DE2429923A1 - 1-(arylamino)-pyrrole und 1-(arylimino)-pyrrole, verfahren zu ihrer herstellung und mittel, worin diese verbindungen enthalten sind - Google Patents
1-(arylamino)-pyrrole und 1-(arylimino)-pyrrole, verfahren zu ihrer herstellung und mittel, worin diese verbindungen enthalten sindInfo
- Publication number
- DE2429923A1 DE2429923A1 DE2429923A DE2429923A DE2429923A1 DE 2429923 A1 DE2429923 A1 DE 2429923A1 DE 2429923 A DE2429923 A DE 2429923A DE 2429923 A DE2429923 A DE 2429923A DE 2429923 A1 DE2429923 A1 DE 2429923A1
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen
- compound
- formula
- benzoyl
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 150000001875 compounds Chemical class 0.000 title claims description 97
- 238000000034 method Methods 0.000 title claims description 53
- 238000004519 manufacturing process Methods 0.000 title description 2
- 239000001257 hydrogen Substances 0.000 claims description 61
- 229910052739 hydrogen Inorganic materials 0.000 claims description 61
- -1 hydroxy, benzyloxy Chemical group 0.000 claims description 42
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims description 36
- 150000002431 hydrogen Chemical class 0.000 claims description 31
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 28
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 24
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 16
- 238000002360 preparation method Methods 0.000 claims description 13
- 125000001589 carboacyl group Chemical group 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 229910052783 alkali metal Inorganic materials 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 claims description 7
- 230000003197 catalytic effect Effects 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- LCVYXMYHLRZUGJ-UHFFFAOYSA-N 4-(pyrrol-1-ylamino)phenol Chemical compound C1=CC(O)=CC=C1NN1C=CC=C1 LCVYXMYHLRZUGJ-UHFFFAOYSA-N 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 125000000018 nitroso group Chemical group N(=O)* 0.000 claims description 4
- 239000006227 byproduct Substances 0.000 claims description 3
- 238000007327 hydrogenolysis reaction Methods 0.000 claims description 3
- ULUNQYODBKLBOE-UHFFFAOYSA-N 2-(1h-pyrrol-2-yl)-1h-pyrrole Chemical compound C1=CNC(C=2NC=CC=2)=C1 ULUNQYODBKLBOE-UHFFFAOYSA-N 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 238000005904 alkaline hydrolysis reaction Methods 0.000 claims description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims 3
- 239000003937 drug carrier Substances 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 239000008177 pharmaceutical agent Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 58
- 239000000243 solution Substances 0.000 description 46
- 238000006243 chemical reaction Methods 0.000 description 44
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 41
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical group CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 34
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 33
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 33
- 239000000203 mixture Substances 0.000 description 31
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 27
- 238000002844 melting Methods 0.000 description 26
- 230000008018 melting Effects 0.000 description 26
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 25
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 239000003921 oil Substances 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 17
- 235000019441 ethanol Nutrition 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- 230000007062 hydrolysis Effects 0.000 description 14
- 238000006460 hydrolysis reaction Methods 0.000 description 14
- YNZAFFFENDLJQG-UHFFFAOYSA-N pyrrol-1-amine Chemical compound NN1C=CC=C1 YNZAFFFENDLJQG-UHFFFAOYSA-N 0.000 description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 13
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 13
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 13
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 13
- 229960000583 acetic acid Drugs 0.000 description 13
- 229910000104 sodium hydride Inorganic materials 0.000 description 13
- 239000012312 sodium hydride Substances 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 239000012362 glacial acetic acid Substances 0.000 description 12
- 239000007787 solid Substances 0.000 description 12
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical compound ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 10
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 9
- 239000003610 charcoal Substances 0.000 description 9
- 239000003960 organic solvent Substances 0.000 description 9
- GFISDBXSWQMOND-UHFFFAOYSA-N 2,5-dimethoxyoxolane Chemical compound COC1CCC(OC)O1 GFISDBXSWQMOND-UHFFFAOYSA-N 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 239000000284 extract Substances 0.000 description 8
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical group [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 238000009833 condensation Methods 0.000 description 6
- 230000005494 condensation Effects 0.000 description 6
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- 241000588724 Escherichia coli Species 0.000 description 5
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 5
- 238000006264 debenzylation reaction Methods 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 150000007857 hydrazones Chemical class 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000001632 sodium acetate Substances 0.000 description 5
- 235000017281 sodium acetate Nutrition 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 238000010531 catalytic reduction reaction Methods 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 description 4
- 235000010755 mineral Nutrition 0.000 description 4
- 239000011707 mineral Substances 0.000 description 4
- 239000002480 mineral oil Substances 0.000 description 4
- 235000010446 mineral oil Nutrition 0.000 description 4
- 150000003233 pyrroles Chemical class 0.000 description 4
- 238000006722 reduction reaction Methods 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- ZLKHNURELCONBB-UHFFFAOYSA-N 2,5-diethoxyoxolane Chemical compound CCOC1CCC(OCC)O1 ZLKHNURELCONBB-UHFFFAOYSA-N 0.000 description 3
- 241000191967 Staphylococcus aureus Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000000844 anti-bacterial effect Effects 0.000 description 3
- 125000004467 aryl imino group Chemical group 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 229910001923 silver oxide Inorganic materials 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- SYTKTCPLMJQMEU-UHFFFAOYSA-N 1-(4-hydroxyanilino)pyrrole-2-carboxylic acid Chemical compound OC(=O)C1=CC=CN1NC1=CC=C(O)C=C1 SYTKTCPLMJQMEU-UHFFFAOYSA-N 0.000 description 2
- FYXHMSKSSNNZNI-UHFFFAOYSA-N 1-n-phenyl-4-n-pyrrol-1-ylbenzene-1,4-diamine Chemical compound C=1C=C(NN2C=CC=C2)C=CC=1NC1=CC=CC=C1 FYXHMSKSSNNZNI-UHFFFAOYSA-N 0.000 description 2
- OJVAMHKKJGICOG-UHFFFAOYSA-N 2,5-hexanedione Chemical compound CC(=O)CCC(C)=O OJVAMHKKJGICOG-UHFFFAOYSA-N 0.000 description 2
- RDQSIADLBQFVMY-UHFFFAOYSA-N 2,6-Di-tert-butylbenzoquinone Chemical compound CC(C)(C)C1=CC(=O)C=C(C(C)(C)C)C1=O RDQSIADLBQFVMY-UHFFFAOYSA-N 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 2
- VTWDKFNVVLAELH-UHFFFAOYSA-N 2-methylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=CC(=O)C=CC1=O VTWDKFNVVLAELH-UHFFFAOYSA-N 0.000 description 2
- PZAOCAWPHTYAPM-UHFFFAOYSA-N 3-chloro-4-(pyrrol-1-ylamino)phenol Chemical compound ClC1=CC(O)=CC=C1NN1C=CC=C1 PZAOCAWPHTYAPM-UHFFFAOYSA-N 0.000 description 2
- LQEMLLZIFVUVGB-UHFFFAOYSA-N 4-(pyrrol-1-ylamino)naphthalen-1-ol Chemical compound C12=CC=CC=C2C(O)=CC=C1NN1C=CC=C1 LQEMLLZIFVUVGB-UHFFFAOYSA-N 0.000 description 2
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 2
- JSTCPNFNKICNNO-UHFFFAOYSA-N 4-nitrosophenol Chemical compound OC1=CC=C(N=O)C=C1 JSTCPNFNKICNNO-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- ZJMSXVSGTCVBQK-UHFFFAOYSA-N I.I.I.I.I.I.I Chemical compound I.I.I.I.I.I.I ZJMSXVSGTCVBQK-UHFFFAOYSA-N 0.000 description 2
- 241000588770 Proteus mirabilis Species 0.000 description 2
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 241000193996 Streptococcus pyogenes Species 0.000 description 2
- SUAGZGXUYANTEF-UHFFFAOYSA-N [4-(pyrrol-1-ylamino)phenyl] acetate Chemical compound C1=CC(OC(=O)C)=CC=C1NN1C=CC=C1 SUAGZGXUYANTEF-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 2
- 150000008046 alkali metal hydrides Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 239000011260 aqueous acid Substances 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- 235000015110 jellies Nutrition 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- KXWRAYYJNDJVHT-UHFFFAOYSA-N n-(4-phenylmethoxyphenyl)benzohydrazide;hydrochloride Chemical compound Cl.C=1C=C(OCC=2C=CC=CC=2)C=CC=1N(N)C(=O)C1=CC=CC=C1 KXWRAYYJNDJVHT-UHFFFAOYSA-N 0.000 description 2
- PUVBCJVTJIXJSC-UHFFFAOYSA-N n-(4-phenylmethoxyphenyl)pyrrol-1-amine Chemical compound C=1C=CC=CC=1COC(C=C1)=CC=C1NN1C=CC=C1 PUVBCJVTJIXJSC-UHFFFAOYSA-N 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 238000006400 oxidative hydrolysis reaction Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000012216 screening Methods 0.000 description 2
- 229910001961 silver nitrate Inorganic materials 0.000 description 2
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- XFPZHTAACFASBH-UHFFFAOYSA-N (4-benzamidonaphthalen-1-yl) benzoate Chemical compound O=C(NC1=CC=C(OC(=O)C2=CC=CC=C2)C2=CC=CC=C12)C1=CC=CC=C1 XFPZHTAACFASBH-UHFFFAOYSA-N 0.000 description 1
- PVRSIFAEUCUJPK-UHFFFAOYSA-N (4-methoxyphenyl)hydrazine Chemical compound COC1=CC=C(NN)C=C1 PVRSIFAEUCUJPK-UHFFFAOYSA-N 0.000 description 1
- UFZKWTITXBRSPK-UHFFFAOYSA-N (4-phenylmethoxyphenyl)hydrazine Chemical compound C1=CC(NN)=CC=C1OCC1=CC=CC=C1 UFZKWTITXBRSPK-UHFFFAOYSA-N 0.000 description 1
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- XJVRSLICNXRPEI-UHFFFAOYSA-N 1-(4-phenylmethoxyanilino)pyrrole-2-carboxylic acid Chemical compound OC(=O)C1=CC=CN1NC(C=C1)=CC=C1OCC1=CC=CC=C1 XJVRSLICNXRPEI-UHFFFAOYSA-N 0.000 description 1
- KITIONBPMFRDGN-UHFFFAOYSA-N 1-methyl-1-(4-phenylmethoxyphenyl)hydrazine Chemical compound C1=CC(N(N)C)=CC=C1OCC1=CC=CC=C1 KITIONBPMFRDGN-UHFFFAOYSA-N 0.000 description 1
- VSCACTWWDUEVOZ-UHFFFAOYSA-N 1-n-methyl-4-n-pyrrol-1-ylbenzene-1,4-diamine Chemical compound C1=CC(NC)=CC=C1NN1C=CC=C1 VSCACTWWDUEVOZ-UHFFFAOYSA-N 0.000 description 1
- QLSWIGRIBOSFMV-UHFFFAOYSA-N 1h-pyrrol-2-amine Chemical compound NC1=CC=CN1 QLSWIGRIBOSFMV-UHFFFAOYSA-N 0.000 description 1
- KRMMRHMTSOXJIC-UHFFFAOYSA-N 2,2,2-trifluoro-n-methyl-n-(4-nitrophenyl)acetamide Chemical compound FC(F)(F)C(=O)N(C)C1=CC=C([N+]([O-])=O)C=C1 KRMMRHMTSOXJIC-UHFFFAOYSA-N 0.000 description 1
- OUYLXVQKVBXUGW-UHFFFAOYSA-N 2,3-dimethyl-1h-pyrrole Chemical compound CC=1C=CNC=1C OUYLXVQKVBXUGW-UHFFFAOYSA-N 0.000 description 1
- HSDMSKWZYVLKSK-UHFFFAOYSA-N 2,5-dimethyl-n-(4-phenylmethoxyphenyl)pyrrol-1-amine Chemical compound CC1=CC=C(C)N1NC(C=C1)=CC=C1OCC1=CC=CC=C1 HSDMSKWZYVLKSK-UHFFFAOYSA-N 0.000 description 1
- SCKJELMIZWKQTP-UHFFFAOYSA-N 2,5-dimethyl-n-phenylpyrrol-1-amine Chemical compound CC1=CC=C(C)N1NC1=CC=CC=C1 SCKJELMIZWKQTP-UHFFFAOYSA-N 0.000 description 1
- SENUUPBBLQWHMF-UHFFFAOYSA-N 2,6-dimethylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=CC(=O)C=C(C)C1=O SENUUPBBLQWHMF-UHFFFAOYSA-N 0.000 description 1
- JVOJGKVROSEMSG-UHFFFAOYSA-N 2-(4-phenylmethoxyphenyl)-3ah-pyrrolo[1,2-b]pyrazole-3,4-dione Chemical compound O=C1C2C(=O)C=CN2N=C1C(C=C1)=CC=C1OCC1=CC=CC=C1 JVOJGKVROSEMSG-UHFFFAOYSA-N 0.000 description 1
- FCOOKTYMYZQRKJ-UHFFFAOYSA-N 2-(pyrrol-1-ylamino)phenol Chemical compound OC1=CC=CC=C1NN1C=CC=C1 FCOOKTYMYZQRKJ-UHFFFAOYSA-N 0.000 description 1
- PCAOYIXQKCKNNT-UHFFFAOYSA-N 3,4-bis(phenylmethoxy)aniline Chemical compound C=1C=CC=CC=1COC1=CC(N)=CC=C1OCC1=CC=CC=C1 PCAOYIXQKCKNNT-UHFFFAOYSA-N 0.000 description 1
- RHDPXJYWOWFLJU-UHFFFAOYSA-N 3-(pyrrol-1-ylamino)phenol Chemical compound OC1=CC=CC(NN2C=CC=C2)=C1 RHDPXJYWOWFLJU-UHFFFAOYSA-N 0.000 description 1
- IGPFOKFDBICQMC-UHFFFAOYSA-N 3-phenylmethoxyaniline Chemical compound NC1=CC=CC(OCC=2C=CC=CC=2)=C1 IGPFOKFDBICQMC-UHFFFAOYSA-N 0.000 description 1
- YBIBSBKCWYOJEC-UHFFFAOYSA-N 4-[(2,5-dimethylpyrrol-1-yl)amino]phenol Chemical compound CC1=CC=C(C)N1NC1=CC=C(O)C=C1 YBIBSBKCWYOJEC-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- ZVNPWFOVUDMGRP-UHFFFAOYSA-N 4-methylaminophenol sulfate Chemical compound OS(O)(=O)=O.CNC1=CC=C(O)C=C1.CNC1=CC=C(O)C=C1 ZVNPWFOVUDMGRP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- XDVRSEBQHQJYRW-UHFFFAOYSA-N Cl.C(C1=CC=CC=C1)(=O)N(N=CC)C1=CC=C(C=C1)OC Chemical compound Cl.C(C1=CC=CC=C1)(=O)N(N=CC)C1=CC=C(C=C1)OC XDVRSEBQHQJYRW-UHFFFAOYSA-N 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- PBLTZVFJTZVIMP-UHFFFAOYSA-N N-[2-(4-chloroanilino)phenyl]benzohydrazide Chemical compound C(C1=CC=CC=C1)(=O)N(N)C1=C(C=CC=C1)NC1=CC=C(C=C1)Cl PBLTZVFJTZVIMP-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- 241000191940 Staphylococcus Species 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- MPRIYAPTRRYMSW-UHFFFAOYSA-N [4-[benzoyl(pyrrol-1-yl)amino]phenyl] benzoate Chemical compound C=1C=CC=CC=1C(=O)OC(C=C1)=CC=C1N(N1C=CC=C1)C(=O)C1=CC=CC=C1 MPRIYAPTRRYMSW-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000006254 arylation reaction Methods 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 238000006480 benzoylation reaction Methods 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- PNEVDCGZQWFIKV-UHFFFAOYSA-N hydron;4-n-phenylbenzene-1,4-diamine;chloride Chemical compound Cl.C1=CC(N)=CC=C1NC1=CC=CC=C1 PNEVDCGZQWFIKV-UHFFFAOYSA-N 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008274 jelly Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- QTHYKOVWPAETGA-UHFFFAOYSA-N n-(2,5-dimethylpyrrol-1-yl)-n-(4-phenylmethoxyphenyl)benzamide Chemical compound CC1=CC=C(C)N1N(C=1C=CC(OCC=2C=CC=CC=2)=CC=1)C(=O)C1=CC=CC=C1 QTHYKOVWPAETGA-UHFFFAOYSA-N 0.000 description 1
- UYKVWAQEMQDRGG-UHFFFAOYSA-N n-(2-hydroxyphenyl)benzamide Chemical compound OC1=CC=CC=C1NC(=O)C1=CC=CC=C1 UYKVWAQEMQDRGG-UHFFFAOYSA-N 0.000 description 1
- UEWAKQZKWOWTKJ-UHFFFAOYSA-N n-(2-phenylmethoxyphenyl)-n-pyrrol-1-ylbenzamide Chemical compound C=1C=CC=CC=1C(=O)N(N1C=CC=C1)C1=CC=CC=C1OCC1=CC=CC=C1 UEWAKQZKWOWTKJ-UHFFFAOYSA-N 0.000 description 1
- SAAWMKNAVUIMIZ-UHFFFAOYSA-N n-(2-phenylmethoxyphenyl)benzamide Chemical compound C=1C=CC=CC=1C(=O)NC1=CC=CC=C1OCC1=CC=CC=C1 SAAWMKNAVUIMIZ-UHFFFAOYSA-N 0.000 description 1
- ZFATVXWJDJEUOH-UHFFFAOYSA-N n-(2-phenylmethoxyphenyl)benzohydrazide;hydrochloride Chemical compound Cl.C=1C=CC=C(OCC=2C=CC=CC=2)C=1N(N)C(=O)C1=CC=CC=C1 ZFATVXWJDJEUOH-UHFFFAOYSA-N 0.000 description 1
- YRQBLIVNFJEFCZ-UHFFFAOYSA-N n-(2-phenylmethoxyphenyl)pyrrol-1-amine Chemical compound C=1C=CC=CC=1COC1=CC=CC=C1NN1C=CC=C1 YRQBLIVNFJEFCZ-UHFFFAOYSA-N 0.000 description 1
- ACPOQWJIMWFGOG-UHFFFAOYSA-N n-(3-phenylmethoxyphenyl)-n-pyrrol-1-ylbenzamide Chemical compound C=1C=CC=CC=1C(=O)N(N1C=CC=C1)C(C=1)=CC=CC=1OCC1=CC=CC=C1 ACPOQWJIMWFGOG-UHFFFAOYSA-N 0.000 description 1
- HFFCCLDOINYYHQ-UHFFFAOYSA-N n-(3-phenylmethoxyphenyl)benzamide Chemical class C=1C=CC=CC=1C(=O)NC(C=1)=CC=CC=1OCC1=CC=CC=C1 HFFCCLDOINYYHQ-UHFFFAOYSA-N 0.000 description 1
- SDCKFTKVZGTFGG-UHFFFAOYSA-N n-(3-phenylmethoxyphenyl)pyrrol-1-amine Chemical compound C=1C=CC=CC=1COC(C=1)=CC=CC=1NN1C=CC=C1 SDCKFTKVZGTFGG-UHFFFAOYSA-N 0.000 description 1
- XNJFLZYGLKPRSH-UHFFFAOYSA-N n-(4-aminophenyl)-2,2,2-trifluoro-n-methylacetamide Chemical compound FC(F)(F)C(=O)N(C)C1=CC=C(N)C=C1 XNJFLZYGLKPRSH-UHFFFAOYSA-N 0.000 description 1
- SNNCWRBHNFDVNS-UHFFFAOYSA-N n-(4-anilinophenyl)-n-pyrrol-1-ylbenzamide Chemical compound C=1C=CC=CC=1C(=O)N(N1C=CC=C1)C(C=C1)=CC=C1NC1=CC=CC=C1 SNNCWRBHNFDVNS-UHFFFAOYSA-N 0.000 description 1
- GIXMMHJWAHQSSW-UHFFFAOYSA-N n-(4-anilinophenyl)benzamide Chemical compound C=1C=CC=CC=1C(=O)NC(C=C1)=CC=C1NC1=CC=CC=C1 GIXMMHJWAHQSSW-UHFFFAOYSA-N 0.000 description 1
- HGUBRMAZJLRPNP-UHFFFAOYSA-N n-(4-anilinophenyl)benzohydrazide Chemical compound C=1C=C(NC=2C=CC=CC=2)C=CC=1N(N)C(=O)C1=CC=CC=C1 HGUBRMAZJLRPNP-UHFFFAOYSA-N 0.000 description 1
- OZUFCRAEDISSPP-UHFFFAOYSA-N n-(4-hydroxyphenyl)-n-methylnitrous amide Chemical compound O=NN(C)C1=CC=C(O)C=C1 OZUFCRAEDISSPP-UHFFFAOYSA-N 0.000 description 1
- OTVRBKKATHMHER-UHFFFAOYSA-N n-(4-methoxyphenyl)-n-pyrrol-1-ylbenzamide Chemical compound C1=CC(OC)=CC=C1N(N1C=CC=C1)C(=O)C1=CC=CC=C1 OTVRBKKATHMHER-UHFFFAOYSA-N 0.000 description 1
- YQRSEYWXEWBLPU-UHFFFAOYSA-N n-(4-methoxyphenyl)pyrrol-1-amine Chemical compound C1=CC(OC)=CC=C1NN1C=CC=C1 YQRSEYWXEWBLPU-UHFFFAOYSA-N 0.000 description 1
- LUZWKHAAJVTDFB-UHFFFAOYSA-N n-(4-nitrosophenyl)pyrrol-1-amine Chemical compound C1=CC(N=O)=CC=C1NN1C=CC=C1 LUZWKHAAJVTDFB-UHFFFAOYSA-N 0.000 description 1
- DRRHZQHUUSTLEQ-UHFFFAOYSA-N n-(4-phenylmethoxynaphthalen-1-yl)-n-pyrrol-1-ylbenzamide Chemical compound C=1C=CC=CC=1C(=O)N(N1C=CC=C1)C(C1=CC=CC=C11)=CC=C1OCC1=CC=CC=C1 DRRHZQHUUSTLEQ-UHFFFAOYSA-N 0.000 description 1
- ITYUQOBXJJKRFJ-UHFFFAOYSA-N n-(4-phenylmethoxynaphthalen-1-yl)benzohydrazide Chemical compound C=1C=C(OCC=2C=CC=CC=2)C2=CC=CC=C2C=1N(N)C(=O)C1=CC=CC=C1 ITYUQOBXJJKRFJ-UHFFFAOYSA-N 0.000 description 1
- JDAYVEMXCFATKU-UHFFFAOYSA-N n-(4-phenylmethoxyphenyl)-n-pyrrol-1-ylbenzamide Chemical compound C=1C=CC=CC=1C(=O)N(N1C=CC=C1)C(C=C1)=CC=C1OCC1=CC=CC=C1 JDAYVEMXCFATKU-UHFFFAOYSA-N 0.000 description 1
- TTZLHHXRYFTEHO-UHFFFAOYSA-N n-(4-phenylmethoxyphenyl)benzamide Chemical compound C=1C=CC=CC=1C(=O)NC(C=C1)=CC=C1OCC1=CC=CC=C1 TTZLHHXRYFTEHO-UHFFFAOYSA-N 0.000 description 1
- JKTLJMSCIJYDAN-UHFFFAOYSA-N n-(ethylideneamino)-4-methoxyaniline Chemical compound COC1=CC=C(NN=CC)C=C1 JKTLJMSCIJYDAN-UHFFFAOYSA-N 0.000 description 1
- MLLDXKMQHXBQDU-UHFFFAOYSA-N n-(ethylideneamino)-4-phenylmethoxyaniline Chemical compound C1=CC(NN=CC)=CC=C1OCC1=CC=CC=C1 MLLDXKMQHXBQDU-UHFFFAOYSA-N 0.000 description 1
- JKBFNKXXXKMTEJ-UHFFFAOYSA-N n-(ethylideneamino)-n-(4-phenylmethoxyphenyl)benzamide Chemical compound C=1C=C(OCC=2C=CC=CC=2)C=CC=1N(N=CC)C(=O)C1=CC=CC=C1 JKBFNKXXXKMTEJ-UHFFFAOYSA-N 0.000 description 1
- TUNAYIORBCGKLF-UHFFFAOYSA-N n-[3,4-bis(phenylmethoxy)phenyl]-n-pyrrol-1-ylbenzamide Chemical compound C=1C=CC=CC=1C(=O)N(N1C=CC=C1)C(C=C1OCC=2C=CC=CC=2)=CC=C1OCC1=CC=CC=C1 TUNAYIORBCGKLF-UHFFFAOYSA-N 0.000 description 1
- WXGFQBYJZMRBOR-UHFFFAOYSA-N n-[3,4-bis(phenylmethoxy)phenyl]benzamide Chemical class C=1C=CC=CC=1C(=O)NC(C=C1OCC=2C=CC=CC=2)=CC=C1OCC1=CC=CC=C1 WXGFQBYJZMRBOR-UHFFFAOYSA-N 0.000 description 1
- SVGOAMDZHNSEJP-UHFFFAOYSA-N n-[3,4-bis(phenylmethoxy)phenyl]benzohydrazide;hydrochloride Chemical compound Cl.C=1C=C(OCC=2C=CC=CC=2)C(OCC=2C=CC=CC=2)=CC=1N(N)C(=O)C1=CC=CC=C1 SVGOAMDZHNSEJP-UHFFFAOYSA-N 0.000 description 1
- VDIKUTQXNGWJFT-UHFFFAOYSA-N n-[3,4-bis(phenylmethoxy)phenyl]pyrrol-1-amine Chemical class C=1C=CC=CC=1COC(C(=C1)OCC=2C=CC=CC=2)=CC=C1NN1C=CC=C1 VDIKUTQXNGWJFT-UHFFFAOYSA-N 0.000 description 1
- QNRDKOHZCLMVSL-UHFFFAOYSA-N n-[4-(4-chloroanilino)phenyl]benzamide Chemical compound C1=CC(Cl)=CC=C1NC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 QNRDKOHZCLMVSL-UHFFFAOYSA-N 0.000 description 1
- YUXPMIVLPWJMQV-UHFFFAOYSA-N n-[4-(4-methoxyanilino)phenyl]benzamide Chemical compound C1=CC(OC)=CC=C1NC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 YUXPMIVLPWJMQV-UHFFFAOYSA-N 0.000 description 1
- AYZLWFARWBTJHR-UHFFFAOYSA-N n-[4-(methylamino)phenyl]benzamide Chemical compound C1=CC(NC)=CC=C1NC(=O)C1=CC=CC=C1 AYZLWFARWBTJHR-UHFFFAOYSA-N 0.000 description 1
- GCJIEFIYDVLODG-UHFFFAOYSA-N n-[4-(methylamino)phenyl]benzohydrazide Chemical compound C1=CC(NC)=CC=C1N(N)C(=O)C1=CC=CC=C1 GCJIEFIYDVLODG-UHFFFAOYSA-N 0.000 description 1
- LFOFIPAZRWSXKO-UHFFFAOYSA-N n-[4-[methyl-(2,2,2-trifluoroacetyl)amino]phenyl]benzamide Chemical compound C1=CC(N(C(=O)C(F)(F)F)C)=CC=C1NC(=O)C1=CC=CC=C1 LFOFIPAZRWSXKO-UHFFFAOYSA-N 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- XIFJZJPMHNUGRA-UHFFFAOYSA-N n-methyl-4-nitroaniline Chemical compound CNC1=CC=C([N+]([O-])=O)C=C1 XIFJZJPMHNUGRA-UHFFFAOYSA-N 0.000 description 1
- CFPGFYTWKWFFFM-UHFFFAOYSA-N n-methyl-n-(4-phenylmethoxyphenyl)nitrous amide Chemical compound C1=CC(N(N=O)C)=CC=C1OCC1=CC=CC=C1 CFPGFYTWKWFFFM-UHFFFAOYSA-N 0.000 description 1
- YHRFBXBKVOXQJD-UHFFFAOYSA-N n-methyl-n-(4-phenylmethoxyphenyl)pyrrol-1-amine Chemical compound C1=CC=CN1N(C)C(C=C1)=CC=C1OCC1=CC=CC=C1 YHRFBXBKVOXQJD-UHFFFAOYSA-N 0.000 description 1
- 230000009935 nitrosation Effects 0.000 description 1
- 238000007034 nitrosation reaction Methods 0.000 description 1
- 150000002832 nitroso derivatives Chemical class 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000003431 oxalo group Chemical group 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 230000037081 physical activity Effects 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 208000019206 urinary tract infection Diseases 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C251/72—Hydrazones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/46—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with hetero atoms directly attached to the ring nitrogen atom
- C07D207/50—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US37232473A | 1973-06-21 | 1973-06-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2429923A1 true DE2429923A1 (de) | 1975-01-16 |
Family
ID=23467683
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2429923A Ceased DE2429923A1 (de) | 1973-06-21 | 1974-06-21 | 1-(arylamino)-pyrrole und 1-(arylimino)-pyrrole, verfahren zu ihrer herstellung und mittel, worin diese verbindungen enthalten sind |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4163015A (enExample) |
| JP (1) | JPS5036456A (enExample) |
| AR (2) | AR209274A1 (enExample) |
| BE (1) | BE816542A (enExample) |
| CA (1) | CA1036166A (enExample) |
| CH (2) | CH593935A5 (enExample) |
| DE (1) | DE2429923A1 (enExample) |
| FR (1) | FR2234001B1 (enExample) |
| GB (1) | GB1476503A (enExample) |
| NL (1) | NL7408334A (enExample) |
| PH (1) | PH12084A (enExample) |
| SE (1) | SE405726B (enExample) |
| ZA (1) | ZA743925B (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4452803A (en) * | 1983-09-19 | 1984-06-05 | Hoechst-Roussel Pharmaceuticals, Inc. | Pyrrolylaminopiperidines |
| US4546105A (en) * | 1984-09-04 | 1985-10-08 | Hoechst-Roussel Pharmaceuticals Inc. | Pyrrolylaminopiperidines, compositions thereof and methods of use |
| US8993574B2 (en) | 2008-04-24 | 2015-03-31 | F2G Ltd | Pyrrole antifungal agents |
| US10201524B2 (en) | 2014-11-21 | 2019-02-12 | F2G Limited | Antifungal agents |
| US10973821B2 (en) | 2016-05-25 | 2021-04-13 | F2G Limited | Pharmaceutical formulation |
| US11819503B2 (en) | 2019-04-23 | 2023-11-21 | F2G Ltd | Method of treating coccidioides infection |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4215137A (en) | 1978-06-26 | 1980-07-29 | Sterling Drug Inc. | Method of alleviating diseases by cell-mediated immune modulation |
| US4761159A (en) * | 1984-01-23 | 1988-08-02 | Lewis Knox | Method of chemical deodorization of articles and solutions used in medical and biological procedures |
| JPH02138251A (ja) * | 1989-08-15 | 1990-05-28 | Otsuka Pharmaceut Factory Inc | シクロヘキサジエン誘導体 |
| EP2882726A4 (en) * | 2012-08-09 | 2016-04-06 | Neuropore Therapies Inc | ARYL AND HETEROARYL-SUBSTITUTED BENZENE DERIVATIVES AS MODULATORS OF PI-3 KINASE SIGNALING PATHWAYS |
| BR112020008727A2 (pt) | 2017-10-30 | 2020-10-20 | Neuropore Therapies, Inc. | fenil sulfonil fenil triazol tionas substituídas e usos destas |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2725378A (en) * | 1951-09-19 | 1955-11-29 | Eastman Kodak Co | Pyrrole dyes and methods of making them |
| US4051147A (en) * | 1973-06-21 | 1977-09-27 | Sterling Drug Inc. | 1-(Arylamino)-and 1-(arylimino)-pyrroles |
-
1974
- 1974-06-10 GB GB2559974A patent/GB1476503A/en not_active Expired
- 1974-06-18 FR FR7421142A patent/FR2234001B1/fr not_active Expired
- 1974-06-19 BE BE1006033A patent/BE816542A/xx unknown
- 1974-06-19 AR AR254271A patent/AR209274A1/es active
- 1974-06-19 ZA ZA00743925A patent/ZA743925B/xx unknown
- 1974-06-20 CA CA202,993A patent/CA1036166A/en not_active Expired
- 1974-06-20 CH CH847674A patent/CH593935A5/xx not_active IP Right Cessation
- 1974-06-20 NL NL7408334A patent/NL7408334A/xx not_active Application Discontinuation
- 1974-06-20 SE SE7408207A patent/SE405726B/xx unknown
- 1974-06-20 CH CH260877A patent/CH593936A5/xx not_active IP Right Cessation
- 1974-06-21 JP JP49070323A patent/JPS5036456A/ja active Pending
- 1974-06-21 DE DE2429923A patent/DE2429923A1/de not_active Ceased
- 1974-06-21 PH PH15967A patent/PH12084A/en unknown
-
1975
- 1975-02-28 AR AR257817A patent/AR209294A1/es active
-
1978
- 1978-05-22 US US05/908,468 patent/US4163015A/en not_active Expired - Lifetime
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4452803A (en) * | 1983-09-19 | 1984-06-05 | Hoechst-Roussel Pharmaceuticals, Inc. | Pyrrolylaminopiperidines |
| US4546105A (en) * | 1984-09-04 | 1985-10-08 | Hoechst-Roussel Pharmaceuticals Inc. | Pyrrolylaminopiperidines, compositions thereof and methods of use |
| US8993574B2 (en) | 2008-04-24 | 2015-03-31 | F2G Ltd | Pyrrole antifungal agents |
| US9452168B2 (en) | 2008-04-24 | 2016-09-27 | F2G Ltd | Pyrrole antifungal agents |
| US10201524B2 (en) | 2014-11-21 | 2019-02-12 | F2G Limited | Antifungal agents |
| US10596150B2 (en) | 2014-11-21 | 2020-03-24 | F2G Limited | Antifungal agents |
| US11065228B2 (en) | 2014-11-21 | 2021-07-20 | F2G Limited | Antifungal agents |
| US10973821B2 (en) | 2016-05-25 | 2021-04-13 | F2G Limited | Pharmaceutical formulation |
| US11819503B2 (en) | 2019-04-23 | 2023-11-21 | F2G Ltd | Method of treating coccidioides infection |
Also Published As
| Publication number | Publication date |
|---|---|
| PH12084A (en) | 1978-10-30 |
| FR2234001B1 (enExample) | 1978-03-24 |
| SE405726B (sv) | 1978-12-27 |
| JPS5036456A (enExample) | 1975-04-05 |
| AR209274A1 (es) | 1977-04-15 |
| AR209294A1 (es) | 1977-04-15 |
| BE816542A (fr) | 1974-12-19 |
| AU7023474A (en) | 1976-01-08 |
| CH593936A5 (enExample) | 1977-12-30 |
| FR2234001A1 (enExample) | 1975-01-17 |
| ZA743925B (en) | 1975-06-25 |
| GB1476503A (en) | 1977-06-16 |
| SE7408207L (enExample) | 1974-12-23 |
| US4163015A (en) | 1979-07-31 |
| NL7408334A (enExample) | 1974-12-24 |
| CA1036166A (en) | 1978-08-08 |
| CH593935A5 (enExample) | 1977-12-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1595883A1 (de) | Verfahren zur Herstellung von Rifamycin-SV-Derivaten | |
| DE3132882A1 (de) | Neue piperazinone, ihre herstellung und verwendung | |
| DE2429923A1 (de) | 1-(arylamino)-pyrrole und 1-(arylimino)-pyrrole, verfahren zu ihrer herstellung und mittel, worin diese verbindungen enthalten sind | |
| DE2712573A1 (de) | 2,3,4,4a-tetrahydro-1h-pyrazinol eckige klammer auf 1,2-a eckige klammer zu -chinoxalin-5(6h)-one, mittel, die diese verbindungen enthalten und verfahren zur herstellung dieser verbindungen | |
| DE2329430A1 (de) | 1-acyl-3-(amino-niedrig-alkyl)-indole | |
| DE2455353A1 (de) | Substituierte alpha-aminooxycarbonsaeurehydrazidderivate und ihre saeureadditionssalze sowie ihre verwendung und verfahren zur herstellung derselben | |
| DE2921660A1 (de) | 5-nitroimidazolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende antiprotozoen-mittel | |
| DD242042A5 (de) | 1-substituierte derivate von 6-flour-7-(pyrol-1-yl)-1,4-dihydro-4-oxoquinoline-3-carboxyl saeuren, ihre herstellung und ihre anwendung als arzneimittel | |
| DE1960029A1 (de) | Ureidophenylthioharnstoffe,Verfahren zu ihrer Herstellung und ihre fungizide Verwendung | |
| DE1670095A1 (de) | Verfahren zur Herstellung von neuen 5-Nitrofuran-bzw. 5-Nitrothiophen-Derivaten | |
| EP0580956A1 (de) | Verfahren zur katalytischen Herstellung von Kondensationsprodukten des Formaldehyds | |
| DE2917244C2 (de) | 1-[[2-(2,4-Dichlorphenyl)-2-benzyloxy]-äthyl]-imidazole, Verfahren zu deren Herstellung sowie solche enthaltende Arzneimittel | |
| US4051147A (en) | 1-(Arylamino)-and 1-(arylimino)-pyrroles | |
| DE2139072B2 (de) | N-(4-Sulfamoylphenyl)-pyrrolidin-2-one, Verfahren zu ihrer Herstellung und pharmazeutische Zusammensetzungen | |
| DE2003144A1 (de) | Verfahren zur Herstellung von 5-Imino-1,2,4-triazin-Derivaten | |
| DE1645978B2 (de) | 5-Nitro-2-furyl-chinolin-derivate und Verfahren zu ihrer Herstellung | |
| DE1795567A1 (de) | Rifamycin SV-Derivate und Verfahren zu ihrer Herstellung | |
| US4138405A (en) | 1-(Arylamino)-and 1-(arylimino)pyrroles | |
| DE2731039A1 (de) | 7-(substituierte)-7h-pyrrolo eckige klammer auf 3,2-f eckige klammer zu -chinazolin-1,3-diamine | |
| DD152126A5 (de) | Verfahren zur herstellung von neuen 1-substituierten-3-cycloalkyl-sulfonyl-pyrrolidin-2,5-dion-derivaten | |
| DE2758111A1 (de) | Verfahren zur herstellung von halogenanilinen | |
| DE2347057A1 (de) | Antimikrobielle mittel | |
| EP0004322A1 (de) | Isochinolinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Arzneimitteln | |
| DD150057A5 (de) | Verfahren zur herstellung von 2-aminopyrazinen | |
| DE2137538A1 (de) | Methoxyaminderivate und ihre Salze sowie ihre Verwendimg und Verfahren zur Herstellung derselben |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8131 | Rejection |