA-N nitrogen oxide Inorganic materials O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 1
- 230000001473 noxious effect Effects 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910001487 potassium perchlorate Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 238000001878 scanning electron micrograph Methods 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 229910001948 sodium oxide Inorganic materials 0.000 description 1
- YUOXWJFDLCMJNV-UHFFFAOYSA-N sodium oxonickel azide Chemical compound [N-]=[N+]=[N-].[Na+].[Ni]=O YUOXWJFDLCMJNV-UHFFFAOYSA-N 0.000 description 1
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- PDEROVFZLWBVSG-UHFFFAOYSA-N strontium;diazide Chemical compound [Sr+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] PDEROVFZLWBVSG-UHFFFAOYSA-N 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 229910000859 α-Fe Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B21/00—Nitrogen; Compounds thereof
- C01B21/02—Preparation of nitrogen
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B35/00—Compositions containing a metal azide
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06D—MEANS FOR GENERATING SMOKE OR MIST; GAS-ATTACK COMPOSITIONS; GENERATION OF GAS FOR BLASTING OR PROPULSION (CHEMICAL PART)
- C06D5/00—Generation of pressure gas, e.g. for blasting cartridges, starting cartridges, rockets
- C06D5/06—Generation of pressure gas, e.g. for blasting cartridges, starting cartridges, rockets by reaction of two or more solids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Combustion & Propulsion (AREA)
- Air Bags (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5826973A GB1443547A (en) | 1973-12-17 | 1973-12-17 | Metal oxide/azide gas generating compositions |
| GB58269/73 | 1973-12-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1101215A true CA1101215A (en) | 1981-05-19 |
Family
ID=10481179
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA215,427A Expired CA1101215A (en) | 1973-12-17 | 1974-12-06 | Metal oxide/azide gas generating compositions |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3996079A (enExample) |
| JP (1) | JPS5423680B2 (enExample) |
| AR (1) | AR204260A1 (enExample) |
| BR (1) | BR7410485D0 (enExample) |
| CA (1) | CA1101215A (enExample) |
| DE (1) | DE2459667C3 (enExample) |
| FR (1) | FR2254618B1 (enExample) |
| GB (1) | GB1443547A (enExample) |
| IT (1) | IT1024474B (enExample) |
| SE (1) | SE7415557L (enExample) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2551921A1 (de) * | 1974-11-29 | 1976-08-12 | Eaton Corp | Gaserzeugendes azid-verbindungsgemisch |
| CA1070351A (en) * | 1975-06-30 | 1980-01-22 | George W. Goetz | Fluid generator |
| US4214438A (en) * | 1978-02-03 | 1980-07-29 | Allied Chemical Corporation | Pyrotechnic composition and method of inflating an inflatable device |
| CA1087851A (en) * | 1978-07-17 | 1980-10-21 | Lechoslaw A.M. Utracki | Gas generating composition |
| US4203787A (en) * | 1978-12-18 | 1980-05-20 | Thiokol Corporation | Pelletizable, rapid and cool burning solid nitrogen gas generant |
| US4604151A (en) * | 1985-01-30 | 1986-08-05 | Talley Defense Systems, Inc. | Method and compositions for generating nitrogen gas |
| IL76874A0 (en) * | 1985-10-29 | 1986-02-28 | Yeda Res & Dev | Source of nitrogen based on alkali metal azides |
| US4758287A (en) * | 1987-06-15 | 1988-07-19 | Talley Industries, Inc. | Porous propellant grain and method of making same |
| US4836255A (en) * | 1988-02-19 | 1989-06-06 | Morton Thiokol, Inc. | Azide gas generant formulations |
| US6977167B2 (en) * | 1988-09-07 | 2005-12-20 | Martek Biosciences Corporation | Mixtures of omega-3 and omega-6 highly unsaturated fatty acids from euryhaline microorganisms |
| US4931111A (en) * | 1989-11-06 | 1990-06-05 | Automotive Systems Laboratory, Inc. | Azide gas generating composition for inflatable devices |
| US4994212A (en) * | 1990-05-24 | 1991-02-19 | Trw Vehicle Safety Systems Inc. | Process for manufacturing a gas generating material |
| US5084218A (en) * | 1990-05-24 | 1992-01-28 | Trw Vehicle Safety Systems Inc. | Spheronizing process |
| US4999063A (en) * | 1990-06-07 | 1991-03-12 | Trw Vehicle Safety Systems Inc. | Process for manufacturing a gas generating material |
| US5074940A (en) * | 1990-06-19 | 1991-12-24 | Nippon Oil And Fats Co., Ltd. | Composition for gas generating |
| US5223184A (en) * | 1990-08-06 | 1993-06-29 | Morton International, Inc. | Enhanced thermal and ignition stability azide gas generant |
| US5019220A (en) * | 1990-08-06 | 1991-05-28 | Morton International, Inc. | Process for making an enhanced thermal and ignition stability azide gas generant |
| DE4218531C1 (enExample) * | 1991-10-11 | 1993-07-15 | Bayern-Chemie Gesellschaft Fuer Flugchemische Antriebe Mbh, 8261 Aschau, De | |
| US5125684A (en) * | 1991-10-15 | 1992-06-30 | Hercules Incorporated | Extrudable gas generating propellants, method and apparatus |
| US5160386A (en) * | 1991-11-04 | 1992-11-03 | Morton International, Inc. | Gas generant formulations containing poly(nitrito) metal complexes as oxidants and method |
| JP2800875B2 (ja) * | 1993-01-21 | 1998-09-21 | ティーアールダブリュー・インコーポレーテッド | 車両搭乗者衝撃抑制具のためのガス発生器 |
| US5682014A (en) * | 1993-08-02 | 1997-10-28 | Thiokol Corporation | Bitetrazoleamine gas generant compositions |
| US5472647A (en) * | 1993-08-02 | 1995-12-05 | Thiokol Corporation | Method for preparing anhydrous tetrazole gas generant compositions |
| CA2167386C (en) * | 1993-08-02 | 1999-10-05 | Alliant Techsystems Inc. | Method for preparing anhydrous tetrazole gas generant compositions |
| US5401340A (en) * | 1993-08-10 | 1995-03-28 | Thiokol Corporation | Borohydride fuels in gas generant compositions |
| US5439537A (en) * | 1993-08-10 | 1995-08-08 | Thiokol Corporation | Thermite compositions for use as gas generants |
| US5429691A (en) * | 1993-08-10 | 1995-07-04 | Thiokol Corporation | Thermite compositions for use as gas generants comprising basic metal carbonates and/or basic metal nitrates |
| US5695216A (en) * | 1993-09-28 | 1997-12-09 | Bofors Explosives Ab | Airbag device and propellant for airbags |
| US5531845A (en) * | 1994-01-10 | 1996-07-02 | Thiokol Corporation | Methods of preparing gas generant formulations |
| US5725699A (en) * | 1994-01-19 | 1998-03-10 | Thiokol Corporation | Metal complexes for use as gas generants |
| EP0740645B1 (en) * | 1994-01-19 | 2012-08-22 | Alliant Techsystems Inc. | Metal complexes for use as gas generants |
| US6969435B1 (en) | 1994-01-19 | 2005-11-29 | Alliant Techsystems Inc. | Metal complexes for use as gas generants |
| US20050067074A1 (en) | 1994-01-19 | 2005-03-31 | Hinshaw Jerald C. | Metal complexes for use as gas generants |
| DE4402047C2 (de) * | 1994-01-25 | 1995-12-07 | Bayern Chemie Gmbh Flugchemie | Verfahren zur Herstellung einer gaserzeugenden Masse |
| DE4423088A1 (de) | 1994-07-01 | 1996-01-04 | Temic Bayern Chem Airbag Gmbh | Gaserzeugendes, azidfreies Stoffgemisch |
| RU2138470C1 (ru) * | 1995-05-30 | 1999-09-27 | Самарский государственный технический университет | Газогенерирующий состав |
| DE19617538C1 (de) * | 1996-05-02 | 1997-10-30 | Temic Bayern Chem Airbag Gmbh | Gaserzeugendes, azidfreies Stoffgemisch |
| US6007736A (en) * | 1996-05-15 | 1999-12-28 | Be Intellectual Property | Oxygen generating compositions catalyzed by copper and nickel oxides |
| EP0958264B1 (en) | 1996-07-25 | 2011-06-01 | Alliant Techsystems Inc. | Metal complexes for use as gas generants |
| DE19643468A1 (de) * | 1996-10-22 | 1998-04-23 | Temic Bayern Chem Airbag Gmbh | Gaserzeugendes, azidfreies Feststoffgemisch |
| RU2257930C1 (ru) * | 2004-01-20 | 2005-08-10 | Федеральное государственное унитарное предприятие "Тамбовский научно-исследовательский химический институт" (ФГУП "ТамбовНИХИ") | Твердый источник азота для дыхательных смесей |
| RU2484075C2 (ru) * | 2011-04-21 | 2013-06-10 | Открытое акционерное общество "Федеральный научно-производственный центр "Научно-исследовательский институт прикладной химии" | Способ изготовления пиротехнических зарядов |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2981616A (en) * | 1956-10-01 | 1961-04-25 | North American Aviation Inc | Gas generator grain |
| US3122462A (en) * | 1961-11-24 | 1964-02-25 | Martin H Kaufman | Novel pyrotechnics |
| US3797854A (en) * | 1971-06-14 | 1974-03-19 | Rocket Research Corp | Crash restraint air generating inflation system |
| US3785674A (en) * | 1971-06-14 | 1974-01-15 | Rocket Research Corp | Crash restraint nitrogen generating inflation system |
| US3741585A (en) * | 1971-06-29 | 1973-06-26 | Thiokol Chemical Corp | Low temperature nitrogen gas generating composition |
| US3904221A (en) | 1972-05-19 | 1975-09-09 | Asahi Chemical Ind | Gas generating system for the inflation of a protective bag |
| US3895098A (en) * | 1972-05-31 | 1975-07-15 | Talley Industries | Method and composition for generating nitrogen gas |
| GB1391310A (en) * | 1972-07-24 | 1975-04-23 | Canadian Ind | Gas generating compositions |
| JPS5713485B2 (enExample) * | 1973-07-23 | 1982-03-17 | ||
| US3931040A (en) * | 1973-08-09 | 1976-01-06 | United Technologies Corporation | Gas generating composition |
-
1973
- 1973-12-17 GB GB5826973A patent/GB1443547A/en not_active Expired
-
1974
- 1974-01-01 AR AR256952A patent/AR204260A1/es active
- 1974-12-03 US US05/529,035 patent/US3996079A/en not_active Expired - Lifetime
- 1974-12-06 CA CA215,427A patent/CA1101215A/en not_active Expired
- 1974-12-11 SE SE7415557A patent/SE7415557L/xx unknown
- 1974-12-16 BR BR10485/74A patent/BR7410485D0/pt unknown
- 1974-12-16 FR FR7441342A patent/FR2254618B1/fr not_active Expired
- 1974-12-16 IT IT7454573A patent/IT1024474B/it active
- 1974-12-17 DE DE2459667A patent/DE2459667C3/de not_active Expired
- 1974-12-17 JP JP14416374A patent/JPS5423680B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2254618A1 (enExample) | 1975-07-11 |
| GB1443547A (en) | 1976-07-21 |
| JPS5095192A (enExample) | 1975-07-29 |
| AU7627874A (en) | 1976-06-17 |
| US3996079A (en) | 1976-12-07 |
| JPS5423680B2 (enExample) | 1979-08-15 |
| DE2459667A1 (de) | 1975-06-19 |
| BR7410485D0 (pt) | 1975-09-16 |
| IT1024474B (it) | 1978-06-20 |
| SE7415557L (enExample) | 1975-06-18 |
| DE2459667B2 (de) | 1977-12-08 |
| FR2254618B1 (enExample) | 1978-07-13 |
| AR204260A1 (es) | 1975-12-10 |
| DE2459667C3 (de) | 1978-10-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1101215A (en) | Metal oxide/azide gas generating compositions | |
| CA1113249A (en) | Azide gas generating composition | |
| US4203787A (en) | Pelletizable, rapid and cool burning solid nitrogen gas generant | |
| CA1146756A (en) | Multi-ingredient gas generants | |
| KR920008180B1 (ko) | 팽창성 장치용 아지드 가스 발생 조성물 | |
| US4533416A (en) | Pelletizable propellant | |
| US4243443A (en) | Azide and doped iron oxide gas generating composition | |
| Focke et al. | Review of gasless pyrotechnic time delays | |
| US4604151A (en) | Method and compositions for generating nitrogen gas | |
| US5783105A (en) | Oxygen generating compositions | |
| PL175606B1 (pl) | Mieszanina do generowania gazu | |
| JPH08511233A (ja) | インフレータガス発生装置用の点火組成物 | |
| JP2001508751A (ja) | ガス発生剤として用いる金属錯体 | |
| KR0137726B1 (ko) | 차량 탑승자 보호구 조립체 | |
| CA1183374A (en) | Process for the production of porous nickel bodies | |
| Tichapondwa et al. | Performance of Mn/Bi2O3 pyrotechnic time delay compositions | |
| CA1087852A (en) | Gas generating composition | |
| JP4006835B2 (ja) | 点火薬組成物 | |
| Fogelzang et al. | Mechanism of modifying ballistic properties of propellant formulations by fast-burning inclusions | |
| CA1179504A (en) | Pelletized propellant | |
| RU2142401C1 (ru) | Пиротехнический состав для получения кислорода | |
| JP2803952B2 (ja) | 粒状難燃性脱臭剤の製造方法 | |
| CA2389046A1 (en) | Low ash gas generant and ignition compositions for vehicle occupant passive restraint systems | |
| Merzbacher | Materials that emit light by chemical reaction | |
| CA1087853A (en) | Gas generating composition |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |