DE2453326C2 - - Google Patents
Info
- Publication number
- DE2453326C2 DE2453326C2 DE2453326A DE2453326A DE2453326C2 DE 2453326 C2 DE2453326 C2 DE 2453326C2 DE 2453326 A DE2453326 A DE 2453326A DE 2453326 A DE2453326 A DE 2453326A DE 2453326 C2 DE2453326 C2 DE 2453326C2
- Authority
- DE
- Germany
- Prior art keywords
- mol
- benzimidazolone
- product
- bromine
- hours
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 34
- 229910052794 bromium Inorganic materials 0.000 claims description 34
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 33
- 239000000460 chlorine Substances 0.000 claims description 23
- 229910052801 chlorine Inorganic materials 0.000 claims description 23
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 21
- 150000001875 compounds Chemical class 0.000 claims description 16
- -1 benzimidazolone compound Chemical class 0.000 claims description 15
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 9
- 239000003063 flame retardant Substances 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 150000008641 benzimidazolones Chemical class 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 5
- WKQKLCTYZKFNTG-UHFFFAOYSA-N 4,5,6,7-tetrabromo-1,3-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound BrC1=C(Br)C(Br)=C2N(CCO)C(=O)N(CCO)C2=C1Br WKQKLCTYZKFNTG-UHFFFAOYSA-N 0.000 claims description 3
- JOMCLWBPUJDERM-UHFFFAOYSA-N 4,5,6,7-tetrachloro-1,3-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound ClC1=C(Cl)C(Cl)=C2N(CCO)C(=O)N(CCO)C2=C1Cl JOMCLWBPUJDERM-UHFFFAOYSA-N 0.000 claims description 3
- RLOFMIQCRDRKMM-UHFFFAOYSA-N 4,5,6,7-tetrachloro-1,3-bis(2-hydroxypropyl)benzimidazol-2-one Chemical compound ClC1=C(Cl)C(Cl)=C2N(CC(C)O)C(=O)N(CC(O)C)C2=C1Cl RLOFMIQCRDRKMM-UHFFFAOYSA-N 0.000 claims description 3
- VIKVFVYZVSIBSS-UHFFFAOYSA-N 5,6-dibromo-4,7-dichloro-1,3-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound BrC1=C(Br)C(Cl)=C2N(CCO)C(=O)N(CCO)C2=C1Cl VIKVFVYZVSIBSS-UHFFFAOYSA-N 0.000 claims description 3
- 229920000642 polymer Polymers 0.000 claims description 3
- ABPHWHDWBYBFAV-UHFFFAOYSA-N 4,5,6,7-tetrabromo-1,3-bis(2-hydroxy-2-phenylethyl)benzimidazol-2-one Chemical compound C=1C=CC=CC=1C(O)CN(C1=O)C2=C(Br)C(Br)=C(Br)C(Br)=C2N1CC(O)C1=CC=CC=C1 ABPHWHDWBYBFAV-UHFFFAOYSA-N 0.000 claims description 2
- JMYHSOWPQLSVOG-UHFFFAOYSA-N 4,5,6,7-tetrabromo-1,3-bis(2-hydroxypropyl)benzimidazol-2-one Chemical compound BrC1=C(Br)C(Br)=C2N(CC(C)O)C(=O)N(CC(O)C)C2=C1Br JMYHSOWPQLSVOG-UHFFFAOYSA-N 0.000 claims description 2
- RQUDSLCRJLIZIN-UHFFFAOYSA-N 4,5,6,7-tetrabromo-1,3-bis(hydroxymethyl)benzimidazol-2-one Chemical compound BrC1=C(Br)C(Br)=C2N(CO)C(=O)N(CO)C2=C1Br RQUDSLCRJLIZIN-UHFFFAOYSA-N 0.000 claims description 2
- IPQLGCNVYJWEEV-UHFFFAOYSA-N 4,7-dibromo-5,6-dichloro-1,3-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound ClC1=C(Cl)C(Br)=C2N(CCO)C(=O)N(CCO)C2=C1Br IPQLGCNVYJWEEV-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 239000000047 product Substances 0.000 description 43
- 239000000243 solution Substances 0.000 description 42
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 37
- 238000006243 chemical reaction Methods 0.000 description 29
- 239000013078 crystal Substances 0.000 description 24
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 19
- 238000002844 melting Methods 0.000 description 18
- 230000008018 melting Effects 0.000 description 18
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 16
- MYONAGGJKCJOBT-UHFFFAOYSA-N benzimidazol-2-one Chemical compound C1=CC=CC2=NC(=O)N=C21 MYONAGGJKCJOBT-UHFFFAOYSA-N 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 239000002244 precipitate Substances 0.000 description 15
- 239000000155 melt Substances 0.000 description 14
- 238000003756 stirring Methods 0.000 description 14
- 238000004458 analytical method Methods 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 239000012043 crude product Substances 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 239000000126 substance Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 150000002009 diols Chemical class 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- 229920001634 Copolyester Polymers 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 238000004140 cleaning Methods 0.000 description 6
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 6
- 229920000728 polyester Polymers 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 238000005160 1H NMR spectroscopy Methods 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 238000000921 elemental analysis Methods 0.000 description 5
- 150000003254 radicals Chemical group 0.000 description 5
- 238000001228 spectrum Methods 0.000 description 5
- 238000000967 suction filtration Methods 0.000 description 5
- TWNNMRWUJWLCKS-UHFFFAOYSA-N 3-[3-(2-cyanoethyl)-2-oxobenzimidazol-1-yl]propanenitrile Chemical compound C1=CC=C2N(CCC#N)C(=O)N(CCC#N)C2=C1 TWNNMRWUJWLCKS-UHFFFAOYSA-N 0.000 description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- WAUNJESDGAPXMO-UHFFFAOYSA-N 1,3-bis(2-hydroxypropyl)benzimidazol-2-one Chemical compound C1=CC=C2N(CC(C)O)C(=O)N(CC(O)C)C2=C1 WAUNJESDGAPXMO-UHFFFAOYSA-N 0.000 description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 3
- JUZLMTKXVARGJJ-UHFFFAOYSA-N 4,5,6,7-tetrachlorobenzimidazol-2-one Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C2=NC(=O)N=C21 JUZLMTKXVARGJJ-UHFFFAOYSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 238000004452 microanalysis Methods 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 238000006068 polycondensation reaction Methods 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000011877 solvent mixture Substances 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- UARFFANGBYNLQT-UHFFFAOYSA-N 1,3-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound C1=CC=C2N(CCO)C(=O)N(CCO)C2=C1 UARFFANGBYNLQT-UHFFFAOYSA-N 0.000 description 2
- CNGROZGOFRTGFU-UHFFFAOYSA-N 1,3-bis(hydroxymethyl)benzimidazol-2-one Chemical compound C1=CC=C2N(CO)C(=O)N(CO)C2=C1 CNGROZGOFRTGFU-UHFFFAOYSA-N 0.000 description 2
- SQXIYRMRRKMQLB-UHFFFAOYSA-N 3-[4,5,6,7-tetrabromo-3-(2-carboxyethyl)-2-oxobenzimidazol-1-yl]propanoic acid Chemical compound BrC1=C(Br)C(Br)=C2N(CCC(O)=O)C(=O)N(CCC(=O)O)C2=C1Br SQXIYRMRRKMQLB-UHFFFAOYSA-N 0.000 description 2
- LQCFHFPIUVWUHF-UHFFFAOYSA-N 3-[4,5,6,7-tetrabromo-3-(2-cyanoethyl)-2-oxobenzimidazol-1-yl]propanenitrile Chemical compound BrC1=C(Br)C(Br)=C2N(CCC#N)C(=O)N(CCC#N)C2=C1Br LQCFHFPIUVWUHF-UHFFFAOYSA-N 0.000 description 2
- KKZOUSBOIMLSLK-UHFFFAOYSA-N 4,5,6,7-tetrabromo-1,3-bis(2,3-dihydroxypropyl)benzimidazol-2-one Chemical compound BrC1=C(Br)C(Br)=C2N(CC(O)CO)C(=O)N(CC(O)CO)C2=C1Br KKZOUSBOIMLSLK-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000031709 bromination Effects 0.000 description 2
- 238000005893 bromination reaction Methods 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 230000009477 glass transition Effects 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 150000002896 organic halogen compounds Chemical class 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- LZBJMGRNQYAAHU-UHFFFAOYSA-N 1,3-bis(2,3-dihydroxypropyl)benzimidazol-2-one Chemical compound C1=CC=C2N(CC(O)CO)C(=O)N(CC(O)CO)C2=C1 LZBJMGRNQYAAHU-UHFFFAOYSA-N 0.000 description 1
- ISLCAAJTFWKTII-UHFFFAOYSA-N 1,3-bis(2-chloroethyl)benzimidazol-2-one Chemical compound C1=CC=C2N(CCCl)C(=O)N(CCCl)C2=C1 ISLCAAJTFWKTII-UHFFFAOYSA-N 0.000 description 1
- VDUQJADUZSMRNM-UHFFFAOYSA-N 1,3-bis(2-hydroxy-2-phenylethyl)benzimidazol-2-one Chemical compound C=1C=CC=CC=1C(O)CN(C1=O)C2=CC=CC=C2N1CC(O)C1=CC=CC=C1 VDUQJADUZSMRNM-UHFFFAOYSA-N 0.000 description 1
- FWNKCKCXQRRGBW-UHFFFAOYSA-N 1,3-bis(2-hydroxycyclohexyl)benzimidazol-2-one Chemical compound OC1CCCCC1N1C(=O)N(C2C(CCCC2)O)C2=CC=CC=C21 FWNKCKCXQRRGBW-UHFFFAOYSA-N 0.000 description 1
- MVGAEVPAVZNUFG-UHFFFAOYSA-N 1,3-bis(3-aminopropyl)benzimidazol-2-one Chemical compound C1=CC=C2N(CCCN)C(=O)N(CCCN)C2=C1 MVGAEVPAVZNUFG-UHFFFAOYSA-N 0.000 description 1
- NAHLQCFWWVZWDY-UHFFFAOYSA-N 1,4-dioxane;ethane-1,2-diol Chemical compound OCCO.C1COCCO1 NAHLQCFWWVZWDY-UHFFFAOYSA-N 0.000 description 1
- RNHDAKUGFHSZEV-UHFFFAOYSA-N 1,4-dioxane;hydrate Chemical compound O.C1COCCO1 RNHDAKUGFHSZEV-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- JMTPLUIWGNLLNB-UHFFFAOYSA-N 2-[3-(carboxymethyl)-2-oxobenzimidazol-1-yl]acetic acid Chemical compound C1=CC=C2N(CC(O)=O)C(=O)N(CC(=O)O)C2=C1 JMTPLUIWGNLLNB-UHFFFAOYSA-N 0.000 description 1
- NMTJOQNJYLKDIX-UHFFFAOYSA-N 2-[4,5,6,7-tetrabromo-3-(carboxymethyl)-2-oxobenzimidazol-1-yl]acetic acid Chemical compound BrC1=C(Br)C(Br)=C2N(CC(O)=O)C(=O)N(CC(=O)O)C2=C1Br NMTJOQNJYLKDIX-UHFFFAOYSA-N 0.000 description 1
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 1
- YKDAJIRBTYBBGD-UHFFFAOYSA-N 3-(2-oxobenzimidazol-4-yl)propanoic acid Chemical compound OC(=O)CCC1=CC=CC2=NC(=O)N=C12 YKDAJIRBTYBBGD-UHFFFAOYSA-N 0.000 description 1
- DHXNZYCXMFBMHE-UHFFFAOYSA-N 3-bromopropanoic acid Chemical compound OC(=O)CCBr DHXNZYCXMFBMHE-UHFFFAOYSA-N 0.000 description 1
- XGBXUEWTVLQCBV-UHFFFAOYSA-N 4,5,6,7-tetrabromo-1,3-bis(2-chloroethyl)benzimidazol-2-one Chemical compound BrC1=C(Br)C(Br)=C2N(CCCl)C(=O)N(CCCl)C2=C1Br XGBXUEWTVLQCBV-UHFFFAOYSA-N 0.000 description 1
- LFRBMLUBOIUCOA-UHFFFAOYSA-N 4,5,6,7-tetrabromobenzimidazol-2-one Chemical compound BrC1=C(Br)C(Br)=C(Br)C2=NC(=O)N=C21 LFRBMLUBOIUCOA-UHFFFAOYSA-N 0.000 description 1
- KGXOHDDITRDHFO-UHFFFAOYSA-N 4,5,6,7-tetrachloro-1,3-bis(2-chloroethyl)benzimidazol-2-one Chemical compound ClC1=C(Cl)C(Cl)=C2N(CCCl)C(=O)N(CCCl)C2=C1Cl KGXOHDDITRDHFO-UHFFFAOYSA-N 0.000 description 1
- UMNVXPKRMQDDNR-UHFFFAOYSA-N 4,5,6-tribromo-1,3-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound BrC1=C(Br)C(Br)=C2N(CCO)C(=O)N(CCO)C2=C1 UMNVXPKRMQDDNR-UHFFFAOYSA-N 0.000 description 1
- KFYMFWLLQFOGRI-UHFFFAOYSA-N 4-(2-hydroxyethyl)benzimidazol-2-one Chemical compound OCCC1=CC=CC2=NC(=O)N=C12 KFYMFWLLQFOGRI-UHFFFAOYSA-N 0.000 description 1
- HIQRFIGNGXPAGN-UHFFFAOYSA-N 5,6-dibromo-1,3-bis(2-chloroethyl)benzimidazol-2-one Chemical compound BrC1=C(Br)C=C2N(CCCl)C(=O)N(CCCl)C2=C1 HIQRFIGNGXPAGN-UHFFFAOYSA-N 0.000 description 1
- JYWSTHCWTDKWJZ-UHFFFAOYSA-N 5,6-dibromo-1,3-bis(2-hydroxycyclohexyl)benzimidazol-2-one Chemical compound OC1CCCCC1N1C(=O)N(C2C(CCCC2)O)C2=CC(Br)=C(Br)C=C21 JYWSTHCWTDKWJZ-UHFFFAOYSA-N 0.000 description 1
- AHLDKBSLFFPEFT-UHFFFAOYSA-N 5,6-dichloro-1,3-bis(2-hydroxyethyl)benzimidazol-2-one Chemical compound ClC1=C(Cl)C=C2N(CCO)C(=O)N(CCO)C2=C1 AHLDKBSLFFPEFT-UHFFFAOYSA-N 0.000 description 1
- GJEZBVHHZQAEDB-UHFFFAOYSA-N 6-oxabicyclo[3.1.0]hexane Chemical compound C1CCC2OC21 GJEZBVHHZQAEDB-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000007805 chemical reaction reactant Substances 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- 125000004965 chloroalkyl group Chemical group 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000007278 cyanoethylation reaction Methods 0.000 description 1
- ZWAJLVLEBYIOTI-UHFFFAOYSA-N cyclohexene oxide Chemical compound C1CCCC2OC21 ZWAJLVLEBYIOTI-UHFFFAOYSA-N 0.000 description 1
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohexene oxide Natural products O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical class C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- LVEGZEHLPRZFGL-UHFFFAOYSA-N methyl 2-[3-(2-methoxy-2-oxoethyl)-2-oxobenzimidazol-1-yl]acetate Chemical compound C1=CC=C2N(CC(=O)OC)C(=O)N(CC(=O)OC)C2=C1 LVEGZEHLPRZFGL-UHFFFAOYSA-N 0.000 description 1
- 125000004492 methyl ester group Chemical group 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000004597 plastic additive Substances 0.000 description 1
- 229920001707 polybutylene terephthalate Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 235000021395 porridge Nutrition 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000005496 tempering Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/26—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/28—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the compounds used containing active hydrogen
- C08G18/30—Low-molecular-weight compounds
- C08G18/38—Low-molecular-weight compounds having heteroatoms other than oxygen
- C08G18/3819—Low-molecular-weight compounds having heteroatoms other than oxygen having nitrogen
- C08G18/3842—Low-molecular-weight compounds having heteroatoms other than oxygen having nitrogen containing heterocyclic rings having at least one nitrogen atom in the ring
- C08G18/3848—Low-molecular-weight compounds having heteroatoms other than oxygen having nitrogen containing heterocyclic rings having at least one nitrogen atom in the ring containing two nitrogen atoms in the ring
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/20—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the epoxy compounds used
- C08G59/22—Di-epoxy compounds
- C08G59/26—Di-epoxy compounds heterocyclic
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/68—Polyesters containing atoms other than carbon, hydrogen and oxygen
- C08G63/685—Polyesters containing atoms other than carbon, hydrogen and oxygen containing nitrogen
- C08G63/6854—Polyesters containing atoms other than carbon, hydrogen and oxygen containing nitrogen derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/6856—Dicarboxylic acids and dihydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Polyesters Or Polycarbonates (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1595373A CH583201A5 (OSRAM) | 1973-11-13 | 1973-11-13 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2453326A1 DE2453326A1 (de) | 1975-05-15 |
| DE2453326C2 true DE2453326C2 (OSRAM) | 1987-06-25 |
Family
ID=4413305
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742453326 Granted DE2453326A1 (de) | 1973-11-13 | 1974-11-11 | Halogensubstituierte benzimidazolonverbindungen und verfahren zu ihrer herstellung |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3954790A (OSRAM) |
| JP (1) | JPS5910348B2 (OSRAM) |
| AR (1) | AR204111A1 (OSRAM) |
| AT (1) | AT337695B (OSRAM) |
| BE (1) | BE822049A (OSRAM) |
| CA (1) | CA1030543A (OSRAM) |
| CH (1) | CH583201A5 (OSRAM) |
| DD (1) | DD114948A5 (OSRAM) |
| DE (1) | DE2453326A1 (OSRAM) |
| ES (1) | ES431849A1 (OSRAM) |
| FR (1) | FR2250747B1 (OSRAM) |
| GB (1) | GB1481859A (OSRAM) |
| NL (1) | NL7414814A (OSRAM) |
| SE (1) | SE7412527L (OSRAM) |
| SU (1) | SU520915A3 (OSRAM) |
| ZA (1) | ZA747237B (OSRAM) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3830324A (en) * | 1973-08-20 | 1974-08-20 | Hydranautics | Transporter for heavy loads |
| AT343911B (de) * | 1975-03-17 | 1978-06-26 | Schmidt Oskar | Verfahren zur herstellung von polyurethan-elastomeren |
| CA1080719A (en) * | 1975-10-27 | 1980-07-01 | Lim-Holding S.A. | Poly (thio) ethers having terminal amino groups, process for their production and their application |
| CH619455A5 (OSRAM) * | 1976-01-07 | 1980-09-30 | Ciba Geigy Ag | |
| US4161603A (en) * | 1976-05-12 | 1979-07-17 | Ciba-Geigy Corporation | Dicarboxylic acids and dicarboxylic acid esters containing a benzimidazolone radical |
| US4228281A (en) * | 1977-09-23 | 1980-10-14 | Ciba-Geigy Corporation | Dicarboxylic acids containing triazine rings |
| CH640548A5 (de) * | 1979-08-28 | 1984-01-13 | Ciba Geigy Ag | Flammwidrige kunststofformmasse. |
| EP0043347A1 (de) * | 1980-06-26 | 1982-01-06 | Ciba-Geigy Ag | Halogenhaltige Benzimidazolonbisglycide und ihre Verwendung |
| US4341693A (en) * | 1980-06-26 | 1982-07-27 | Ciba-Geigy Corporation | Oligomeric epoxide resins and their use as flameproofing agents |
| MY145571A (en) | 2003-12-19 | 2012-02-29 | Ciba Holding Inc | Fluorocarbon terminated oligo-and poly-carbonates as surface modifiers |
| EP2207851B1 (en) | 2007-11-01 | 2015-11-25 | Dow Global Technologies LLC | In situ moisture generation and use of polyfunctional alcohols for crosslinking of silane-functionalized resins |
| EP3409707A1 (en) | 2017-05-30 | 2018-12-05 | Henkel AG & Co. KGaA | Method for producing functionalized polyesters |
| CN108395526B (zh) * | 2018-02-09 | 2020-03-10 | 四川大学 | 基于苯并咪唑结构的阻燃抗熔滴共聚酯及其制备方法 |
| CN111138633B (zh) * | 2020-01-07 | 2021-03-30 | 厦门大学 | 一种生物质本征阻燃耐高温环氧树脂及其制备方法 |
| US20240287019A1 (en) * | 2021-06-07 | 2024-08-29 | Kinki University | T-type calcium channel blocker |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3024166A (en) * | 1960-03-22 | 1962-03-06 | Bristol Myers Co | Analgesic dihydroxymethylbenzimidazol-2-ones |
| BE627013A (OSRAM) * | 1962-01-11 | |||
| BE793659A (fr) * | 1972-01-05 | 1973-07-04 | Ciba Geigy | Diglycidylimidazolidones et melanges durcissables qui en renferment |
-
1973
- 1973-11-13 CH CH1595373A patent/CH583201A5/xx not_active IP Right Cessation
-
1974
- 1974-01-01 AR AR256480A patent/AR204111A1/es active
- 1974-10-04 SE SE7412527A patent/SE7412527L/xx unknown
- 1974-11-05 US US05/521,228 patent/US3954790A/en not_active Expired - Lifetime
- 1974-11-08 CA CA213,317A patent/CA1030543A/en not_active Expired
- 1974-11-11 DD DD182287A patent/DD114948A5/xx unknown
- 1974-11-11 DE DE19742453326 patent/DE2453326A1/de active Granted
- 1974-11-12 BE BE150381A patent/BE822049A/xx not_active IP Right Cessation
- 1974-11-12 SU SU2073854A patent/SU520915A3/ru active
- 1974-11-12 ES ES431849A patent/ES431849A1/es not_active Expired
- 1974-11-12 ZA ZA00747237A patent/ZA747237B/xx unknown
- 1974-11-12 AT AT904974A patent/AT337695B/de not_active IP Right Cessation
- 1974-11-13 NL NL7414814A patent/NL7414814A/xx not_active Application Discontinuation
- 1974-11-13 FR FR7437392A patent/FR2250747B1/fr not_active Expired
- 1974-11-13 JP JP49130917A patent/JPS5910348B2/ja not_active Expired
- 1974-11-13 GB GB49203/74A patent/GB1481859A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SU520915A3 (ru) | 1976-07-05 |
| ES431849A1 (es) | 1976-11-01 |
| BE822049A (fr) | 1975-05-12 |
| SE7412527L (OSRAM) | 1975-05-14 |
| ZA747237B (en) | 1975-11-26 |
| DD114948A5 (OSRAM) | 1975-09-05 |
| GB1481859A (en) | 1977-08-03 |
| US3954790A (en) | 1976-05-04 |
| AR204111A1 (es) | 1975-11-20 |
| JPS5082064A (OSRAM) | 1975-07-03 |
| FR2250747B1 (OSRAM) | 1977-10-21 |
| CH583201A5 (OSRAM) | 1976-12-31 |
| CA1030543A (en) | 1978-05-02 |
| ATA904974A (de) | 1976-11-15 |
| DE2453326A1 (de) | 1975-05-15 |
| AT337695B (de) | 1977-07-11 |
| NL7414814A (nl) | 1975-05-15 |
| JPS5910348B2 (ja) | 1984-03-08 |
| FR2250747A1 (OSRAM) | 1975-06-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2453326C2 (OSRAM) | ||
| DE2626768A1 (de) | Imidyl-benzoldicarbonsaeure-derivate | |
| DE2425983B2 (de) | Sulfonsaeuresalze von acylcholinen, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische zusammensetzung | |
| DE1947264C3 (de) | Phosphorsäurepolycarboxytriphenylester und Verfahren zu deren Herstellung | |
| DE2852785A1 (de) | Anthranilsaeureester von oxyalkylierten carbonsaeureamiden | |
| DE2453450C2 (de) | Neue, flammwidrige, thermoplastische Polyester | |
| DE1770010B2 (de) | Verfahren zur Herstellung von 5(6)-substituierten 2-Carb-alkoxyamino-benzimidazolen | |
| AT356085B (de) | Verfahren zur herstellung von neuen anthranil- saeureestern | |
| DE2720772A1 (de) | Einen heterocyclischen rest enthaltende dicarbonsaeuren und dicarbonsaeureester | |
| CH642617A5 (de) | Verfahren zur herstellung von bromhexin. | |
| DE2124885A1 (OSRAM) | ||
| EP0523619A2 (de) | Verfahren zur Herstellung von N-Cyanimidocarbonaten | |
| AT234698B (de) | Verfahren zur Herstellung von 4-Sulfanilamido-2,6-di-nieder-alkoxy-pyrimidinen | |
| DE910654C (de) | Verfahren zur Herstellung von 2-Halogenarylamino-4-amino-1,3, 5-triazinderivaten | |
| WO1998043958A1 (de) | Verfahren zur herstellung von 2,6-dichlor-5-fluornicotinonitril und die chemische verbindung 3-cyano-2-hydroxy-5-fluorpyrid-6-on-mononatriumsalz sowie dessen tautomere | |
| CH619687A5 (OSRAM) | ||
| AT355045B (de) | Verfahren zur herstellung von neuen anthranyl- oyloxyalkylhydantoinen | |
| DE3047043A1 (de) | Verfahren zur herstellung von 2-amino-benzimidazolen | |
| AT273950B (de) | Verfahren zur Herstellung von neuen, einen Nitrofuran- oder Nitrothiophenrest enthaltenden Triazolo-tetrazolo-pyridazin-derivaten | |
| DE886904C (de) | Verfahren zur Herstellung von o-Oxycarbonsaeurearylamiden | |
| AT356674B (de) | Verfahren zur herstellung von neuen 5-fluor- dihydrouracilen | |
| DE859169C (de) | Verfahren zur Herstellung von dihalogenierten, substituierten Pteridinen | |
| DE1670261A1 (de) | Verfahren zur Herstellung von N-Hexahydropyrimidyl-(4)-carbamin-saeureestern | |
| DE2916545A1 (de) | Anthranilsaeureester von polyoxyaethylierten carbonsaeureamiden | |
| CH597124A5 (en) | 1,3,5-Trialkoxy-benzenes prepn |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |