DE2444234C2 - Verfahren zur Herstellung von p-Benzochinonen - Google Patents
Verfahren zur Herstellung von p-BenzochinonenInfo
- Publication number
- DE2444234C2 DE2444234C2 DE2444234A DE2444234A DE2444234C2 DE 2444234 C2 DE2444234 C2 DE 2444234C2 DE 2444234 A DE2444234 A DE 2444234A DE 2444234 A DE2444234 A DE 2444234A DE 2444234 C2 DE2444234 C2 DE 2444234C2
- Authority
- DE
- Germany
- Prior art keywords
- phenol
- copper
- catalyst
- benzoquinone
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 13
- 150000004057 1,4-benzoquinones Chemical class 0.000 title claims description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 37
- 239000003054 catalyst Substances 0.000 claims description 33
- 239000010949 copper Substances 0.000 claims description 24
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 20
- 229910052802 copper Inorganic materials 0.000 claims description 20
- 238000007254 oxidation reaction Methods 0.000 claims description 20
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 16
- 239000001301 oxygen Substances 0.000 claims description 16
- 229910052760 oxygen Inorganic materials 0.000 claims description 16
- 230000003647 oxidation Effects 0.000 claims description 14
- 150000002989 phenols Chemical class 0.000 claims description 13
- 239000003446 ligand Substances 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 6
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 claims description 4
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 4
- -1 copper (I) ions Chemical class 0.000 claims description 4
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 claims description 3
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 claims description 3
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 claims description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 51
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 28
- 238000006243 chemical reaction Methods 0.000 description 22
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 16
- 230000035484 reaction time Effects 0.000 description 10
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 9
- 239000007789 gas Substances 0.000 description 8
- RDQSIADLBQFVMY-UHFFFAOYSA-N 2,6-Di-tert-butylbenzoquinone Chemical compound CC(C)(C)C1=CC(=O)C=C(C(C)(C)C)C1=O RDQSIADLBQFVMY-UHFFFAOYSA-N 0.000 description 7
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 7
- 229940116357 potassium thiocyanate Drugs 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 5
- DKCPKDPYUFEZCP-UHFFFAOYSA-N 2,6-di-tert-butylphenol Chemical compound CC(C)(C)C1=CC=CC(C(C)(C)C)=C1O DKCPKDPYUFEZCP-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 150000004054 benzoquinones Chemical class 0.000 description 3
- 229910001431 copper ion Inorganic materials 0.000 description 3
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 3
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 2
- IXQGCWUGDFDQMF-UHFFFAOYSA-N 2-Ethylphenol Chemical compound CCC1=CC=CC=C1O IXQGCWUGDFDQMF-UHFFFAOYSA-N 0.000 description 2
- VTWDKFNVVLAELH-UHFFFAOYSA-N 2-methylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=CC(=O)C=CC1=O VTWDKFNVVLAELH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- JXTGICXCHWMCPM-UHFFFAOYSA-N (methylsulfinyl)benzene Chemical compound CS(=O)C1=CC=CC=C1 JXTGICXCHWMCPM-UHFFFAOYSA-N 0.000 description 1
- SENUUPBBLQWHMF-UHFFFAOYSA-N 2,6-dimethylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=CC(=O)C=C(C)C1=O SENUUPBBLQWHMF-UHFFFAOYSA-N 0.000 description 1
- IGRSQEOIAAGSGS-UHFFFAOYSA-N 2-ethylcyclohexa-2,5-diene-1,4-dione Chemical compound CCC1=CC(=O)C=CC1=O IGRSQEOIAAGSGS-UHFFFAOYSA-N 0.000 description 1
- WJQOZHYUIDYNHM-UHFFFAOYSA-N 2-tert-Butylphenol Chemical compound CC(C)(C)C1=CC=CC=C1O WJQOZHYUIDYNHM-UHFFFAOYSA-N 0.000 description 1
- NPGZGVPKRJYKCI-UHFFFAOYSA-N 2-tert-butyl-6-methylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=CC(=O)C=C(C(C)(C)C)C1=O NPGZGVPKRJYKCI-UHFFFAOYSA-N 0.000 description 1
- BKZXZGWHTRCFPX-UHFFFAOYSA-N 2-tert-butyl-6-methylphenol Chemical compound CC1=CC=CC(C(C)(C)C)=C1O BKZXZGWHTRCFPX-UHFFFAOYSA-N 0.000 description 1
- NCCTVAJNFXYWTM-UHFFFAOYSA-N 2-tert-butylcyclohexa-2,5-diene-1,4-dione Chemical compound CC(C)(C)C1=CC(=O)C=CC1=O NCCTVAJNFXYWTM-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- IIBOGKHTXBPGEI-UHFFFAOYSA-N N-benzylformamide Chemical compound O=CNCC1=CC=CC=C1 IIBOGKHTXBPGEI-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 229960003280 cupric chloride Drugs 0.000 description 1
- RMBGFUOEZINVEP-UHFFFAOYSA-N cyclohexa-2,5-diene-1,4-dione;phenol Chemical compound OC1=CC=CC=C1.O=C1C=CC(=O)C=C1 RMBGFUOEZINVEP-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- ISJDYHYHRZQRKW-UHFFFAOYSA-N methylsulfinylcyclohexane Chemical compound CS(=O)C1CCCCC1 ISJDYHYHRZQRKW-UHFFFAOYSA-N 0.000 description 1
- 229960000990 monobenzone Drugs 0.000 description 1
- DCNUQRBLZWSGAV-UHFFFAOYSA-N n,n-diphenylformamide Chemical compound C=1C=CC=CC=1N(C=O)C1=CC=CC=C1 DCNUQRBLZWSGAV-UHFFFAOYSA-N 0.000 description 1
- IOPSSIBZIWXMMU-UHFFFAOYSA-N n-(cyclohexylmethyl)formamide Chemical compound O=CNCC1CCCCC1 IOPSSIBZIWXMMU-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920013636 polyphenyl ether polymer Polymers 0.000 description 1
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- PXLIDIMHPNPGMH-UHFFFAOYSA-N sodium chromate Chemical compound [Na+].[Na+].[O-][Cr]([O-])(=O)=O PXLIDIMHPNPGMH-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C46/00—Preparation of quinones
- C07C46/02—Preparation of quinones by oxidation giving rise to quinoid structures
- C07C46/06—Preparation of quinones by oxidation giving rise to quinoid structures of at least one hydroxy group on a six-membered aromatic ring
- C07C46/08—Preparation of quinones by oxidation giving rise to quinoid structures of at least one hydroxy group on a six-membered aromatic ring with molecular oxygen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US401724A US3870731A (en) | 1973-09-28 | 1973-09-28 | Oxidation of phenols and alkyl substituted phenols to their corresponding para-benzoquinone |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2444234A1 DE2444234A1 (de) | 1975-04-03 |
| DE2444234C2 true DE2444234C2 (de) | 1982-07-15 |
Family
ID=23588961
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2444234A Expired DE2444234C2 (de) | 1973-09-28 | 1974-09-16 | Verfahren zur Herstellung von p-Benzochinonen |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3870731A (enExample) |
| JP (1) | JPS5747894B2 (enExample) |
| BE (1) | BE820402A (enExample) |
| CA (1) | CA1016953A (enExample) |
| DE (1) | DE2444234C2 (enExample) |
| FR (1) | FR2245602B1 (enExample) |
| GB (1) | GB1487091A (enExample) |
| IT (1) | IT1029594B (enExample) |
| NL (1) | NL7412824A (enExample) |
| ZA (1) | ZA745899B (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3987068A (en) * | 1975-07-28 | 1976-10-19 | E. I. Du Pont De Nemours And Company | Oxidation of monohydroxy aryl compounds to 1,4-quinones |
| FR2408570A1 (fr) * | 1977-06-27 | 1979-06-08 | Rhone Poulenc Ind | Procede de preparation de para-benzoquinone |
| US4257968A (en) * | 1979-10-04 | 1981-03-24 | E. I. Du Pont De Nemours And Company | Oxidation of phenol to p-benzoquinone in acetonitrile/methanol cosolvent |
| US4311627A (en) * | 1980-10-29 | 1982-01-19 | Consolidated Foundries And Mfg. Corp. | Process for curing foundry cores and molds |
| US4317745A (en) * | 1980-12-15 | 1982-03-02 | The Dow Chemical Company | Catalytic oxidation of phenols to 1,4-benzoquinones |
| US4478752A (en) * | 1981-07-20 | 1984-10-23 | Sun Tech, Inc. | Process for oxidizing phenol to p-benzoquinone |
| GR78368B (enExample) * | 1981-11-18 | 1984-09-26 | Delalande Sa | |
| US4519948A (en) * | 1982-09-27 | 1985-05-28 | Sun Tech, Inc. | Process for oxidizing a phenol to a p-benzoquinone |
| JPS5961262U (ja) * | 1982-10-18 | 1984-04-21 | 新開 敏弘 | 台座つき石けん |
| US4522757A (en) * | 1982-10-25 | 1985-06-11 | Sun Tech, Inc. | Process for oxidizing a phenol to a p-benzoquinone |
| US4442036A (en) * | 1983-02-28 | 1984-04-10 | Sun Tech, Inc. | Process for oxidizing phenol to benzoquinone |
| JPS59225137A (ja) * | 1983-06-06 | 1984-12-18 | Mitsubishi Gas Chem Co Inc | 2,3,5−トリメチルベンゾキノンの製造方法 |
| DE68907180D1 (de) * | 1988-11-18 | 1993-07-22 | Agency Ind Science Techn | Verfahren zur herstellung von 2,3,5-trimethylbenzochinon. |
| DE3908768A1 (de) * | 1989-03-17 | 1990-09-20 | Basf Ag | Verfahren zur herstellung von 2,3,5-trimethyl-p-benzochinon |
| US6693221B1 (en) | 2003-04-04 | 2004-02-17 | General Electric Company | Method of preparing mixtures of bromophenols and benzoquinones |
| US6815565B2 (en) * | 2003-04-04 | 2004-11-09 | General Electric Company | Method for preparing hydroquinones and dihydroxybiphenyl compounds from mixtures of bromophenols and benzoquinones |
| US20050137409A1 (en) * | 2003-12-18 | 2005-06-23 | Sunil Ashtekar | Processes for preparing benzoquinones and hydroquinones |
| US20050137380A1 (en) * | 2003-12-18 | 2005-06-23 | Mahalingam Rathinam J. | Processes for preparing benzoquinones and hydroquinones |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3219626A (en) * | 1961-05-29 | 1965-11-23 | Gen Electric | Process for oxidizing phenols to polyphenyl ethers and diphenoquinones |
| US3219625A (en) * | 1961-05-29 | 1965-11-23 | Gen Electric | Process for oxidizing phenols to polyphenyl ethers and diphenoquinones |
| US3213114A (en) * | 1962-06-19 | 1965-10-19 | Ethyl Corp | Preparation of quinones and hydroquinones |
| IL39225A (en) * | 1971-05-17 | 1975-07-28 | Sparamedica Ag | Process for the manufacture of methyl substituted p-benzoquinones |
-
1973
- 1973-09-28 US US401724A patent/US3870731A/en not_active Expired - Lifetime
-
1974
- 1974-08-27 CA CA207,915A patent/CA1016953A/en not_active Expired
- 1974-09-06 GB GB39010/74A patent/GB1487091A/en not_active Expired
- 1974-09-16 DE DE2444234A patent/DE2444234C2/de not_active Expired
- 1974-09-17 ZA ZA00745899A patent/ZA745899B/xx unknown
- 1974-09-24 IT IT53181/74A patent/IT1029594B/it active
- 1974-09-25 FR FR7432312A patent/FR2245602B1/fr not_active Expired
- 1974-09-26 BE BE148954A patent/BE820402A/xx not_active IP Right Cessation
- 1974-09-27 NL NL7412824A patent/NL7412824A/xx not_active Application Discontinuation
- 1974-09-28 JP JP49111335A patent/JPS5747894B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2245602A1 (enExample) | 1975-04-25 |
| IT1029594B (it) | 1979-03-20 |
| GB1487091A (en) | 1977-09-28 |
| FR2245602B1 (enExample) | 1976-10-22 |
| US3870731A (en) | 1975-03-11 |
| NL7412824A (nl) | 1975-04-02 |
| DE2444234A1 (de) | 1975-04-03 |
| CA1016953A (en) | 1977-09-06 |
| BE820402A (fr) | 1975-01-16 |
| JPS5059342A (enExample) | 1975-05-22 |
| JPS5747894B2 (enExample) | 1982-10-13 |
| ZA745899B (en) | 1975-09-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2444234C2 (de) | Verfahren zur Herstellung von p-Benzochinonen | |
| DE2516567A1 (de) | Verfahren zum chlorieren von aromatischen verbindungen | |
| DE3826073A1 (de) | Verfahren zur oxidation von 5-hydroxymethylfurfural | |
| CH631956A5 (de) | Verfahren zur herstellung von 2,5-dichlorphenol. | |
| DE2827552A1 (de) | Verfahren zur herstellung von p-benzochinon | |
| DE2139564B2 (de) | Verfahren zur Herstellung von 33'33'-Tetra-isopropyl-4,4'-hydroxydiphenyl | |
| DE2411826A1 (de) | Verfahren zur herstellung von merkaptophenolen | |
| DE2538158C3 (de) | Verfahren zur Herstellung von monochlorbenzoylchlorid | |
| DE69429789T2 (de) | Verfahren zur Herstellung von Phenolen | |
| DE1141275B (de) | Verfahren zur Herstellung eines Chlorbutenins der empirischen Formel C H Cl | |
| EP0387820B1 (de) | Verfahren zur Herstellung von 2,3,5-Trimethyl-p-benzochinon | |
| DE2337621A1 (de) | Verfahren zur kernchlorierung einer aromatischen verbindung | |
| DE2802863A1 (de) | Verfahren zur abtrennung von p-benzochinon aus den reaktionsprodukten der phenoloxydation | |
| DE1210771B (de) | Verfahren zur Herstellung von araliphatischen Dicarbinolen | |
| DE2355040C3 (de) | Verfahren zur Herstellung von Dicyan | |
| DE2751662C2 (de) | Verfahren zur Herstellung von 1,4-Dihydroanthrachinonen | |
| DE2006205A1 (de) | Verfahren zur Herstellung von Nitrophenol und Salzen desselben | |
| DE1933419C3 (de) | Verfahren zur Herstellung eines l,l'-Dimethyl-4,4'-bipyridyliumsalzes | |
| EP0179931B1 (de) | Verfahren zur Herstellung von Thiurampolysulfiden | |
| DD201584A5 (de) | Verfahren zur selektiven herstellung m-chlorierter aniline | |
| DE1168408B (de) | Verfahren zur Herstellung von ª‰-Methylmercaptopropionaldehyd | |
| DE1201262B (de) | Verfahren zur praktisch voelligen Entfernung von in Wasser geloestem Sauerstoff | |
| DE2110516A1 (de) | Verfahren zur Herstellung von 1,1'-disubstituierten 4,4'-Bipyridyliumsalzen | |
| DE1468046A1 (de) | Verfahren zur Herstellung von AEthylenoxyd | |
| DE1963385C3 (de) | Verfahren zur Herstellung gesättigter, unverzweigter aliphatischer oder alicyclischer Sulfonsäuren mit 6 bis 30 Kohlenstoffatomen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8330 | Complete disclaimer |