DE2409753A1 - Substituierte pyrazole - Google Patents
Substituierte pyrazoleInfo
- Publication number
- DE2409753A1 DE2409753A1 DE2409753A DE2409753A DE2409753A1 DE 2409753 A1 DE2409753 A1 DE 2409753A1 DE 2409753 A DE2409753 A DE 2409753A DE 2409753 A DE2409753 A DE 2409753A DE 2409753 A1 DE2409753 A1 DE 2409753A1
- Authority
- DE
- Germany
- Prior art keywords
- spp
- phenyl
- substituted
- radical
- parts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 150000003217 pyrazoles Chemical class 0.000 title claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 230000002363 herbicidal effect Effects 0.000 claims description 7
- 239000004009 herbicide Substances 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- -1 aralkyl radical Chemical class 0.000 description 49
- 239000004480 active ingredient Substances 0.000 description 25
- 150000003839 salts Chemical class 0.000 description 21
- 150000002148 esters Chemical class 0.000 description 16
- 150000001408 amides Chemical class 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000003921 oil Substances 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 239000006185 dispersion Substances 0.000 description 8
- NEELEVWEBRBBBE-UHFFFAOYSA-N 5-phenyl-3-phenylsulfanyl-1h-pyrazole Chemical compound C=1C=CC=CC=1SC(=NN1)C=C1C1=CC=CC=C1 NEELEVWEBRBBBE-UHFFFAOYSA-N 0.000 description 6
- 241000196324 Embryophyta Species 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- 239000013543 active substance Substances 0.000 description 4
- 239000004359 castor oil Substances 0.000 description 4
- 235000019438 castor oil Nutrition 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 4
- 150000002431 hydrogen Chemical group 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 235000021533 Beta vulgaris Nutrition 0.000 description 3
- 241000335053 Beta vulgaris Species 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 241000209219 Hordeum Species 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000000853 adhesive Substances 0.000 description 3
- 230000001070 adhesive effect Effects 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 229920005610 lignin Polymers 0.000 description 3
- 150000002790 naphthalenes Chemical class 0.000 description 3
- YDCVQGAUCOROHB-UHFFFAOYSA-N oxadiazolidine-4,5-dione Chemical group O=C1NNOC1=O YDCVQGAUCOROHB-UHFFFAOYSA-N 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- XQEMNBNCQVQXMO-UHFFFAOYSA-M 1,2-dimethyl-3,5-diphenylpyrazol-1-ium;methyl sulfate Chemical compound COS([O-])(=O)=O.C[N+]=1N(C)C(C=2C=CC=CC=2)=CC=1C1=CC=CC=C1 XQEMNBNCQVQXMO-UHFFFAOYSA-M 0.000 description 2
- POBMFNPLFSOSRO-UHFFFAOYSA-N 1-(3-phenyl-5-phenylsulfanylpyrazol-1-yl)ethanone Chemical compound CC(=O)N1N=C(C=2C=CC=CC=2)C=C1SC1=CC=CC=C1 POBMFNPLFSOSRO-UHFFFAOYSA-N 0.000 description 2
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 2
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical class CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 2
- 241001621841 Alopecurus myosuroides Species 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- 241000208173 Apiaceae Species 0.000 description 2
- 235000005781 Avena Nutrition 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 241000219198 Brassica Species 0.000 description 2
- 235000011331 Brassica Nutrition 0.000 description 2
- 240000002791 Brassica napus Species 0.000 description 2
- 235000011293 Brassica napus Nutrition 0.000 description 2
- 241000219193 Brassicaceae Species 0.000 description 2
- 241000871189 Chenopodiaceae Species 0.000 description 2
- 244000000626 Daucus carota Species 0.000 description 2
- 235000002767 Daucus carota Nutrition 0.000 description 2
- 241000195952 Equisetaceae Species 0.000 description 2
- 241000220485 Fabaceae Species 0.000 description 2
- 241000208822 Lactuca Species 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 241000219071 Malvaceae Species 0.000 description 2
- 241000219823 Medicago Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 241000013557 Plantaginaceae Species 0.000 description 2
- 244000292693 Poa annua Species 0.000 description 2
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 2
- 241000220259 Raphanus Species 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 241000208292 Solanaceae Species 0.000 description 2
- 235000002634 Solanum Nutrition 0.000 description 2
- 241000207763 Solanum Species 0.000 description 2
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 2
- 244000062793 Sorghum vulgare Species 0.000 description 2
- 241000219793 Trifolium Species 0.000 description 2
- 241000405217 Viola <butterfly> Species 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 239000000729 antidote Substances 0.000 description 2
- 229940075522 antidotes Drugs 0.000 description 2
- 239000003899 bactericide agent Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 244000038559 crop plants Species 0.000 description 2
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 241001233957 eudicotyledons Species 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 239000000417 fungicide Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000003630 growth substance Substances 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 2
- 230000001069 nematicidal effect Effects 0.000 description 2
- 239000005645 nematicide Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical class OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- 235000013311 vegetables Nutrition 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- OHPMGIYXBRVIES-UHFFFAOYSA-N (3,5-diphenyl-1H-pyrazol-4-yl) hydrogen sulfate Chemical compound C1(=CC=CC=C1)C1=NNC(=C1OS(=O)(=O)O)C1=CC=CC=C1 OHPMGIYXBRVIES-UHFFFAOYSA-N 0.000 description 1
- FTDGDIFUDKDKAW-UHFFFAOYSA-N 1,1a,5,5a,6,6a-hexahydrocyclopropa[a]indene Chemical group C12C(CC3CC=CC=C13)C2 FTDGDIFUDKDKAW-UHFFFAOYSA-N 0.000 description 1
- FNQJDLTXOVEEFB-UHFFFAOYSA-N 1,2,3-benzothiadiazole Chemical group C1=CC=C2SN=NC2=C1 FNQJDLTXOVEEFB-UHFFFAOYSA-N 0.000 description 1
- CSNIZNHTOVFARY-UHFFFAOYSA-N 1,2-benzothiazole Chemical group C1=CC=C2C=NSC2=C1 CSNIZNHTOVFARY-UHFFFAOYSA-N 0.000 description 1
- LTQKIFCNCIFEHG-UHFFFAOYSA-N 1,2-oxazole 1H-pyrimidin-2-one Chemical group C=1C=NOC=1.O=C1N=CC=CN1 LTQKIFCNCIFEHG-UHFFFAOYSA-N 0.000 description 1
- YRHBXARQWSQUCM-UHFFFAOYSA-N 1,4-dioxane hydrazine hydrate Chemical compound O1CCOCC1.O.NN YRHBXARQWSQUCM-UHFFFAOYSA-N 0.000 description 1
- YMVSJXWLOWFFKK-UHFFFAOYSA-N 1-benzyl-3-phenyl-5-phenylsulfanylpyrazole Chemical compound N1=C(C=2C=CC=CC=2)C=C(SC=2C=CC=CC=2)N1CC1=CC=CC=C1 YMVSJXWLOWFFKK-UHFFFAOYSA-N 0.000 description 1
- FKKAGFLIPSSCHT-UHFFFAOYSA-N 1-dodecoxydodecane;sulfuric acid Chemical compound OS(O)(=O)=O.CCCCCCCCCCCCOCCCCCCCCCCCC FKKAGFLIPSSCHT-UHFFFAOYSA-N 0.000 description 1
- XUJLWPFSUCHPQL-UHFFFAOYSA-N 11-methyldodecan-1-ol Chemical compound CC(C)CCCCCCCCCCO XUJLWPFSUCHPQL-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- NOIXNOMHHWGUTG-UHFFFAOYSA-N 2-[[4-[4-pyridin-4-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]phenoxy]methyl]quinoline Chemical compound C=1C=C(OCC=2N=C3C=CC=CC3=CC=2)C=CC=1C1=NN(CC(F)(F)F)C=C1C1=CC=NC=C1 NOIXNOMHHWGUTG-UHFFFAOYSA-N 0.000 description 1
- MUKYLHIZBOASDM-UHFFFAOYSA-N 2-[carbamimidoyl(methyl)amino]acetic acid 2,3,4,5,6-pentahydroxyhexanoic acid Chemical compound NC(=N)N(C)CC(O)=O.OCC(O)C(O)C(O)C(O)C(O)=O MUKYLHIZBOASDM-UHFFFAOYSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- REEXLQXWNOSJKO-UHFFFAOYSA-N 2h-1$l^{4},2,3-benzothiadiazine 1-oxide Chemical class C1=CC=C2S(=O)NN=CC2=C1 REEXLQXWNOSJKO-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- QZBOTZOIKVJOIE-UHFFFAOYSA-N 4-bromo-5-phenyl-3-phenylsulfanyl-1h-pyrazole Chemical compound N=1NC(C=2C=CC=CC=2)=C(Br)C=1SC1=CC=CC=C1 QZBOTZOIKVJOIE-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- RQMWVVBHJMUJNZ-UHFFFAOYSA-N 4-chloropyridin-2-amine Chemical group NC1=CC(Cl)=CC=N1 RQMWVVBHJMUJNZ-UHFFFAOYSA-N 0.000 description 1
- HQQTZCPKNZVLFF-UHFFFAOYSA-N 4h-1,2-benzoxazin-3-one Chemical group C1=CC=C2ONC(=O)CC2=C1 HQQTZCPKNZVLFF-UHFFFAOYSA-N 0.000 description 1
- QFOACKKYAGVUQT-UHFFFAOYSA-N 5-phenylsulfanyl-1h-pyrazole Chemical compound C=1C=CC=CC=1SC1=CC=NN1 QFOACKKYAGVUQT-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 241000219144 Abutilon Species 0.000 description 1
- 241000206486 Adonis Species 0.000 description 1
- 241000125147 Aethusa cynapium Species 0.000 description 1
- 241000209136 Agropyron Species 0.000 description 1
- 241001533988 Agrostemma Species 0.000 description 1
- 241000219479 Aizoaceae Species 0.000 description 1
- 241000209514 Alismataceae Species 0.000 description 1
- 241000743985 Alopecurus Species 0.000 description 1
- 241000219317 Amaranthaceae Species 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- 235000005750 Ammi majus Nutrition 0.000 description 1
- 244000160914 Ammi majus Species 0.000 description 1
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- 241000208479 Anagallis arvensis Species 0.000 description 1
- 244000099147 Ananas comosus Species 0.000 description 1
- 235000007119 Ananas comosus Nutrition 0.000 description 1
- 244000277177 Anchusa azurea Species 0.000 description 1
- 235000017106 Anchusa azurea Nutrition 0.000 description 1
- 241000404028 Anthemis Species 0.000 description 1
- 241001666377 Apera Species 0.000 description 1
- 235000002764 Apium graveolens Nutrition 0.000 description 1
- 240000007087 Apium graveolens Species 0.000 description 1
- 241000219195 Arabidopsis thaliana Species 0.000 description 1
- 235000003911 Arachis Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000003826 Artemisia Nutrition 0.000 description 1
- 235000003261 Artemisia vulgaris Nutrition 0.000 description 1
- 241000219305 Atriplex Species 0.000 description 1
- 235000007320 Avena fatua Nutrition 0.000 description 1
- 241000209764 Avena fatua Species 0.000 description 1
- 235000007563 Barbarea vulgaris Nutrition 0.000 description 1
- 240000008399 Barbarea vulgaris Species 0.000 description 1
- 241000143476 Bidens Species 0.000 description 1
- 241001072256 Boraginaceae Species 0.000 description 1
- 241000611157 Brachiaria Species 0.000 description 1
- 241000339490 Brachyachne Species 0.000 description 1
- 235000008427 Brassica arvensis Nutrition 0.000 description 1
- 244000024671 Brassica kaber Species 0.000 description 1
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
- 241000234670 Bromeliaceae Species 0.000 description 1
- 241000209200 Bromus Species 0.000 description 1
- WUFYJSIFTHYAGJ-UHFFFAOYSA-N C=1C=NSC=1.O=C1N=CC=CN1 Chemical group C=1C=NSC=1.O=C1N=CC=CN1 WUFYJSIFTHYAGJ-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000220244 Capsella <angiosperm> Species 0.000 description 1
- 235000002567 Capsicum annuum Nutrition 0.000 description 1
- 240000004160 Capsicum annuum Species 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical group NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 241000722731 Carex Species 0.000 description 1
- WLYGSPLCNKYESI-RSUQVHIMSA-N Carthamin Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1[C@@]1(O)C(O)=C(C(=O)\C=C\C=2C=CC(O)=CC=2)C(=O)C(\C=C\2C([C@](O)([C@H]3[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O3)O)C(O)=C(C(=O)\C=C\C=3C=CC(O)=CC=3)C/2=O)=O)=C1O WLYGSPLCNKYESI-RSUQVHIMSA-N 0.000 description 1
- 241000208809 Carthamus Species 0.000 description 1
- 241000219321 Caryophyllaceae Species 0.000 description 1
- 241000209120 Cenchrus Species 0.000 description 1
- 241000132570 Centaurea Species 0.000 description 1
- 241000219294 Cerastium Species 0.000 description 1
- 241000219312 Chenopodium Species 0.000 description 1
- 235000000509 Chenopodium ambrosioides Nutrition 0.000 description 1
- 244000098897 Chenopodium botrys Species 0.000 description 1
- 235000005490 Chenopodium botrys Nutrition 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 240000005250 Chrysanthemum indicum Species 0.000 description 1
- 244000037364 Cinnamomum aromaticum Species 0.000 description 1
- 235000014489 Cinnamomum aromaticum Nutrition 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 241000233838 Commelina Species 0.000 description 1
- 241000233833 Commelinaceae Species 0.000 description 1
- 241000207782 Convolvulaceae Species 0.000 description 1
- 241000207892 Convolvulus Species 0.000 description 1
- 241000219122 Cucurbita Species 0.000 description 1
- 241000219104 Cucurbitaceae Species 0.000 description 1
- 241000219992 Cuphea Species 0.000 description 1
- 241000207901 Cuscuta Species 0.000 description 1
- 241000234646 Cyperaceae Species 0.000 description 1
- 241000234653 Cyperus Species 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical class OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 241000209210 Dactylis Species 0.000 description 1
- 241000208296 Datura Species 0.000 description 1
- 241000202296 Delphinium Species 0.000 description 1
- 241000032170 Descurainia Species 0.000 description 1
- 240000001879 Digitalis lutea Species 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- 241000865506 Diodia Species 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 241000004297 Draba Species 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 244000058871 Echinochloa crus-galli Species 0.000 description 1
- 241000202829 Eleocharis Species 0.000 description 1
- 235000007351 Eleusine Nutrition 0.000 description 1
- 241000209215 Eleusine Species 0.000 description 1
- 241001518935 Eragrostis Species 0.000 description 1
- 241000132521 Erigeron Species 0.000 description 1
- 241001071608 Erodium Species 0.000 description 1
- 241000221079 Euphorbia <genus> Species 0.000 description 1
- 241000221017 Euphorbiaceae Species 0.000 description 1
- 235000009419 Fagopyrum esculentum Nutrition 0.000 description 1
- 240000008620 Fagopyrum esculentum Species 0.000 description 1
- 241000220223 Fragaria Species 0.000 description 1
- 244000044980 Fumaria officinalis Species 0.000 description 1
- 235000006961 Fumaria officinalis Nutrition 0.000 description 1
- 241000816457 Galeopsis Species 0.000 description 1
- 241000748465 Galinsoga Species 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 241000208150 Geraniaceae Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 1
- 244000299507 Gossypium hirsutum Species 0.000 description 1
- 241000208818 Helianthus Species 0.000 description 1
- 235000005206 Hibiscus Nutrition 0.000 description 1
- 235000007185 Hibiscus lunariifolius Nutrition 0.000 description 1
- 244000284380 Hibiscus rosa sinensis Species 0.000 description 1
- 241001113566 Hydrocharitaceae Species 0.000 description 1
- 235000021506 Ipomoea Nutrition 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000110847 Kochia Species 0.000 description 1
- 241000207923 Lamiaceae Species 0.000 description 1
- 241000520028 Lamium Species 0.000 description 1
- 241000219729 Lathyrus Species 0.000 description 1
- 241000801118 Lepidium Species 0.000 description 1
- 241000932234 Lepidium didymum Species 0.000 description 1
- 241000320639 Leptochloa Species 0.000 description 1
- 241000234280 Liliaceae Species 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 241000208202 Linaceae Species 0.000 description 1
- 241000167853 Linaria Species 0.000 description 1
- 241000208204 Linum Species 0.000 description 1
- 241001071917 Lithospermum Species 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 240000004296 Lolium perenne Species 0.000 description 1
- 241000612166 Lysimachia Species 0.000 description 1
- 241000219991 Lythraceae Species 0.000 description 1
- 235000013939 Malva Nutrition 0.000 description 1
- 240000000982 Malva neglecta Species 0.000 description 1
- 235000000060 Malva neglecta Nutrition 0.000 description 1
- 241000736303 Marsileaceae Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 235000009382 Mollugo verticillata Nutrition 0.000 description 1
- 240000005272 Mollugo verticillata Species 0.000 description 1
- 241000721619 Najas Species 0.000 description 1
- 229930192627 Naphthoquinone Natural products 0.000 description 1
- 241001106046 Nicandra Species 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- 241000219929 Onagraceae Species 0.000 description 1
- 241000209094 Oryza Species 0.000 description 1
- 241000208165 Oxalidaceae Species 0.000 description 1
- 235000016499 Oxalis corniculata Nutrition 0.000 description 1
- 240000007019 Oxalis corniculata Species 0.000 description 1
- 241000209117 Panicum Species 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 240000008114 Panicum miliaceum Species 0.000 description 1
- 235000007199 Panicum miliaceum Nutrition 0.000 description 1
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 1
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 1
- 235000011096 Papaver Nutrition 0.000 description 1
- 240000001090 Papaver somniferum Species 0.000 description 1
- 241000218180 Papaveraceae Species 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 241000208181 Pelargonium Species 0.000 description 1
- 241000745991 Phalaris Species 0.000 description 1
- 241000219833 Phaseolus Species 0.000 description 1
- 244000273256 Phragmites communis Species 0.000 description 1
- 235000014676 Phragmites communis Nutrition 0.000 description 1
- 244000064622 Physalis edulis Species 0.000 description 1
- 241000219843 Pisum Species 0.000 description 1
- 241001127637 Plantago Species 0.000 description 1
- 241000209048 Poa Species 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 241000219050 Polygonaceae Species 0.000 description 1
- 241000205407 Polygonum Species 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 241000196124 Polypodiaceae Species 0.000 description 1
- 241000219295 Portulaca Species 0.000 description 1
- 241000219304 Portulacaceae Species 0.000 description 1
- 241000722195 Potamogeton Species 0.000 description 1
- 241000756999 Potamogetonaceae Species 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 241001092489 Potentilla Species 0.000 description 1
- 241000208476 Primulaceae Species 0.000 description 1
- 241001453830 Pteridium Species 0.000 description 1
- 241000218201 Ranunculaceae Species 0.000 description 1
- 241000218206 Ranunculus Species 0.000 description 1
- 235000004789 Rosa xanthina Nutrition 0.000 description 1
- 241000220222 Rosaceae Species 0.000 description 1
- 241001107098 Rubiaceae Species 0.000 description 1
- 241000219053 Rumex Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 240000009132 Sagittaria sagittifolia Species 0.000 description 1
- 235000006466 Sagittaria sagittifolia Nutrition 0.000 description 1
- 241001632050 Salsola Species 0.000 description 1
- 241000219287 Saponaria Species 0.000 description 1
- 241000202758 Scirpus Species 0.000 description 1
- 241000583552 Scleranthus annuus Species 0.000 description 1
- 244000292071 Scorzonera hispanica Species 0.000 description 1
- 235000018704 Scorzonera hispanica Nutrition 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- 241000533293 Sesbania emerus Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 241000219289 Silene Species 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- 241000220263 Sisymbrium Species 0.000 description 1
- 241000488874 Sonchus Species 0.000 description 1
- 241000960310 Spergula Species 0.000 description 1
- 241000219315 Spinacia Species 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 235000012308 Tagetes Nutrition 0.000 description 1
- 241000736851 Tagetes Species 0.000 description 1
- 241000245665 Taraxacum Species 0.000 description 1
- 241000722118 Thlaspi Species 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 241000819233 Tribulus <sea snail> Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 241000249864 Tussilago Species 0.000 description 1
- 239000005659 Urtica spp. Substances 0.000 description 1
- 241000218215 Urticaceae Species 0.000 description 1
- 240000005592 Veronica officinalis Species 0.000 description 1
- 241001106476 Violaceae Species 0.000 description 1
- 241000219094 Vitaceae Species 0.000 description 1
- 235000014787 Vitis vinifera Nutrition 0.000 description 1
- 240000006365 Vitis vinifera Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000007244 Zea mays Nutrition 0.000 description 1
- 241000218496 Zeugodacus cucumis Species 0.000 description 1
- 241000159213 Zygophyllaceae Species 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229940111121 antirheumatic drug quinolines Drugs 0.000 description 1
- 239000001387 apium graveolens Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- BUSBFZWLPXDYIC-UHFFFAOYSA-N arsonic acid Chemical class O[AsH](O)=O BUSBFZWLPXDYIC-UHFFFAOYSA-N 0.000 description 1
- 244000030166 artemisia Species 0.000 description 1
- 235000009052 artemisia Nutrition 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 150000005130 benzoxazines Chemical group 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Inorganic materials [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 239000001511 capsicum annuum Substances 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000011280 coal tar Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical group 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000002019 disulfides Chemical group 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 150000004659 dithiocarbamates Chemical group 0.000 description 1
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- QQSGDKKFXBGYON-UHFFFAOYSA-N ethoxy-methylperoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-$l^{5}-phosphane Chemical group CCOP(=S)(OOC)OC1=CC(C)=NC(C(C)C)=N1 QQSGDKKFXBGYON-UHFFFAOYSA-N 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 235000002532 grape seed extract Nutrition 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N heptadecan-1-ol Chemical class CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- 150000001469 hydantoins Chemical group 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 150000002460 imidazoles Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical group 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 1
- IPGXHHDCOUXZNH-UHFFFAOYSA-N n,3-diphenyl-5-phenylsulfanylpyrazole-1-carboxamide Chemical compound N1=C(C=2C=CC=CC=2)C=C(SC=2C=CC=CC=2)N1C(=O)NC1=CC=CC=C1 IPGXHHDCOUXZNH-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002791 naphthoquinones Chemical group 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- QNMLMAVEXUCXRG-UHFFFAOYSA-N oxadiazinane-4,5-dione Chemical group O=C1CONNC1=O QNMLMAVEXUCXRG-UHFFFAOYSA-N 0.000 description 1
- 150000004866 oxadiazoles Chemical group 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- UCUUFSAXZMGPGH-UHFFFAOYSA-N penta-1,4-dien-3-one Chemical class C=CC(=O)C=C UCUUFSAXZMGPGH-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000001377 petroselinum spp. Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical compound O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 description 1
- CWHFDTWZHFRTAB-UHFFFAOYSA-N phenyl cyanate Chemical compound N#COC1=CC=CC=C1 CWHFDTWZHFRTAB-UHFFFAOYSA-N 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- REJGOFYVRVIODZ-UHFFFAOYSA-N phosphanium;chloride Chemical group P.Cl REJGOFYVRVIODZ-UHFFFAOYSA-N 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical group [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- BFZYLUGEHGYJKJ-UHFFFAOYSA-N pyrazolidine-3-thione Chemical group S=C1CCNN1 BFZYLUGEHGYJKJ-UHFFFAOYSA-N 0.000 description 1
- 150000004892 pyridazines Chemical group 0.000 description 1
- 150000005299 pyridinones Chemical group 0.000 description 1
- 150000003230 pyrimidines Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 150000008318 pyrimidones Chemical group 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- NYCVCXMSZNOGDH-UHFFFAOYSA-N pyrrolidine-1-carboxylic acid Chemical class OC(=O)N1CCCC1 NYCVCXMSZNOGDH-UHFFFAOYSA-N 0.000 description 1
- 150000003235 pyrrolidines Chemical group 0.000 description 1
- 150000004040 pyrrolidinones Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 150000003248 quinolines Chemical group 0.000 description 1
- 238000005201 scrubbing Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 150000003440 styrenes Chemical group 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- OLPRIZQBWZMBAS-UHFFFAOYSA-N thiadiazolidine 1,1-dioxide Chemical group O=S1(=O)CCNN1 OLPRIZQBWZMBAS-UHFFFAOYSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 150000003566 thiocarboxylic acids Chemical class 0.000 description 1
- 150000003582 thiophosphoric acids Chemical class 0.000 description 1
- 150000003585 thioureas Chemical group 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- 150000003918 triazines Chemical group 0.000 description 1
- 150000003852 triazoles Chemical group 0.000 description 1
- 229940047183 tribulus Drugs 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/18—One oxygen or sulfur atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Priority Applications (23)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2409753A DE2409753A1 (de) | 1974-03-01 | 1974-03-01 | Substituierte pyrazole |
| IL46563A IL46563A (en) | 1974-03-01 | 1975-02-04 | Substituted pyrazoles their preparation and their use as herbicides |
| JP50019515A JPS50117936A (enExample) | 1974-03-01 | 1975-02-18 | |
| BG029043A BG26354A3 (bg) | 1974-03-01 | 1975-02-21 | Хербицидно средство |
| SU7502107330A SU569268A3 (ru) | 1974-03-01 | 1975-02-24 | Гербицидное средство |
| CH241575A CH593609A5 (enExample) | 1974-03-01 | 1975-02-26 | |
| CS7500001290A CS185676B2 (en) | 1974-03-01 | 1975-02-26 | Herbicidal agent |
| IT48351/75A IT1044124B (it) | 1974-03-01 | 1975-02-27 | Pirazoli sostituiti |
| BE153824A BE826074A (fr) | 1974-03-01 | 1975-02-27 | Couche jetable pour bebe |
| DD184466A DD117977A5 (enExample) | 1974-03-01 | 1975-02-27 | |
| US05/553,496 US4008249A (en) | 1974-03-01 | 1975-02-27 | Substituted pyrazoles |
| FR7506323A FR2262663B1 (enExample) | 1974-03-01 | 1975-02-28 | |
| DK79975A DK139474C (da) | 1974-03-01 | 1975-02-28 | Herbicidt aktive,substituerede pyrazoler |
| ES435199A ES435199A1 (es) | 1974-03-01 | 1975-02-28 | Procedimiento para la obtencion de pirazoles sustituidos. |
| NL7502416A NL7502416A (nl) | 1974-03-01 | 1975-02-28 | Werkwijze voor het bereiden van gesubstitueerde pyrazolen. |
| GB8386/75A GB1488285A (en) | 1974-03-01 | 1975-02-28 | Substituted pyrazoles |
| HU75BA00003219A HU171228B (hu) | 1974-03-01 | 1975-02-28 | Gerbicid soderzhahhij zamehhjonnykh pirazoly i sposob poluchenija aktivnykh vehhestv |
| AT159275A AT340199B (de) | 1974-03-01 | 1975-02-28 | Herbizid |
| SE7502300A SE413026B (sv) | 1974-03-01 | 1975-02-28 | Substituerad pyrazol for anvendning som herbicid |
| CA221,039A CA1047502A (en) | 1974-03-01 | 1975-02-28 | Substituted pyrazoles |
| NO750690A NO142800C (no) | 1974-03-01 | 1975-02-28 | Herbicide preparater inneholdende pyrazolderivater |
| ZA00751242A ZA751242B (en) | 1974-03-01 | 1975-02-28 | Substituted pyrazoles |
| PL1975178380A PL92447B1 (enExample) | 1974-03-01 | 1975-02-28 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2409753A DE2409753A1 (de) | 1974-03-01 | 1974-03-01 | Substituierte pyrazole |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2409753A1 true DE2409753A1 (de) | 1975-09-11 |
Family
ID=5908770
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2409753A Withdrawn DE2409753A1 (de) | 1974-03-01 | 1974-03-01 | Substituierte pyrazole |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4008249A (enExample) |
| JP (1) | JPS50117936A (enExample) |
| AT (1) | AT340199B (enExample) |
| BE (1) | BE826074A (enExample) |
| BG (1) | BG26354A3 (enExample) |
| CA (1) | CA1047502A (enExample) |
| CH (1) | CH593609A5 (enExample) |
| CS (1) | CS185676B2 (enExample) |
| DD (1) | DD117977A5 (enExample) |
| DE (1) | DE2409753A1 (enExample) |
| DK (1) | DK139474C (enExample) |
| ES (1) | ES435199A1 (enExample) |
| FR (1) | FR2262663B1 (enExample) |
| GB (1) | GB1488285A (enExample) |
| HU (1) | HU171228B (enExample) |
| IL (1) | IL46563A (enExample) |
| IT (1) | IT1044124B (enExample) |
| NL (1) | NL7502416A (enExample) |
| NO (1) | NO142800C (enExample) |
| PL (1) | PL92447B1 (enExample) |
| SE (1) | SE413026B (enExample) |
| SU (1) | SU569268A3 (enExample) |
| ZA (1) | ZA751242B (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0216102A1 (de) * | 1985-08-21 | 1987-04-01 | Bayer Ag | 1-Arylpyrazole |
| WO1992002509A1 (en) * | 1990-08-06 | 1992-02-20 | Monsanto Company | Herbicidal substituted aryl alkylsulfonyl pyrazoles |
| US5232940A (en) * | 1985-12-20 | 1993-08-03 | Hatton Leslie R | Derivatives of N-phenylpyrazoles |
| US5547974A (en) * | 1985-12-20 | 1996-08-20 | Rhone-Poulenc Agriculture Ltd. | Derivatives of N-phenylpyrazoles |
| WO1997027184A1 (de) * | 1996-01-24 | 1997-07-31 | Vogelbacher, Uwe, Josef | Sulfoxid- und sulfon-substituierte heterocyclen, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| US6372774B1 (en) | 1985-12-20 | 2002-04-16 | Rhone-Poulenc Agriculture Ltd. | Derivatives of N-phenylpyrazoles |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5436648B2 (enExample) * | 1974-03-28 | 1979-11-10 | ||
| US4124374A (en) * | 1976-02-06 | 1978-11-07 | E. I. Du Pont De Nemours And Company | Alkyl-substituted cycloalkanapyrazole herbicides |
| US4123252A (en) * | 1976-01-16 | 1978-10-31 | E. I. Du Pont De Nemours And Company | Methoxy substituted cycloalkanapyrazole herbicides |
| US4230481A (en) * | 1977-08-12 | 1980-10-28 | Ishihara Sangyo Kaisha Limited | Pyrazole derivatives useful as a herbicidal component |
| DE2747531A1 (de) * | 1977-10-22 | 1979-04-26 | Basf Ag | Substituierte 3-aminopyrazole |
| EP0014810A3 (en) * | 1979-01-18 | 1980-11-26 | Fbc Limited | Pesticidal pyrazoles, their production, compositions and uses, as well as intermediates and their preparation |
| FR2460299A1 (fr) * | 1979-07-05 | 1981-01-23 | Bellon Labor Sa Roger | Nouveaux derives du pyrazole et leur application therapeutique |
| DE3332271A1 (de) * | 1983-09-07 | 1985-03-21 | Bayer Ag, 5090 Leverkusen | Herbizide mittel enthaltend metribuzin in kombination mit substituierten azolyl-derivaten |
| US4620865A (en) * | 1983-11-07 | 1986-11-04 | Eli Lilly And Company | Herbicidal and algicidal 1,5-disubstituted-1H-pyrazole-4-carboxamides |
| GB2161160B (en) * | 1984-07-06 | 1989-05-24 | Fisons Plc | Heterocyclic sulphinyl compounds |
| US4666507A (en) * | 1985-01-16 | 1987-05-19 | Nippon Kayaku Kabushiki Kaisha | Herbicidal 5-halo-1-[5-(N-substituted sulfonylamino)phenyl]pyrazole derivatives |
| DE3704359A1 (de) * | 1987-02-12 | 1988-08-25 | Basf Ag | Azolhalbaminal-derivate und ihre verwendung als nitrifikationsinhibitoren |
| CA1340284C (en) * | 1987-03-19 | 1998-12-22 | Zeneca Inc. | Herbicidal substituted cyclic diones |
| US4964895A (en) * | 1987-06-08 | 1990-10-23 | Monsanto Company | Substituted 4-(4-nitrophenoxy) pyrazoles and their use as herbicides |
| KR930004672B1 (ko) * | 1988-08-31 | 1993-06-03 | 니혼 노야꾸 가부시끼가이샤 | 3-치환 페닐피라졸 유도체 또는 이의 염 및 이의 제조방법, 이의 용도 및 이의 사용 방법 |
| ES2118060T3 (es) * | 1990-02-21 | 1998-09-16 | Nihon Nohyaku Co Ltd | Derivados de 3-(fenil sustituido)pirazol, sus sales, sus herbicidas; y los procedimientos de preparacion de estos derivados o de sus sales. |
| TR24287A (tr) * | 1990-03-13 | 1991-09-01 | Nihon Nohyaku Co Ltd | 3-(ikameli feniluepirazol tuerevleri,bunlarin tuzla- ri,bunlardan elde edilen herb |
| US5281571A (en) * | 1990-10-18 | 1994-01-25 | Monsanto Company | Herbicidal benzoxazinone- and benzothiazinone-substituted pyrazoles |
| DE69128132T2 (de) | 1990-12-17 | 1998-06-04 | Sankyo Co | Pyrazolderivate mit herbizider Wirkung, deren Herstellung und Verwendung |
| US5532416A (en) * | 1994-07-20 | 1996-07-02 | Monsanto Company | Benzoyl derivatives and synthesis thereof |
| FR2690440B1 (fr) * | 1992-04-27 | 1995-05-19 | Rhone Poulenc Agrochimie | Arylpyrazoles fongicides. |
| AU653299B2 (en) * | 1993-02-06 | 1994-09-22 | Nihon Nohyaku Co., Ltd. | A herbicidal composition having a reduced phytotoxicity |
| US5880290A (en) * | 1994-01-31 | 1999-03-09 | Monsanto Company | Preparation of substituted 3-aryl-5-haloalkyl-pyrazoles having herbicidal activity |
| DE4417837A1 (de) * | 1994-05-20 | 1995-11-23 | Basf Ag | Substituierte 3-Phenylpyrazole |
| DE4419517A1 (de) * | 1994-06-03 | 1995-12-07 | Basf Ag | Substituierte 3-Phenylpyrazole |
| US5869688A (en) * | 1994-07-20 | 1999-02-09 | Monsanto Company | Preparation of substituted 3-aryl-5-haloalkyl-pyrazoles having herbicidal activity |
| US6103667A (en) * | 1995-06-15 | 2000-08-15 | Novartis Corporation | Phenylpyrazole herbicides |
| CA2220136A1 (en) * | 1995-06-15 | 1997-01-03 | Novartis Ag | Novel herbicides |
| WO1997013756A1 (en) * | 1995-10-13 | 1997-04-17 | Otsuka Kagaku Kabushiki Kaisha | Pyrazole derivatives and insecticidal compositions containing the same as active ingredient |
| JP2000500448A (ja) * | 1995-11-15 | 2000-01-18 | ゼネカ リミテッド | 除草性置換ピラゾール化合物 |
| US5698495A (en) * | 1995-11-15 | 1997-12-16 | Zeneca Limited | Herbicidal substituted pyrazole compounds |
| US5698708A (en) * | 1996-06-20 | 1997-12-16 | Monsanto Company | Preparation of substituted 3-aryl-5-haloalkyl-pyrazoles having herbicidal activity |
| DE19645313A1 (de) | 1996-11-04 | 1998-05-07 | Basf Ag | Substituierte 3-Benzylpyrazole |
| DE19751943A1 (de) * | 1997-11-24 | 1999-05-27 | Hoechst Schering Agrevo Gmbh | 1-Methyl-5-alkylsulfonyl-, 1-Methyl-5-alkylsulfinyl- und 1-Methyl-5-alkylthio-substituierte Pyrazolylpyrazole, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide |
| JP4249982B2 (ja) * | 2001-02-20 | 2009-04-08 | 財団法人相模中央化学研究所 | ピラゾール誘導体とその製造中間体及びそれらの製造方法、並びにそれらを有効成分とする除草剤 |
| SG184243A1 (en) * | 2010-03-30 | 2012-10-30 | Verseon Corp | Multisubstituted aromatic compounds as inhibitors of thrombin |
| HK1214252A1 (zh) | 2013-03-15 | 2016-07-22 | Verseon Corporation | 作為凝血酶抑制劑的鹵代吡唑 |
| SI2968297T1 (sl) | 2013-03-15 | 2019-02-28 | Verseon Corporation | Multisubstituirane aromatske skupine kot inhibitorji serinske proteaze |
| KR20170048410A (ko) | 2014-09-17 | 2017-05-08 | 베르선 코포레이션 | 세린 프로테아제 저해제로서의 피라졸릴-치환된 피리돈 화합물 |
| KR102824411B1 (ko) | 2015-02-27 | 2025-06-23 | 베르선 코포레이션 | 세린 프로테아제 저해제로서의 치환된 피라졸 화합물 |
-
1974
- 1974-03-01 DE DE2409753A patent/DE2409753A1/de not_active Withdrawn
-
1975
- 1975-02-04 IL IL46563A patent/IL46563A/xx unknown
- 1975-02-18 JP JP50019515A patent/JPS50117936A/ja active Pending
- 1975-02-21 BG BG029043A patent/BG26354A3/xx unknown
- 1975-02-24 SU SU7502107330A patent/SU569268A3/ru active
- 1975-02-26 CH CH241575A patent/CH593609A5/xx not_active IP Right Cessation
- 1975-02-26 CS CS7500001290A patent/CS185676B2/cs unknown
- 1975-02-27 DD DD184466A patent/DD117977A5/xx unknown
- 1975-02-27 IT IT48351/75A patent/IT1044124B/it active
- 1975-02-27 BE BE153824A patent/BE826074A/xx unknown
- 1975-02-27 US US05/553,496 patent/US4008249A/en not_active Expired - Lifetime
- 1975-02-28 FR FR7506323A patent/FR2262663B1/fr not_active Expired
- 1975-02-28 NO NO750690A patent/NO142800C/no unknown
- 1975-02-28 HU HU75BA00003219A patent/HU171228B/hu unknown
- 1975-02-28 AT AT159275A patent/AT340199B/de not_active IP Right Cessation
- 1975-02-28 SE SE7502300A patent/SE413026B/xx unknown
- 1975-02-28 PL PL1975178380A patent/PL92447B1/xx unknown
- 1975-02-28 GB GB8386/75A patent/GB1488285A/en not_active Expired
- 1975-02-28 DK DK79975A patent/DK139474C/da active
- 1975-02-28 CA CA221,039A patent/CA1047502A/en not_active Expired
- 1975-02-28 ES ES435199A patent/ES435199A1/es not_active Expired
- 1975-02-28 NL NL7502416A patent/NL7502416A/xx not_active Application Discontinuation
- 1975-02-28 ZA ZA00751242A patent/ZA751242B/xx unknown
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0216102A1 (de) * | 1985-08-21 | 1987-04-01 | Bayer Ag | 1-Arylpyrazole |
| US4820725A (en) * | 1985-08-21 | 1989-04-11 | Bayer Aktiengesellschaft | 1-aryl-pyrazoles, pesticidal compositions and use |
| US5232940A (en) * | 1985-12-20 | 1993-08-03 | Hatton Leslie R | Derivatives of N-phenylpyrazoles |
| US5547974A (en) * | 1985-12-20 | 1996-08-20 | Rhone-Poulenc Agriculture Ltd. | Derivatives of N-phenylpyrazoles |
| US5608077A (en) * | 1985-12-20 | 1997-03-04 | Rhone-Poulenc Agriculture Ltd. | Derivatives of n-phenylpyrazoles |
| US5714191A (en) * | 1985-12-20 | 1998-02-03 | Rhone-Poulenc Agriculture Ltd. | Derivatives of N-phenylpyrazoles |
| US5916618A (en) * | 1985-12-20 | 1999-06-29 | Rhone-Poulenc Agriculture Ltd. | Derivatives of N-phenylpyrazoles |
| US6372774B1 (en) | 1985-12-20 | 2002-04-16 | Rhone-Poulenc Agriculture Ltd. | Derivatives of N-phenylpyrazoles |
| WO1992002509A1 (en) * | 1990-08-06 | 1992-02-20 | Monsanto Company | Herbicidal substituted aryl alkylsulfonyl pyrazoles |
| WO1997027184A1 (de) * | 1996-01-24 | 1997-07-31 | Vogelbacher, Uwe, Josef | Sulfoxid- und sulfon-substituierte heterocyclen, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
Also Published As
| Publication number | Publication date |
|---|---|
| IL46563A0 (en) | 1975-04-25 |
| SE413026B (sv) | 1980-03-31 |
| NO142800B (no) | 1980-07-14 |
| ES435199A1 (es) | 1977-04-16 |
| DD117977A5 (enExample) | 1976-02-12 |
| BG26354A3 (bg) | 1979-03-15 |
| DK139474C (da) | 1979-08-13 |
| CS185676B2 (en) | 1978-10-31 |
| HU171228B (hu) | 1977-12-28 |
| SE7502300L (enExample) | 1975-09-02 |
| GB1488285A (en) | 1977-10-12 |
| CH593609A5 (enExample) | 1977-12-15 |
| PL92447B1 (enExample) | 1977-04-30 |
| IT1044124B (it) | 1980-03-20 |
| CA1047502A (en) | 1979-01-30 |
| ZA751242B (en) | 1976-02-25 |
| IL46563A (en) | 1978-04-30 |
| NL7502416A (nl) | 1975-09-03 |
| FR2262663B1 (enExample) | 1978-07-13 |
| NO142800C (no) | 1980-10-22 |
| NO750690L (enExample) | 1975-09-02 |
| FR2262663A1 (enExample) | 1975-09-26 |
| DK79975A (enExample) | 1975-11-03 |
| BE826074A (fr) | 1975-08-27 |
| ATA159275A (de) | 1977-03-15 |
| AT340199B (de) | 1977-11-25 |
| JPS50117936A (enExample) | 1975-09-16 |
| US4008249A (en) | 1977-02-15 |
| SU569268A3 (ru) | 1977-08-15 |
| DK139474B (da) | 1979-02-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2409753A1 (de) | Substituierte pyrazole | |
| DE2324592A1 (de) | Substituierte benzofuranylester | |
| DE2546845A1 (de) | Substituierte 2-(chinolyl-xy)- und 2-(isochinolyl-oxy)-carbonsaeurederivate | |
| DE2417764A1 (de) | O-aminosulfonyl-glykolsaeureanilide | |
| DE2526643A1 (de) | Substituierte pyridazone | |
| DE2349114A1 (de) | 2,1,3-benzothiadiazin-(4)-on-2,2-dioxi- de | |
| DE2404795A1 (de) | Pyrazoliumsalze | |
| DE2310757A1 (de) | Substituierte o-(aminosulfonyl)glykolsaeureanilide | |
| DE2334787A1 (de) | Herbizid | |
| DE2312045A1 (de) | Carbothiolate | |
| DE2343293A1 (de) | Herbizid | |
| DE2458343A1 (de) | N-n'-disubstituierte 2,1,3-benzothiadiazin(4)on-2.2-dioxide | |
| CH615087A5 (enExample) | ||
| DE2402370A1 (de) | Substituierte benzofuranylester | |
| DE2333397A1 (de) | Carbothiolate substituierter azepine | |
| DE2444822A1 (de) | 2,1,3-benzothiadiazin(4)on-2,2dioxid-derivate | |
| DE2334601A1 (de) | Thiolcarbamate | |
| DE2341629A1 (de) | Herbizid | |
| DE2437275A1 (de) | Substituierte anilide | |
| DE2351589A1 (de) | Substituierte uracile | |
| DE2333477A1 (de) | Schwefligsaeureester aliphatischer glykolsaeureamide | |
| DE2364876A1 (de) | Butinylcarbamate | |
| DE2425668C3 (de) | Herbizides Mittel auf Benzothiadiazinondioxid-Basis | |
| DE2403037A1 (de) | Herbizid | |
| DE2458972A1 (de) | Substituierte o-alkylsulfonylglykolsaeureanilide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |