DE2425711A1 - Verfahren zur herstellung von ketonen - Google Patents
Verfahren zur herstellung von ketonenInfo
- Publication number
- DE2425711A1 DE2425711A1 DE19742425711 DE2425711A DE2425711A1 DE 2425711 A1 DE2425711 A1 DE 2425711A1 DE 19742425711 DE19742425711 DE 19742425711 DE 2425711 A DE2425711 A DE 2425711A DE 2425711 A1 DE2425711 A1 DE 2425711A1
- Authority
- DE
- Germany
- Prior art keywords
- copper
- hydroperoxide
- phenol
- derivative
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 21
- 150000002576 ketones Chemical class 0.000 title description 4
- 238000004519 manufacturing process Methods 0.000 title description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 22
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 14
- 150000001879 copper Chemical class 0.000 claims description 11
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 claims description 10
- 239000010949 copper Substances 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 7
- 238000000354 decomposition reaction Methods 0.000 claims description 7
- 239000012429 reaction media Substances 0.000 claims description 7
- 239000011541 reaction mixture Substances 0.000 claims description 7
- 239000008346 aqueous phase Substances 0.000 claims description 6
- 238000006243 chemical reaction Methods 0.000 claims description 6
- 150000002432 hydroperoxides Chemical group 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 4
- 239000002671 adjuvant Substances 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 238000003421 catalytic decomposition reaction Methods 0.000 claims description 4
- 229910052802 copper Inorganic materials 0.000 claims description 4
- YRNNKGFMTBWUGL-UHFFFAOYSA-L copper(ii) perchlorate Chemical compound [Cu+2].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O YRNNKGFMTBWUGL-UHFFFAOYSA-L 0.000 claims description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-M hydroperoxide group Chemical group [O-]O MHAJPDPJQMAIIY-UHFFFAOYSA-M 0.000 claims description 3
- 150000002989 phenols Chemical class 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- QCRRJEABYLEFAE-UHFFFAOYSA-N (1-hydroperoxycyclohexyl)benzene Chemical compound C=1C=CC=CC=1C1(OO)CCCCC1 QCRRJEABYLEFAE-UHFFFAOYSA-N 0.000 claims description 2
- BSMKYQUHXQAVKG-UHFFFAOYSA-N 1-nitro-2-propan-2-ylbenzene Chemical compound CC(C)C1=CC=CC=C1[N+]([O-])=O BSMKYQUHXQAVKG-UHFFFAOYSA-N 0.000 claims description 2
- BDCFWIDZNLCTMF-UHFFFAOYSA-N 2-phenylpropan-2-ol Chemical compound CC(C)(O)C1=CC=CC=C1 BDCFWIDZNLCTMF-UHFFFAOYSA-N 0.000 claims description 2
- DGKBPASUCMSPFK-UHFFFAOYSA-N CC(C)C(C=C1)=CC=C1[N+]([O-])=O.OO Chemical class CC(C)C(C=C1)=CC=C1[N+]([O-])=O.OO DGKBPASUCMSPFK-UHFFFAOYSA-N 0.000 claims description 2
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical class [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 claims description 2
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- -1 aryl ketones Chemical class 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 claims 1
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- 239000003054 catalyst Substances 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 230000002378 acidificating effect Effects 0.000 description 6
- 238000003776 cleavage reaction Methods 0.000 description 6
- 230000007017 scission Effects 0.000 description 6
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 4
- 150000008365 aromatic ketones Chemical class 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 3
- 150000008442 polyphenolic compounds Chemical class 0.000 description 3
- 235000013824 polyphenols Nutrition 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- CRBJBYGJVIBWIY-UHFFFAOYSA-N 2-isopropylphenol Chemical compound CC(C)C1=CC=CC=C1O CRBJBYGJVIBWIY-UHFFFAOYSA-N 0.000 description 1
- 239000005749 Copper compound Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 150000004648 butanoic acid derivatives Chemical class 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001880 copper compounds Chemical class 0.000 description 1
- 125000005594 diketone group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- WQGWDDDVZFFDIG-UHFFFAOYSA-N pyrogallol Chemical class OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 230000001256 tonic effect Effects 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 150000003739 xylenols Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/51—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition
- C07C45/53—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition of hydroperoxides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7319288A FR2231652B1 (https=) | 1973-05-28 | 1973-05-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2425711A1 true DE2425711A1 (de) | 1975-01-09 |
Family
ID=9120075
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742425711 Withdrawn DE2425711A1 (de) | 1973-05-28 | 1974-05-28 | Verfahren zur herstellung von ketonen |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4113779A (https=) |
| JP (1) | JPS5040537A (https=) |
| BE (1) | BE815578A (https=) |
| BR (1) | BR7404251D0 (https=) |
| DE (1) | DE2425711A1 (https=) |
| FR (1) | FR2231652B1 (https=) |
| GB (1) | GB1473680A (https=) |
| IT (1) | IT1012885B (https=) |
| LU (1) | LU70163A1 (https=) |
| NL (1) | NL7406757A (https=) |
| SU (1) | SU606548A3 (https=) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5929632A (ja) * | 1982-08-12 | 1984-02-16 | Sumitomo Chem Co Ltd | 芳香族カルボニル化合物の製造方法 |
| US4486605A (en) * | 1982-01-07 | 1984-12-04 | Sumitomo Chemical Company, Limited | Method for producing aromatic carbonyl compounds |
| JPS60132929A (ja) * | 1983-12-20 | 1985-07-16 | Sumitomo Chem Co Ltd | m−ヒドロキシアセトフエノンの製造法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2557968A (en) * | 1948-11-24 | 1951-06-26 | Hercules Powder Co Ltd | Decomposition of organic hydroperoxides |
| GB1198261A (en) * | 1966-08-23 | 1970-07-08 | Laporte Chemical | Oxidation of Aromatic Compounds |
-
1973
- 1973-05-28 FR FR7319288A patent/FR2231652B1/fr not_active Expired
-
1974
- 1974-05-20 NL NL7406757A patent/NL7406757A/xx not_active Application Discontinuation
- 1974-05-24 US US05/473,267 patent/US4113779A/en not_active Expired - Lifetime
- 1974-05-24 JP JP49058641A patent/JPS5040537A/ja active Pending
- 1974-05-24 BR BR4251/74A patent/BR7404251D0/pt unknown
- 1974-05-24 GB GB2341174A patent/GB1473680A/en not_active Expired
- 1974-05-27 SU SU742028396A patent/SU606548A3/ru active
- 1974-05-27 BE BE144787A patent/BE815578A/xx not_active IP Right Cessation
- 1974-05-27 LU LU70163A patent/LU70163A1/xx unknown
- 1974-05-28 IT IT23261/74A patent/IT1012885B/it active
- 1974-05-28 DE DE19742425711 patent/DE2425711A1/de not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| LU70163A1 (https=) | 1975-02-24 |
| FR2231652B1 (https=) | 1976-04-23 |
| JPS5040537A (https=) | 1975-04-14 |
| SU606548A3 (ru) | 1978-05-05 |
| NL7406757A (https=) | 1974-12-02 |
| US4113779A (en) | 1978-09-12 |
| BE815578A (fr) | 1974-11-27 |
| GB1473680A (en) | 1977-05-18 |
| FR2231652A1 (https=) | 1974-12-27 |
| BR7404251D0 (pt) | 1975-09-30 |
| IT1012885B (it) | 1977-03-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2446004C3 (de) | Verfahren zur Herstellung besonders reiner aromatischer Cyansäureester | |
| DE2653188A1 (de) | Verfahren zur oxidativen kupplung von alkylphenolen | |
| DE2451936A1 (de) | Verfahren zur umwandlung einer aromatischen verbindung mit wenigstens zwei hydroxylgruppen an einem benzolring in den entsprechenden monoaether | |
| DE2633302C2 (de) | Verfahren zur Herstellung von Phenolen durch Hydroxylierung von aromatischen Verbindungen | |
| DE2139564A1 (de) | Herstellung von 3,3,5,5 Tetra isopropyl 4,4 hydroxydiphenyl | |
| DE2655826C2 (de) | Verfahren zur Herstellung von Alkylaryläthern | |
| DE2923805A1 (de) | Verfahren zur herstellung von salicylaldehyd | |
| DE2948635A1 (de) | Meta-, para-substituierte isopropyliden-bisphenole und verfahren zu ihrer herstellung | |
| DE2355690A1 (de) | Verfahren zur herstellung von phenolen | |
| DE2425711A1 (de) | Verfahren zur herstellung von ketonen | |
| DE2520120A1 (de) | Verfahren zur herstellung von phenolen | |
| EP0121671B2 (de) | Verfahren zur Herstellung von Dihydroxybenzolen | |
| DE1262282B (de) | Verfahren zur Herstellung von Phenolen durch Oxydieren von aromatischen Kohlenwasserstoffen | |
| DE3417433C2 (https=) | ||
| EP0475272B1 (de) | Verfahren zur Herstellung von 2,3,5-Trimethyl-p-benzochinon | |
| DE2256513A1 (de) | Verfahren zur herstellung von phenolen durch oxydation von aromatischen aldehyden | |
| DE3408126A1 (de) | Katalysator und verfahren zur herstellung von polyphenylenoxid unter verwendung des katalysators | |
| DE928230C (de) | Verfahren zur Herstellung von Hydroperoxyden alkylaromatischer Kohlenwasserstoffe | |
| EP0013924B1 (de) | Verfahren zur Herstellung von Alkylarylethern | |
| DE2064108B2 (de) | Verfahren zur Herstellung von Phenol und p-Isopropenylphenol aus 2.4'-Bisphenol A | |
| DE2440950A1 (de) | Verfahren zur herstellung von 2,6di-tert.-butyl-4-cumylphenol | |
| DE2446425A1 (de) | Verfahren zur herstellung von polyphenylenaethern bei erhoehtem druck | |
| DE2512295C2 (de) | Verfahren zur Herstellung von β-Aryl-substituierten Ketonen | |
| DE2007737A1 (de) | Monoalkylierung von unsubstituierten Diphenolen | |
| EP0239872B1 (de) | Verfahren zur Herstellung von 4-Nitrophenetol |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8141 | Disposal/no request for examination |