DE2424501C3 - Wasserlösliche Trisazofarbstoffe, ihre Herstellung und Verwendung zum Färben und Bedrucken von hydroxylgruppenhaltigen oder stickstoffhaltigen, natürlichen oder synthetischen Fasermaterialien - Google Patents
Wasserlösliche Trisazofarbstoffe, ihre Herstellung und Verwendung zum Färben und Bedrucken von hydroxylgruppenhaltigen oder stickstoffhaltigen, natürlichen oder synthetischen FasermaterialienInfo
- Publication number
- DE2424501C3 DE2424501C3 DE2424501A DE2424501A DE2424501C3 DE 2424501 C3 DE2424501 C3 DE 2424501C3 DE 2424501 A DE2424501 A DE 2424501A DE 2424501 A DE2424501 A DE 2424501A DE 2424501 C3 DE2424501 C3 DE 2424501C3
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- alkyl
- acid
- amino
- nitro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000975 dye Substances 0.000 title claims description 58
- 125000002887 hydroxy group Chemical group [H]O* 0.000 title claims description 10
- 238000004043 dyeing Methods 0.000 title description 8
- 238000004519 manufacturing process Methods 0.000 title description 5
- 239000000463 material Substances 0.000 title description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 title description 3
- 239000012209 synthetic fiber Substances 0.000 title description 2
- 229920002994 synthetic fiber Polymers 0.000 title description 2
- 239000002253 acid Substances 0.000 claims description 56
- -1 nitro, Sulfo, carboxy Chemical group 0.000 claims description 56
- 238000005859 coupling reaction Methods 0.000 claims description 39
- 230000008878 coupling Effects 0.000 claims description 37
- 238000010168 coupling process Methods 0.000 claims description 37
- 125000004432 carbon atom Chemical group C* 0.000 claims description 36
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 22
- 125000000217 alkyl group Chemical group 0.000 claims description 18
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 14
- 239000000460 chlorine Substances 0.000 claims description 9
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000001589 carboacyl group Chemical group 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 125000003277 amino group Chemical group 0.000 claims description 7
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 5
- XRTJYEIMLZALBD-UHFFFAOYSA-N 4-(6-methyl-1,3-benzothiazol-2-yl)aniline Chemical compound S1C2=CC(C)=CC=C2N=C1C1=CC=C(N)C=C1 XRTJYEIMLZALBD-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 150000001450 anions Chemical class 0.000 claims description 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- VNMGVBPCESRCOG-UHFFFAOYSA-N OC(=O)ClS(O)(=O)=O Chemical compound OC(=O)ClS(O)(=O)=O VNMGVBPCESRCOG-UHFFFAOYSA-N 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 2
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 125000005521 carbonamide group Chemical group 0.000 claims description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 2
- 239000011707 mineral Substances 0.000 claims description 2
- HVZWVEKIQMJYIK-UHFFFAOYSA-N nitryl chloride Chemical compound [O-][N+](Cl)=O HVZWVEKIQMJYIK-UHFFFAOYSA-N 0.000 claims description 2
- VHNQIURBCCNWDN-UHFFFAOYSA-N pyridine-2,6-diamine Chemical class NC1=CC=CC(N)=N1 VHNQIURBCCNWDN-UHFFFAOYSA-N 0.000 claims description 2
- WLFXSECCHULRRO-UHFFFAOYSA-N pyridine-2,6-diol Chemical compound OC1=CC=CC(O)=N1 WLFXSECCHULRRO-UHFFFAOYSA-N 0.000 claims description 2
- 150000003839 salts Chemical group 0.000 claims description 2
- 125000004964 sulfoalkyl group Chemical group 0.000 claims description 2
- 229940124530 sulfonamide Drugs 0.000 claims description 2
- 150000003456 sulfonamides Chemical class 0.000 claims description 2
- 150000001555 benzenes Chemical class 0.000 claims 1
- 125000001624 naphthyl group Chemical group 0.000 claims 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 24
- LDCCBULMAFILCT-UHFFFAOYSA-N 2-aminobenzene-1,4-disulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1S(O)(=O)=O LDCCBULMAFILCT-UHFFFAOYSA-N 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 229960003742 phenol Drugs 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- 125000000623 heterocyclic group Chemical group 0.000 description 8
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- 150000004985 diamines Chemical class 0.000 description 6
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 5
- SKDHHIUENRGTHK-UHFFFAOYSA-N 4-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=C(C(Cl)=O)C=C1 SKDHHIUENRGTHK-UHFFFAOYSA-N 0.000 description 5
- 229920000742 Cotton Polymers 0.000 description 5
- GGOZGYRTNQBSSA-UHFFFAOYSA-N pyridine-2,3-diol Chemical compound OC1=CC=CN=C1O GGOZGYRTNQBSSA-UHFFFAOYSA-N 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 4
- ASHGTJPOSUFTGB-UHFFFAOYSA-N 3-methoxyphenol Chemical compound COC1=CC=CC(O)=C1 ASHGTJPOSUFTGB-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 239000012736 aqueous medium Substances 0.000 description 4
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 4
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- DQLGIONSPPKALA-UHFFFAOYSA-N phenylazanium;phenoxide Chemical compound NC1=CC=CC=C1.OC1=CC=CC=C1 DQLGIONSPPKALA-UHFFFAOYSA-N 0.000 description 4
- 210000002268 wool Anatomy 0.000 description 4
- RAXXELZNTBOGNW-UHFFFAOYSA-N 1H-imidazole Chemical compound C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical class NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 3
- OTLNPYWUJOZPPA-UHFFFAOYSA-N 4-nitrobenzoic acid Chemical class OC(=O)C1=CC=C([N+]([O-])=O)C=C1 OTLNPYWUJOZPPA-UHFFFAOYSA-N 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- 229950000244 sulfanilic acid Drugs 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- 239000002351 wastewater Substances 0.000 description 3
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 2
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 2
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 2
- IMUUNYPYNWXUBO-UHFFFAOYSA-N 4-aminobenzene-1,3-disulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1S(O)(=O)=O IMUUNYPYNWXUBO-UHFFFAOYSA-N 0.000 description 2
- HDHQZCHIXUUSMK-UHFFFAOYSA-N 4-hydroxy-2-quinolone Chemical compound C1=CC=C2C(O)=CC(=O)NC2=C1 HDHQZCHIXUUSMK-UHFFFAOYSA-N 0.000 description 2
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- DGOBMKYRQHEFGQ-UHFFFAOYSA-L acid green 5 Chemical compound [Na+].[Na+].C=1C=C(C(=C2C=CC(C=C2)=[N+](CC)CC=2C=C(C=CC=2)S([O-])(=O)=O)C=2C=CC(=CC=2)S([O-])(=O)=O)C=CC=1N(CC)CC1=CC=CC(S([O-])(=O)=O)=C1 DGOBMKYRQHEFGQ-UHFFFAOYSA-L 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000003931 anilides Chemical class 0.000 description 2
- LKXDAJYGUTZODI-UHFFFAOYSA-N aniline benzene-1,3-diamine Chemical compound NC1=CC=CC=C1.NC1=CC=CC(N)=C1 LKXDAJYGUTZODI-UHFFFAOYSA-N 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- DMLAVOWQYNRWNQ-UHFFFAOYSA-N azobenzene Chemical compound C1=CC=CC=C1N=NC1=CC=CC=C1 DMLAVOWQYNRWNQ-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Substances ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 235000013601 eggs Nutrition 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Substances CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical class C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- 150000000183 1,3-benzoxazoles Chemical class 0.000 description 1
- ULHFFAFDSSHFDA-UHFFFAOYSA-N 1-amino-2-ethoxybenzene Chemical compound CCOC1=CC=CC=C1N ULHFFAFDSSHFDA-UHFFFAOYSA-N 0.000 description 1
- ATTJFNOYTYJNJH-UHFFFAOYSA-N 1-chloro-4,6-dinitrocyclohexa-2,4-dien-1-ol Chemical compound OC1(Cl)C=CC([N+]([O-])=O)=CC1[N+]([O-])=O ATTJFNOYTYJNJH-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- HYFIHEYSLNBJKW-UHFFFAOYSA-N 2,3-dichloro-4,6-dinitroaniline Chemical compound NC1=C(Cl)C(Cl)=C([N+]([O-])=O)C=C1[N+]([O-])=O HYFIHEYSLNBJKW-UHFFFAOYSA-N 0.000 description 1
- RHTVQEPJVKUMPI-UHFFFAOYSA-N 2,4-dinitro-n-phenylaniline Chemical compound [O-][N+](=O)C1=CC([N+](=O)[O-])=CC=C1NC1=CC=CC=C1 RHTVQEPJVKUMPI-UHFFFAOYSA-N 0.000 description 1
- LXQOQPGNCGEELI-UHFFFAOYSA-N 2,4-dinitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O LXQOQPGNCGEELI-UHFFFAOYSA-N 0.000 description 1
- UFBJCMHMOXMLKC-UHFFFAOYSA-N 2,4-dinitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O UFBJCMHMOXMLKC-UHFFFAOYSA-N 0.000 description 1
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 description 1
- LQFWUHCFBYXKGT-UHFFFAOYSA-N 2,5-dinitro-n-propylaniline Chemical compound CCCNC1=CC([N+]([O-])=O)=CC=C1[N+]([O-])=O LQFWUHCFBYXKGT-UHFFFAOYSA-N 0.000 description 1
- RZKBRXDCJZLQLI-UHFFFAOYSA-N 2,5-dinitroaniline Chemical compound NC1=CC([N+]([O-])=O)=CC=C1[N+]([O-])=O RZKBRXDCJZLQLI-UHFFFAOYSA-N 0.000 description 1
- UWEZBKLLMKVIPI-UHFFFAOYSA-N 2,5-dinitrophenol Chemical compound OC1=CC([N+]([O-])=O)=CC=C1[N+]([O-])=O UWEZBKLLMKVIPI-UHFFFAOYSA-N 0.000 description 1
- UEJJHQNACJXSKW-UHFFFAOYSA-N 2-(2,6-dioxopiperidin-3-yl)-1H-isoindole-1,3(2H)-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1C1CCC(=O)NC1=O UEJJHQNACJXSKW-UHFFFAOYSA-N 0.000 description 1
- VBDIELASAOAJQB-UHFFFAOYSA-N 2-(oxadiazol-4-yl)aniline Chemical compound NC1=CC=CC=C1C1=CON=N1 VBDIELASAOAJQB-UHFFFAOYSA-N 0.000 description 1
- VLZVIIYRNMWPSN-UHFFFAOYSA-N 2-Amino-4-nitrophenol Chemical compound NC1=CC([N+]([O-])=O)=CC=C1O VLZVIIYRNMWPSN-UHFFFAOYSA-N 0.000 description 1
- DOPJTDJKZNWLRB-UHFFFAOYSA-N 2-Amino-5-nitrophenol Chemical compound NC1=CC=C([N+]([O-])=O)C=C1O DOPJTDJKZNWLRB-UHFFFAOYSA-N 0.000 description 1
- ZNZUCODRUIUSSP-UHFFFAOYSA-N 2-amino-5-ethylbenzene-1,4-disulfonic acid Chemical compound CCC1=CC(S(O)(=O)=O)=C(N)C=C1S(O)(=O)=O ZNZUCODRUIUSSP-UHFFFAOYSA-N 0.000 description 1
- YYRVBCBZQPTVEO-UHFFFAOYSA-N 2-amino-5-methylbenzene-1,4-disulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=C(N)C=C1S(O)(=O)=O YYRVBCBZQPTVEO-UHFFFAOYSA-N 0.000 description 1
- FPBSWFHEVAHUOS-UHFFFAOYSA-N 2-amino-5-nitrobenzene-1,4-disulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=C([N+]([O-])=O)C=C1S(O)(=O)=O FPBSWFHEVAHUOS-UHFFFAOYSA-N 0.000 description 1
- LTASFWDWBYFZQQ-UHFFFAOYSA-N 2-amino-5-nitrobenzenesulfonic acid Chemical compound NC1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O LTASFWDWBYFZQQ-UHFFFAOYSA-N 0.000 description 1
- VRVRGVPWCUEOGV-UHFFFAOYSA-N 2-aminothiophenol Chemical compound NC1=CC=CC=C1S VRVRGVPWCUEOGV-UHFFFAOYSA-N 0.000 description 1
- CEXGTXNIIFSPSF-UHFFFAOYSA-N 2-bromo-4-nitrobenzoic acid Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C=C1Br CEXGTXNIIFSPSF-UHFFFAOYSA-N 0.000 description 1
- DJXPTWGRUNFXLJ-UHFFFAOYSA-N 2-chloro-3,6-dinitroaniline Chemical compound NC1=C(Cl)C([N+]([O-])=O)=CC=C1[N+]([O-])=O DJXPTWGRUNFXLJ-UHFFFAOYSA-N 0.000 description 1
- PCBCIXWBAPIVDV-UHFFFAOYSA-N 2-chloro-4,6-dinitrophenol Chemical compound OC1=C(Cl)C=C([N+]([O-])=O)C=C1[N+]([O-])=O PCBCIXWBAPIVDV-UHFFFAOYSA-N 0.000 description 1
- XXXOBNJIIZQSPT-UHFFFAOYSA-N 2-methyl-4-nitrobenzoic acid Chemical compound CC1=CC([N+]([O-])=O)=CC=C1C(O)=O XXXOBNJIIZQSPT-UHFFFAOYSA-N 0.000 description 1
- DLURHXYXQYMPLT-UHFFFAOYSA-N 2-nitro-p-toluidine Chemical compound CC1=CC=C(N)C([N+]([O-])=O)=C1 DLURHXYXQYMPLT-UHFFFAOYSA-N 0.000 description 1
- BWWHTIHDQBHTHP-UHFFFAOYSA-N 2-nitrobenzoyl chloride Chemical class [O-][N+](=O)C1=CC=CC=C1C(Cl)=O BWWHTIHDQBHTHP-UHFFFAOYSA-N 0.000 description 1
- UCTREIIEJSFTDI-UHFFFAOYSA-N 3-aminonaphthalene-2,7-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(N)=CC2=C1 UCTREIIEJSFTDI-UHFFFAOYSA-N 0.000 description 1
- KKPPNEJUUOQRLE-UHFFFAOYSA-N 3-bromo-4-nitrobenzoic acid Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C(Br)=C1 KKPPNEJUUOQRLE-UHFFFAOYSA-N 0.000 description 1
- HORNXRXVQWOLPJ-UHFFFAOYSA-N 3-chlorophenol Chemical compound OC1=CC=CC(Cl)=C1 HORNXRXVQWOLPJ-UHFFFAOYSA-N 0.000 description 1
- XDTTUTIFWDAMIX-UHFFFAOYSA-N 3-methyl-4-nitrobenzoic acid Chemical compound CC1=CC(C(O)=O)=CC=C1[N+]([O-])=O XDTTUTIFWDAMIX-UHFFFAOYSA-N 0.000 description 1
- DUEGOHNPUBPUIV-UHFFFAOYSA-N 3-methyl-4-nitrobenzoyl chloride Chemical compound CC1=CC(C(Cl)=O)=CC=C1[N+]([O-])=O DUEGOHNPUBPUIV-UHFFFAOYSA-N 0.000 description 1
- FRKPCXYPIHAOFI-UHFFFAOYSA-N 3-methylaniline Chemical compound [CH2]C1=CC=CC(N)=C1 FRKPCXYPIHAOFI-UHFFFAOYSA-N 0.000 description 1
- HHSBHVJQXZLIRW-UHFFFAOYSA-N 3-n,3-n-dimethylbenzene-1,3-diamine Chemical compound CN(C)C1=CC=CC(N)=C1 HHSBHVJQXZLIRW-UHFFFAOYSA-N 0.000 description 1
- XJCVRTZCHMZPBD-UHFFFAOYSA-N 3-nitroaniline Chemical compound NC1=CC=CC([N+]([O-])=O)=C1 XJCVRTZCHMZPBD-UHFFFAOYSA-N 0.000 description 1
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 description 1
- KDNATMJFDJXJJB-UHFFFAOYSA-N 4-bromo-2,5-dinitro-n-phenylaniline Chemical compound C1=C(Br)C([N+](=O)[O-])=CC(NC=2C=CC=CC=2)=C1[N+]([O-])=O KDNATMJFDJXJJB-UHFFFAOYSA-N 0.000 description 1
- JHQQUWFJSRYONK-UHFFFAOYSA-N 4-chloro-2,5-dinitroaniline Chemical compound NC1=CC([N+]([O-])=O)=C(Cl)C=C1[N+]([O-])=O JHQQUWFJSRYONK-UHFFFAOYSA-N 0.000 description 1
- XARNRQYYUZJXSB-UHFFFAOYSA-N 4-chloro-2,5-dinitrophenol Chemical compound OC1=CC([N+]([O-])=O)=C(Cl)C=C1[N+]([O-])=O XARNRQYYUZJXSB-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- IMPPGHMHELILKG-UHFFFAOYSA-N 4-ethoxyaniline Chemical compound CCOC1=CC=C(N)C=C1 IMPPGHMHELILKG-UHFFFAOYSA-N 0.000 description 1
- DPIZKMGPXNXSGL-UHFFFAOYSA-N 4-nitro-1,3-phenylenediamine Chemical compound NC1=CC=C([N+]([O-])=O)C(N)=C1 DPIZKMGPXNXSGL-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- 150000005443 4-nitrobenzoic acid derivatives Chemical class 0.000 description 1
- WRZOMWDJOLIVQP-UHFFFAOYSA-N 5-Chloro-ortho-toluidine Chemical compound CC1=CC=C(Cl)C=C1N WRZOMWDJOLIVQP-UHFFFAOYSA-N 0.000 description 1
- AEDWQWWPRLJGDM-UHFFFAOYSA-N 5-bromo-2,4-dinitroaniline Chemical compound NC1=CC(Br)=C([N+]([O-])=O)C=C1[N+]([O-])=O AEDWQWWPRLJGDM-UHFFFAOYSA-N 0.000 description 1
- DJMSRFQEEDIQLX-UHFFFAOYSA-N 5-chloro-2,4-dinitroaniline Chemical compound NC1=CC(Cl)=C([N+]([O-])=O)C=C1[N+]([O-])=O DJMSRFQEEDIQLX-UHFFFAOYSA-N 0.000 description 1
- YUIDCTJTNTXYFM-UHFFFAOYSA-N 5-chloro-2,4-dinitrophenol Chemical compound OC1=CC(Cl)=C([N+]([O-])=O)C=C1[N+]([O-])=O YUIDCTJTNTXYFM-UHFFFAOYSA-N 0.000 description 1
- RPJXLEZOFUNGNZ-UHFFFAOYSA-N 5-methoxy-2-methylaniline Chemical compound COC1=CC=C(C)C(N)=C1 RPJXLEZOFUNGNZ-UHFFFAOYSA-N 0.000 description 1
- YUNBHHWDQDGWHC-UHFFFAOYSA-N 6-aminonaphthalene-1-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC2=CC(N)=CC=C21 YUNBHHWDQDGWHC-UHFFFAOYSA-N 0.000 description 1
- QAYNSPOKTRVZRC-UHFFFAOYSA-N 99-60-5 Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C=C1Cl QAYNSPOKTRVZRC-UHFFFAOYSA-N 0.000 description 1
- AOMZHDJXSYHPKS-DROYEMJCSA-L Amido Black 10B Chemical compound [Na+].[Na+].[O-]S(=O)(=O)C1=CC2=CC(S([O-])(=O)=O)=C(\N=N\C=3C=CC=CC=3)C(O)=C2C(N)=C1\N=N\C1=CC=C(N(=O)=O)C=C1 AOMZHDJXSYHPKS-DROYEMJCSA-L 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- 101100336279 Caenorhabditis elegans icl-1 gene Proteins 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- FIWILGQIZHDAQG-UHFFFAOYSA-N NC1=C(C(=O)NCC2=CC=C(C=C2)OCC(F)(F)F)C=C(C(=N1)N)N1N=C(N=C1)C1(CC1)C(F)(F)F Chemical compound NC1=C(C(=O)NCC2=CC=C(C=C2)OCC(F)(F)F)C=C(C(=N1)N)N1N=C(N=C1)C1(CC1)C(F)(F)F FIWILGQIZHDAQG-UHFFFAOYSA-N 0.000 description 1
- KCCOMGGPHUCZQV-UHFFFAOYSA-N NC1=CC=CC=C1.NC1=CC=CC=C1.NC1=CC=CC=C1 Chemical compound NC1=CC=CC=C1.NC1=CC=CC=C1.NC1=CC=CC=C1 KCCOMGGPHUCZQV-UHFFFAOYSA-N 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N Salicylic acid Natural products OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- 241000534944 Thia Species 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000027455 binding Effects 0.000 description 1
- 238000009739 binding Methods 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- JJYPMNFTHPTTDI-UHFFFAOYSA-N meta-toluidine Natural products CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000010446 mirabilite Substances 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- RJIRIFJATWTRKR-UHFFFAOYSA-N n-benzyl-2-chloroaniline Chemical compound ClC1=CC=CC=C1NCC1=CC=CC=C1 RJIRIFJATWTRKR-UHFFFAOYSA-N 0.000 description 1
- VSHTWPWTCXQLQN-UHFFFAOYSA-N n-butylaniline Chemical compound CCCCNC1=CC=CC=C1 VSHTWPWTCXQLQN-UHFFFAOYSA-N 0.000 description 1
- QOMRNUWWLIIBLO-UHFFFAOYSA-N n-methyl-2,5-dinitroaniline Chemical compound CNC1=CC([N+]([O-])=O)=CC=C1[N+]([O-])=O QOMRNUWWLIIBLO-UHFFFAOYSA-N 0.000 description 1
- CDZOGLJOFWFVOZ-UHFFFAOYSA-N n-propylaniline Chemical compound CCCNC1=CC=CC=C1 CDZOGLJOFWFVOZ-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 150000005338 nitrobenzoic acids Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- RWZYAGGXGHYGMB-UHFFFAOYSA-N o-aminobenzenecarboxylic acid Natural products NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 1
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000013535 sea water Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- RSIJVJUOQBWMIM-UHFFFAOYSA-L sodium sulfate decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[O-]S([O-])(=O)=O RSIJVJUOQBWMIM-UHFFFAOYSA-L 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002759 woven fabric Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B35/00—Disazo and polyazo dyes of the type A<-D->B prepared by diazotising and coupling
- C09B35/38—Trisazo dyes ot the type
- C09B35/44—Trisazo dyes ot the type the component K being a hydroxy amine
- C09B35/46—Trisazo dyes ot the type the component K being a hydroxy amine the component K being an amino naphthol
- C09B35/469—D being derived from heterocyclic diamine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Paper (AREA)
Priority Applications (16)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2424501A DE2424501C3 (de) | 1974-05-20 | 1974-05-20 | Wasserlösliche Trisazofarbstoffe, ihre Herstellung und Verwendung zum Färben und Bedrucken von hydroxylgruppenhaltigen oder stickstoffhaltigen, natürlichen oder synthetischen Fasermaterialien |
| DK214675A DK214675A (da) | 1974-05-20 | 1975-05-15 | Oploselige trisazofarvestoffer deres fremstilling og anvendelse |
| NL7505739A NL7505739A (nl) | 1974-05-20 | 1975-05-15 | Oplosbare trisazokleurstoffen, de bereiding en toepassing ervan. |
| CA75227150A CA1048999A (en) | 1974-05-20 | 1975-05-16 | Soluble trisazo dyestuffs and their production and use |
| BE156473A BE829210A (fr) | 1974-05-20 | 1975-05-16 | Colorants tris-azoiques et leur preparation |
| FR7515343A FR2272148B1 (OSRAM) | 1974-05-20 | 1975-05-16 | |
| IT23479/75A IT1038248B (it) | 1974-05-20 | 1975-05-19 | Trisazocoloranti solubili loro preparazione ed impiego |
| GB2119075A GB1470483A (en) | 1974-05-20 | 1975-05-19 | Soluble trisazo dyestuffs and their prod and use |
| AR258858A AR211849A1 (es) | 1974-05-20 | 1975-05-19 | Colorantes trisazoicos solubles y el procedimiento para su obtencion |
| BR3947/75D BR7503098A (pt) | 1974-05-20 | 1975-05-19 | Processo para a preparacao de corantes trisazo |
| JP50058771A JPS5938272B2 (ja) | 1974-05-20 | 1975-05-19 | 可溶性トリスアゾ染料の製法 |
| IE1119/75A IE41126B1 (en) | 1974-05-20 | 1975-05-19 | Solube trisazo dyestuffs and their production and use |
| CH642575A CH587893A5 (OSRAM) | 1974-05-20 | 1975-05-20 | |
| LU72523A LU72523A1 (OSRAM) | 1974-05-20 | 1975-05-20 | |
| IN1017/CAL/1975A IN143478B (OSRAM) | 1974-05-20 | 1975-05-20 | |
| IN1007/CAL/77A IN145412B (OSRAM) | 1974-05-20 | 1977-07-04 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2424501A DE2424501C3 (de) | 1974-05-20 | 1974-05-20 | Wasserlösliche Trisazofarbstoffe, ihre Herstellung und Verwendung zum Färben und Bedrucken von hydroxylgruppenhaltigen oder stickstoffhaltigen, natürlichen oder synthetischen Fasermaterialien |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2424501A1 DE2424501A1 (de) | 1975-12-11 |
| DE2424501B2 DE2424501B2 (de) | 1979-09-13 |
| DE2424501C3 true DE2424501C3 (de) | 1982-05-13 |
Family
ID=5916084
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2424501A Expired DE2424501C3 (de) | 1974-05-20 | 1974-05-20 | Wasserlösliche Trisazofarbstoffe, ihre Herstellung und Verwendung zum Färben und Bedrucken von hydroxylgruppenhaltigen oder stickstoffhaltigen, natürlichen oder synthetischen Fasermaterialien |
Country Status (15)
| Country | Link |
|---|---|
| JP (1) | JPS5938272B2 (OSRAM) |
| AR (1) | AR211849A1 (OSRAM) |
| BE (1) | BE829210A (OSRAM) |
| BR (1) | BR7503098A (OSRAM) |
| CA (1) | CA1048999A (OSRAM) |
| CH (1) | CH587893A5 (OSRAM) |
| DE (1) | DE2424501C3 (OSRAM) |
| DK (1) | DK214675A (OSRAM) |
| FR (1) | FR2272148B1 (OSRAM) |
| GB (1) | GB1470483A (OSRAM) |
| IE (1) | IE41126B1 (OSRAM) |
| IN (1) | IN143478B (OSRAM) |
| IT (1) | IT1038248B (OSRAM) |
| LU (1) | LU72523A1 (OSRAM) |
| NL (1) | NL7505739A (OSRAM) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2349626A2 (fr) * | 1976-04-30 | 1977-11-25 | Ugine Kuhlmann | Nouveaux colorants polyazoiques hydro solubles |
| FR2349675A2 (fr) * | 1976-04-30 | 1977-11-25 | Ugine Kuhlmann | Nouveaux colorants polyazoiques hydrosolubles |
| DE3743527A1 (de) * | 1987-12-22 | 1989-07-06 | Cassella Ag | Wasserloesliche schwarze trisazofarbstoffe |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH1353173A4 (OSRAM) * | 1972-09-22 | 1975-05-30 |
-
1974
- 1974-05-20 DE DE2424501A patent/DE2424501C3/de not_active Expired
-
1975
- 1975-05-15 NL NL7505739A patent/NL7505739A/xx not_active Application Discontinuation
- 1975-05-15 DK DK214675A patent/DK214675A/da unknown
- 1975-05-16 BE BE156473A patent/BE829210A/xx not_active IP Right Cessation
- 1975-05-16 CA CA75227150A patent/CA1048999A/en not_active Expired
- 1975-05-16 FR FR7515343A patent/FR2272148B1/fr not_active Expired
- 1975-05-19 JP JP50058771A patent/JPS5938272B2/ja not_active Expired
- 1975-05-19 IT IT23479/75A patent/IT1038248B/it active
- 1975-05-19 GB GB2119075A patent/GB1470483A/en not_active Expired
- 1975-05-19 AR AR258858A patent/AR211849A1/es active
- 1975-05-19 IE IE1119/75A patent/IE41126B1/xx unknown
- 1975-05-19 BR BR3947/75D patent/BR7503098A/pt unknown
- 1975-05-20 CH CH642575A patent/CH587893A5/xx not_active IP Right Cessation
- 1975-05-20 IN IN1017/CAL/1975A patent/IN143478B/en unknown
- 1975-05-20 LU LU72523A patent/LU72523A1/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IN143478B (OSRAM) | 1977-12-03 |
| BR7503098A (pt) | 1976-04-20 |
| BE829210A (fr) | 1975-11-17 |
| LU72523A1 (OSRAM) | 1977-02-10 |
| AR211849A1 (es) | 1978-03-31 |
| DE2424501A1 (de) | 1975-12-11 |
| IT1038248B (it) | 1979-11-20 |
| CH587893A5 (OSRAM) | 1977-05-13 |
| DK214675A (da) | 1975-11-21 |
| JPS5938272B2 (ja) | 1984-09-14 |
| IE41126B1 (en) | 1979-10-24 |
| DE2424501B2 (de) | 1979-09-13 |
| IE41126L (en) | 1975-11-20 |
| FR2272148B1 (OSRAM) | 1979-01-19 |
| FR2272148A1 (OSRAM) | 1975-12-19 |
| JPS50160579A (OSRAM) | 1975-12-25 |
| CA1048999A (en) | 1979-02-20 |
| GB1470483A (en) | 1977-04-14 |
| NL7505739A (nl) | 1975-11-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE4128490A1 (de) | Neue kationische thiazolazofarbstoffe | |
| DE2424462A1 (de) | Loesliche trisazofarbstoffe, ihre herstellung und verwendung | |
| DE2424501C3 (de) | Wasserlösliche Trisazofarbstoffe, ihre Herstellung und Verwendung zum Färben und Bedrucken von hydroxylgruppenhaltigen oder stickstoffhaltigen, natürlichen oder synthetischen Fasermaterialien | |
| DE2159216A1 (de) | Neue wasserloesliche disazofarbstoffe und verfahren zu ihrer herstellung | |
| EP0754732B1 (de) | Azofarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| DE1219155B (de) | Verfahren zur Herstellung wasserloeslicher Azofarbstoffe | |
| EP0016975B1 (de) | Polyazofarbstoffe sowie ihre Verwendung zum Färben von amino- und hydroxygruppenhaltigen Fasermaterialien und Leder | |
| DE2110772A1 (de) | Trisazofarbstoffe | |
| DE2110771C3 (de) | Trisazofarbstoffe und ihre Verwendung zum Färben hydroxylgruppenhaltiger und stickstoffhaltiger Fasermaterialien | |
| DE2553261C2 (de) | Wasserlösliche Trisazofarbstoffe, ihre Herstellung und Verwendung | |
| DE2139148C3 (de) | Telrakisazofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung zum Färben vonpflanzlichen und tierischen Fasermaterialien, sowie von Leder | |
| DE2140864A1 (de) | Disazofarbstoffe | |
| CH618725A5 (OSRAM) | ||
| EP0073387A1 (de) | Wasserlösliche Polyazofarbstoffe, ihre Herstellung und ihre Verwendung | |
| DE853188C (de) | Verfahren zur Herstellung von Mono-, Dis- oder Polyazofarbstoffen | |
| DE2453209A1 (de) | Disazofarbstoffe | |
| CH641485A5 (de) | Disazofarbstoffe. | |
| CH616174A5 (en) | Process for the preparation of novel polyazo dyestuffs, and their use | |
| DE849287C (de) | Verfahren zur Herstellung von Trisazofarbstoffen | |
| CH492767A (de) | Verfahren zur Herstellung von Reaktivfarbstoffen | |
| AT162618B (de) | Verfahren zur Herstellung neuer Tetrakisazofarbstoffe | |
| DE849736C (de) | Verfahren zur Herstellung direktziehender Azofarbstoffe | |
| DE610625C (de) | Verfahren zur Herstellung faerbender Umwandlungsprodukte von Azofarbstoffen | |
| AT142562B (de) | Verfahren zur Herstellung färbender Umwandlungsprodukte von Azofarbstoffen. | |
| DE2026247A1 (de) | Azofarbstoffe, ihre Metallkomplexverbindungen sowie ihre Herstellung und Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OGA | New person/name/address of the applicant | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |