DE3935869C1 - - Google Patents
Info
- Publication number
- DE3935869C1 DE3935869C1 DE3935869A DE3935869A DE3935869C1 DE 3935869 C1 DE3935869 C1 DE 3935869C1 DE 3935869 A DE3935869 A DE 3935869A DE 3935869 A DE3935869 A DE 3935869A DE 3935869 C1 DE3935869 C1 DE 3935869C1
- Authority
- DE
- Germany
- Prior art keywords
- moles
- alkali
- alkaline earth
- azide
- slag
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Revoked
Links
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 20
- 239000002893 slag Substances 0.000 claims description 19
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 17
- 229910052814 silicon oxide Inorganic materials 0.000 claims description 17
- 229910052717 sulfur Inorganic materials 0.000 claims description 17
- 239000011593 sulfur Substances 0.000 claims description 17
- PZNSFCLAULLKQX-UHFFFAOYSA-N Boron nitride Chemical compound N#B PZNSFCLAULLKQX-UHFFFAOYSA-N 0.000 claims description 13
- 239000003513 alkali Substances 0.000 claims description 13
- 229910052582 BN Inorganic materials 0.000 claims description 12
- -1 alkaline earth metal azide Chemical class 0.000 claims description 12
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 11
- 150000001540 azides Chemical class 0.000 claims description 11
- 239000007800 oxidant agent Substances 0.000 claims description 8
- 229910052581 Si3N4 Inorganic materials 0.000 claims description 7
- HQVNEWCFYHHQES-UHFFFAOYSA-N silicon nitride Chemical compound N12[Si]34N5[Si]62N3[Si]51N64 HQVNEWCFYHHQES-UHFFFAOYSA-N 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 6
- 230000003647 oxidation Effects 0.000 claims description 5
- 238000007254 oxidation reaction Methods 0.000 claims description 5
- 238000007496 glass forming Methods 0.000 claims description 4
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 3
- PMHQVHHXPFUNSP-UHFFFAOYSA-M copper(1+);methylsulfanylmethane;bromide Chemical compound Br[Cu].CSC PMHQVHHXPFUNSP-UHFFFAOYSA-M 0.000 claims description 2
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052723 transition metal Inorganic materials 0.000 claims description 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical group [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims 1
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 229910052810 boron oxide Inorganic materials 0.000 claims 1
- 229910052710 silicon Inorganic materials 0.000 claims 1
- 239000010703 silicon Substances 0.000 claims 1
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 30
- 239000007789 gas Substances 0.000 description 13
- 239000000446 fuel Substances 0.000 description 10
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 10
- 230000015572 biosynthetic process Effects 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- CWQXQMHSOZUFJS-UHFFFAOYSA-N molybdenum disulfide Chemical compound S=[Mo]=S CWQXQMHSOZUFJS-UHFFFAOYSA-N 0.000 description 6
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 6
- 239000002245 particle Substances 0.000 description 5
- 235000010333 potassium nitrate Nutrition 0.000 description 5
- 239000004323 potassium nitrate Substances 0.000 description 5
- 229910052979 sodium sulfide Inorganic materials 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 229910052982 molybdenum disulfide Inorganic materials 0.000 description 4
- 150000004767 nitrides Chemical class 0.000 description 4
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 4
- 229910001948 sodium oxide Inorganic materials 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 3
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 229910052750 molybdenum Inorganic materials 0.000 description 3
- 239000011733 molybdenum Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 239000008188 pellet Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 229910000314 transition metal oxide Inorganic materials 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 2
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 2
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 238000002485 combustion reaction Methods 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 229910000431 copper oxide Inorganic materials 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000002341 toxic gas Substances 0.000 description 2
- PIGFYZPCRLYGLF-UHFFFAOYSA-N Aluminum nitride Chemical compound [Al]#N PIGFYZPCRLYGLF-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 1
- 239000005751 Copper oxide Substances 0.000 description 1
- 229910020275 Na2Sx Inorganic materials 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- CHWRSCGUEQEHOH-UHFFFAOYSA-N potassium oxide Chemical compound [O-2].[K+].[K+] CHWRSCGUEQEHOH-UHFFFAOYSA-N 0.000 description 1
- 229910001950 potassium oxide Inorganic materials 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06D—MEANS FOR GENERATING SMOKE OR MIST; GAS-ATTACK COMPOSITIONS; GENERATION OF GAS FOR BLASTING OR PROPULSION (CHEMICAL PART)
- C06D5/00—Generation of pressure gas, e.g. for blasting cartridges, starting cartridges, rockets
- C06D5/06—Generation of pressure gas, e.g. for blasting cartridges, starting cartridges, rockets by reaction of two or more solids
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B35/00—Compositions containing a metal azide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Combustion & Propulsion (AREA)
- Air Bags (AREA)
- Feeding, Discharge, Calcimining, Fusing, And Gas-Generation Devices (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3935869A DE3935869C1 (enExample) | 1989-10-27 | 1989-10-27 | |
| US07/588,719 US5064483A (en) | 1989-10-27 | 1990-09-27 | Gas generating mass |
| JP2287364A JPH03150285A (ja) | 1989-10-27 | 1990-10-26 | ガス発生混合物 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3935869A DE3935869C1 (enExample) | 1989-10-27 | 1989-10-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3935869C1 true DE3935869C1 (enExample) | 1991-07-18 |
Family
ID=6392395
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3935869A Revoked DE3935869C1 (enExample) | 1989-10-27 | 1989-10-27 |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US5064483A (enExample) |
| JP (1) | JPH03150285A (enExample) |
| DE (1) | DE3935869C1 (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4311703A1 (de) * | 1992-04-10 | 1993-10-14 | Nof Corp | Gaserzeuger-Zusammensetzung und Verfahren zur Herstellung derselben |
| EP0607618A1 (en) * | 1993-01-21 | 1994-07-27 | Trw Inc. | Gas generator for vehicle occupant restraint |
| EP0712767A1 (de) * | 1992-09-21 | 1996-05-22 | DIEHL GMBH & CO. | Gasgenerator für einen Airbag |
| WO2001023327A1 (en) * | 1999-09-30 | 2001-04-05 | Altai Federal Research And Production Organisation | Gas generator and method for the generation of low-temperature gas |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5390952A (en) * | 1990-11-27 | 1995-02-21 | Goor Associates, Inc. | Integral inflatable occupant restraint system |
| US5653501A (en) * | 1996-02-16 | 1997-08-05 | Xcsi, Inc. | Inflatable restraint system |
| EP0952131A4 (en) * | 1996-12-28 | 1999-12-22 | Nippon Kayaku Kk | GAS GENERATING COMPOSITION FOR AIRBAG |
| JP4318777B2 (ja) * | 1998-02-25 | 2009-08-26 | 日本化薬株式会社 | ガス発生剤組成物 |
| DE20111410U1 (de) | 2001-07-10 | 2001-08-30 | TRW Airbag Systems GmbH & Co. KG, 84544 Aschau | Nitrozellulosefreie gaserzeugende Zusammensetzung |
| WO2004080251A2 (de) * | 2003-03-13 | 2004-09-23 | Ruag Ammotec Gmbh | Wärme erzeugende mischung sowie vorrichtung und verfahren zur wärmeerzeugung |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3779823A (en) * | 1971-11-18 | 1973-12-18 | R Price | Abrasion resistant gas generating compositions for use in inflating safety crash bags |
| DE2336853B2 (de) * | 1972-07-24 | 1976-08-12 | Canadian Industries Ltd., Montreal, Quebec (Kanada) | Gaserzeugende masse und deren verwendung |
| DE3316529A1 (de) * | 1982-10-16 | 1984-11-08 | Erno Raumfahrttechnik Gmbh, 2800 Bremen | Stoffgemisch zur gaserzeugung |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3741585A (en) * | 1971-06-29 | 1973-06-26 | Thiokol Chemical Corp | Low temperature nitrogen gas generating composition |
| US3865660A (en) * | 1973-03-12 | 1975-02-11 | Thiokol Chemical Corp | Non-toxic, non-corrosive, odorless gas generating composition |
| CA1146756A (en) * | 1980-06-20 | 1983-05-24 | Lechoslaw A.M. Utracki | Multi-ingredient gas generants |
| DE3733176A1 (de) * | 1987-10-01 | 1989-04-13 | Bayern Chemie Gmbh Flugchemie | Gaserzeugende masse |
-
1989
- 1989-10-27 DE DE3935869A patent/DE3935869C1/de not_active Revoked
-
1990
- 1990-09-27 US US07/588,719 patent/US5064483A/en not_active Expired - Fee Related
- 1990-10-26 JP JP2287364A patent/JPH03150285A/ja active Pending
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3779823A (en) * | 1971-11-18 | 1973-12-18 | R Price | Abrasion resistant gas generating compositions for use in inflating safety crash bags |
| DE2336853B2 (de) * | 1972-07-24 | 1976-08-12 | Canadian Industries Ltd., Montreal, Quebec (Kanada) | Gaserzeugende masse und deren verwendung |
| DE3316529A1 (de) * | 1982-10-16 | 1984-11-08 | Erno Raumfahrttechnik Gmbh, 2800 Bremen | Stoffgemisch zur gaserzeugung |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4311703A1 (de) * | 1992-04-10 | 1993-10-14 | Nof Corp | Gaserzeuger-Zusammensetzung und Verfahren zur Herstellung derselben |
| EP0712767A1 (de) * | 1992-09-21 | 1996-05-22 | DIEHL GMBH & CO. | Gasgenerator für einen Airbag |
| EP0713808A1 (de) * | 1992-09-21 | 1996-05-29 | DIEHL GMBH & CO. | Airbaganordnung |
| US5562303A (en) * | 1992-09-21 | 1996-10-08 | Honda Giken Kogyo Kabushiki Kaisha | Pyrotechnic mixture and gas generator for an airbag |
| US5585048A (en) * | 1992-09-21 | 1996-12-17 | Diehl Gmbh & Co. | Pyrotechnic mixture and gas generator for an airbag |
| US5589662A (en) * | 1992-09-21 | 1996-12-31 | Honda Giken Kogyo Kabushiki Kaisha | Pyrotechnic mixture and gas generator for an airbag |
| EP0607618A1 (en) * | 1993-01-21 | 1994-07-27 | Trw Inc. | Gas generator for vehicle occupant restraint |
| WO2001023327A1 (en) * | 1999-09-30 | 2001-04-05 | Altai Federal Research And Production Organisation | Gas generator and method for the generation of low-temperature gas |
Also Published As
| Publication number | Publication date |
|---|---|
| US5064483A (en) | 1991-11-12 |
| JPH03150285A (ja) | 1991-06-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3602731C2 (de) | Zusammensetzung zur Erzeugung von Stickstoffgas | |
| DE69220412T2 (de) | Verfahren zur Kontrolle der Menge von Stickoxiden im generierten Gas für Airbags | |
| DE69004787T2 (de) | Gaserzeugende Azid enthaltende Zusammensetzung für aufblasbare Vorrichtungen. | |
| DE69106667T2 (de) | Gaserzeugende, azidfreie Zusammensetzung, die leicht zu filternde Verbrennungsprodukte ergibt. | |
| DE2459667C3 (de) | Verfahren zur Herstellung einer Gaserzeugungszusammensetzung | |
| DE69001893T2 (de) | Zusammensetzung und Verfahren zum Aufblasen eines Sicherheitsluftsackes. | |
| DE69609791T2 (de) | Katalysator enthaltende, azidfreie gaserzeugende zusammensetzungen | |
| DE69730202T2 (de) | Azidfreie, gaserzeugende zusammensetzungen | |
| DE3733177C1 (de) | Gaserzeugende Masse | |
| US6149745A (en) | Gas generant composition | |
| DE69609793T2 (de) | Heterogene gaserzeugende Treibladungen | |
| EP0691317B1 (de) | Gaserzeugendes, azidfreies Stoffgemisch | |
| DE3935869C1 (enExample) | ||
| DE3733176C2 (enExample) | ||
| DE2439771A1 (de) | Pyrotechnisches gemisch | |
| DE19646931B4 (de) | Eisenoxid als Kühlmittel und Restebildner in einer organischen gaserzeugenden Zusammensetzung | |
| EP1006096B1 (de) | Azidfreie, gaserzeugende Zusammensetzung | |
| US5656793A (en) | Gas generator compositions | |
| DE19742203A1 (de) | Partikelfreies gaserzeugendes Gemisch | |
| DE4218531C1 (enExample) | ||
| EP1162183B1 (de) | Anzündmischung zur Verwendung in Gasgeneratoren | |
| DE19643468A1 (de) | Gaserzeugendes, azidfreies Feststoffgemisch | |
| DE60106076T2 (de) | Gaserzeugung mit metallkomplexen von guanylharnstoffnitrat | |
| DE10017772A1 (de) | Verminderten Rauch aufweisendes Gaserzeugungsmittel mit verbesserter Temperaturstabilität | |
| DE69318280T2 (de) | Gasgenerator für ein Fahrzeug-Insassenrückhaltesystem |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8100 | Publication of the examined application without publication of unexamined application | ||
| D1 | Grant (no unexamined application published) patent law 81 | ||
| 8363 | Opposition against the patent | ||
| 8331 | Complete revocation |