DE2423326C2 - Kreiselheuwerbungsmaschine - Google Patents
KreiselheuwerbungsmaschineInfo
- Publication number
- DE2423326C2 DE2423326C2 DE2423326A DE2423326A DE2423326C2 DE 2423326 C2 DE2423326 C2 DE 2423326C2 DE 2423326 A DE2423326 A DE 2423326A DE 2423326 A DE2423326 A DE 2423326A DE 2423326 C2 DE2423326 C2 DE 2423326C2
- Authority
- DE
- Germany
- Prior art keywords
- tine
- tines
- carriers
- rotary
- support
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000969 carrier Substances 0.000 claims description 15
- OCDRLZFZBHZTKQ-NMUBGGKPSA-N onetine Chemical compound C[C@@H](O)[C@@]1(O)C[C@@H](C)[C@@](C)(O)C(=O)OC\C2=C\CN(C)CC[C@@H](OC1=O)C2=O OCDRLZFZBHZTKQ-NMUBGGKPSA-N 0.000 claims 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 5
- 210000002105 tongue Anatomy 0.000 description 5
- 239000011701 zinc Substances 0.000 description 5
- 229910052725 zinc Inorganic materials 0.000 description 5
- 210000003746 feather Anatomy 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01D—HARVESTING; MOWING
- A01D80/00—Parts or details of, or accessories for, haymakers
- A01D80/02—Tines; Attachment of tines
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01D—HARVESTING; MOWING
- A01D78/00—Haymakers with tines moving with respect to the machine
- A01D78/08—Haymakers with tines moving with respect to the machine with tine-carrying rotary heads or wheels
- A01D78/10—Haymakers with tines moving with respect to the machine with tine-carrying rotary heads or wheels the tines rotating about a substantially vertical axis
- A01D78/1078—Having only one row of rotors arranged on the same horizontal line perpendicular to the advance direction of the machine
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Environmental Sciences (AREA)
- Soil Working Implements (AREA)
- Agricultural Machines (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Body Structure For Vehicles (AREA)
- Heating, Cooling, Or Curing Plastics Or The Like In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NLAANVRAGE7306706,A NL170221C (nl) | 1973-05-15 | 1973-05-15 | Hooibouwmachine. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2423326A1 DE2423326A1 (de) | 1974-12-05 |
| DE2423326C2 true DE2423326C2 (de) | 1984-08-09 |
Family
ID=19818858
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2423326A Expired DE2423326C2 (de) | 1973-05-15 | 1974-05-14 | Kreiselheuwerbungsmaschine |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3995416A (enFirst) |
| JP (1) | JPS5051825A (enFirst) |
| BE (1) | BE814983A (enFirst) |
| CH (1) | CH577781A5 (enFirst) |
| DE (1) | DE2423326C2 (enFirst) |
| ES (1) | ES426318A1 (enFirst) |
| FR (2) | FR2240681B1 (enFirst) |
| GB (4) | GB1475581A (enFirst) |
| IT (1) | IT1012398B (enFirst) |
| NL (2) | NL170221C (enFirst) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2342639A1 (fr) * | 1976-03-05 | 1977-09-30 | Kuhn Sa | Dispositif permettant la modification de l'angle de piquage des toupies d'une machine agricole du type faneuse-andaineuse |
| NL7603683A (nl) * | 1976-04-08 | 1977-10-11 | Lely Nv C Van Der | Hooibouwmachine. |
| US4065967A (en) * | 1976-07-29 | 1978-01-03 | Robert E. Kirkpatrick | Silo level indicating system |
| NL7802741A (nl) * | 1978-03-14 | 1979-09-18 | Patent Concern Nv | Hooibouwmachine. |
| NL7809023A (nl) * | 1978-09-01 | 1980-03-04 | Expert Nv | Landbouwwerktuig voor het bewerken van op het land lig- gend gewas. |
| NL179440C (nl) * | 1979-12-21 | 1986-09-16 | Lely Nv C Van Der | Hooibouwmachine. |
| DE3028350A1 (de) * | 1980-07-25 | 1982-04-01 | Klöckner-Humboldt-Deutz AG Zweigniederlassung Fahr, 7702 Gottmadingen | Heuwerbungsmaschine |
| NL188013B (nl) * | 1981-12-22 | 1991-10-16 | Lely Nv C Van Der | Landbouwwerktuig. |
| US4487003A (en) * | 1983-03-02 | 1984-12-11 | Mathews B C | Multiple rotor mowers |
| FR2621213B1 (fr) * | 1987-10-01 | 1990-01-05 | Kuhn Sa | Machine de fenaison avec un dispositif de protection perfectionne |
| US4782654A (en) * | 1988-01-25 | 1988-11-08 | Bezzerides Paul A | Apparatus for removing material from a work area |
| FR2648310B1 (fr) * | 1989-06-16 | 1991-09-20 | Kuhn Sa | Machine agricole pour l'andainage, comportant des bras porte-outils repliables |
| US4977734A (en) * | 1989-08-02 | 1990-12-18 | Rowe Carroll G | Foldable hay rake |
| US4974407A (en) * | 1989-11-09 | 1990-12-04 | Rowe Carroll G | Foldable hay rake |
| NL1007236C2 (nl) * | 1997-10-09 | 1999-04-12 | Maasland Nv | Hooibouwmachine. |
| NL1009947C2 (nl) * | 1997-10-09 | 1999-04-12 | Maasland Nv | Inrichting voor het verplaatsen van op de grond liggend gewas. |
| US6000207A (en) * | 1998-06-09 | 1999-12-14 | Sitrex S.R.L. | Disassemblable hay rake |
| US6164052A (en) * | 1998-10-27 | 2000-12-26 | Golay; George Rex | Retractable hay and bean fluffer |
| US6272826B1 (en) | 1999-04-29 | 2001-08-14 | Sitrex S.R.L. | Method and apparatus for positioning a hay rake |
| US6865873B2 (en) | 2002-06-21 | 2005-03-15 | Sitrex S.R.L. | Pull type V-shaped hay rake |
| US6834488B2 (en) | 2002-11-22 | 2004-12-28 | Sitrex S.R.L. | Towable hay rake with an automatic steering mechanism |
| JP5022263B2 (ja) * | 2008-02-13 | 2012-09-12 | 株式会社タカキタ | テッダーにおける集草ロス減少装置 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2669826A (en) * | 1949-02-16 | 1954-02-23 | Winston S Watrous | Lawn mower of the rotating sickle type |
| NL288772A (enFirst) * | 1963-02-08 | |||
| DE1295265B (de) * | 1965-06-30 | 1969-05-14 | Niemeyer Soehne Stahl Pflug | Heuwerbungsmaschine |
| DE1507286B2 (de) * | 1965-09-15 | 1980-11-06 | C. Van Der Lely N.V., Maasland (Niederlande) | Kreiselheuwerbungsmaschine |
| DE1929104C3 (de) * | 1968-08-13 | 1981-10-22 | Maschinenfabrik Fahr Ag Gottmadingen, 7702 Gottmadingen | Heuwerbungsmaschine |
| IE34222B1 (en) * | 1969-06-05 | 1975-03-05 | Zweegers P | Improvements in or relating to implements for working crop lying on the ground |
| BE754375A (fr) * | 1969-08-07 | 1971-01-18 | Fahr Ag Maschf | Faneuse |
| US3707122A (en) * | 1970-07-13 | 1972-12-26 | Peripheral Dynamics | Print hammer mechanism with magnetic reinforcement to cath hammer |
| NL165033B (nl) * | 1970-12-11 | 1980-10-15 | Lely Nv C Van Der | Harkmachine. |
| FR2162768A6 (enFirst) * | 1971-05-14 | 1973-07-20 | Reber Walter | |
| US3664105A (en) * | 1971-05-24 | 1972-05-23 | Sperry Rand Corp | Rake-tedding device |
| NL167834C (nl) * | 1971-11-05 | 1982-02-16 | Lely Nv C Van Der | Hooibouwmachine. |
| NL7308237A (enFirst) * | 1973-06-13 | 1974-12-17 |
-
1973
- 1973-05-15 NL NLAANVRAGE7306706,A patent/NL170221C/xx not_active IP Right Cessation
-
1974
- 1974-05-10 CH CH642774A patent/CH577781A5/xx not_active IP Right Cessation
- 1974-05-14 US US05/469,764 patent/US3995416A/en not_active Expired - Lifetime
- 1974-05-14 ES ES426318A patent/ES426318A1/es not_active Expired
- 1974-05-14 DE DE2423326A patent/DE2423326C2/de not_active Expired
- 1974-05-14 BE BE144272A patent/BE814983A/xx not_active IP Right Cessation
- 1974-05-15 IT IT22759/74A patent/IT1012398B/it active
- 1974-05-15 GB GB2165874A patent/GB1475581A/en not_active Expired
- 1974-05-15 GB GB3607576A patent/GB1475583A/en not_active Expired
- 1974-05-15 JP JP49054307A patent/JPS5051825A/ja active Pending
- 1974-05-15 FR FR7416753A patent/FR2240681B1/fr not_active Expired
- 1974-05-15 GB GB3607476A patent/GB1475582A/en not_active Expired
- 1974-05-15 GB GB3607676A patent/GB1475584A/en not_active Expired
- 1974-12-24 FR FR7442661A patent/FR2240682B1/fr not_active Expired
-
1981
- 1981-10-28 NL NLAANVRAGE8104871,A patent/NL182690C/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2240682A1 (enFirst) | 1975-03-14 |
| IT1012398B (it) | 1977-03-10 |
| DE2423326A1 (de) | 1974-12-05 |
| GB1475583A (en) | 1977-06-01 |
| FR2240682B1 (enFirst) | 1978-09-22 |
| NL7306706A (enFirst) | 1974-11-19 |
| BE814983A (nl) | 1974-09-02 |
| NL182690B (nl) | 1987-12-01 |
| NL170221C (nl) | 1985-10-16 |
| US3995416A (en) | 1976-12-07 |
| FR2240681A1 (enFirst) | 1975-03-14 |
| GB1475584A (en) | 1977-06-01 |
| ES426318A1 (es) | 1976-11-01 |
| GB1475582A (en) | 1977-06-01 |
| NL170221B (nl) | 1982-05-17 |
| NL8104871A (nl) | 1982-03-01 |
| NL182690C (nl) | 1988-05-02 |
| CH577781A5 (enFirst) | 1976-07-30 |
| JPS5051825A (enFirst) | 1975-05-08 |
| AU6890574A (en) | 1975-11-20 |
| GB1475581A (en) | 1977-06-01 |
| FR2240681B1 (enFirst) | 1979-07-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2423326C2 (de) | Kreiselheuwerbungsmaschine | |
| DE3050793C2 (de) | Kreiselheuwerbungsmaschine | |
| DE7215019U (de) | Bodenbearbeitungsmaschine | |
| DE1507353C3 (de) | Heuwerbungsmaschine | |
| CH622669A5 (enFirst) | ||
| DE2418210C2 (de) | Kreiselheuwerbungsmaschine | |
| DE1507391C3 (de) | Kreiselheuwerbungsmaschine | |
| DE6610452U (de) | Kreiselheuwerbungsmaschine. | |
| DE7147375U (de) | Kreiselegge | |
| DE3048014C2 (de) | Kreiselheuwerbungsmaschine | |
| DE1782700B2 (de) | Kreiselheuwerbungsmaschine | |
| DE2127701B1 (de) | Heuwerbungsmaschine | |
| DE1582461C3 (de) | Kreiselheuwerbungsmaschine | |
| DE1582167C2 (de) | Kreiselheuwerbungsmaschine | |
| DE3000538A1 (de) | Heuwerbungsmaschine | |
| DE2909729C2 (de) | Kreiselheuwerbungsmaschine | |
| DE1507239C3 (de) | Heuwerbungsmaschine | |
| DE1782954C2 (de) | Kreiselheuwerbungsmaschine | |
| DE1843431U (de) | Heuwerbungsmaschine. | |
| DE1757768C3 (de) | Kreiselheuwerbungsmaschine | |
| DE2222841C3 (de) | Maschine zum Zetten,,Wenden und Schwaden von auf dem Boden liegenden Gras oder Heu mit wenigstens zwei Kreiseln | |
| DE2254716C2 (de) | Kreiselheuwerbungsmaschine | |
| DE1582291A1 (de) | Heuwerbungsmaschine | |
| DE1235058B (de) | Schleppergezogene Heuwerbungsmaschine | |
| DE2607072A1 (de) | Kreiselheuwerbungsmaschine |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |