DE2416020A1 - Antioxydativ wirkende verbindungen - Google Patents
Antioxydativ wirkende verbindungenInfo
- Publication number
 - DE2416020A1 DE2416020A1 DE2416020A DE2416020A DE2416020A1 DE 2416020 A1 DE2416020 A1 DE 2416020A1 DE 2416020 A DE2416020 A DE 2416020A DE 2416020 A DE2416020 A DE 2416020A DE 2416020 A1 DE2416020 A1 DE 2416020A1
 - Authority
 - DE
 - Germany
 - Prior art keywords
 - formula
 - carbon atoms
 - radical
 - compound
 - atoms
 - Prior art date
 - Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
 - Pending
 
Links
- 150000001875 compounds Chemical class 0.000 title claims description 62
 - 230000003078 antioxidant effect Effects 0.000 title claims description 4
 - 125000004432 carbon atom Chemical group C* 0.000 claims description 47
 - -1 piperidino, Piperazino, morpholino, pyrrolidino Chemical group 0.000 claims description 20
 - CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 14
 - 229910052739 hydrogen Inorganic materials 0.000 claims description 14
 - 239000001257 hydrogen Substances 0.000 claims description 14
 - PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 12
 - 239000000460 chlorine Substances 0.000 claims description 12
 - 229910052801 chlorine Inorganic materials 0.000 claims description 12
 - ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 10
 - 125000001309 chloro group Chemical group Cl* 0.000 claims description 10
 - 238000000034 method Methods 0.000 claims description 9
 - 239000004743 Polypropylene Substances 0.000 claims description 8
 - 125000000753 cycloalkyl group Chemical group 0.000 claims description 8
 - 229910052760 oxygen Inorganic materials 0.000 claims description 8
 - 229920001155 polypropylene Polymers 0.000 claims description 8
 - 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 6
 - 229910052757 nitrogen Inorganic materials 0.000 claims description 6
 - 239000000126 substance Substances 0.000 claims description 6
 - 125000001424 substituent group Chemical class 0.000 claims description 6
 - UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
 - 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
 - 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
 - 239000011368 organic material Substances 0.000 claims description 5
 - 230000000087 stabilizing effect Effects 0.000 claims description 5
 - 229920001897 terpolymer Polymers 0.000 claims description 5
 - NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 4
 - KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 4
 - NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 4
 - 125000000217 alkyl group Chemical group 0.000 claims description 4
 - 229910052717 sulfur Inorganic materials 0.000 claims description 4
 - 239000004952 Polyamide Substances 0.000 claims description 3
 - 239000004698 Polyethylene Substances 0.000 claims description 3
 - 229920000122 acrylonitrile butadiene styrene Polymers 0.000 claims description 3
 - 229920001577 copolymer Polymers 0.000 claims description 3
 - 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
 - 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
 - 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 3
 - 229920002239 polyacrylonitrile Polymers 0.000 claims description 3
 - 229920002647 polyamide Polymers 0.000 claims description 3
 - 229920000728 polyester Polymers 0.000 claims description 3
 - 229920000573 polyethylene Polymers 0.000 claims description 3
 - 229920002635 polyurethane Polymers 0.000 claims description 3
 - 239000004814 polyurethane Substances 0.000 claims description 3
 - CPEONABTMRSIKA-UHFFFAOYSA-N 1,4$l^{2}-oxazinane Chemical compound C1COCC[N]1 CPEONABTMRSIKA-UHFFFAOYSA-N 0.000 claims description 2
 - YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 2
 - 229910001413 alkali metal ion Chemical group 0.000 claims description 2
 - 125000003118 aryl group Chemical group 0.000 claims description 2
 - 125000005842 heteroatom Chemical group 0.000 claims description 2
 - 125000000623 heterocyclic group Chemical group 0.000 claims description 2
 - 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
 - 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
 - 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
 - 238000002360 preparation method Methods 0.000 claims description 2
 - 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 5
 - 125000004429 atom Chemical group 0.000 claims 2
 - UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
 - RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
 - 239000004033 plastic Substances 0.000 description 7
 - 229920003023 plastic Polymers 0.000 description 7
 - 239000003381 stabilizer Substances 0.000 description 6
 - 239000000463 material Substances 0.000 description 5
 - 239000000243 solution Substances 0.000 description 5
 - DOZRDZLFLOODMB-UHFFFAOYSA-N 3,5-di-tert-Butyl-4-hydroxybenzaldehyde Chemical compound CC(C)(C)C1=CC(C=O)=CC(C(C)(C)C)=C1O DOZRDZLFLOODMB-UHFFFAOYSA-N 0.000 description 4
 - 238000004458 analytical method Methods 0.000 description 4
 - QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
 - 150000002431 hydrogen Chemical class 0.000 description 4
 - 239000001301 oxygen Substances 0.000 description 4
 - YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
 - ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
 - 238000006243 chemical reaction Methods 0.000 description 3
 - 239000000203 mixture Substances 0.000 description 3
 - VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
 - 239000003208 petroleum Substances 0.000 description 3
 - IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
 - OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
 - JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
 - UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
 - 239000004676 acrylonitrile butadiene styrene Substances 0.000 description 2
 - 230000032683 aging Effects 0.000 description 2
 - 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
 - 238000000576 coating method Methods 0.000 description 2
 - 230000006378 damage Effects 0.000 description 2
 - 239000008187 granular material Substances 0.000 description 2
 - 238000002156 mixing Methods 0.000 description 2
 - 239000000843 powder Substances 0.000 description 2
 - 239000002244 precipitate Substances 0.000 description 2
 - 239000011541 reaction mixture Substances 0.000 description 2
 - 239000002904 solvent Substances 0.000 description 2
 - 239000004753 textile Substances 0.000 description 2
 - HJIAMFHSAAEUKR-UHFFFAOYSA-N (2-hydroxyphenyl)-phenylmethanone Chemical class OC1=CC=CC=C1C(=O)C1=CC=CC=C1 HJIAMFHSAAEUKR-UHFFFAOYSA-N 0.000 description 1
 - PDVPMTPDISUWSY-UHFFFAOYSA-N (4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazine Chemical compound N=1C(NN)=NC(N2CCOCC2)=NC=1N1CCOCC1 PDVPMTPDISUWSY-UHFFFAOYSA-N 0.000 description 1
 - RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
 - 125000004398 2-methyl-2-butyl group Chemical group CC(C)(CC)* 0.000 description 1
 - 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
 - LUFLTVHAAVPJCI-UHFFFAOYSA-N 6-hydrazinyl-2-n,4-n-diphenyl-1,3,5-triazine-2,4-diamine Chemical compound N=1C(NC=2C=CC=CC=2)=NC(NN)=NC=1NC1=CC=CC=C1 LUFLTVHAAVPJCI-UHFFFAOYSA-N 0.000 description 1
 - WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
 - PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
 - VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
 - 239000004677 Nylon Substances 0.000 description 1
 - OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
 - 239000004721 Polyphenylene oxide Substances 0.000 description 1
 - 239000004793 Polystyrene Substances 0.000 description 1
 - ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
 - 239000002253 acid Substances 0.000 description 1
 - 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
 - 150000001412 amines Chemical class 0.000 description 1
 - 239000011230 binding agent Substances 0.000 description 1
 - 238000009835 boiling Methods 0.000 description 1
 - GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
 - 229910052794 bromium Inorganic materials 0.000 description 1
 - 150000001735 carboxylic acids Chemical class 0.000 description 1
 - 239000007795 chemical reaction product Substances 0.000 description 1
 - 239000003795 chemical substances by application Substances 0.000 description 1
 - 239000006071 cream Substances 0.000 description 1
 - 239000013078 crystal Substances 0.000 description 1
 - 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
 - 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
 - 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
 - 239000003599 detergent Substances 0.000 description 1
 - 239000006185 dispersion Substances 0.000 description 1
 - 230000000694 effects Effects 0.000 description 1
 - 229920001971 elastomer Polymers 0.000 description 1
 - 239000000839 emulsion Substances 0.000 description 1
 - 238000001125 extrusion Methods 0.000 description 1
 - 239000000835 fiber Substances 0.000 description 1
 - 229910052731 fluorine Inorganic materials 0.000 description 1
 - 239000011737 fluorine Substances 0.000 description 1
 - 239000011888 foil Substances 0.000 description 1
 - 229910052736 halogen Inorganic materials 0.000 description 1
 - 125000005843 halogen group Chemical group 0.000 description 1
 - 150000002367 halogens Chemical class 0.000 description 1
 - 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
 - IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
 - 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
 - 238000002329 infrared spectrum Methods 0.000 description 1
 - 239000000543 intermediate Substances 0.000 description 1
 - 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
 - 238000004898 kneading Methods 0.000 description 1
 - 239000006210 lotion Substances 0.000 description 1
 - 238000004452 microanalysis Methods 0.000 description 1
 - 239000000178 monomer Substances 0.000 description 1
 - 239000005445 natural material Substances 0.000 description 1
 - 150000002815 nickel Chemical class 0.000 description 1
 - 229920001778 nylon Polymers 0.000 description 1
 - 150000002894 organic compounds Chemical class 0.000 description 1
 - 239000003960 organic solvent Substances 0.000 description 1
 - 230000003647 oxidation Effects 0.000 description 1
 - 238000007254 oxidation reaction Methods 0.000 description 1
 - 238000010525 oxidative degradation reaction Methods 0.000 description 1
 - 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
 - 229910052698 phosphorus Inorganic materials 0.000 description 1
 - 239000011574 phosphorus Substances 0.000 description 1
 - 239000000049 pigment Substances 0.000 description 1
 - 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
 - 230000000379 polymerizing effect Effects 0.000 description 1
 - 239000004926 polymethyl methacrylate Substances 0.000 description 1
 - 229920000098 polyolefin Polymers 0.000 description 1
 - 229920006380 polyphenylene oxide Polymers 0.000 description 1
 - 229920001451 polypropylene glycol Polymers 0.000 description 1
 - 229920002223 polystyrene Polymers 0.000 description 1
 - 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
 - 239000011241 protective layer Substances 0.000 description 1
 - UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
 - 230000035484 reaction time Effects 0.000 description 1
 - 238000010992 reflux Methods 0.000 description 1
 - 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
 - 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
 - 235000017557 sodium bicarbonate Nutrition 0.000 description 1
 - 238000003756 stirring Methods 0.000 description 1
 
Classifications
- 
        
- C—CHEMISTRY; METALLURGY
 - C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
 - C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
 - C08K5/00—Use of organic ingredients
 - C08K5/16—Nitrogen-containing compounds
 - C08K5/34—Heterocyclic compounds having nitrogen in the ring
 - C08K5/3467—Heterocyclic compounds having nitrogen in the ring having more than two nitrogen atoms in the ring
 - C08K5/3477—Six-membered rings
 - C08K5/3492—Triazines
 
 
Landscapes
- Chemical & Material Sciences (AREA)
 - Health & Medical Sciences (AREA)
 - Chemical Kinetics & Catalysis (AREA)
 - Medicinal Chemistry (AREA)
 - Polymers & Plastics (AREA)
 - Organic Chemistry (AREA)
 - Compositions Of Macromolecular Compounds (AREA)
 - Plural Heterocyclic Compounds (AREA)
 - Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
 
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title | 
|---|---|---|---|
| CH491773A CH567484A5 (forum.php) | 1973-04-05 | 1973-04-05 | 
Publications (1)
| Publication Number | Publication Date | 
|---|---|
| DE2416020A1 true DE2416020A1 (de) | 1974-10-24 | 
Family
ID=4284783
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date | 
|---|---|---|---|
| DE2416020A Pending DE2416020A1 (de) | 1973-04-05 | 1974-04-02 | Antioxydativ wirkende verbindungen | 
Country Status (10)
| Country | Link | 
|---|---|
| US (1) | US3957765A (forum.php) | 
| JP (1) | JPS49127987A (forum.php) | 
| BE (1) | BE813260A (forum.php) | 
| CH (1) | CH567484A5 (forum.php) | 
| DE (1) | DE2416020A1 (forum.php) | 
| ES (1) | ES424900A1 (forum.php) | 
| FR (1) | FR2224465B3 (forum.php) | 
| GB (1) | GB1468225A (forum.php) | 
| IT (1) | IT1015903B (forum.php) | 
| NL (1) | NL7404380A (forum.php) | 
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| DE3207477A1 (de) * | 1982-03-02 | 1983-09-15 | Bayer Ag, 5090 Leverkusen | Kationische hydrazonfarbstoffe, verfahren zu ihrer herstellung sowie ihre verwendung zum faerben von natuerlichen und synthetischen substraten | 
| US4517188A (en) * | 1983-05-09 | 1985-05-14 | Mead Johnson & Company | 1-Pyrimidinyloxy-3-hetaryl-alkylamino-2-propanols | 
| GB2397301A (en) * | 2003-01-14 | 2004-07-21 | Novo Pharmaceuticals Ltd De | Substituted 1,3,5-triazine derivatives | 
| JP4990766B2 (ja) * | 2004-07-01 | 2012-08-01 | シンタ ファーマシューティカルズ コーポレーション | 二置換型ヘテロアリール化合物 | 
| US9321735B2 (en) | 2010-07-20 | 2016-04-26 | Vestaron Corporation | Insecticidal triazines and pyrimidines | 
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| NL288391A (forum.php) * | 1962-12-14 | |||
| CH490116A (de) * | 1967-08-04 | 1970-05-15 | Ciba Geigy | Verwendung von neuen Triazinderivaten als Antioxydantien für organische Substanzen | 
| GB1274081A (en) * | 1968-05-27 | 1972-05-10 | Argus Chem | Heterocyclic-amino, imino and acylamino compounds and their use | 
| GB1274759A (en) * | 1968-05-30 | 1972-05-17 | Argus Chem | Heterocyclic hydrazines, amides and lactams and their use in the enhancement of resistance of olefin polymers to copper-catalyzed oxidative degradation | 
| US3706740A (en) * | 1971-04-19 | 1972-12-19 | Ciba Geigy Corp | 3,5-dialkyl-4-hydroxyphenyl derivatives of triazines | 
- 
        1973
        
- 1973-04-05 CH CH491773A patent/CH567484A5/xx not_active IP Right Cessation
 
 - 
        1974
        
- 1974-04-01 NL NL7404380A patent/NL7404380A/xx unknown
 - 1974-04-01 US US05/456,630 patent/US3957765A/en not_active Expired - Lifetime
 - 1974-04-02 DE DE2416020A patent/DE2416020A1/de active Pending
 - 1974-04-02 GB GB1464974A patent/GB1468225A/en not_active Expired
 - 1974-04-03 ES ES424900A patent/ES424900A1/es not_active Expired
 - 1974-04-03 BE BE142818A patent/BE813260A/xx unknown
 - 1974-04-03 JP JP49037751A patent/JPS49127987A/ja active Pending
 - 1974-04-05 FR FR7412083A patent/FR2224465B3/fr not_active Expired
 - 1974-04-05 IT IT50190/74A patent/IT1015903B/it active
 
 
Also Published As
| Publication number | Publication date | 
|---|---|
| JPS49127987A (forum.php) | 1974-12-07 | 
| US3957765A (en) | 1976-05-18 | 
| FR2224465A1 (forum.php) | 1974-10-31 | 
| CH567484A5 (forum.php) | 1975-10-15 | 
| GB1468225A (en) | 1977-03-23 | 
| FR2224465B3 (forum.php) | 1977-02-18 | 
| IT1015903B (it) | 1977-05-20 | 
| ES424900A1 (es) | 1976-10-16 | 
| BE813260A (fr) | 1974-10-03 | 
| NL7404380A (forum.php) | 1974-10-08 | 
Similar Documents
| Publication | Publication Date | Title | 
|---|---|---|
| DE2331720A1 (de) | Ultraviolett-strahlen absorbierende verbindungen | |
| DE2301862C3 (de) | Neue Isoindolinonpigmente und Verfahren zum Pigmentieren von hochmolekularem organischem Material | |
| DE1769646C3 (de) | Stabilisierung von synthetischen Polymeren | |
| DE2323022A1 (de) | Verfahren zum stabilisieren von organischen materialien | |
| DE2256783C2 (de) | Verfahren zur Herstellung von neuen Diphenylmethan-, Diphenyloxid- und Diphenylsulfid-phosphonigsäuren, deren Salzen mit anorganischen Kationen, deren Ester und Thioester | |
| DE2433111A1 (de) | Ultraviolett-strahlen absorbierende verbindungen | |
| DE2324933C2 (forum.php) | ||
| DE2416020A1 (de) | Antioxydativ wirkende verbindungen | |
| DE2346748A1 (de) | Verfahren zur herstellung von antioxydativ wirkenden verbindungen | |
| DE2456735A1 (de) | Verbindungen zum stabilisieren von organischen materialien | |
| DE2118298A1 (de) | Verwendung von Piperidonazinen zum Stabilisieren von organischem Material | |
| DE3524542A1 (de) | 1-oxa-3-oxo-4,8-diaza-spiro-(4,5)decan- verbindungen | |
| DE2410370C2 (de) | Neue Pyrazolverbindungen, Verfahren zu ihrer Herstellung und die Verwendung von Pyrazolverbindungen zum Stabilisieren von organischen Materialien | |
| DE2511354A1 (de) | Neue heterocyclische verbindungen | |
| DE2834871A1 (de) | Arylphosphonite und arylthiophosphonite, deren herstellung und verwendung als antioxydantien | |
| DE2839132A1 (de) | Fluorenphophonite bzw. -thionophosphonite, deren herstellung und verwendung als antioxydantien | |
| DE2519594A1 (de) | Neue heterocyclische verbindungen | |
| DE2231981A1 (de) | Schwefelhaltige derivate von dialkyl-4-hydroxyphenyltriazin | |
| DE2529052A1 (de) | Neue chemische verbindungen | |
| DE2432098A1 (de) | Ultraviolett-strahlen desaktivierende verbindungen | |
| DE69720475T2 (de) | 1:2 eisenkomplex-azofarbstoffe | |
| DE1468091A1 (de) | Stabilisierungsmittel | |
| CH581090A5 (en) | Stabilising org. materials, e.g. polymers against ultraviolet radiatio - with complexes prepd. from acid, amine and nickel salt | |
| CH570966A5 (en) | p-Hydroxy benzoic esters stabilising agents - against ultra-violet light, contg. 1,2 or 4 ester gps and tert alkyl groups | |
| DE1808482A1 (de) | Acrylelastomere | 
Legal Events
| Date | Code | Title | Description | 
|---|---|---|---|
| OHJ | Non-payment of the annual fee |