DE2417487C2 - Benzyl-phenoxyalkancarbonsäuren, deren Derivate und Verfahren zu ihrer Herstellung - Google Patents
Benzyl-phenoxyalkancarbonsäuren, deren Derivate und Verfahren zu ihrer HerstellungInfo
- Publication number
- DE2417487C2 DE2417487C2 DE2417487A DE2417487A DE2417487C2 DE 2417487 C2 DE2417487 C2 DE 2417487C2 DE 2417487 A DE2417487 A DE 2417487A DE 2417487 A DE2417487 A DE 2417487A DE 2417487 C2 DE2417487 C2 DE 2417487C2
- Authority
- DE
- Germany
- Prior art keywords
- weeds
- substances
- emergence
- millet
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002253 acid Substances 0.000 title claims description 6
- 150000007513 acids Chemical class 0.000 title claims description 4
- 238000002360 preparation method Methods 0.000 title description 20
- 238000000034 method Methods 0.000 title description 7
- 241000196324 Embryophyta Species 0.000 description 37
- 239000000126 substance Substances 0.000 description 35
- 244000062793 Sorghum vulgare Species 0.000 description 22
- 235000019713 millet Nutrition 0.000 description 19
- 240000007594 Oryza sativa Species 0.000 description 14
- 239000004480 active ingredient Substances 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 235000007164 Oryza sativa Nutrition 0.000 description 13
- 235000009566 rice Nutrition 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 241000192043 Echinochloa Species 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- 239000011734 sodium Substances 0.000 description 10
- 241000287828 Gallus gallus Species 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000460 chlorine Substances 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 9
- 240000001592 Amaranthus caudatus Species 0.000 description 8
- 235000010469 Glycine max Nutrition 0.000 description 8
- 244000068988 Glycine max Species 0.000 description 8
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 8
- 241001148683 Zostera marina Species 0.000 description 8
- 238000002474 experimental method Methods 0.000 description 8
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 7
- 235000007320 Avena fatua Nutrition 0.000 description 7
- 229920000742 Cotton Polymers 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical group CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 239000007900 aqueous suspension Substances 0.000 description 7
- 241000743985 Alopecurus Species 0.000 description 6
- 230000006378 damage Effects 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- 239000008187 granular material Substances 0.000 description 6
- 244000075850 Avena orientalis Species 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 244000000626 Daucus carota Species 0.000 description 5
- 235000002767 Daucus carota Nutrition 0.000 description 5
- 241000209504 Poaceae Species 0.000 description 5
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 5
- 240000008042 Zea mays Species 0.000 description 5
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 5
- 235000013339 cereals Nutrition 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 4
- 240000008067 Cucumis sativus Species 0.000 description 4
- 240000005979 Hordeum vulgare Species 0.000 description 4
- 235000007340 Hordeum vulgare Nutrition 0.000 description 4
- 235000005775 Setaria Nutrition 0.000 description 4
- 241000232088 Setaria <nematode> Species 0.000 description 4
- 241000209140 Triticum Species 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 239000004495 emulsifiable concentrate Substances 0.000 description 4
- 239000004009 herbicide Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- MZHCENGPTKEIGP-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1Cl MZHCENGPTKEIGP-UHFFFAOYSA-N 0.000 description 3
- GNAXZWMCLBRMEL-UHFFFAOYSA-N 2-[4-[(2,4-dichlorophenyl)methyl]phenoxy]propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1CC1=CC=C(Cl)C=C1Cl GNAXZWMCLBRMEL-UHFFFAOYSA-N 0.000 description 3
- CDMGNVWZXRKJNS-UHFFFAOYSA-N 2-benzylphenol Chemical class OC1=CC=CC=C1CC1=CC=CC=C1 CDMGNVWZXRKJNS-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 235000004431 Linum usitatissimum Nutrition 0.000 description 3
- 240000006240 Linum usitatissimum Species 0.000 description 3
- 241000209082 Lolium Species 0.000 description 3
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 3
- 240000004658 Medicago sativa Species 0.000 description 3
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 description 3
- 244000061176 Nicotiana tabacum Species 0.000 description 3
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 3
- 240000003768 Solanum lycopersicum Species 0.000 description 3
- 244000300264 Spinacia oleracea Species 0.000 description 3
- 235000009337 Spinacia oleracea Nutrition 0.000 description 3
- 235000021536 Sugar beet Nutrition 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 235000021307 Triticum Nutrition 0.000 description 3
- 240000006677 Vicia faba Species 0.000 description 3
- 235000010749 Vicia faba Nutrition 0.000 description 3
- 235000002098 Vicia faba var. major Nutrition 0.000 description 3
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- XCSGPAVHZFQHGE-UHFFFAOYSA-N alachlor Chemical compound CCC1=CC=CC(CC)=C1N(COC)C(=O)CCl XCSGPAVHZFQHGE-UHFFFAOYSA-N 0.000 description 3
- -1 alkaline earth metal cation Chemical class 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 235000005822 corn Nutrition 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 230000002363 herbicidal effect Effects 0.000 description 3
- 150000007529 inorganic bases Chemical class 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- 150000003254 radicals Chemical group 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 235000011121 sodium hydroxide Nutrition 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 241001621841 Alopecurus myosuroides Species 0.000 description 2
- 235000017060 Arachis glabrata Nutrition 0.000 description 2
- 235000010777 Arachis hypogaea Nutrition 0.000 description 2
- 244000105624 Arachis hypogaea Species 0.000 description 2
- 235000018262 Arachis monticola Nutrition 0.000 description 2
- 241000209764 Avena fatua Species 0.000 description 2
- 240000007124 Brassica oleracea Species 0.000 description 2
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 2
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 2
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 2
- YJKIALIXRCSISK-UHFFFAOYSA-N Chlorfenprop-methyl Chemical group COC(=O)C(Cl)CC1=CC=C(Cl)C=C1 YJKIALIXRCSISK-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 241000209048 Poa Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 2
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 2
- 230000000274 adsorptive effect Effects 0.000 description 2
- MCOQHIWZJUDQIC-UHFFFAOYSA-N barban Chemical compound ClCC#CCOC(=O)NC1=CC=CC(Cl)=C1 MCOQHIWZJUDQIC-UHFFFAOYSA-N 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 125000003963 dichloro group Chemical group Cl* 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 2
- 150000003977 halocarboxylic acids Chemical class 0.000 description 2
- 230000009931 harmful effect Effects 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 235000009973 maize Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 235000020232 peanut Nutrition 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000009331 sowing Methods 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZQKRWOHLQBPAGS-UHFFFAOYSA-N 2-[4-[(2,4-dichlorophenyl)methyl]phenoxy]propanamide Chemical compound C1=CC(OC(C)C(N)=O)=CC=C1CC1=CC=C(Cl)C=C1Cl ZQKRWOHLQBPAGS-UHFFFAOYSA-N 0.000 description 1
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- NPNHACUAJQMTLH-UHFFFAOYSA-N 4-[(2,4-dichlorophenyl)methyl]phenol Chemical compound C1=CC(O)=CC=C1CC1=CC=C(Cl)C=C1Cl NPNHACUAJQMTLH-UHFFFAOYSA-N 0.000 description 1
- CSELFPNBUAQDMK-UHFFFAOYSA-N 4-[(4-chlorophenyl)methyl]phenol Chemical compound C1=CC(O)=CC=C1CC1=CC=C(Cl)C=C1 CSELFPNBUAQDMK-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- 240000007087 Apium graveolens Species 0.000 description 1
- 235000015849 Apium graveolens Dulce Group Nutrition 0.000 description 1
- 235000010591 Appio Nutrition 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 240000002791 Brassica napus Species 0.000 description 1
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
- 244000241235 Citrullus lanatus Species 0.000 description 1
- 235000012828 Citrullus lanatus var citroides Nutrition 0.000 description 1
- 241000219112 Cucumis Species 0.000 description 1
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- 241001057636 Dracaena deremensis Species 0.000 description 1
- 240000001327 Echinochloa stagnina Species 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- 235000003222 Helianthus annuus Nutrition 0.000 description 1
- 244000020551 Helianthus annuus Species 0.000 description 1
- 235000021506 Ipomoea Nutrition 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- 240000003483 Leersia hexandra Species 0.000 description 1
- 241000209510 Liliopsida Species 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- REYJJPSVUYRZGE-UHFFFAOYSA-N Octadecylamine Chemical class CCCCCCCCCCCCCCCCCCN REYJJPSVUYRZGE-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 235000014676 Phragmites communis Nutrition 0.000 description 1
- 244000273256 Phragmites communis Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 239000006004 Quartz sand Substances 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000015724 Trifolium pratense Nutrition 0.000 description 1
- 235000002096 Vicia faba var. equina Nutrition 0.000 description 1
- FJJCIZWZNKZHII-UHFFFAOYSA-N [4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]cyanamide Chemical compound N#CNC1=NC(NC#N)=NC(NC#N)=N1 FJJCIZWZNKZHII-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 150000005524 benzylchlorides Chemical class 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000003967 crop rotation Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000012136 culture method Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- FDPIMTJIUBPUKL-UHFFFAOYSA-N dimethylacetone Natural products CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 1
- MYTMXVHNEWBFAL-UHFFFAOYSA-L dipotassium;carbonate;hydrate Chemical compound O.[K+].[K+].[O-]C([O-])=O MYTMXVHNEWBFAL-UHFFFAOYSA-L 0.000 description 1
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 1
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 1
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 235000005489 dwarf bean Nutrition 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 244000080020 horsebean Species 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- 235000021374 legumes Nutrition 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 125000001117 oleyl group Polymers [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- MFOUDYKPLGXPGO-UHFFFAOYSA-N propachlor Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC=C1 MFOUDYKPLGXPGO-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 235000013526 red clover Nutrition 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- ZSDSQXJSNMTJDA-UHFFFAOYSA-N trifluralin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O ZSDSQXJSNMTJDA-UHFFFAOYSA-N 0.000 description 1
- 244000045561 useful plants Species 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (32)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2417487A DE2417487C2 (de) | 1974-04-10 | 1974-04-10 | Benzyl-phenoxyalkancarbonsäuren, deren Derivate und Verfahren zu ihrer Herstellung |
| ZA00752088A ZA752088B (en) | 1974-04-10 | 1975-04-03 | Herbicidal agents |
| NLAANVRAGE7504051,A NL182192C (nl) | 1974-04-10 | 1975-04-04 | Werkwijze voor de selectieve bestrijding van grasachtige onkruidsoorten, voor de bereiding van 2,4dichloorbenzyl-fenoxypropionzuurderivaten alsmede voor een herbicide preparaat. |
| ES436325A ES436325A1 (es) | 1974-04-10 | 1975-04-04 | Procedimiento para la obtencion de agentes herbicidas. |
| IL47019A IL47019A (en) | 1974-04-10 | 1975-04-04 | Benzylphenoxylakanoic acid derivates |
| BG029572A BG26510A3 (bg) | 1974-04-10 | 1975-04-07 | Хербицидно средство |
| AT258675A AT337497B (de) | 1974-04-10 | 1975-04-07 | Herbizide mittel |
| CH440275A CH612828A5 (enFirst) | 1974-04-10 | 1975-04-07 | |
| IT22119/75A IT1049402B (it) | 1974-04-10 | 1975-04-08 | Erbicidi |
| US05/566,536 US4088474A (en) | 1974-04-10 | 1975-04-08 | Herbicidal agents |
| LU72241A LU72241A1 (enFirst) | 1974-04-10 | 1975-04-08 | |
| FI751049A FI751049A7 (enFirst) | 1974-04-10 | 1975-04-08 | |
| AU79939/75A AU494167B2 (en) | 1974-04-10 | 1975-04-08 | Herbicidal agents |
| DD185301A DD118368A5 (enFirst) | 1974-04-10 | 1975-04-08 | |
| GB14357/75A GB1491087A (en) | 1974-04-10 | 1975-04-08 | Benzyl-phenoxyalkane carboxylic acids and derivatives thereof and their use as herbicides |
| PL1975179466A PL95488B1 (pl) | 1974-04-10 | 1975-04-09 | Srodek chwastobojczy |
| RO7581946A RO68184A (ro) | 1974-04-10 | 1975-04-09 | Procedeu de preparare a unor acizi benzil-fenoxi-alcan-carboxilici |
| SE7504072A SE422049B (sv) | 1974-04-10 | 1975-04-09 | Anvendning av bensylfenoxialkankarboxylsyror och deras derivat for bekempning av ogres |
| NO751243A NO751243L (enFirst) | 1974-04-10 | 1975-04-09 | |
| CA000224168A CA1170470A (en) | 1974-04-10 | 1975-04-09 | Herbicidal benzylphenoxyalkanecarboxylic acid derivatives |
| SU752121903A SU645517A3 (ru) | 1974-04-10 | 1975-04-09 | Способ борьбы с нежелательной растительностью |
| AR258305A AR216284A1 (es) | 1974-04-10 | 1975-04-09 | Acidos bencilfenoxi-2-propionico mono o disustituido y derivados del mismo,utiles como herbicidas,procedimiento para prepararlos y composiciones que los contienen |
| JP50043180A JPS5944284B2 (ja) | 1974-04-10 | 1975-04-09 | 除草剤 |
| EG201/75A EG12339A (en) | 1974-04-10 | 1975-04-09 | Benzyl-phenoxyalkanecarboxylic acids and the derivatives and their use as herbicides |
| DK151975A DK151975A (enFirst) | 1974-04-10 | 1975-04-09 | |
| HU75HO1789A HU178242B (en) | 1974-04-10 | 1975-04-10 | Herbicide compositions and process for producing the active agents |
| CS7500002490A CS178842B2 (en) | 1974-04-10 | 1975-04-10 | Herbicidal agent and mode of preparation of actice compound |
| FR7511179A FR2267302B1 (enFirst) | 1974-04-10 | 1975-04-10 | |
| BE155285A BE827794A (fr) | 1974-04-10 | 1975-04-10 | Derives d'acides phenoxy-alcanoiques |
| KE2877A KE2877A (en) | 1974-04-10 | 1978-08-24 | Benzyl-phenoxyalkane corboxylic acids and derivatives thereof and their use as herbicides |
| MY376/78A MY7800376A (en) | 1974-04-10 | 1978-12-30 | Benzyl-phenoxyalkane carboxylic acids and derivatives thereof and their use as herbicides |
| CA000400497A CA1183149A (en) | 1974-04-10 | 1982-04-05 | Herbicidal compositions |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2417487A DE2417487C2 (de) | 1974-04-10 | 1974-04-10 | Benzyl-phenoxyalkancarbonsäuren, deren Derivate und Verfahren zu ihrer Herstellung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2417487A1 DE2417487A1 (de) | 1975-10-30 |
| DE2417487C2 true DE2417487C2 (de) | 1983-01-20 |
Family
ID=5912675
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2417487A Expired DE2417487C2 (de) | 1974-04-10 | 1974-04-10 | Benzyl-phenoxyalkancarbonsäuren, deren Derivate und Verfahren zu ihrer Herstellung |
Country Status (30)
| Country | Link |
|---|---|
| US (1) | US4088474A (enFirst) |
| JP (1) | JPS5944284B2 (enFirst) |
| AR (1) | AR216284A1 (enFirst) |
| AT (1) | AT337497B (enFirst) |
| BE (1) | BE827794A (enFirst) |
| BG (1) | BG26510A3 (enFirst) |
| CA (1) | CA1170470A (enFirst) |
| CH (1) | CH612828A5 (enFirst) |
| CS (1) | CS178842B2 (enFirst) |
| DD (1) | DD118368A5 (enFirst) |
| DE (1) | DE2417487C2 (enFirst) |
| DK (1) | DK151975A (enFirst) |
| EG (1) | EG12339A (enFirst) |
| ES (1) | ES436325A1 (enFirst) |
| FI (1) | FI751049A7 (enFirst) |
| FR (1) | FR2267302B1 (enFirst) |
| GB (1) | GB1491087A (enFirst) |
| HU (1) | HU178242B (enFirst) |
| IL (1) | IL47019A (enFirst) |
| IT (1) | IT1049402B (enFirst) |
| KE (1) | KE2877A (enFirst) |
| LU (1) | LU72241A1 (enFirst) |
| MY (1) | MY7800376A (enFirst) |
| NL (1) | NL182192C (enFirst) |
| NO (1) | NO751243L (enFirst) |
| PL (1) | PL95488B1 (enFirst) |
| RO (1) | RO68184A (enFirst) |
| SE (1) | SE422049B (enFirst) |
| SU (1) | SU645517A3 (enFirst) |
| ZA (1) | ZA752088B (enFirst) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH617417A5 (enFirst) * | 1973-12-27 | 1980-05-30 | Siegfried Ag | |
| CS185694B2 (en) * | 1974-07-17 | 1978-10-31 | Ishihara Sangyo Kaisha | Herbicidal agent |
| GB1563195A (en) * | 1975-08-20 | 1980-03-19 | Sori Soc Rech Ind | Derivating of phenoxy-alkylcarboxylic acids |
| DK189677A (da) * | 1976-05-07 | 1977-11-08 | Sumitomo Chemical Co | M-phenoxybenzamid-derivater |
| DE2628384C2 (de) * | 1976-06-24 | 1984-09-27 | Hoechst Ag, 6230 Frankfurt | 2-(4-Phenoxyphenoxy)- bzw. 2-(4-Benzylphenoxy)-propionsäurederivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Pflanzenbehandlungsmittel |
| US4211551A (en) * | 1976-11-15 | 1980-07-08 | Siegfried Ag | Herbicide |
| US4182625A (en) * | 1977-07-05 | 1980-01-08 | Stauffer Chemical Company | 3-Halo-5-(lower alkoxy) phenoxy alkyl amides |
| CH650493A5 (en) * | 1977-12-24 | 1985-07-31 | Hoechst Ag | D-(+)-alpha-phenoxypropionic acid derivatives |
| US4259105A (en) * | 1978-05-10 | 1981-03-31 | Nippon Soda Company, Ltd. | Diphenylamine derivatives |
| FR2428629A1 (fr) * | 1978-06-14 | 1980-01-11 | Hexachimie | Nouveaux composes bis(aryloxycarboxyliques), leur preparation et leur utilisation en therapeutique |
| DE2843184A1 (de) * | 1978-10-04 | 1980-04-24 | Hoechst Ag | Verfahren zur herstellung von (phenoxi- bzw. benzyl)-phenoxipropionsaeuremethylestern |
| DE2854492C2 (de) * | 1978-12-16 | 1982-12-16 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von (Phenoxy- bzw. Benzyl)-phenoxypropionsäuren und ihren Alkalisalzen |
| DE2854542A1 (de) * | 1978-12-16 | 1980-06-19 | Hoechst Ag | Verfahren zur herstellung von optisch aktiven d-(phenoxi- bzw. benzyl)- phenoxipropionsaeuren und ihren alkalisalzen |
| US4214095A (en) * | 1979-01-25 | 1980-07-22 | Siegfried Aktiengesellschaft | Chlorobenzyl phenoxy alkoxylates |
| DE2913976A1 (de) * | 1979-04-05 | 1980-10-23 | Schering Ag | Substituierte carbanilsaeureester, verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittel |
| EP0034120B1 (de) * | 1980-02-12 | 1983-12-14 | Ciba-Geigy Ag | Neue Phenoxy-phenoxy-carbonsäurederivate |
| JPS6131082U (ja) * | 1984-07-31 | 1986-02-25 | 株式会社 武蔵野フ−ズ | 紙状巻き物付おにぎり包装体 |
| JPH0791217B2 (ja) * | 1988-11-21 | 1995-10-04 | 宇部興産株式会社 | 光学活性な2−フェノキシブタン酸の製造法 |
| EP1836894A1 (de) | 2006-03-25 | 2007-09-26 | Bayer CropScience GmbH | Neue Sulfonamid-haltige feste Formulungen |
| EP1844654A1 (de) | 2006-03-29 | 2007-10-17 | Bayer CropScience GmbH | Penetrationsförderer für agrochemische Wirkstoffe |
| DE102007013362A1 (de) | 2007-03-16 | 2008-09-18 | Bayer Cropscience Ag | Penetrationsförderer für herbizide Wirkstoffe |
| WO2011076731A1 (de) | 2009-12-23 | 2011-06-30 | Bayer Cropscience Ag | Flüssige formulierung von 2-iodo-n-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl] benzolsulfonamid |
| US20130316901A1 (en) | 2011-02-15 | 2013-11-28 | Bayer Intellectual Property Gmbh | Synergistic combinations containing a dithino-tetracarboxamide fungicide and a herbicide, safener or plant growth regulator |
| DE102011079991A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Crop Science Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Nicotinoid-Insektizide als Safener |
| DE102011080010A1 (de) | 2011-07-28 | 2012-10-25 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus den Gruppen der Anilid- und Thiazol-Fungizide als Safener |
| DE102011079997A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Corpscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Pyrazol-Insektizide als Safener |
| DE102011080016A1 (de) | 2011-07-28 | 2012-10-25 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Strobilurin-Fungizide als Safener |
| DE102011080020A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Dicarboximid-Fungizide als Safener |
| DE102011080007A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus den Gruppen der Conazole- und Triazol-Fungizide als Safener |
| DE102011080004A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Carbamat-Fungizide als Safener |
| DE102011080001A1 (de) | 2011-07-28 | 2012-10-25 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Carbamat-Insektizide als Safener |
| EP2908639A1 (en) | 2012-10-19 | 2015-08-26 | Bayer Cropscience AG | Active compound combinations comprising carboxamide derivatives |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3332957A (en) * | 1964-09-02 | 1967-07-25 | Ciba Geigy Corp | Amino esters of substituted phenoxy acetic acids |
| US3630715A (en) * | 1968-12-19 | 1971-12-28 | Weston Chemical Corp | Alkylene bis (phenoxyacetic acid) derivatives as herbicides |
-
1974
- 1974-04-10 DE DE2417487A patent/DE2417487C2/de not_active Expired
-
1975
- 1975-04-03 ZA ZA00752088A patent/ZA752088B/xx unknown
- 1975-04-04 ES ES436325A patent/ES436325A1/es not_active Expired
- 1975-04-04 IL IL47019A patent/IL47019A/xx unknown
- 1975-04-04 NL NLAANVRAGE7504051,A patent/NL182192C/xx not_active IP Right Cessation
- 1975-04-07 AT AT258675A patent/AT337497B/de not_active IP Right Cessation
- 1975-04-07 BG BG029572A patent/BG26510A3/xx unknown
- 1975-04-07 CH CH440275A patent/CH612828A5/xx not_active IP Right Cessation
- 1975-04-08 IT IT22119/75A patent/IT1049402B/it active
- 1975-04-08 LU LU72241A patent/LU72241A1/xx unknown
- 1975-04-08 DD DD185301A patent/DD118368A5/xx unknown
- 1975-04-08 FI FI751049A patent/FI751049A7/fi not_active Application Discontinuation
- 1975-04-08 US US05/566,536 patent/US4088474A/en not_active Expired - Lifetime
- 1975-04-08 GB GB14357/75A patent/GB1491087A/en not_active Expired
- 1975-04-09 NO NO751243A patent/NO751243L/no unknown
- 1975-04-09 CA CA000224168A patent/CA1170470A/en not_active Expired
- 1975-04-09 JP JP50043180A patent/JPS5944284B2/ja not_active Expired
- 1975-04-09 PL PL1975179466A patent/PL95488B1/pl unknown
- 1975-04-09 SU SU752121903A patent/SU645517A3/ru active
- 1975-04-09 EG EG201/75A patent/EG12339A/xx active
- 1975-04-09 DK DK151975A patent/DK151975A/da not_active IP Right Cessation
- 1975-04-09 AR AR258305A patent/AR216284A1/es active
- 1975-04-09 SE SE7504072A patent/SE422049B/xx unknown
- 1975-04-09 RO RO7581946A patent/RO68184A/ro unknown
- 1975-04-10 HU HU75HO1789A patent/HU178242B/hu unknown
- 1975-04-10 FR FR7511179A patent/FR2267302B1/fr not_active Expired
- 1975-04-10 CS CS7500002490A patent/CS178842B2/cs unknown
- 1975-04-10 BE BE155285A patent/BE827794A/xx not_active IP Right Cessation
-
1978
- 1978-08-24 KE KE2877A patent/KE2877A/xx unknown
- 1978-12-30 MY MY376/78A patent/MY7800376A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2417487C2 (de) | Benzyl-phenoxyalkancarbonsäuren, deren Derivate und Verfahren zu ihrer Herstellung | |
| DE2433067C3 (enFirst) | ||
| DE2328340C3 (de) | N-aliphatoxyalkylierte Chloracetanilide, Verfahren zu deren Herstellung und Mittel zur Beeinflussung des Pflanzenwachstums | |
| DD146593A5 (de) | Verfahren zur herstellung neuer oximaether und-ester | |
| DE2212268B2 (de) | N-Halogenacetylanilinoessigsäureester, Verfahren zu deren Herstellung und diese enthaltende herbicide Massen | |
| DE2643477C2 (enFirst) | ||
| DE2513730A1 (de) | Halogenacetanilide als mikrobizide wirkstoffe | |
| DE2744169A1 (de) | N-eckige klammer auf 4-(subst.- benzyloxy)-phenyl eckige klammer zu -n'- methyl-n'-methoxyharnstoffe, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| EP0310558A2 (de) | Mikrobizide Mittel | |
| DE2628384A1 (de) | Herbizide und fungizide mittel | |
| CH646160A5 (de) | Heterocyclisch substituierte phenylether, diese enthaltende herbizide mittel, sowie verfahren zu deren herstellung. | |
| DD204607A5 (de) | Herbizide und wachstumsregulierende mittel | |
| DE2637886A1 (de) | 3-pyridyl-oxy-alkancarbonsaeureamide | |
| EP0007089B1 (de) | Acylanilide mit herbicider und fungicider Wirkung, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DD202087A5 (de) | Herbizide mittel | |
| EP0050097B1 (de) | Neue alpha-(Pyridyl-2-oxy-phenoxy)-propionsäurederivate, Verfahren zu deren Herstellung, sowie deren Verwendung als Herbizide und/oder Pflanzenwachstumsregulatoren | |
| CH636093A5 (de) | Mikrobizide mittel. | |
| DE3625460A1 (de) | N-(2-cyan-2-oximinoacetyl)-aminonitrile | |
| DD202374A5 (de) | Herbizide mittel | |
| CH626227A5 (en) | Herbicide | |
| DE19831803A1 (de) | Organische Hydrazinverbindungen | |
| CH635313A5 (de) | Pflanzenmikrobizid wirkende hydrazino-acetanilid-derivate, verfahren zu ihrer herstellung sowie mikrobizide mittel mit diesen praeparaten als wirkstoffe. | |
| DE2163381A1 (de) | Herbizide Komposition | |
| DD219362A5 (de) | Herbizides mittel | |
| DD200204A5 (de) | Fungizide mittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |