DE2425668C3 - Herbizides Mittel auf Benzothiadiazinondioxid-Basis - Google Patents
Herbizides Mittel auf Benzothiadiazinondioxid-BasisInfo
- Publication number
- DE2425668C3 DE2425668C3 DE2425668A DE2425668A DE2425668C3 DE 2425668 C3 DE2425668 C3 DE 2425668C3 DE 2425668 A DE2425668 A DE 2425668A DE 2425668 A DE2425668 A DE 2425668A DE 2425668 C3 DE2425668 C3 DE 2425668C3
- Authority
- DE
- Germany
- Prior art keywords
- spp
- substituted
- salts
- plants
- dioxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004009 herbicide Substances 0.000 title claims abstract description 11
- REEXLQXWNOSJKO-UHFFFAOYSA-N 2h-1$l^{4},2,3-benzothiadiazine 1-oxide Chemical compound C1=CC=C2S(=O)NN=CC2=C1 REEXLQXWNOSJKO-UHFFFAOYSA-N 0.000 title description 4
- 239000000203 mixture Substances 0.000 claims abstract description 32
- 150000001875 compounds Chemical class 0.000 claims description 6
- 150000003839 salts Chemical group 0.000 abstract description 25
- 239000004480 active ingredient Substances 0.000 abstract description 21
- 230000002363 herbicidal effect Effects 0.000 abstract description 17
- PUIYMUZLKQOUOZ-UHFFFAOYSA-N isoproturon Chemical compound CC(C)C1=CC=C(NC(=O)N(C)C)C=C1 PUIYMUZLKQOUOZ-UHFFFAOYSA-N 0.000 abstract description 9
- 239000003795 chemical substances by application Substances 0.000 abstract description 7
- 230000002195 synergetic effect Effects 0.000 abstract description 2
- UFMYTQKWTNNGEV-UHFFFAOYSA-N 1H-2lambda4,1,3-benzothiadiazine 2-oxide Chemical compound N1S(N=CC2=C1C=CC=C2)=O UFMYTQKWTNNGEV-UHFFFAOYSA-N 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 125000004965 chloroalkyl group Chemical group 0.000 abstract 1
- 241000196324 Embryophyta Species 0.000 description 22
- -1 alkyl radical Chemical class 0.000 description 20
- 230000006378 damage Effects 0.000 description 17
- 150000002148 esters Chemical class 0.000 description 16
- 150000001408 amides Chemical class 0.000 description 15
- 244000038559 crop plants Species 0.000 description 11
- 239000003921 oil Substances 0.000 description 10
- 235000019198 oils Nutrition 0.000 description 10
- 241000209219 Hordeum Species 0.000 description 9
- 240000006694 Stellaria media Species 0.000 description 9
- 241001621841 Alopecurus myosuroides Species 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 239000006185 dispersion Substances 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 235000014820 Galium aparine Nutrition 0.000 description 7
- 240000005702 Galium aparine Species 0.000 description 7
- 244000098338 Triticum aestivum Species 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 244000292693 Poa annua Species 0.000 description 6
- 235000013339 cereals Nutrition 0.000 description 5
- 239000000839 emulsion Substances 0.000 description 5
- 150000003672 ureas Chemical class 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241001101998 Galium Species 0.000 description 3
- 244000042664 Matricaria chamomilla Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 150000002790 naphthalenes Chemical class 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 241000219317 Amaranthaceae Species 0.000 description 2
- 240000001592 Amaranthus caudatus Species 0.000 description 2
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 2
- HNUALPPJLMYHDK-UHFFFAOYSA-N C[CH]C Chemical compound C[CH]C HNUALPPJLMYHDK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241000195952 Equisetaceae Species 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 235000017945 Matricaria Nutrition 0.000 description 2
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 241000013557 Plantaginaceae Species 0.000 description 2
- 241000209504 Poaceae Species 0.000 description 2
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 2
- 244000062793 Sorghum vulgare Species 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 239000000729 antidote Substances 0.000 description 2
- 229940075522 antidotes Drugs 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000003899 bactericide agent Substances 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 241001233957 eudicotyledons Species 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 239000000417 fungicide Substances 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 2
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 2
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical class OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 235000013311 vegetables Nutrition 0.000 description 2
- FTDGDIFUDKDKAW-UHFFFAOYSA-N 1,1a,5,5a,6,6a-hexahydrocyclopropa[a]indene Chemical class C12C(CC3CC=CC=C13)C2 FTDGDIFUDKDKAW-UHFFFAOYSA-N 0.000 description 1
- FNQJDLTXOVEEFB-UHFFFAOYSA-N 1,2,3-benzothiadiazole Chemical class C1=CC=C2SN=NC2=C1 FNQJDLTXOVEEFB-UHFFFAOYSA-N 0.000 description 1
- CSNIZNHTOVFARY-UHFFFAOYSA-N 1,2-benzothiazole Chemical group C1=CC=C2C=NSC2=C1 CSNIZNHTOVFARY-UHFFFAOYSA-N 0.000 description 1
- LTQKIFCNCIFEHG-UHFFFAOYSA-N 1,2-oxazole 1H-pyrimidin-2-one Chemical class C=1C=NOC=1.O=C1N=CC=CN1 LTQKIFCNCIFEHG-UHFFFAOYSA-N 0.000 description 1
- FKKAGFLIPSSCHT-UHFFFAOYSA-N 1-dodecoxydodecane;sulfuric acid Chemical compound OS(O)(=O)=O.CCCCCCCCCCCCOCCCCCCCCCCCC FKKAGFLIPSSCHT-UHFFFAOYSA-N 0.000 description 1
- ZLOTYHZOJPLLGG-UHFFFAOYSA-N 1-sulfanylidenethiadiazinane Chemical class S=S1CCCNN1 ZLOTYHZOJPLLGG-UHFFFAOYSA-N 0.000 description 1
- XUJLWPFSUCHPQL-UHFFFAOYSA-N 11-methyldodecan-1-ol Chemical compound CC(C)CCCCCCCCCCO XUJLWPFSUCHPQL-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical compound CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 1
- MUKYLHIZBOASDM-UHFFFAOYSA-N 2-[carbamimidoyl(methyl)amino]acetic acid 2,3,4,5,6-pentahydroxyhexanoic acid Chemical compound NC(=N)N(C)CC(O)=O.OCC(O)C(O)C(O)C(O)C(O)=O MUKYLHIZBOASDM-UHFFFAOYSA-N 0.000 description 1
- RQMWVVBHJMUJNZ-UHFFFAOYSA-N 4-chloropyridin-2-amine Chemical group NC1=CC(Cl)=CC=N1 RQMWVVBHJMUJNZ-UHFFFAOYSA-N 0.000 description 1
- HQQTZCPKNZVLFF-UHFFFAOYSA-N 4h-1,2-benzoxazin-3-one Chemical class C1=CC=C2ONC(=O)CC2=C1 HQQTZCPKNZVLFF-UHFFFAOYSA-N 0.000 description 1
- 241000219144 Abutilon Species 0.000 description 1
- 241000206486 Adonis Species 0.000 description 1
- 241000125147 Aethusa cynapium Species 0.000 description 1
- 241000209136 Agropyron Species 0.000 description 1
- 241001533988 Agrostemma Species 0.000 description 1
- 241000219479 Aizoaceae Species 0.000 description 1
- 241000209514 Alismataceae Species 0.000 description 1
- 241000743985 Alopecurus Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 235000005750 Ammi majus Nutrition 0.000 description 1
- 244000160914 Ammi majus Species 0.000 description 1
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- 241001377087 Amsinckia Species 0.000 description 1
- 241000208479 Anagallis arvensis Species 0.000 description 1
- 244000277177 Anchusa azurea Species 0.000 description 1
- 235000017106 Anchusa azurea Nutrition 0.000 description 1
- 241000404028 Anthemis Species 0.000 description 1
- 241001666377 Apera Species 0.000 description 1
- 241000208173 Apiaceae Species 0.000 description 1
- 241000219195 Arabidopsis thaliana Species 0.000 description 1
- 244000294263 Arctium minus Species 0.000 description 1
- 235000003826 Artemisia Nutrition 0.000 description 1
- 235000003261 Artemisia vulgaris Nutrition 0.000 description 1
- 241000219305 Atriplex Species 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 235000007563 Barbarea vulgaris Nutrition 0.000 description 1
- 240000008399 Barbarea vulgaris Species 0.000 description 1
- 241000143476 Bidens Species 0.000 description 1
- 241001072256 Boraginaceae Species 0.000 description 1
- 241000611157 Brachiaria Species 0.000 description 1
- 241000339490 Brachyachne Species 0.000 description 1
- 235000011331 Brassica Nutrition 0.000 description 1
- 241000219198 Brassica Species 0.000 description 1
- 235000008427 Brassica arvensis Nutrition 0.000 description 1
- 244000024671 Brassica kaber Species 0.000 description 1
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
- 241000219193 Brassicaceae Species 0.000 description 1
- 241000209200 Bromus Species 0.000 description 1
- WUFYJSIFTHYAGJ-UHFFFAOYSA-N C=1C=NSC=1.O=C1N=CC=CN1 Chemical class C=1C=NSC=1.O=C1N=CC=CN1 WUFYJSIFTHYAGJ-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 241000220244 Capsella <angiosperm> Species 0.000 description 1
- 241000722731 Carex Species 0.000 description 1
- 241000219321 Caryophyllaceae Species 0.000 description 1
- 241000209120 Cenchrus Species 0.000 description 1
- 241000132570 Centaurea Species 0.000 description 1
- 241000219294 Cerastium Species 0.000 description 1
- 241000219312 Chenopodium Species 0.000 description 1
- 235000000509 Chenopodium ambrosioides Nutrition 0.000 description 1
- 244000098897 Chenopodium botrys Species 0.000 description 1
- 235000005490 Chenopodium botrys Nutrition 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 240000005250 Chrysanthemum indicum Species 0.000 description 1
- 244000037364 Cinnamomum aromaticum Species 0.000 description 1
- 235000014489 Cinnamomum aromaticum Nutrition 0.000 description 1
- 241000132536 Cirsium Species 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 241000233838 Commelina Species 0.000 description 1
- 241000207782 Convolvulaceae Species 0.000 description 1
- 241000207892 Convolvulus Species 0.000 description 1
- 241000219992 Cuphea Species 0.000 description 1
- 241000207901 Cuscuta Species 0.000 description 1
- 241000234646 Cyperaceae Species 0.000 description 1
- 241000234653 Cyperus Species 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Chemical group OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical group OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 241000209210 Dactylis Species 0.000 description 1
- 241000208296 Datura Species 0.000 description 1
- 244000000626 Daucus carota Species 0.000 description 1
- 235000002767 Daucus carota Nutrition 0.000 description 1
- 241000202296 Delphinium Species 0.000 description 1
- 241000032170 Descurainia Species 0.000 description 1
- 240000001879 Digitalis lutea Species 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- 241000865506 Diodia Species 0.000 description 1
- 241000004297 Draba Species 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 241001518935 Eragrostis Species 0.000 description 1
- 241000132521 Erigeron Species 0.000 description 1
- 241001071608 Erodium Species 0.000 description 1
- 241000221079 Euphorbia <genus> Species 0.000 description 1
- 241000221017 Euphorbiaceae Species 0.000 description 1
- 241000220485 Fabaceae Species 0.000 description 1
- 235000009419 Fagopyrum esculentum Nutrition 0.000 description 1
- 240000008620 Fagopyrum esculentum Species 0.000 description 1
- 244000044980 Fumaria officinalis Species 0.000 description 1
- 235000006961 Fumaria officinalis Nutrition 0.000 description 1
- 241000816457 Galeopsis Species 0.000 description 1
- 241000748465 Galinsoga Species 0.000 description 1
- 241000208150 Geraniaceae Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000005206 Hibiscus Nutrition 0.000 description 1
- 235000007185 Hibiscus lunariifolius Nutrition 0.000 description 1
- 244000284380 Hibiscus rosa sinensis Species 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 241001113566 Hydrocharitaceae Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 235000021506 Ipomoea Nutrition 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000208822 Lactuca Species 0.000 description 1
- 241000207923 Lamiaceae Species 0.000 description 1
- 241000520028 Lamium Species 0.000 description 1
- 235000006761 Lapsana communis Nutrition 0.000 description 1
- 240000002702 Lapsana communis Species 0.000 description 1
- 241000219729 Lathyrus Species 0.000 description 1
- 241000932234 Lepidium didymum Species 0.000 description 1
- 241000320639 Leptochloa Species 0.000 description 1
- 241000209510 Liliopsida Species 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 241000167853 Linaria Species 0.000 description 1
- 241001071917 Lithospermum Species 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 241000612166 Lysimachia Species 0.000 description 1
- 241000219991 Lythraceae Species 0.000 description 1
- 241000219071 Malvaceae Species 0.000 description 1
- 241000736305 Marsilea quadrifolia Species 0.000 description 1
- 241000736303 Marsileaceae Species 0.000 description 1
- 241000221026 Mercurialis annua Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 235000009382 Mollugo verticillata Nutrition 0.000 description 1
- 240000005272 Mollugo verticillata Species 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 241000721619 Najas Species 0.000 description 1
- 229930192627 Naphthoquinone Natural products 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000219929 Onagraceae Species 0.000 description 1
- 241000208165 Oxalidaceae Species 0.000 description 1
- 235000016499 Oxalis corniculata Nutrition 0.000 description 1
- 240000007019 Oxalis corniculata Species 0.000 description 1
- 241000209117 Panicum Species 0.000 description 1
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 1
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 1
- 235000011096 Papaver Nutrition 0.000 description 1
- 240000001090 Papaver somniferum Species 0.000 description 1
- 241000218180 Papaveraceae Species 0.000 description 1
- 241000208181 Pelargonium Species 0.000 description 1
- 241000745991 Phalaris Species 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 244000273256 Phragmites communis Species 0.000 description 1
- 235000014676 Phragmites communis Nutrition 0.000 description 1
- 244000064622 Physalis edulis Species 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 241001127637 Plantago Species 0.000 description 1
- 241000209048 Poa Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 241000219050 Polygonaceae Species 0.000 description 1
- 241000205407 Polygonum Species 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 241000196124 Polypodiaceae Species 0.000 description 1
- 241000219295 Portulaca Species 0.000 description 1
- 241000219304 Portulacaceae Species 0.000 description 1
- 241000722195 Potamogeton Species 0.000 description 1
- 241000756999 Potamogetonaceae Species 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 241001092489 Potentilla Species 0.000 description 1
- 241000208476 Primulaceae Species 0.000 description 1
- 241001453830 Pteridium Species 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical class C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 241000218201 Ranunculaceae Species 0.000 description 1
- 241000218206 Ranunculus Species 0.000 description 1
- 241000593769 Richardia <angiosperm> Species 0.000 description 1
- 235000004789 Rosa xanthina Nutrition 0.000 description 1
- 241000220222 Rosaceae Species 0.000 description 1
- 241001107098 Rubiaceae Species 0.000 description 1
- 241000219053 Rumex Species 0.000 description 1
- 240000009132 Sagittaria sagittifolia Species 0.000 description 1
- 235000006466 Sagittaria sagittifolia Nutrition 0.000 description 1
- 241001632050 Salsola Species 0.000 description 1
- 241000219287 Saponaria Species 0.000 description 1
- 241000202758 Scirpus Species 0.000 description 1
- 241000583552 Scleranthus annuus Species 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- 241000533293 Sesbania emerus Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 241000220263 Sisymbrium Species 0.000 description 1
- 241000208292 Solanaceae Species 0.000 description 1
- 235000002634 Solanum Nutrition 0.000 description 1
- 241000207763 Solanum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 241000488874 Sonchus Species 0.000 description 1
- 241000960310 Spergula Species 0.000 description 1
- 235000012308 Tagetes Nutrition 0.000 description 1
- 241000736851 Tagetes Species 0.000 description 1
- 241000245665 Taraxacum Species 0.000 description 1
- 241000722118 Thlaspi Species 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 241000819233 Tribulus <sea snail> Species 0.000 description 1
- 241000219793 Trifolium Species 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 241000145124 Uniola Species 0.000 description 1
- 239000005659 Urtica spp. Substances 0.000 description 1
- 241000218215 Urticaceae Species 0.000 description 1
- 240000005592 Veronica officinalis Species 0.000 description 1
- 241000219873 Vicia Species 0.000 description 1
- 241000405217 Viola <butterfly> Species 0.000 description 1
- 241001106476 Violaceae Species 0.000 description 1
- 241001506766 Xanthium Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000007244 Zea mays Nutrition 0.000 description 1
- 241001148683 Zostera marina Species 0.000 description 1
- 241000159213 Zygophyllaceae Species 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical group 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 235000012735 amaranth Nutrition 0.000 description 1
- 239000004178 amaranth Substances 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 229940111121 antirheumatic drug quinolines Drugs 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- BUSBFZWLPXDYIC-UHFFFAOYSA-N arsonic acid Chemical class O[AsH](O)=O BUSBFZWLPXDYIC-UHFFFAOYSA-N 0.000 description 1
- 244000030166 artemisia Species 0.000 description 1
- 235000009052 artemisia Nutrition 0.000 description 1
- 125000003785 benzimidazolyl group Chemical class N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 150000005130 benzoxazines Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Inorganic materials [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 239000001175 calcium sulphate Substances 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000011280 coal tar Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical class OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 150000002019 disulfides Chemical class 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 150000004659 dithiocarbamates Chemical class 0.000 description 1
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 150000002170 ethers Chemical group 0.000 description 1
- QQSGDKKFXBGYON-UHFFFAOYSA-N ethoxy-methylperoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-$l^{5}-phosphane Chemical class CCOP(=S)(OOC)OC1=CC(C)=NC(C(C)C)=N1 QQSGDKKFXBGYON-UHFFFAOYSA-N 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N heptadecan-1-ol Chemical class CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical class CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 1
- 150000001469 hydantoins Chemical class 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229920005610 lignin Chemical class 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 239000010807 litter Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 150000002791 naphthoquinones Chemical class 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 235000019488 nut oil Nutrition 0.000 description 1
- 239000010466 nut oil Substances 0.000 description 1
- QNMLMAVEXUCXRG-UHFFFAOYSA-N oxadiazinane-4,5-dione Chemical class O=C1CONNC1=O QNMLMAVEXUCXRG-UHFFFAOYSA-N 0.000 description 1
- SDRLFDJOSQLRPB-UHFFFAOYSA-N oxadiazine-4,5-dione Chemical class O=C1CON=NC1=O SDRLFDJOSQLRPB-UHFFFAOYSA-N 0.000 description 1
- 150000004866 oxadiazoles Chemical class 0.000 description 1
- YDCVQGAUCOROHB-UHFFFAOYSA-N oxadiazolidine-4,5-dione Chemical class O=C1NNOC1=O YDCVQGAUCOROHB-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- REJGOFYVRVIODZ-UHFFFAOYSA-N phosphanium;chloride Chemical class P.Cl REJGOFYVRVIODZ-UHFFFAOYSA-N 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 150000003217 pyrazoles Chemical class 0.000 description 1
- BFZYLUGEHGYJKJ-UHFFFAOYSA-N pyrazolidine-3-thione Chemical class S=C1CCNN1 BFZYLUGEHGYJKJ-UHFFFAOYSA-N 0.000 description 1
- 150000004892 pyridazines Chemical class 0.000 description 1
- 150000005299 pyridinones Chemical group 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- 150000008318 pyrimidones Chemical class 0.000 description 1
- NYCVCXMSZNOGDH-UHFFFAOYSA-N pyrrolidine-1-carboxylic acid Chemical class OC(=O)N1CCCC1 NYCVCXMSZNOGDH-UHFFFAOYSA-N 0.000 description 1
- 150000003235 pyrrolidines Chemical class 0.000 description 1
- 150000004040 pyrrolidinones Chemical group 0.000 description 1
- 150000003246 quinazolines Chemical class 0.000 description 1
- 150000003248 quinolines Chemical class 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000000600 sorbitol Chemical group 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000003011 styrenyl group Chemical group [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 1
- 229960000278 theophylline Drugs 0.000 description 1
- 150000003566 thiocarboxylic acids Chemical class 0.000 description 1
- 150000003582 thiophosphoric acids Chemical class 0.000 description 1
- 150000003585 thioureas Chemical group 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 150000003918 triazines Chemical group 0.000 description 1
- 150000003852 triazoles Chemical group 0.000 description 1
- 229940047183 tribulus Drugs 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/88—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms six-membered rings with three ring hetero atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
- A01N47/30—Derivatives containing the group >N—CO—N aryl or >N—CS—N—aryl
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Description
15
in der
R1 einen niederen Alkylrest bedeutet
oder deren Salzen und
oder deren Salzen und
b) einem N-Aryl-N',N'-dimethylharnstoffderivat der Formel
-NH-CO-N(CHj)2
dadurch gekennzeichnet, daß R2 den Isopropylrest bedeutet.
2. Herbizides Mittel nach Anspruch 1, dadurch gekennzeichnet, daß es zusätzlich «-(2,4-Dichlorphenoxy)-propionsäure
enthält
40
Die vorliegende Erfindung betrifft ein Herbizid, das eine Mischung aus einem Benzothiadiazinondioxid und
einem Harnstoffderivat enthält.
Es ist bekannt Benzothiadiazinone und substituierte Harnstoffderivate zur Bekämpfung von Unkräutern und
Ungräsern zu verwenden. Insbesondere sind synergistisch wirkende herbizide Gemische eines 3-Alkyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxids
mit N-4-Chlorphenyl-N'-methyl-N'-butin-l-yl-3-harnstoff
bekannt (DE-OS 21 31 401). Diese Mischungen zeigen jedoch gegenüber Ungräsern eine im Vergleich zu ihrer Wirkung
gegenüber breitblättrigen Unkräutern schwache herbizide
Wirkung.
Herbizidmischungen aus 3-Alkyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxiden
mit N-Aryl-N',N'-dimethyl- bzw. N-Aryl-N'-methyl-N'-methoxyharnstoffen sind weiterhin
Gegenstand der älteren Patentanmeldung gemäß DE-OS 24 04 311.
Es wurde nun überraschenderweise gefunden, daß Mischungen aus
a) einer Verbindung der Formel
O
O
in der
R1 einen niederen Alkylrest bedeutet,
oder deren Salzen und
b) einem in den genannten Druckschriften nicht . angeführten N-Aryl-N'.N'-dimethylhamstoffderivat
der Formel
V—CO-N(CHs)2
in der
R2 den Isopropylrest bedeutet
eine «pie, synergistisch gesteigerte herbizide
Wirkung haben.
Die erfindungsgemäßen herbiziden Mittel sind der aus der DE-OS 21 31 401 bekannten Mischung aus
3-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid und
dem Harnstoffderivat N-4-Chlorphenyl-N'-methyl-N'-butin-l-yl-3-harnstoff
sowohl in ihrer herbiziden Wirkung als auch in ihrer Kulturpflanzenverträglichkeit
überlegen.
Die Mischungen können eine oder mehrere Verbindungen der Formel a) und Verbindungen der Formel b)
und gegebenenfalls als dritte Komponente c) die Verbindung oc-(2,4-Dichlorphenoxy)-propionsäure enthalten.
Die Mischungsverhältnisse können beliebig gewählt werden. Das Mischungsverhältnis der Wirkstoffe a zu b
oder c beträgt 0,1 bis 10 Gewichtsteile a zu 1 Gewichtsteil b oder c, vorzugsweise 0,3 bis 3
Gewichtsteile a zu 1 Gewichtsteil b oder c.
Die erfindungsgemäßen Mittel können in ihrer aufgewandten Menge schwanken. Die aufgewandte
Menge hängt hauptsächlich von der Art des gewünschten Effektes ab. Die Aufwandmenge liegt im allgemeinen
zwischen 0,1 und 30 oder mehr, vorzugsweise 0,2 bis 6 kg Wirkstoff pro Hektar. Die erfindungsgemäßen
Mittel können unter anderem im Vorpflanz-, Nachpflanz-, Vorraat-, Vorauflauf-, Nachauflauf verfahren
oder während des Auflaufens der Kultur- oder unerwünschten Pflanzen ein- oder mehrmals angewandt
werden.
Die Mischungen sind geeignet unerwünschte Pflanzen in Nutzpflanzen, z. B. Triticum aestivum, Hordeum
vulgäre, Seeale cereale, Zea mays, Sorghum spp., Glycine max., Solanum tuberosum, Pisum sativum zu
bekämpfen.
Außerdem können die Mischungen als Totalmittel an Gräben, Gewässern, Gleisanlagen, auf Kahlflächen,
Ödland etc. angewandt werden.
Die Anwendung erfolgt z. B. in Form von direkt versprühbaren Lösungen, Pulvern, Suspensionen mit
verschiedener Konsistenz (z. B. Flowable-Suspensionen) oder Dispersionen, Emulsionen, öldispersionen,
Pasten, Stäubmitteln, Streumitteln, Granulaten durch Versprühen, Vernebeln, Verstäuben, Verstreuen oder
Gießen. Die Aufwendungsformen richten sich ganz nach den Verwendungszwecken; sie sollten in jedem
Fall möglichst die feinste Verteilung der erfindungsgemäßen Wirkstoffe gewährleisten.
Zur Herstellung von direkt versprühbaren Lösungen, Emulsionen, Pasten und öldispersionen kommen
Mineralölfraktionen von mittlerem bis hohem Siedepunkt, wie Kerosin oder Dieselöl, ferner Kohlenteeröle
usw., sowie öle pflanzlichen oder tierischen Ursprungs, aliphatische, cyclische und aromatische Kohlenwasserstoffe,
z. B. Benzol, Toluol, Xylol, Paraffin, Tetrahydronaphthalin, alkylierte Naphthaline oder deren Derivate,
z. B. Methanol, Äthanol, Propanol, Butanol, Chloroform, Tetrachlorkohlenstoff, Cyclohexanol, Cyclohexanon,
Chlorbenzol, Isophoron usw., stark polare Lösungsmit-
| 24 25 3 |
5 | 668 4 |
| •J VeX, wie z.B. Dimethylformamid, Dimethylsulfoxid, |
substituierte Benzthiadiazinondioxide | |
| N-Methylpyrrolidon, Wasser usw. in Betracht | substituierte Benzoxazine | |
| Wäßrige Anwendungsformen können aus Emulsions | substituierte Benzoxazinone | |
| konzentraten, Pasten oder netzbaren Pulvern (Spritz | substituierte Benzthiadiazole | |
| pulvern), öldispersionen durch Zusatz von Wasser | 10 | substituierte Biurete |
| bereitet werden. Zur Herstellung von Emulsionen, | substituierte Chinoline | |
| Pasten oder Öldispersionen können die Substanzen als | substituierte Carbamate | |
| solche oder in einem Öl oder Lösungsmittel gelöst, | substituierte aliphatische Carbonsäuren sowie | |
| mittels Netz-, Haft-, Dispergier- oder Emulgiermittel | deren Salze, Ester und Amide | |
| in Wasser homogenisiert werden. Es können aber auch | 15 | substituierte aromatische Carbonsäuren sowie |
| aus wirksamer Substanz, Netz-, Haft-, Dispergier- oder | deren Salze, Ester und Amide | |
| Emulgiermittel und evtl. Lösungsmittel oder Öl | substituierte Carbamoylalkyl-thiol- oder | |
| bestehende Konzentrate hergestellt werden, die zur | -dithiophosphate | |
| Verdünnung mit Wasser geeignet sind. | substituierte Chinazoline | |
| An oberflächenaktiven Stoffen sind zu nennen: | 20 | substituierte Cycloalkylamidocarbonthiolsäuren |
| Alkali-, Erdalkali-, Ammoniumsalze von Ligninsulfon- | sowie deren Salze, Ester und Amide | |
| säure, Naphthalinsulfonsäuren, Phenolsulfonsäuren, Λ1- | substituierte Cycloalkyicarbonamido-thiazole | |
| kylarylsulfonate, Alkylsulfonate, Alkylsulfate, Alkali- | substituierte Dicarbonsäuren sowie | |
| und Erdalkalisalze der Dibutylnaphthalinsulfonsäure, | deren Salze, Ester und Amide | |
| Lauryläthersulfat, Fettalkoholsulfate, fettsaure Alkali- | 25 | substituierte Dihydrobenzofuranylsulfonate |
| und Erdalkalisalze, Salze sulfatierter Hexadecanole, | substituierte Disulfide | |
| Heptadecanole, Octadecanole, Salze von sulfatiertem | substituierte Dipyridyliumsalze | |
| Fettalkoholglykoläther, Kondensationsprodukte von | substituierte Dithiocarbamate | |
| sulfoniertem Naphthalin und Naphthalinderivaten mit | substituierte Dithiophosphorsäuren sowie | |
| Formaldehyd, Kondensationsprodukte des Naphthalins | 30 | deren Salze, Ester und Amide |
| bzw. der Naphthalinsulfonsäuren mit Phenol und | substituierte Harnstoffe | |
| Formaldehyd, Polyoxyäthylen-octylphenoläther, äth- | substituierte Hexahydro-1 -H-carbothioate | |
| oxyliertes Isooctylphenol-, Octylphenol-, Nonylphenol, | substituierte Hydantoine | |
| Alkylphenolpolyglykoläther, Tributylphenylpolyglykol- | substituierte Hydrazide | |
| äther, Alkylarylpolyätheralkohole, Isotridecylalkohol, | 35 | substituierte Hydrazoniumsalze |
| Fettalkoholäthylenoxid-Kondensate, äthoxyliertes Rizi | substituierte Isooxazolpyrimidone | |
| nusöl, Polyoxyäthylenalkyiäther, äthoxyliertes Polyoxy- | substituierte Imidazole | |
| propylen, Laurylalkoholpolyglykolätheracetal, Sorbit | substituierte Isothiazolpyrimidone | |
| ester, Lignin, Sulfitablaugen und Methylcellulose. | substituierte Ketone | |
| Pulver, Streu- und Stäubemittel können durch | 40 | substituierte Naphtochinone |
| Mischen oder gemeinsames Vermählen der wirksamen | substituierte aliphatische Nitrile | |
| Substanzen mit einem festen Trägerstoff hergestellt | substituierte aromatische Nitrile | |
| werden. | substituierte Oxadiazole | |
| Granulate, z. B. Umhüllungs-, Imprägnierungs- und | substituierte Oxadiazinone | |
| Homogengranulate, können durch Bindung der Wirk | 4 j | substituierte Oxadiazolidindione |
| stoffe an feste Trägerstoffe hergestellt werden. Feste | substituierte Oxadiazindione | |
| Trägerstoffe sind z. B. Mineralerden wie Silicagel, | substituierte Phenole sowie | |
| Kieselsäuren, Kieselgele, Silikate, Talkum, Kaolin, | deren Salze und Ester | |
| Attaclay, Kalkstein, Kalk, Kreide, Bolus, Löß, Ton, | substituierte Phosphonsäuren sowie | |
| Dolomit, Diatomeenerde, Calcium- und Magnesiumsul | 50 | deren Salze, Ester und Amide |
| fat, Magnesiumoxid, gemahlene Kunststoffe, Düngemit | substituierte Phosphoniumchloride | |
| tel, wie z. B. Ammoniumsulfat, Ammoniumphosphat, | substituierte Phosphonalkylglyzine | |
| Ammoniumnitrat, Harnstoffe und pflanzliche Produkte, | substituierte Phosphite | |
| wie Getreidemehl, Baumrinden-, Holz- und Nußschalen | substituierte Phosphorsäuren sowie | |
| mehl, Cellulosepulver und andere feste Trägerstoffe. | 55 | deren Salze, Ester und Amide |
| Die Formulierungen enthalten zwischen 0,1 und 95 | substituierte Piperidine | |
| Gewichtsprozent Wirkstoff, vorzugsweise zwischen 0,5 | substituierte Pyrazole | |
| und 90 Gewichtsprozent. | substituierte Pyrazolalkylcarbonsäuren sowie | |
| Zu den Mischungen oder Einzelwirkstoffen können | deren Salze, Ester und Amide | |
| öle verschiedenen Typs, Herbizide, Fungizide, Nemato | W) | substituierte Pyrazoliumsalze |
| zide, Insektizide, Bakterizide, Spurenelemente, Dünge | substituierte Pyrazoliumalkylsulfate | |
| mittel, Antischaummittel (z. B. Silikone), Wachstumsre | substituierte Pyridazine | |
| gulatoren, Antidotmittel oder andere herbizid wirksame | substituierte Pyridazone | |
| Verbindungen, wie z. B. | substituierte Pyridincarbonsäuren sowie | |
| h5 | deren Salze, Ester und Amide | |
| substituierte Aniline | substituierte Pyridine | |
| substituierte Aryloxycarbonsäuren sowie | substituierte Pyridincarboxylate | |
| deren Salze, Ester und Amide | substituierte Pyridinone | |
| substituierte Äther | substituierte Pyrimidine | |
| I substituierte Arsonsäuren sowie | substituierte Pyrimidone | |
| ü deren Salze, Ester und Amide | substituierte Pyrrolidincarbonsäure sowie | |
| i substituierte Benzimidazole | deren Salze, Ester und Amide | |
| ΐ substituierte Benzisothiazole | substituierte Pyrrolidine | |
substituierte Pyrrolidone
substituierte Arylsulfonsäuren sowie
substituierte Arylsulfonsäuren sowie
deren Salze, Ester und Amide substituierte Styrole
substituierte Tetrahydro-oxadiazindione substituierte Tetrahydro-oxaiiazoldione substituierte Tetrahydromethanoindene substituierte Tetrahydro-diazol-thione substituierte Tetrahydro-thiadiazin- thione substituierte Tetrahydro-thiadiazcldione substituierte aromatische Thiocarbonsäureamide substituierte Thiocarbonsäuren sowie
substituierte Tetrahydro-oxadiazindione substituierte Tetrahydro-oxaiiazoldione substituierte Tetrahydromethanoindene substituierte Tetrahydro-diazol-thione substituierte Tetrahydro-thiadiazin- thione substituierte Tetrahydro-thiadiazcldione substituierte aromatische Thiocarbonsäureamide substituierte Thiocarbonsäuren sowie
deren Salze, Ester und Amide substituierte Thiolcarbamate
substituierte Thioharnstoffe
substituierte Thiophosphorsäuren sowie
substituierte Thioharnstoffe
substituierte Thiophosphorsäuren sowie
deren Salze, Ester und Amide substituierte Triazine
substituierte Triazole
substituierte Uracile
substituierte Uretidindione
substituierte Triazole
substituierte Uracile
substituierte Uretidindione
gegebenenfalls auch erst unmittelbar vor der Anwendung (Tankmix) zugesetzt werden. Die zuletzt genannten
herbiziden Verbindungen können auch vor oder nach den erfindungsgemäßen Einzelwirkstoffen oder
Mischungen zur Anwendung gebracht werden.
Die Zumischung dieser Mittel zu den erfindungsgemäßen Herbiziden kann im Gewichtsverhältnis 1 :10 bis
10:1 erfolgen. Das gleiche gilt für öle, Fungizide, Nematozide, Insektizide, Bakterizide, Antidotnsittel und
Wachstumsregulatoren.
Die Mittel weisen einen starken herbiziden Effekt auf und können deshalb als Unkrautvernichtungsmittel bzw.
zur Bekämpfung unerwünschten Pflenzenwuchses verwendet werden. Ob die Mittel als totale oder selektive
Mittel wirken, hängt hauptsächlich von der Wirkstoffmenge je Flächeneinheit ab.
Unter Unkräuter bzw. unerwünschten Pflanzenwuchses sind alle monokotylen und dikotylen Pflanzen zu
verstehen, die an Orten aufwachsen, wo sie nicht erwünscht sind.
So können mit den erfindungsgemäßen Mitteln beispielsweise
Compastiae, wie Ambrosia spp.
Lactuca spp.
Senecio spp. Sonchus spp.
Xanthium spp.
Iva spp.
Galinsoga spp.
Taraxacum spp. ίο Chrysanthemum spp.
Bidens spp.
Cirsium spp.
Convolvulaceae, wie Convolvulus spp. Ipomoea spp. Jaquemontia tamnifolia
Gramineen, wie
Cynodon spp.
Digitaria spp.
Echinochloa spp.
Setaria spp.
Panicum spp.
Alopecurus spp.
Lolium spp.
Sorghum spp.
Agropyron spp.
Phalaris spp.
Apera spp.
Cynodon spp.
Digitaria spp.
Echinochloa spp.
Setaria spp.
Panicum spp.
Alopecurus spp.
Lolium spp.
Sorghum spp.
Agropyron spp.
Phalaris spp.
Apera spp.
Cyperaceae, wie
Carex spp.
Cyperus spp.
Scirpus spp.
Carex spp.
Cyperus spp.
Scirpus spp.
dikotyle Unkräuter, wie
Malvaceae, ζ. Β.
Abutilon theoprasti
Sida spp.
Malvaspp.
Sida spp.
Malvaspp.
Dactylis spp. Avena spp Bromus spp. Uniola spp. Poa spp.
Leptochloa spp. Brachiaria spp. Eleusinc spp. Cenchrus spp. Eragrostis spp.
Phragmites communis und andere
Eloecharis spp. und andere
Hibiscus spp. und andere Cruciferae, wie 2(i Barbarea vulgaris
Brassica spp. Capsella spp. Sisymbrium spp. Thlaspi spp. Sinapis arvensis
Raohanus spp.
Geraniaceae, wie Erodium spp. Geranium spp.
Portulacaceae, wie Portulaca spp.
Primulaceae, wie Anagallis arvensis Lysimachia spp.
Rubiaceae.wie 4(l Richardia spp.
Galium spp.
Scrophulariaceae, wie Linaria spp. Veronica spp.
Solanaceae.wie Physalis spp. Solanum spp.
Datura spp.
Urticaceae, wie Urtica spp.
Violaceae, wie Viola spp.
Zygophyllaceae, wie Tribulus terrestis
Euphorbiaceae, wie Mercurialis annua
w Umbelliferae, wie Daucus carota Aethusa cynapium
Commelinaeae Commelina spp.
Labiatae, wie Lamium spp. Galeopsisspp.
Centaurea spp. Tassilago spp. Lapsana communis Tagetes spp. Erigeron spp.
Anthemis spp. Ma'ricaria spp. Artemisia spp. und andere
Cuscuta spp. und andere
Arabidopsis thaliana Descurainia spp. Draba spp. Coronopus didymus
Lepidium spp. und andere
und andere
und andere und andere
Diodia spp. und andere
Digitalis spp. und andere
Nicandraspp. und andere
und andere und andere Euphorbia spp.
Ammi majus und andere
und andere und andere
Leguminosae, wie
Medicagospp.
Trifolium spp.
Vicia spp.
Lathyrus spp.
Medicagospp.
Trifolium spp.
Vicia spp.
Lathyrus spp.
Plantaginaceae, wie
Plantago spp.
Plantago spp.
Polygonaceae, wie
Polygonum spp.
Rumex spp.
Polygonum spp.
Rumex spp.
Aizoaceae, wie
Mollugo verticillata
Amaranthaceae, wie
Amaranthusspp.
Amaranthusspp.
Boraginaceae, wie
Amsinckia spp.
Myostis spp.
Lithospermum spp.
Amsinckia spp.
Myostis spp.
Lithospermum spp.
Caryophyllaceae, wie
Stellaria spp.
Spergula spp.
Saponaria spp.
Scleranthus annuus
Stellaria spp.
Spergula spp.
Saponaria spp.
Scleranthus annuus
Chenopodiaceae, wie
Chenopodium spp.
Koch i a spp.
Salsola Kali
Chenopodium spp.
Koch i a spp.
Salsola Kali
Lythraceae, wie
Cuphea spp.
Cuphea spp.
Oxalidaceae, wie
Oxalis spp.
Oxalis spp.
Ranunculaceae, wie
Ranunculus spp.
Delphinium spp.
Ranunculus spp.
Delphinium spp.
Papaveraceae, wie
Papaver spp.
Fumaria officinaiis
Papaver spp.
Fumaria officinaiis
Onagraceae, wie
Jussiacea spp.
Jussiacea spp.
Sesbania exaltata Cassia spp. und andere
und andere
Fagopyrum spp. und andere
und andere und andere
Anchusa spp. und andere
Silenespp. Cerastium spp. Agrostemma githago und andere
Atriplex spp. Monolepsis nuttalliana und andere
und andere
Adonis spp. und andere
und andere
und andere Rosaceae, wie
Alchemillia spp.
Potentilla spp.
Potentilla spp.
Potamogetonaceae, wie
Potamogeton spp.
Potamogeton spp.
Najadaceae, wie
Najas spp.
Najas spp.
Marsileaceae.wie
Marsilea quadrifolia
Marsilea quadrifolia
Polypodiaceae, wie
Pteridium aguilinum
Alismataceae, wie
Alismaspp.
Alismaspp.
Sagittaria sagittifolia
und andere
und andere und andere und andere
und andere und andere
Equisetaceae, wie
Equisetaceae spp.
bekämpft werden.
Im Gewächshaus wurden verschiedene Pflanzen bei einer Wuchshöhe von 4 bis 20 cm mit folgenden
Einzelwirkstoffen und deren Mischungen als Dispersion behandelt:
I 3-Isopropyl-2,l,3-benzothiadiazinon-(4)-
2,2-dioxid
II 3-Isopropyl-2,l,3-benzothiadiazinon-(4)-
2,2-dioxid-Natriumsalz IU 3-Isopropyl-2,l,3-benzothiadiazinon-(4)-2,2-dioxid-Dimethylaminsalz
IV 3-Isopropyl-2,l,3-benzothiadiazinon-(4)-
2,2-dioxid-Diäthanolaminsalz
V N-4-Isopropylphenyl-N',N'-dimethylharnstoff mit je 0,5,1 und 1,5 kg/ha a. S.
I+ V, II+ V, III+ V, IV +V mit je 0,5 + 0,5,
1+0,5 und 0,5+1 kg/ha.
Nach 15 bis 20 Tagen wurde festgestellt, daß die Mischungen eine bessere herbizide Wirkung bei
gleicher Verträglichkeit an den Kulturpflanzen zeigten als die Einzelwirkstoffe.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen.
| Wirkstoff, | 1 | 0 | kg/ha | a.S. | 1 | 0 | 1.5 | UI | 1 | 0 | 1.5 | IV | 1 | 0 | 1,5 | V | 1 | 0 | 1,5 |
| I | 0 | II | 0 | 0 | 0.5 | 0 | 0 | 0,5 | 0 | 0 | 0,5 | 0 | 0 | ||||||
| 0.5 | 0 | 1.5 | 0.5 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||
| 0 | 10 | 0 | 0 | 12 | 0 | 0 | 12 | 0 | 0 | 12 | 0 | 0 | 65 | 0 | |||||
| 0 | 5 | 0 | 0 | 12 | 15 | 0 | 8 | 16 | 0 | 10 | 15 | 0 | 60 | 80 | |||||
| 0 | 65 | 0 | 0 | 60 | 15 | 5 | 50 | 13 | 4 | 65 | 15 | 40 | 35 | 70 | |||||
| 3 | 60 | 15 | 5 | 55 | 75 | 5 | 50 | 60 | 5 | 60 | 70 | 35 | 30 | 60 | |||||
| 0 | 10 | 5 | 70 | 30 | 70 | 35 | 85 | 20 | 55 | ||||||||||
| 30 | 75 | 30 | 20 | 20 | 20 | ||||||||||||||
| 30 | 70 | 20 | |||||||||||||||||
Nutzpflanzen:
Triticum aestivum
Hordeum vulgäre
Seeale cereale
Hordeum vulgäre
Seeale cereale
Unerwünschte Pflanzen:
Alopecurus myosuroides
Poa annua
Galium aparine
Stellaria media
Poa annua
Galium aparine
Stellaria media
ohne Schädigung,
totale Schädigung.
totale Schädigung.
| Nutzpflanzen: | Wirkstoff, kg/h | 1 | 24 25 | 0 | 11 + V | 668 | 0,5 | 0 | 1II + V | 1 | 10 | 0,5 | 0 | IV + V | 1 | 0,5 | 0 | |
| 9 | Triticum aestivum | I + V | 0,5 | 0 | 0,5 | 1 | 0 | 0,5 | 0,5 | 1 | 0 | 0,5 | 0,5 | 1 | 0 | |||
| Hordeum vulgäre | 0,5 | a a. S. | 0 | 0,5 | 0 | 0,5 | 0 | 0,5 | 0 | |||||||||
| Seeale cereale | 0,5 | 0 | 0 | 0 | ||||||||||||||
| Unerwünschte Pflanzen: | 0 | 0,5 | 100 | 0 | 1 | 100 | 0 | 0 | 100 | 0 | 0 | 100 | ||||||
| Alopecurus myosuroides | 0 | 0 | 1 | 96 | 0 | 0,5 | 100 | 0 | 0 | 100 | 0 | 0 | 100 | |||||
| Poa annua | 0 | 100 | 0 | 100 | 0 | 100 | 0 | 100 | ||||||||||
| Galium aparine | 0 | 88 | 98 | 0 | 91 | 90 | 90 | 92 | 91 | |||||||||
| Stellaria media | 80 | 80 | 0 | 90 | 82 | 91 | 85 | |||||||||||
| 83 | 100 | 81 | 0 | 89 | 100 | 88 | 100 | |||||||||||
| 75 | 100 | 90 | 90 | 100 | 93 | 100 | ||||||||||||
| 90 | 80 | 91 | 80 | 80 | ||||||||||||||
| 89 | 87 | |||||||||||||||||
| 100 | ||||||||||||||||||
| 100 | ||||||||||||||||||
0 = ohne Schädigung. 100 = totale Schädigung.
Im Gewächshaus wurden verschiedene Pflanzen bei einer Wuchshöhe von 5 bis 22 cm mit folgenden
Einzelwirkstoffen und deren Mischungen als Dispersion, wäßrige Lösung behandelt:
3-Isopropyl-2,l,3-benzothiadiazinon-(4)-
2,2-dioxid 3-Isopropyl-
2,2-dioxid-3-Isopropyl-
2,2-dioxid-IV 3-Isopropyl-2,2-dioxid-,
l-2,l,3-benzothiadiazinon-(4)-d-Natriumsalz
-2,1,3-benzothiadiazinon-(4)-
-Dimethylaminsalz 1-2,1,3-benzothiadiazinon -(4)-'-Äthanolaminsaiz
V N-4-Isopropylphenyl-N',N'-dimethylharnstoff
mit je 1,2,3 kg/ha a. S.
I+ V, 11 +V, III+V, IV+ V mit je 1 + 1,2 + 1 und
1+2 kg/ha a. S.
Nach 12 bis 20 Tagen wurde festgestellt, daß die Mischungen eine bessere herbizide Wirkung bei
gleicher Verträglichkeit an den Kulturpflanzen zeigten als die Einzelwirkstoffe.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen.
| Wirkstoff, | 0 | 2 | 0 | kg/ha | 0 | a.S. | 0 | 2 | 0 | 3 | 0 | III | 0 | 2 | 0 | 3 | 0 | IV | 0 | 2 | 0 | 3 | 0 | V | 0 | 2 | 0 | 3 | 5 |
| I | 0 | 0 | 0 | II | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 10 | ||||||||||
| 1 | 0 | 0 | 3 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 10 | ||||||||||||
| 10 | 20 | 30 | 12 | 18 | 25 | 12 | 21 | 30 | 12 | 19 | 25 | 65 | 85 | 90 | |||||||||||||||
| 5 | 18 | 20 | 12 | 20 | 25 | 8 | 20 | 30 | 10 | 26 | 30 | 60 | 75 | 90 | |||||||||||||||
| 65 | 80 | 95 | 60 | 80 | 95 | 50 | 75 | 95 | 65 | 80 | 95 | 35 | 70 | 85 | |||||||||||||||
Nutzpflanzen:
Triücum aestivum Hordeum vulgäre Seeale cereale
Triücum aestivum Hordeum vulgäre Seeale cereale
Unerwünschte Pflanzen:
Alopecurus myosuroides Poa annua
Galium aparine Stellaria media
Galium aparine Stellaria media
0 = ohne Schädigung. = totale Schädigung.
60 82 95 55 80 94 50 90 95 60 95 100 30 65 80
| Nutzpflanzen: | 24 | 0 | 2 | 0 | 1 | 0 | 25i | 0 | 668 | 0 | 1 | 0 | 111 +V | 0 | 12 | 2 | 0 | I | 0 | IV + V | 0 | 2 | 0 | 1 | 0 | |
| π | Triticum aestivum | 0 | 1 | 0 | 2 | 0 | 0 | 0 | 2 | 0 | 1 | 0 | 1 | 0 | 2 | 0 | 1 | 0 | I | 0 | 2 | 0 | ||||
| Hordeum vulgäre | Wirkstoff, kg/ha a. S. | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | |||||||||||
| Seeale cereale | I + V | Il + V | ||||||||||||||||||||||||
| Unerwünschte Pflanzen: | 1 | 100 | 100 | 100 | 1 | 100 | 2 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | |||||||||||
| Alopecurus myosuroides | 1 | 100 | Ϊ00 | 100 | 1 | 100 | 1 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | |||||||||||
| Poa annua | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | ||||||||||||||
| Galium aparine | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | ||||||||||||||
| Stellaria media | ||||||||||||||||||||||||||
0 = ohne Schädigung. 100 = totale Schädigung.
Im Gewächshaus wurden verschiedene Pflanzen bei einer Wuchshöhe von 5 bis 20 cm mit folgenden
Einzelwirkstoffen und deren Mischungen als Dispersion, Emulsion, wäßrige Lösung behandelt:
3-Isopropyl-2,l,3-benzothiadiazinon-(4)-
2,2-dioxid 3-Isopropyl-
2,2-dioxid-3-Isopropyl-2
2,2-dioxid-IV 3-lsopropyl-:
2,2-dioxid-
-2,1,3-benzothiadiazinon-(4)-
-Natriumsalz
-2,1,3-benzothiadiazinon-(4)-
-Dimethylaminsalz
-2,1,3-benzothiadiazinon-(4)-
I-Äthanolaminsalz
V N-4-lsopropylphenyl-N',N'-diniethylharnstoff
VI a-(2.4-Dichlor-phenoxy)-propionsäure
mit je 0,5,1 und 2 kg/ha a. S.
I +V +VI, II+ V +VI, III+ V +Vl, IV+ V +VI,
mit je 1+0,5 + 0,5.0,5 + 1 +0,5 und
0,5 + 0,5 + 1 kg/ha a. S.
Nach 15 bis 20 Tagen wurde festgestellt, daß die Mischungen eine bessere herbizide Wirkung bei
gleicher Vercräglichkeit an den Kulturpflanzen zeigten als die Einzelwirkstoffe.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen.
| Wirkstoff, | 1 | 0 | kg/ha a. | 0 | II | S. | 1 | 0 | 2 | 0 | III | 1 | 0 | 2 | 0 | IV | 1 | 0 | 2 | 0 | V | 1 | 0 | 2 | 0 | VI | 1 | 0 | 2 | 0 | |
| I | 0 | 0 | 0,5 | 0 | 0 | 0,5 | 0 | 0 | 0,5 | 0 | 0 | 0,5 | 0 | 0 | 0,5 | 0 | 0 | ||||||||||||||
| 0,5 | 0 | 2 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | 0 | ||||||||||||||||||||||||||
| Triticum aestivum | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||||||
| Hordeum vulgäre | 0 | 0 | 0 | 0 | 0 | 0 | |||||||||||||||||||||||||
| Seeale cereale | 0 | ||||||||||||||||||||||||||||||
Unerwünschte Pflanzen:
Alopecurus myosuroides 3 10 20 5 12 18 5 12 21 4 12 19 40 65 85 0 0 0
Poa annua 0 5 18 5 12 20 5 8 20 5 10 26 35 60 75 5 10 20
Galium aparine 30 65 80 30 60 80 30 50 75 35 65 80 20 35 70 35 70 95
Stellaria media
0 = ohne Schädigung. 100 = totale Schädigung.
30 60 82 20 55 80 20 50 90 20 60 95 20 30 65 25 50 80
| Wirkstoff, kg/ha a. S. | ■*■ Vl | 0,5 0,5 1 |
Il + V | + Vl | 0,5 0,5 1 |
111 + V + VI | 0,5 1 0,i |
0,5 0,5 1 |
IV+ V +VI | 0,5 1 0,5 |
0,5 0,5 1 |
|
| I + V· | 0,5 1 0,5 |
1 0,5 0,5 |
0,5 I 0,5 |
1 0,5 0,5 |
1 0,5 0,5 |
|||||||
| 1 0,5 0,5 |
0 | 0 | 0 | 0 | 0 | 0 | ||||||
| Nutzpflanzen: | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |
| Triticum aestivum | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| Hordeum vulgäre | 0 | 0 | 0 | 0 | 0 | 0 | ||||||
| Seeale cereale | 0 | 85 | 80 | 100 | 90 | 100 | 88 | |||||
| Unerwünschte Pflanzen: | 100 | 85 | 92 | 99 | 90 | 91 | 100 | 92 | 90 | 100 | 90 | |
| Alopecurus myosuroides | 90 | 100 | 100 | 94 | 100 | 100 | 89 | 100 | 100 | 95 | 100 | 100 |
| Poa annua | 85 | 100 | 100 | 100 | !00 | 100 | 100 | 100 | 100 | 100 | 100 | 100 |
| Galium aparine | 100 | 100 | 100 | 100 | 100 | 100 | ||||||
| Stellaria media | 100 | |||||||||||
0 = ohne Schädigung.
100 = totale Schädigung.
100 = totale Schädigung.
Vergleichsversuch
Bei Kleinparzellenversuchen im Freiland wurden die herbiziden Wirkungen der erfindungsgemäßen Herbizidmischung
aus S-lsopropyl^.l.S-benzothiadiazinon-(4)-2,2-dioxid
(I) und N-4-Isopropylphenyl-N',N'-dimethylharnstoff (II) und der aus der DE-OS 21 31 401
bekannten Herbizidmischung aus 3-Isopropyl-2,1,3-benzothiadiazinon-(4)-2,2-dioxid
(I) und N-4-Chlorphenyl-N'-methyl-N'-butin-l-yl-3-harnstoff
(III) getestet. Die Mischungen wurden im Frühjahr im Nachauflaufverfahren auf die Blätter von Wintergetreide und der darin
wachsenden unerwünschten Pflanzen gespritzt. 7301 Wasser je Hektar dienten als Träger- und Verteilungsmittel. Als Ausbringungsgerät wurde eine auf einem
Traktor montierte Parzellenspritze benutzt. Es wurden mehrere separate Versuche angelegt, deren Ergebnisse
bei der Auswertung gemittelt wurden.
Die Versuchsergebn'sse wurden in Tabelle 1 zusammengestellt.
Die Bewertung erfolgte visuell nach der Skala 0 bis 100. Dabei bedeuten 0 keine Wirkung und
keine Schädigung, 100 völlige Abtötung zumindest der oberirdischen Pflanzenteile. Tabelle 2 enthält die
Bezeichnungen der Versuchspflanzen.
jo Als Ergebnis kann man demnach folgende Feststellung
treffen:
Die erfindungsgemäßen Mischungen I+ 11 erzielen
gegenüber breitblättrigen Unkräutern eine mit den bekannten Mischungen l + III vergleichbare Wirkung.
Ji Die Aktivität von I+ 11 gegen das landwirtschaftlich
wichtige Ungras Alopecurus myosuroides ist dagegen wesentlich stärker als die der Mischung I+ III. Die
Mischung l + III bekämpft dieses Gras erst bei einer Aufwandmenge von 1,0 + 2,0 kg/ha in befriedigender
4« Weise, wobei bei dieser Dosis bereits heftige Schaden
an den Getreidearten auftreten. Die erfindungsgemäße Mischung I+ 11 dagegen zeigt eine gute herbizide
Wirkung ohne Phytotoxizität gegenüber den Kulturpflanzen.
Wirkstoffe kga.S./ha
1 + II 0,5 + 0,5
1,0 + 0,5
0,5 + 1,0
1,0 + 2,0
0,5 + 1,0
1,0 + 2,0
I + III 0,5 + 0,5
i,0 + 0,5
0,5 + 1,0
1,0 + 2,0
0,5 + 1,0
1,0 + 2,0
0 = keine Schädigung.
100 = Pflanzen abgestorben.
*) = Wintergetreide.
100 = Pflanzen abgestorben.
*) = Wintergetreide.
| Testpflanzen | und Schädigung (%) | Trilic. | Alopec. | Galium | Stcllaria | Matricaria |
| Hordeum | Seeale | ! aesL*) | mvnc | ap. | media | (nn |
| vijlg.*) | cereale* | 0 | 53 | 62 | 93 | 96 |
| 0 | 0 | 0 | 60 | 87 | 97 | 98 |
| 0 | 0 | 0 | 85 | 86 | 97 | 98 |
| 5 | 0 | 5 | 100 | 99 | 100 | 100 |
| 0 | 8 | 0 | 20 | 98 | 97 | 93 |
| 0 | 0 | 1 | 32 | 100 | 98 | 98 |
| 2 | 0 | 4 | 59 | 98 | 100 | 98 |
| 10 | 0 | 43 | 90 | 100 | 100 | 100 |
| 26 | 12 |
| Tabelle 2 | 24 25 668 | 16 | |
| 15 | Botanischer Name | ||
| Hordeum vulgäre | Deutsche Bezeichnung | ||
| Seeale cereale | Abkürzung in Tabelle | Gerste | |
| Triticum aestivum | Hcrdeum vulg. | Roggen | |
| Alopecurus myosuroides | - | Weizen | |
| Galium aparine | Tritic. aest. | Ackerfuchsschwanz | |
| Stellaria media | Alopec. myos. | Klettenlabkraut | |
| Matricaria spp. | Galium ap. | Vogelsternmiere j | |
| - | Kamillearten | ||
| - | |||
130 2)4/132
Claims (1)
1. Herbizides Mittel mit einem Gehalt an einer Mischung aus
a) einer Verbindung der Formel
Il
10
Priority Applications (17)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2425668A DE2425668C3 (de) | 1974-05-28 | 1974-05-28 | Herbizides Mittel auf Benzothiadiazinondioxid-Basis |
| GB20059/75A GB1497461A (en) | 1974-05-28 | 1975-05-13 | Herbicide |
| NLAANVRAGE7505742,A NL181249C (nl) | 1974-05-28 | 1975-05-15 | Werkwijze voor het bereiden van herbicide preparaten. |
| IT49728/75A IT1036900B (it) | 1974-05-28 | 1975-05-22 | Diserbante |
| CH660775A CH596756A5 (de) | 1974-05-28 | 1975-05-23 | |
| SE7505917A SE418143B (sv) | 1974-05-28 | 1975-05-23 | Herbicid innehallande en blandning av vissa bensotiadiazinondioxider och n-4-isopropylfenyl-n',n'-dimetyl-urinemne |
| BR4144/75A BR7503240A (pt) | 1974-05-28 | 1975-05-23 | Composicoes herbicidas |
| PL1975180699A PL93907B1 (de) | 1974-05-28 | 1975-05-26 | |
| DD186255A DD117976A5 (de) | 1974-05-28 | 1975-05-26 | |
| BE156714A BE829492A (fr) | 1974-05-28 | 1975-05-26 | Agent herbicide |
| SU2136597A SU537611A3 (ru) | 1974-05-28 | 1975-05-26 | Гербицидный состав |
| CS753700A CS190481B2 (en) | 1974-05-28 | 1975-05-27 | Herbicide means |
| ZA00753401A ZA753401B (en) | 1974-05-28 | 1975-05-27 | Herbicide |
| AT403575A AT341824B (de) | 1974-05-28 | 1975-05-27 | Herbizid |
| ES437945A ES437945A1 (es) | 1974-05-28 | 1975-05-27 | Procedimiento para la obtencion de herbicidas. |
| FR7516482A FR2272601B1 (de) | 1974-05-28 | 1975-05-27 | |
| DK232575A DK232575A (da) | 1974-05-28 | 1975-05-27 | Herbicid |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2425668A DE2425668C3 (de) | 1974-05-28 | 1974-05-28 | Herbizides Mittel auf Benzothiadiazinondioxid-Basis |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2425668A1 DE2425668A1 (de) | 1975-12-11 |
| DE2425668B2 DE2425668B2 (de) | 1980-08-21 |
| DE2425668C3 true DE2425668C3 (de) | 1981-04-02 |
Family
ID=5916624
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2425668A Expired DE2425668C3 (de) | 1974-05-28 | 1974-05-28 | Herbizides Mittel auf Benzothiadiazinondioxid-Basis |
Country Status (17)
| Country | Link |
|---|---|
| AT (1) | AT341824B (de) |
| BE (1) | BE829492A (de) |
| BR (1) | BR7503240A (de) |
| CH (1) | CH596756A5 (de) |
| CS (1) | CS190481B2 (de) |
| DD (1) | DD117976A5 (de) |
| DE (1) | DE2425668C3 (de) |
| DK (1) | DK232575A (de) |
| ES (1) | ES437945A1 (de) |
| FR (1) | FR2272601B1 (de) |
| GB (1) | GB1497461A (de) |
| IT (1) | IT1036900B (de) |
| NL (1) | NL181249C (de) |
| PL (1) | PL93907B1 (de) |
| SE (1) | SE418143B (de) |
| SU (1) | SU537611A3 (de) |
| ZA (1) | ZA753401B (de) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN104478829A (zh) * | 2014-11-12 | 2015-04-01 | 浙江中山化工集团股份有限公司 | 一种苯达松二甲胺盐原药的制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2131401C3 (de) * | 1971-06-24 | 1981-09-24 | Basf Ag, 6700 Ludwigshafen | Herbizides Gemisch auf Benzothiadiazinondioxid-Basis |
-
1974
- 1974-05-28 DE DE2425668A patent/DE2425668C3/de not_active Expired
-
1975
- 1975-05-13 GB GB20059/75A patent/GB1497461A/en not_active Expired
- 1975-05-15 NL NLAANVRAGE7505742,A patent/NL181249C/xx not_active IP Right Cessation
- 1975-05-22 IT IT49728/75A patent/IT1036900B/it active
- 1975-05-23 BR BR4144/75A patent/BR7503240A/pt unknown
- 1975-05-23 SE SE7505917A patent/SE418143B/xx not_active IP Right Cessation
- 1975-05-23 CH CH660775A patent/CH596756A5/xx not_active IP Right Cessation
- 1975-05-26 PL PL1975180699A patent/PL93907B1/pl unknown
- 1975-05-26 DD DD186255A patent/DD117976A5/xx unknown
- 1975-05-26 SU SU2136597A patent/SU537611A3/ru active
- 1975-05-26 BE BE156714A patent/BE829492A/xx not_active IP Right Cessation
- 1975-05-27 FR FR7516482A patent/FR2272601B1/fr not_active Expired
- 1975-05-27 ES ES437945A patent/ES437945A1/es not_active Expired
- 1975-05-27 AT AT403575A patent/AT341824B/de not_active IP Right Cessation
- 1975-05-27 DK DK232575A patent/DK232575A/da unknown
- 1975-05-27 CS CS753700A patent/CS190481B2/cs unknown
- 1975-05-27 ZA ZA00753401A patent/ZA753401B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH596756A5 (de) | 1978-03-15 |
| DD117976A5 (de) | 1976-02-12 |
| NL181249B (nl) | 1987-02-16 |
| ATA403575A (de) | 1977-06-15 |
| ZA753401B (en) | 1976-05-26 |
| BR7503240A (pt) | 1976-04-27 |
| DK232575A (da) | 1975-11-29 |
| ES437945A1 (es) | 1977-01-16 |
| CS190481B2 (en) | 1979-05-31 |
| SE418143B (sv) | 1981-05-11 |
| DE2425668B2 (de) | 1980-08-21 |
| SE7505917L (sv) | 1975-12-01 |
| IT1036900B (it) | 1979-10-30 |
| SU537611A3 (ru) | 1976-11-30 |
| FR2272601B1 (de) | 1978-06-09 |
| DE2425668A1 (de) | 1975-12-11 |
| PL93907B1 (de) | 1977-07-30 |
| NL7505742A (nl) | 1975-12-02 |
| AT341824B (de) | 1978-02-27 |
| GB1497461A (en) | 1978-01-12 |
| NL181249C (nl) | 1987-07-16 |
| BE829492A (fr) | 1975-11-26 |
| FR2272601A1 (de) | 1975-12-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2409753A1 (de) | Substituierte pyrazole | |
| DE2417764A1 (de) | O-aminosulfonyl-glykolsaeureanilide | |
| DE2349114C2 (de) | 3-sek.-Butyl-2,1,3-benzothiadiazin-(4)-on-2,2-dioxid | |
| DE2341594A1 (de) | Herbizid | |
| DE2425668C3 (de) | Herbizides Mittel auf Benzothiadiazinondioxid-Basis | |
| DE2526643A1 (de) | Substituierte pyridazone | |
| DE2334787A1 (de) | Herbizid | |
| DE2310757A1 (de) | Substituierte o-(aminosulfonyl)glykolsaeureanilide | |
| CH615087A5 (de) | ||
| DE2343293A1 (de) | Herbizid | |
| DE2312045A1 (de) | Carbothiolate | |
| DE2453908A1 (de) | Herbizide mischungen | |
| DE2341629A1 (de) | Herbizid | |
| DE2334601A1 (de) | Thiolcarbamate | |
| DE2329044A1 (de) | Herbizid | |
| US4165977A (en) | Herbicidal compositions | |
| DE2336444A1 (de) | Herbizid | |
| DE2460474A1 (de) | Herbizide mischung | |
| DE2334563A1 (de) | Herbizid | |
| DE2457688A1 (de) | Carbaminsaeurethiolester | |
| DE2333477A1 (de) | Schwefligsaeureester aliphatischer glykolsaeureamide | |
| DE2437275A1 (de) | Substituierte anilide | |
| DE2403037A1 (de) | Herbizid | |
| DE2431582A1 (de) | O-aminosulfonyl-glykolsaeureamide | |
| DE2333414A1 (de) | Herbizid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |