DE2440608A1 - Reinigungszubereitung - Google Patents
ReinigungszubereitungInfo
- Publication number
- DE2440608A1 DE2440608A1 DE2440608A DE2440608A DE2440608A1 DE 2440608 A1 DE2440608 A1 DE 2440608A1 DE 2440608 A DE2440608 A DE 2440608A DE 2440608 A DE2440608 A DE 2440608A DE 2440608 A1 DE2440608 A1 DE 2440608A1
- Authority
- DE
- Germany
- Prior art keywords
- preparation
- weight
- water
- preparation according
- sodium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000002360 preparation method Methods 0.000 title claims description 43
- 238000004140 cleaning Methods 0.000 title claims description 8
- 239000002904 solvent Substances 0.000 claims description 34
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 19
- SVTBMSDMJJWYQN-UHFFFAOYSA-N 2-methylpentane-2,4-diol Chemical compound CC(O)CC(C)(C)O SVTBMSDMJJWYQN-UHFFFAOYSA-N 0.000 claims description 14
- 229910052783 alkali metal Inorganic materials 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- -1 alkali metal salts Chemical class 0.000 claims description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 11
- 229930195733 hydrocarbon Natural products 0.000 claims description 9
- 150000002430 hydrocarbons Chemical class 0.000 claims description 9
- 239000004215 Carbon black (E152) Substances 0.000 claims description 8
- 229940051250 hexylene glycol Drugs 0.000 claims description 7
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 239000003960 organic solvent Substances 0.000 claims description 6
- 239000004094 surface-active agent Substances 0.000 claims description 6
- BTMZHHCFEOXAAN-UHFFFAOYSA-N 2-[bis(2-hydroxyethyl)amino]ethanol;2-dodecylbenzenesulfonic acid Chemical compound OCCN(CCO)CCO.CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O BTMZHHCFEOXAAN-UHFFFAOYSA-N 0.000 claims description 5
- 239000004115 Sodium Silicate Substances 0.000 claims description 5
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 claims description 5
- 229910052911 sodium silicate Inorganic materials 0.000 claims description 5
- WCNNLAJSTDTFBA-UHFFFAOYSA-M sodium;4-(4-decoxysulfonylphenoxy)benzenesulfonate Chemical compound [Na+].C1=CC(S(=O)(=O)OCCCCCCCCCC)=CC=C1OC1=CC=C(S([O-])(=O)=O)C=C1 WCNNLAJSTDTFBA-UHFFFAOYSA-M 0.000 claims description 5
- 229940105956 tea-dodecylbenzenesulfonate Drugs 0.000 claims description 5
- 150000002334 glycols Chemical class 0.000 claims description 4
- 239000004519 grease Substances 0.000 claims description 4
- 239000003350 kerosene Substances 0.000 claims description 4
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 claims description 3
- 239000004615 ingredient Substances 0.000 claims description 3
- 239000003208 petroleum Substances 0.000 claims description 3
- 150000005215 alkyl ethers Chemical class 0.000 claims description 2
- 150000003460 sulfonic acids Chemical class 0.000 claims description 2
- 239000006260 foam Substances 0.000 claims 1
- 238000000034 method Methods 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000012459 cleaning agent Substances 0.000 description 6
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 6
- 150000001340 alkali metals Chemical class 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 238000005187 foaming Methods 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- ZIWRUEGECALFST-UHFFFAOYSA-M sodium 4-(4-dodecoxysulfonylphenoxy)benzenesulfonate Chemical compound [Na+].CCCCCCCCCCCCOS(=O)(=O)c1ccc(Oc2ccc(cc2)S([O-])(=O)=O)cc1 ZIWRUEGECALFST-UHFFFAOYSA-M 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 229910021538 borax Inorganic materials 0.000 description 2
- 239000003599 detergent Substances 0.000 description 2
- SXCBDZAEHILGLM-UHFFFAOYSA-N heptane-1,7-diol Chemical compound OCCCCCCCO SXCBDZAEHILGLM-UHFFFAOYSA-N 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 229940048086 sodium pyrophosphate Drugs 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 235000010339 sodium tetraborate Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229950011008 tetrachloroethylene Drugs 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 2
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 2
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 1
- BOSAWIQFTJIYIS-UHFFFAOYSA-N 1,1,1-trichloro-2,2,2-trifluoroethane Chemical compound FC(F)(F)C(Cl)(Cl)Cl BOSAWIQFTJIYIS-UHFFFAOYSA-N 0.000 description 1
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- AJDIZQLSFPQPEY-UHFFFAOYSA-N 1,1,2-Trichlorotrifluoroethane Chemical compound FC(F)(Cl)C(F)(Cl)Cl AJDIZQLSFPQPEY-UHFFFAOYSA-N 0.000 description 1
- YHRUOJUYPBUZOS-UHFFFAOYSA-N 1,3-dichloropropane Chemical compound ClCCCCl YHRUOJUYPBUZOS-UHFFFAOYSA-N 0.000 description 1
- KJDRSWPQXHESDQ-UHFFFAOYSA-N 1,4-dichlorobutane Chemical compound ClCCCCCl KJDRSWPQXHESDQ-UHFFFAOYSA-N 0.000 description 1
- MOMKYJPSVWEWPM-UHFFFAOYSA-N 4-(chloromethyl)-2-(4-methylphenyl)-1,3-thiazole Chemical compound C1=CC(C)=CC=C1C1=NC(CCl)=CS1 MOMKYJPSVWEWPM-UHFFFAOYSA-N 0.000 description 1
- BLFRQYKZFKYQLO-UHFFFAOYSA-N 4-aminobutan-1-ol Chemical compound NCCCCO BLFRQYKZFKYQLO-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- SLINHMUFWFWBMU-UHFFFAOYSA-N Triisopropanolamine Chemical compound CC(O)CN(CC(C)O)CC(C)O SLINHMUFWFWBMU-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- LVTYICIALWPMFW-UHFFFAOYSA-N diisopropanolamine Chemical compound CC(O)CNCC(C)O LVTYICIALWPMFW-UHFFFAOYSA-N 0.000 description 1
- 229940043276 diisopropanolamine Drugs 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 1
- 239000010771 distillate fuel oil Substances 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000005341 metaphosphate group Chemical group 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002826 nitrites Chemical class 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- 235000019983 sodium metaphosphate Nutrition 0.000 description 1
- 235000019795 sodium metasilicate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 1
- POWFTOSLLWLEBN-UHFFFAOYSA-N tetrasodium;silicate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-][Si]([O-])([O-])[O-] POWFTOSLLWLEBN-UHFFFAOYSA-N 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 1
- 235000019801 trisodium phosphate Nutrition 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/0005—Other compounding ingredients characterised by their effect
- C11D3/0094—High foaming compositions
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/43—Solvents
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US392647A US3915902A (en) | 1973-08-29 | 1973-08-29 | Cleaning compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2440608A1 true DE2440608A1 (de) | 1975-03-13 |
Family
ID=23551452
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2440608A Pending DE2440608A1 (de) | 1973-08-29 | 1974-08-23 | Reinigungszubereitung |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3915902A (enExample) |
| JP (1) | JPS5072905A (enExample) |
| DE (1) | DE2440608A1 (enExample) |
| FR (1) | FR2242461B3 (enExample) |
| GB (1) | GB1438447A (enExample) |
| IT (1) | IT1020225B (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5354208A (en) * | 1976-10-27 | 1978-05-17 | Kao Corp | Detergent composition for dry cleaning |
| US4219333A (en) * | 1978-07-03 | 1980-08-26 | Harris Robert D | Carbonated cleaning solution |
| US4306989A (en) * | 1979-10-09 | 1981-12-22 | Lift-Off, Inc. | Composition for releasing adhesives from a surface |
| US4302365A (en) * | 1980-02-11 | 1981-11-24 | American Grease Stick Company | Engine degreaser composition |
| US4501682A (en) * | 1982-12-17 | 1985-02-26 | Edward Goodman | Cleaning and protective composition and method |
| US4592856A (en) * | 1983-11-14 | 1986-06-03 | Shin-Etsu Chemical Co., Ltd. | Liquid detergent composition |
| US4543206A (en) * | 1984-05-03 | 1985-09-24 | Adams Cornell L | Nail lacquer and enamel remover |
| US4780100A (en) * | 1984-12-14 | 1988-10-25 | The Clorox Company | Fabric cleaner |
| US4652389A (en) * | 1984-12-14 | 1987-03-24 | The Clorox Company | Carpet cleaner |
| US4879419A (en) * | 1985-07-01 | 1989-11-07 | Minnesota Mining And Manufacturing Company | Hydroxyl-terminated polyepichlorohydrin polymers |
| GB8519699D0 (en) * | 1985-08-06 | 1985-09-11 | Procter & Gamble | Scouring compositions |
| US4810411A (en) * | 1986-04-16 | 1989-03-07 | E. I. Du Pont De Nemours And Company | Solvent-based fabric protector |
| EP0330379A3 (en) * | 1988-02-26 | 1990-04-18 | The British Petroleum Company p.l.c. | Cleansing compositions |
| WO1994003571A1 (en) * | 1992-07-31 | 1994-02-17 | Henkel Corporation | Process and aqueous composition for degreasing metal surface |
| JPH06226226A (ja) * | 1993-02-01 | 1994-08-16 | Tootaru Service:Kk | 建造物外壁表面の清掃方法 |
| US5454969A (en) * | 1993-06-18 | 1995-10-03 | Fields; Paul B. | Cleaning fluids |
| TW324029B (en) * | 1994-01-11 | 1998-01-01 | Mitsubishi Chem Corp | De-oiling cleaner composition |
| US6315949B1 (en) | 1999-12-30 | 2001-11-13 | Robert Carmello | Composition for carpet and room deodorizer and method of delivering the composition |
| US6943142B2 (en) * | 2002-01-09 | 2005-09-13 | Air Products And Chemicals, Inc. | Aqueous stripping and cleaning composition |
| CN104395451A (zh) * | 2012-06-19 | 2015-03-04 | 宝洁公司 | 用于清洁交通工具的外表面的表面活性剂组合物以及方法 |
| US12534691B2 (en) | 2022-09-13 | 2026-01-27 | Envirox, L.L.C. | Potential of hydrogen (pH) stabilized cleaning formulations |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA797197A (en) * | 1965-12-09 | 1968-10-22 | Witco Chemical Company | Liquid detergent composition |
| US3634272A (en) * | 1968-10-25 | 1972-01-11 | Dow Chemical Co | Systems for solubilizing water and halogenated aliphatic hydrocarbons |
| US3634338A (en) * | 1970-07-10 | 1972-01-11 | Grace W R & Co | Method and composition for cleaning aluminum magnesiumand alloys thereof |
| US3835070A (en) * | 1972-04-17 | 1974-09-10 | Diamond Shamrock Corp | Hard surface cleaners |
-
1973
- 1973-08-29 US US392647A patent/US3915902A/en not_active Expired - Lifetime
-
1974
- 1974-08-20 GB GB3661774A patent/GB1438447A/en not_active Expired
- 1974-08-23 DE DE2440608A patent/DE2440608A1/de active Pending
- 1974-08-26 FR FR7429091A patent/FR2242461B3/fr not_active Expired
- 1974-08-27 IT IT26650/74A patent/IT1020225B/it active
- 1974-08-28 JP JP49098808A patent/JPS5072905A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| FR2242461B3 (enExample) | 1977-06-17 |
| US3915902A (en) | 1975-10-28 |
| GB1438447A (en) | 1976-06-09 |
| IT1020225B (it) | 1977-12-20 |
| JPS5072905A (enExample) | 1975-06-16 |
| FR2242461A1 (enExample) | 1975-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2440608A1 (de) | Reinigungszubereitung | |
| DE69225033T2 (de) | Glasreinigungsmittel | |
| DE69017684T2 (de) | Verbesserte wässrige reinigungs-/entfettungszusammensetzungen. | |
| DE69412080T2 (de) | Verbesserte fussbodenabbeizzusammensetung und verfahren | |
| DE2558988C2 (de) | Flüssige Haushaltsreinigungsmittel | |
| DE68924189T2 (de) | Ein unpolares Lösungsmittel enthaltende flüssige Reinigungszusammensetzung. | |
| DE69029472T2 (de) | Verbesserte gerüststoffe enthaltende wässrige reinigungs-/entfettungs-mikroemulsionszusammensetzungen | |
| DE1669102A1 (de) | Scheuermittel | |
| DE1467704B1 (de) | Verfahren zur Herstellung von waessrigen Hochleistungs-Waschund Reinigungsmitteln | |
| DE1243313B (de) | Fluessiges Reinigungsmittelkonzentrat | |
| DE1519054B2 (de) | Fluessiges scheuermittel | |
| DE1669103A1 (de) | Scheuermittel | |
| EP0019734B1 (de) | Waschmittel für Textilien | |
| DE2060849A1 (de) | Waschmittel zum gleichzeitigen Reinigen und Weichmachen | |
| DE1617116C3 (de) | Schwachschäumende Wasch- und Reinigungsmittel | |
| DE1617173A1 (de) | Fluessiges Reinigungsmittel | |
| WO2000039270A1 (de) | Wässriges mehrphasiges reinigungsmittel | |
| DE2505252A1 (de) | Verfahren zum reinigen und entfetten von gegenstaenden | |
| DE1250949B (de) | Gießfahiges Scheuerund Reinigungsmittel | |
| WO1998051766A1 (de) | Feststoffzubereitungen | |
| CH635614A5 (en) | Liquid detergent and process for its preparation | |
| DE1075779B (de) | Hochleistungsfähiges, flüssiges Reinigungsmittel | |
| DE2918364A1 (de) | Waschmittel fuer textilien | |
| DE1937272A1 (de) | Halogenierte Kohlenwasserstoff-Stoffzusammensetzungen | |
| DE102005047462A1 (de) | Kurzkettige Alkoholethoxilate und Lösemittel enthaltende Reinigungsmittel |