DE2334563A1 - Herbizid - Google Patents
HerbizidInfo
- Publication number
- DE2334563A1 DE2334563A1 DE19732334563 DE2334563A DE2334563A1 DE 2334563 A1 DE2334563 A1 DE 2334563A1 DE 19732334563 DE19732334563 DE 19732334563 DE 2334563 A DE2334563 A DE 2334563A DE 2334563 A1 DE2334563 A1 DE 2334563A1
- Authority
- DE
- Germany
- Prior art keywords
- spp
- vii
- radical
- dinitro
- propyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 230000002363 herbicidal effect Effects 0.000 title description 13
- 239000004009 herbicide Substances 0.000 title description 3
- -1 methoxy, aminosulphonyl Chemical group 0.000 claims description 38
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 12
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 150000002367 halogens Chemical group 0.000 claims description 10
- 125000003342 alkenyl group Chemical group 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 150000003254 radicals Chemical class 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- XIPUIGPNIDKXJU-UHFFFAOYSA-N [CH]1CC1 Chemical compound [CH]1CC1 XIPUIGPNIDKXJU-UHFFFAOYSA-N 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- RMCDUNHIVVEEDD-UHFFFAOYSA-N methylcyclopropane Chemical compound [CH2]C1CC1 RMCDUNHIVVEEDD-UHFFFAOYSA-N 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 description 74
- 235000007320 Avena fatua Nutrition 0.000 description 41
- 241000209764 Avena fatua Species 0.000 description 41
- 241001621841 Alopecurus myosuroides Species 0.000 description 40
- 244000058871 Echinochloa crus-galli Species 0.000 description 40
- 235000011999 Panicum crusgalli Nutrition 0.000 description 40
- 240000006694 Stellaria media Species 0.000 description 40
- 235000021533 Beta vulgaris Nutrition 0.000 description 37
- 241000335053 Beta vulgaris Species 0.000 description 37
- 239000000203 mixture Substances 0.000 description 32
- 241001355178 Setaria faberi Species 0.000 description 28
- 244000152970 Digitaria sanguinalis Species 0.000 description 22
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 22
- 241000196324 Embryophyta Species 0.000 description 22
- 229910052757 nitrogen Inorganic materials 0.000 description 14
- 239000013543 active substance Substances 0.000 description 12
- 239000002689 soil Substances 0.000 description 11
- 244000038559 crop plants Species 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 10
- 239000003921 oil Substances 0.000 description 10
- ZSDSQXJSNMTJDA-UHFFFAOYSA-N trifluralin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O ZSDSQXJSNMTJDA-UHFFFAOYSA-N 0.000 description 8
- 239000006185 dispersion Substances 0.000 description 7
- 239000002253 acid Substances 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 239000008187 granular material Substances 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 239000000839 emulsion Substances 0.000 description 5
- UNAHYJYOSSSJHH-UHFFFAOYSA-N oryzalin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(S(N)(=O)=O)C=C1[N+]([O-])=O UNAHYJYOSSSJHH-UHFFFAOYSA-N 0.000 description 5
- 241000743985 Alopecurus Species 0.000 description 4
- 244000042664 Matricaria chamomilla Species 0.000 description 4
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000011575 calcium Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 235000017896 Digitaria Nutrition 0.000 description 3
- 241001303487 Digitaria <clam> Species 0.000 description 3
- 241000192043 Echinochloa Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 235000010582 Pisum sativum Nutrition 0.000 description 3
- 240000004713 Pisum sativum Species 0.000 description 3
- 244000286177 Raphanus raphanistrum Species 0.000 description 3
- 235000000241 Raphanus raphanistrum Nutrition 0.000 description 3
- 235000005775 Setaria Nutrition 0.000 description 3
- 241000232088 Setaria <nematode> Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 150000002790 naphthalenes Chemical class 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- 241000219317 Amaranthaceae Species 0.000 description 2
- 241000209761 Avena Species 0.000 description 2
- 235000005781 Avena Nutrition 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 241000013557 Plantaginaceae Species 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 239000000729 antidote Substances 0.000 description 2
- 229940075522 antidotes Drugs 0.000 description 2
- 239000003899 bactericide agent Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 239000000417 fungicide Substances 0.000 description 2
- 239000003630 growth substance Substances 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 2
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 2
- 230000001069 nematicidal effect Effects 0.000 description 2
- 239000005645 nematicide Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 235000013311 vegetables Nutrition 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- MHSZKJBKSUXTSI-UHFFFAOYSA-N (3-propylthiophen-2-yl)carbamic acid Chemical compound C(CC)C1=C(SC=C1)NC(=O)O MHSZKJBKSUXTSI-UHFFFAOYSA-N 0.000 description 1
- VPGSXIKVUASQIY-UHFFFAOYSA-N 1,2-dibutylnaphthalene Chemical class C1=CC=CC2=C(CCCC)C(CCCC)=CC=C21 VPGSXIKVUASQIY-UHFFFAOYSA-N 0.000 description 1
- FKKAGFLIPSSCHT-UHFFFAOYSA-N 1-dodecoxydodecane;sulfuric acid Chemical compound OS(O)(=O)=O.CCCCCCCCCCCCOCCCCCCCCCCCC FKKAGFLIPSSCHT-UHFFFAOYSA-N 0.000 description 1
- XUJLWPFSUCHPQL-UHFFFAOYSA-N 11-methyldodecan-1-ol Chemical compound CC(C)CCCCCCCCCCO XUJLWPFSUCHPQL-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical class CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 1
- MUKYLHIZBOASDM-UHFFFAOYSA-N 2-[carbamimidoyl(methyl)amino]acetic acid 2,3,4,5,6-pentahydroxyhexanoic acid Chemical compound NC(=N)N(C)CC(O)=O.OCC(O)C(O)C(O)C(O)C(O)=O MUKYLHIZBOASDM-UHFFFAOYSA-N 0.000 description 1
- IOJAESFEVURKSE-UHFFFAOYSA-N 3,5-dinitro-4-(propylamino)benzenesulfonamide Chemical compound CCCNC1=C([N+]([O-])=O)C=C(S(N)(=O)=O)C=C1[N+]([O-])=O IOJAESFEVURKSE-UHFFFAOYSA-N 0.000 description 1
- DFNAFDHFFUVITM-UHFFFAOYSA-N 4-methylsulfonyl-2,6-dinitro-n-propylaniline Chemical compound CCCNC1=C([N+]([O-])=O)C=C(S(C)(=O)=O)C=C1[N+]([O-])=O DFNAFDHFFUVITM-UHFFFAOYSA-N 0.000 description 1
- 241000219144 Abutilon Species 0.000 description 1
- 241000206486 Adonis Species 0.000 description 1
- 241000125147 Aethusa cynapium Species 0.000 description 1
- 241000209136 Agropyron Species 0.000 description 1
- 241001533988 Agrostemma Species 0.000 description 1
- 241000219479 Aizoaceae Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- 235000005750 Ammi majus Nutrition 0.000 description 1
- 244000160914 Ammi majus Species 0.000 description 1
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- 241001377087 Amsinckia Species 0.000 description 1
- 241000208479 Anagallis arvensis Species 0.000 description 1
- 244000277177 Anchusa azurea Species 0.000 description 1
- 235000017106 Anchusa azurea Nutrition 0.000 description 1
- 241000404028 Anthemis Species 0.000 description 1
- 241001666377 Apera Species 0.000 description 1
- 241000208173 Apiaceae Species 0.000 description 1
- 241000219195 Arabidopsis thaliana Species 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000003826 Artemisia Nutrition 0.000 description 1
- 235000003261 Artemisia vulgaris Nutrition 0.000 description 1
- 241000219305 Atriplex Species 0.000 description 1
- 235000007563 Barbarea vulgaris Nutrition 0.000 description 1
- 240000008399 Barbarea vulgaris Species 0.000 description 1
- 241000143476 Bidens Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 241001072256 Boraginaceae Species 0.000 description 1
- 241000611157 Brachiaria Species 0.000 description 1
- 241000339490 Brachyachne Species 0.000 description 1
- 235000011331 Brassica Nutrition 0.000 description 1
- 241000219198 Brassica Species 0.000 description 1
- 235000008427 Brassica arvensis Nutrition 0.000 description 1
- 244000024671 Brassica kaber Species 0.000 description 1
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
- 241000219193 Brassicaceae Species 0.000 description 1
- 241000209200 Bromus Species 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000220244 Capsella <angiosperm> Species 0.000 description 1
- 241000722731 Carex Species 0.000 description 1
- 241000219321 Caryophyllaceae Species 0.000 description 1
- 241000209120 Cenchrus Species 0.000 description 1
- 241000132570 Centaurea Species 0.000 description 1
- 241000219294 Cerastium Species 0.000 description 1
- 241000219312 Chenopodium Species 0.000 description 1
- 235000000509 Chenopodium ambrosioides Nutrition 0.000 description 1
- 244000098897 Chenopodium botrys Species 0.000 description 1
- 235000005490 Chenopodium botrys Nutrition 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 240000005250 Chrysanthemum indicum Species 0.000 description 1
- 244000037364 Cinnamomum aromaticum Species 0.000 description 1
- 235000014489 Cinnamomum aromaticum Nutrition 0.000 description 1
- 241000132536 Cirsium Species 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 241000233838 Commelina Species 0.000 description 1
- 241000207782 Convolvulaceae Species 0.000 description 1
- 241000207892 Convolvulus Species 0.000 description 1
- 241000219992 Cuphea Species 0.000 description 1
- 241000207901 Cuscuta Species 0.000 description 1
- 241000234646 Cyperaceae Species 0.000 description 1
- 241000234653 Cyperus Species 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 241000209210 Dactylis Species 0.000 description 1
- 241000208296 Datura Species 0.000 description 1
- 244000000626 Daucus carota Species 0.000 description 1
- 235000002767 Daucus carota Nutrition 0.000 description 1
- 241000202296 Delphinium Species 0.000 description 1
- 241000032170 Descurainia Species 0.000 description 1
- 240000001879 Digitalis lutea Species 0.000 description 1
- 241000865506 Diodia Species 0.000 description 1
- 241000202829 Eleocharis Species 0.000 description 1
- 235000007351 Eleusine Nutrition 0.000 description 1
- 241000209215 Eleusine Species 0.000 description 1
- 241001518935 Eragrostis Species 0.000 description 1
- 241000132521 Erigeron Species 0.000 description 1
- 241001071608 Erodium Species 0.000 description 1
- 241000221079 Euphorbia <genus> Species 0.000 description 1
- 241000221017 Euphorbiaceae Species 0.000 description 1
- XWYPHYABTAQSQZ-UHFFFAOYSA-N FC(C1=CC(=C(N(CC#C)C(C)C)C(=C1)[N+](=O)[O-])[N+](=O)[O-])(F)F Chemical compound FC(C1=CC(=C(N(CC#C)C(C)C)C(=C1)[N+](=O)[O-])[N+](=O)[O-])(F)F XWYPHYABTAQSQZ-UHFFFAOYSA-N 0.000 description 1
- HWFMJNRDGZLESH-UHFFFAOYSA-N FC(C1=CC(=C(N(CC#C)CCC)C(=C1)[N+](=O)[O-])[N+](=O)[O-])(F)F Chemical compound FC(C1=CC(=C(N(CC#C)CCC)C(=C1)[N+](=O)[O-])[N+](=O)[O-])(F)F HWFMJNRDGZLESH-UHFFFAOYSA-N 0.000 description 1
- 244000044980 Fumaria officinalis Species 0.000 description 1
- 235000006961 Fumaria officinalis Nutrition 0.000 description 1
- 241000816457 Galeopsis Species 0.000 description 1
- 241000748465 Galinsoga Species 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 241000208150 Geraniaceae Species 0.000 description 1
- 241000245654 Gladiolus Species 0.000 description 1
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 1
- 244000299507 Gossypium hirsutum Species 0.000 description 1
- 235000005206 Hibiscus Nutrition 0.000 description 1
- 235000007185 Hibiscus lunariifolius Nutrition 0.000 description 1
- 244000284380 Hibiscus rosa sinensis Species 0.000 description 1
- 241001113566 Hydrocharitaceae Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 235000021506 Ipomoea Nutrition 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000208822 Lactuca Species 0.000 description 1
- 241000207923 Lamiaceae Species 0.000 description 1
- 241000520028 Lamium Species 0.000 description 1
- 235000006761 Lapsana communis Nutrition 0.000 description 1
- 240000002702 Lapsana communis Species 0.000 description 1
- 241000219729 Lathyrus Species 0.000 description 1
- 241000932234 Lepidium didymum Species 0.000 description 1
- 241000320639 Leptochloa Species 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 241000167853 Linaria Species 0.000 description 1
- 241001071917 Lithospermum Species 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 241000612166 Lysimachia Species 0.000 description 1
- 241000219991 Lythraceae Species 0.000 description 1
- 235000013939 Malva Nutrition 0.000 description 1
- 240000000982 Malva neglecta Species 0.000 description 1
- 235000000060 Malva neglecta Nutrition 0.000 description 1
- 241000219071 Malvaceae Species 0.000 description 1
- 241000736305 Marsilea quadrifolia Species 0.000 description 1
- 241000736303 Marsileaceae Species 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 241000219823 Medicago Species 0.000 description 1
- 241000221026 Mercurialis annua Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 235000009382 Mollugo verticillata Nutrition 0.000 description 1
- 240000005272 Mollugo verticillata Species 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 241000721619 Najas Species 0.000 description 1
- 241001106046 Nicandra Species 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000219929 Onagraceae Species 0.000 description 1
- 241000208165 Oxalidaceae Species 0.000 description 1
- 235000016499 Oxalis corniculata Nutrition 0.000 description 1
- 240000007019 Oxalis corniculata Species 0.000 description 1
- 241000209117 Panicum Species 0.000 description 1
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 1
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 1
- 235000011096 Papaver Nutrition 0.000 description 1
- 240000001090 Papaver somniferum Species 0.000 description 1
- 241000208181 Pelargonium Species 0.000 description 1
- 241000745991 Phalaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 244000064622 Physalis edulis Species 0.000 description 1
- 241001127637 Plantago Species 0.000 description 1
- 241000209048 Poa Species 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 241000219050 Polygonaceae Species 0.000 description 1
- 241000205407 Polygonum Species 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 241000219295 Portulaca Species 0.000 description 1
- 241000219304 Portulacaceae Species 0.000 description 1
- 241000722195 Potamogeton Species 0.000 description 1
- 241000756999 Potamogetonaceae Species 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 241001092489 Potentilla Species 0.000 description 1
- 241000208476 Primulaceae Species 0.000 description 1
- ITVQAKZNYJEWKS-UHFFFAOYSA-N Profluralin Chemical compound [O-][N+](=O)C=1C=C(C(F)(F)F)C=C([N+]([O-])=O)C=1N(CCC)CC1CC1 ITVQAKZNYJEWKS-UHFFFAOYSA-N 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 241000218206 Ranunculus Species 0.000 description 1
- 241000220259 Raphanus Species 0.000 description 1
- 241000593769 Richardia <angiosperm> Species 0.000 description 1
- 241000219053 Rumex Species 0.000 description 1
- 241001632050 Salsola Species 0.000 description 1
- 241000219287 Saponaria Species 0.000 description 1
- 241000202758 Scirpus Species 0.000 description 1
- 241000583552 Scleranthus annuus Species 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- 241000533293 Sesbania emerus Species 0.000 description 1
- 241000220263 Sisymbrium Species 0.000 description 1
- 241000208292 Solanaceae Species 0.000 description 1
- 235000002634 Solanum Nutrition 0.000 description 1
- 241000207763 Solanum Species 0.000 description 1
- 241000488874 Sonchus Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- 241000960310 Spergula Species 0.000 description 1
- XJCLWVXTCRQIDI-UHFFFAOYSA-N Sulfallate Chemical compound CCN(CC)C(=S)SCC(Cl)=C XJCLWVXTCRQIDI-UHFFFAOYSA-N 0.000 description 1
- 235000012308 Tagetes Nutrition 0.000 description 1
- 241000736851 Tagetes Species 0.000 description 1
- 241000245665 Taraxacum Species 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 241000819233 Tribulus <sea snail> Species 0.000 description 1
- 241000219793 Trifolium Species 0.000 description 1
- 241000249864 Tussilago Species 0.000 description 1
- 241000145124 Uniola Species 0.000 description 1
- 241000219422 Urtica Species 0.000 description 1
- 241000218215 Urticaceae Species 0.000 description 1
- 240000005592 Veronica officinalis Species 0.000 description 1
- 241000219873 Vicia Species 0.000 description 1
- 241000405217 Viola <butterfly> Species 0.000 description 1
- 241001106476 Violaceae Species 0.000 description 1
- 241001506766 Xanthium Species 0.000 description 1
- 241000159213 Zygophyllaceae Species 0.000 description 1
- DBNLGTYGKCMLLR-UHFFFAOYSA-N [4-(trifluoromethyl)phenyl]hydrazine Chemical compound NNC1=CC=C(C(F)(F)F)C=C1 DBNLGTYGKCMLLR-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 244000030166 artemisia Species 0.000 description 1
- 235000009052 artemisia Nutrition 0.000 description 1
- 210000000081 body of the sternum Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Inorganic materials [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000011280 coal tar Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- PDQRIMRBJSQRSL-UHFFFAOYSA-N di(propan-2-yl)carbamothioic s-acid Chemical compound CC(C)N(C(C)C)C(S)=O PDQRIMRBJSQRSL-UHFFFAOYSA-N 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- HGFPICLKJKYGQV-UHFFFAOYSA-N ethyl N-(3-propylthiophen-2-yl)carbamate Chemical compound C(C)OC(NC=1SC=CC=1CCC)=O HGFPICLKJKYGQV-UHFFFAOYSA-N 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N heptadecan-1-ol Chemical class CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical class CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- HLLYDGVOMRCOFR-UHFFFAOYSA-N n-butyl-n-ethyl-2,6-dinitro-4-(trifluoromethyl)aniline;2,6-dinitro-n,n-dipropyl-4-(trifluoromethyl)aniline Chemical compound CCCCN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O.CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O HLLYDGVOMRCOFR-UHFFFAOYSA-N 0.000 description 1
- MONYWWWQBHZMIZ-UHFFFAOYSA-N n-ethyl-2,6-dinitro-n-(oxolan-2-ylmethyl)-4-(trifluoromethyl)aniline Chemical compound [O-][N+](=O)C=1C=C(C(F)(F)F)C=C([N+]([O-])=O)C=1N(CC)CC1CCCO1 MONYWWWQBHZMIZ-UHFFFAOYSA-N 0.000 description 1
- 239000004533 oil dispersion Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- VXPLXMJHHKHSOA-UHFFFAOYSA-N propham Chemical compound CC(C)OC(=O)NC1=CC=CC=C1 VXPLXMJHHKHSOA-UHFFFAOYSA-N 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 1
- 229960000278 theophylline Drugs 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 229940047183 tribulus Drugs 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03H—HOLOGRAPHIC PROCESSES OR APPARATUS
- G03H1/00—Holographic processes or apparatus using light, infrared or ultraviolet waves for obtaining holograms or for obtaining an image from them; Details peculiar thereto
- G03H1/04—Processes or apparatus for producing holograms
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Description
in der X niederes Alkyl, Halogenalkyl, Alkylsulfonyl, Methoxy,
Aminosulfonyl, Y Wasserstoff oder Amino, R1 einen Tetrahydrofurfurylrest,
Cyclopropylrest oder den Cyclopropylmethylrest, oder einen gegebenenfalls durch Halogen oder Alkoxy substituierten
niederen Alkyl-, Alkenyl- oder Alkinylrest, R einen Alkoxyalkylrest oder Propionmethylamidrest oder einen
gegebenenfalls durch Halogen substituierten niederen Alkyl-, Alkenyl-, Alkinylrest bedeutet
und
b) einer Verbindung der Formel
und
b) einer Verbindung der Formel
1^N- C-A-R0 n 0
in der R Alkyl, Alkenyl, Alkinyl, Bi- oder Tricycloalkyl,
einen gegebenenfalls durch Halogen oder Alkyl substituierten Phenyl- oder Cycloalkylrest, R1 Wasserstoff, einen aliphatischen
Rest bis 4 C-Atome, R2 einen gegebenenfalls durch
Halogen oder Alkoxy substituierten Alkyl-, Alkenyl-, Alkinyl-
214/73 409885/1338 /2
- 2 - O.Z. 29 964
rest, einen gegebenenfalls durch Halogen, Halogenalkyl, Alkyl,
Alkoxy substituierten Phenyl- oder Benzylrest, 3-Methoxy-
.---CH carbonylaminophenylrest oder den Rest -N^C^^-J, A Sauerstoff
oder Schwefel, X Sauerstoff oder Schwefel, und/oder
c) einer Verbindung der Formel
c) einer Verbindung der Formel
in der X Amino oder ft'-Hydroxy-ßißjß-trichloräthylainino,
Y Chlor, Brom bedeutet,
eine gute herbizide Wirkung besitzen.
Die Mischungen können eine oder mehrere Verbindungen der Formel a und/oder eine oder mehrere Verbindungen aus einer oder
mehreren der übrigen Wirkstoff gruppen b und c enthalten.
Die Mischungsverhältnisse können beliebig gewählt werden; Mischungen der Verbindungen der Formel a 0,1 bis 10 Gewichtsteile mit 0,1 bis 10 Gewichtsteilen der Verbindungen b oder c
werden bevorzugt. Die Aufwandmengen betragen 0,1 bis 15 kg per
Hektar, vorzugsweise 0,1 bis 5 kg per Hektar Wirkstoff.
Die erfindungsgemäßen Mittel sind selektiv in Beta spp., Alium cepa, Pisum sativum, Gladiolus spp., Soja hispida,
Gossypium hirsutum, Phaseolus vulgaris, Arachis hypogaea und anderen.
Die Anwendung erfolgt z. B. in Form von direkt versprUhbaren
Lösungen, Pulvern, Suspensionen oder Dispersionen, Emulsionen, öldispersionen, Pasten, Stäubemitteln, Streumitteln, Granulaten
durch Versprühen, Vernebeln, Verstäuben, Verstreuen oder Gießen. Die Anwendungsformen richten sich ganz nach den Verwendungszwecken;
sie sollten in jedem Fall möglichst die feinste Verteilung der erfindungsgemäßen Wirkstoffe gewährleisten.
40S88S/1338
- 3 - O.Z. 29
Zur Herstellung von direkt versprühbaren Lösungen, Emulsionen, Pasten und öldispersionen kommen Mineralölfraktionen von
mittlerem bis hohem Siedepunkt, wie Kerosin oder Dieselöl, ferner Kohlenteeröle usw., sowie öle pflanzlichen oder tierischen
Ursprungs, aliphatisch^, cyclische und aromatische Kohlenwasserstoffe,
z. B. Benzol, Toluol, Xylol, Paraffin, Tetrahydronaphthalin, alkylierte Naphthaline oder deren Derivate, z. B.
Methanol, Äthanol, Propanol, Butanol, Chloroform, Tetrachlorkohlenstoff, Cyclohexanol Cyclolhexanon, Chlorbenzol, Isophoron
usw., stark polare Lösungsmittel, z. B. Dimethylformamid, Dimethylsulfoxid,
N-Methylpyrrolidon, Wasser usw. in Betrachte
Wäßrige Anwendungsformen können aus Emulsionskonzentraten, Pasten oder netzbaren Pulvern (Spritzpulvern), öldispersionen durch
Zusatz von Wasser bereitet werden. Zur Herstellung von Emulsionen, Pasten oder öldispersionen können die Substanzen als solche
oder in einem öl oder Lösungsmittel gelöst, mittels Netz-, Haft-, Dispergier- oder Emulgiermittel in Wasser homogenisiert werden.
Es können aber auch aus wirksamer Substanz·, Netz-, Haft-, Dispergier- oder Emulgiermittel und eventuell Lösungsmittel
oder öl bestehende Konzentrate hergestellt werden, die zur Verdünnung
mit Wasser geeignet sind.
An oberflächenaktiven Stoffen sind zu nennen: Alkali-, Erdalkali-,
Ammoniumsalze von Ligninsulfonsäure, Naphthalinsulfonsäuren, Phenolsulfonsäuren, Alkylarylsulfonate, Alkylsulfate, Alkylsulfonate,
Alkali- und Erdalkalisalze der Dibutylnaphthalinsulfonsäure, Lauryläthersulfat, Fettalkoholsulfate, fettsaure
Alkali- und Erdalkalisalze, Salze sulfatierter Hexadecanole,
Heptadecanole, Oetadecanole, Salze von sulfatiertem Fettalkoholglykoläther, Kondensationsprodukte von sulfonierten» Naphthalin
und Naphthalinderivaten mit Formaldehyd, Kondensationsprodukte des Naphthalins bzw. der Naphthalinsulfonsäuren mit Phenol und
Formaldehyd, Polyoxyäthylen-octylphenoläther, äthoxyliertes Isooctylphenol, - Oetylphenol, - Nonylphenol, Alkylphenolpolyglykoläther,
Tributylphenylpolyglykoläther, Alkylarylpolyätheralkohole, Isotridecylalkohol, Fettalkoholäthylenoxid-Kondensate,
äthoxyliertes Rizinusöl, Polyoxyäthylenalkyläther, äthoxyliertes Polyoxypropylen, Laurylalkoholpolyglykolätheracetal, Sorbit-
4Ö988S/1338
- 4 - υ.Ζ. 29 964
ester, Lignin, Sulfitablaugen und Methyleellulose.
Pulver, Streu- und Stäubemittel können durch Mischen oder gemeinsames
Vermählen der wirksamen Substanzen mit einem festen Trägerstoff hergestellt werden.
Granulate, z. B. UmhUllungs-, Imprägnierungs- und Homogengranulate,
können durch Bindung der Wirkstoffe an feste Trägerstoffe hergestellt werden. Feste Trägerstoffe sind z. B.
Mineralerden wie Silicagel, Kieselsäuren, Kieselgele, Silikate, Talkum, Kaolin, Attaclay, Kalkstein, Kalk, Kreide, Bolus, Löß,
Ton, Dolomit, Diatomeenerde, Calcium- und Magnesiumsulfat, Magnesiumoxid, gemahlene Kunststoffe, Düngemittel, wie z. B.
Ammoniumsulfat, Ammoniumphosphat, Ammoniumnitrat, Harnstoffe und pflanzliche Produkte, wie Getreidemehle, Baumrinden-, HoIz-
und Nußschalenmehl, Cellulosepulver und andere feste Trägerstoffe.
Die Pormulierungen enthalten zwischen 0,1 und 95 Gewichtsprozent
Wirkstoff, vorzugsweise zwischen 0,5 und 90 Gewichtsprozent.
Zu den Mischungen oder Einzelwirkstoffen können öle verschiedenen
Typs, Herblzide, Fungizide, Nematozide, Insektizide, Bakterizide, Spurenelemente, Düngemittel, Antischaummittel (z. B. Silikone),
Wachstumsregulatoren, Antidotmittel und andere herbizld wirksame
Verbindungen, gegebenenfalls auch erst unmittelbar vor der Anwendung (Tankmix) zugesetzt werden. Die zuletzt genannten
herbizlden Verbindungen können auch vor oder nach den erfindungsgemäßen
Einzelwirkstoffen oder Mischungen zur Anwendung gebracht werden.
Die Zumischung dieser Mittel zu den erfindungsgemäßen Herbiziden kann im Gewichtsverhältnis 1 : 10 bis 10 : 1 erfolgen. Das
Gleiche gilt für öle, Fungizide, Nematozide, Insektizide, Bakterizide,
Antidotmittel und Wachstumsregulatoren.
Die erfindungsgemäßen Mittel können u. a. Im Vorpflanz-,
Nachpflanz-, Vorsaat-, Vorauflauf-, Nachauflaufverfahren oder
während des Auflaufens der Kulturpflanzen oder der unerwünschten
4098Ö5/1338
- 5 - O S. 29 964
Pflanzen ein- oder mehrmals angewandt werden.
Die erfindungsgemäßen Mittel können in ihrer aufgewandten Menge schwanken. Die aufgewandte Menge hängt hauptsächlich von der Art
des gewünschten Effektes ab.
Die Aufwandmenge liegt im allgemeinen zwischen 0,1 und 15 oder
mehr, vorzugsweise zwischen 0,2 und β kg Wirkstoff pro Hektar.
Die neuen Mittel weisen einen starken herbiziden Effekt auf und können deshalb als Unkrautvernichtungsmittel bzw. zur Bekämpfung
unerwünschten Pflanzenwuchses verwendet werden. Ob die neuen Wirkstoffe als totale oder selektive Mittel wirken,
hängt hauptsächlich von der Wirkstoffmenge je Flächeneinheit
ab ο
Unter Unkräuter bzw. unerwünschten Pflanzenwuchses sind alle monokotylen und dikotylen Pflanzen zu verstehen, die an Orten
aufwachsen, wo sie nicht erwünscht sind.
So können mit den erfindungsgemäßen Mitteln beispielsweise Gramineen, wie
Cynodon spp. Dactylis spp.
Digitaria spp. Avena spp.
Echinochloa spp. Bromus spp.
Setaria spp. Uniola spp.
Panicum spp· Poa spp.
Alopecurus spp. Leptochloa spp.
Lolium spp. Brachiaria spp.
Sorghum spp. Eleusine spp.
Agropyron spp. Cenchrus spp.
Phalaris spp. Eragrostis spp.
Apera spp. und andere
Cyperaceae, wie
Carex spp. Eleocharis spp.
Cyperus spp. Scirpus spp.
und andere
40988S/1338
29 964
dikotyle Unkräuter, wie Malvaceae, ζ. Β.
Abutilon theoprasti Sida spp. und andere
Compostiae, wie Ambrosia spp. Lactuca spp. Senecio spp.
Sonchus spp. Xanthium spp. Iva spp. Galinsoga spp.
Taraxacum spp. Chrysanthemum spp. Cirsium spp.
Convolvulaceae, wie Convolvulus spp. Ipomoea spp. und andere
Cruciferae, wie Barbarea vulgaris Brassica spp. Capsella spp. Sisymbrium spp.
ThIaspi spp. Sinapis arvensis und andere
Geraniaceae, wie Erodium spp. und andere
Portulacaceae, wie Portulaca spp.
Primulaceae, wie Anagallis arvensis und andere
Hibiscus spp. Malva spp.
Centaurea spp. Tussilago spp. Lapsana communis
Tagetes spp. Erigeron spp. Anthemis spp. Matricaria spp. Artemisia spp.
Bidens spp. und andere
Cuscuta spp. Jaquemontia tamnifolia
Arabidopsis thaliana Descurainia spp. Drabe spp. Coronopus didymus
Lepidium spp. Raphanus spp.
Geranium spp.
und andere
Lysimachia spp.
409885/1338
— T —
O1Z. 29 964
Rubiaeeae, wie Richardia spp.
Galium spp.
Scrophulariaceae, wie Linaria spp. Veronica spp.
Solanaceae, wie Physalis spp.
Solanum spp. und andere
Urticaceae, wie Urtica spp·
Violaceae, wie Viola spp.
Zygophyllaceae, wie Tribulus terrestis
Euphorbiaceae, wie Mercurialis annua
Umbelliferae, wie Daucus carota Aethusa cynapium
Commelinaeae, wie Commelina spp.
Labiatae, wie Lamium spp. und andere
Lagurninosae, wie Medicago spp.
Trifolium spp. Vicia spp. und andere
Plantaginaceae, wie Plantago spp.
Polygonaceae, wie Polygonum spp. Diodia spp. und andere
Digitalis spp. und andere
Nicandra spp. Datura spp.
und andere und andere Euphorbia spp.
Ammi majus und andere und andere Galeopsis spp.
Sesbania exaltata Cassia spp. Lathyrus spp.
und andere
Pagopyrum spp, 409885/1338
Rumex spp.
Aizoaceae, wie Mollugo verticillata
Amaranthaceae, wie Amaranthus spp.
Boraginaceae, wie Amsinckia spp. Myostis spp.
und andere
Caryophyllaceae, wie Stellaria spp. Spergula spp. Saponaria spp.
Scleranthus annuus
Chenopodiaceae, wie
Chenopodium spp. Kochla spp.
Salsola Kali
Lythraceae, wie Cuphea spp.
Oxalidaceae, wie Oxalis spp.
Ranuneulaceae, wie Ranunculus spp. Delphinium spp.
Papveraceae, wie Papaver spp. und andere
Onagraceae, wie Jussiaea spp.
Rosaeeae, wie Alchemillia spp. und andere
Potamogetonaceae, wie Potamogeton spp. und andere und andere und andere
Anchusa spp. Lithospermum spp.
SiIene spp. Cerastium spp. Agrostemma githago
und andere
Atriplex spp. Monolepsis nuttalliana
und andere
und andere
O.Z. 29 964
Adonis spp. und andere
Fumaria officinalis
und andere
Potentilla spp.
und andere 40988B/1338
- 9 - O,Z. 29 964
Najadaceae, wie
Najas spp. und andere
Marsileaceae, wie
Marsilea quadrifolia und andere
bekämpft werden.
Im Gewächshaus und im Freiland wurden die Verbindungen N-Äthyl-N-butyl-2,6-dinitro-4-trifluormethylanilin
N,N-Di-(n-propyl)-2,6-dinitro-4-trifluormethylanilin
N-Propyl-N-ß-chloräthyl-2,6-dinitro-4-trifluormethylanilin
N-Allyl-N-ß-chloräthyl-2,6-dinitro-4-trifluormethylanilin
N-Äthyl-N-ß-chloräthyl-2,ö-dinitro-4-trifluormethylanilin
N-Äthyl-N-ß-bromäthyl-2,6-dinitro-4-trifluormethylanilin
N-Propyl-N-ß-bromäthyl-2,6-dinitro-4-trifluormethylanilin
N-ß-Methoxyäthyl-N-ß-chloräthyl-2,6-dinitro-4-trifluormethylanilin
N-Isopropyl-N-propargyl-2,6-dinitro-4-trifluormethylanilin
N-Propyl-N-allyl-2,6-dinitro-4-trifluormethylanilin
N-Propyl-N-propargyl-2,6-dinitro-4-trifluormethylanilin
N,N-Bis-(ß-chloräthyl)-2,6-dinitro-4-trifluormethylanilin
Ν,Ν-Bis-(ß-methoxyäthyl)-2,6-dinitro-4-trifluormethylanilin
N-Propyl-N-cyclopropyl-2,6-dinitro-4-trifluormethylanilin
N-Propyl-N-tetrahydrofurfuryl-2,6-dinitro-4-trifluormethylanilin
N-Äthyl-N-tetrahydrofurfuryl-2,6-dinitro-4-trifluormethylanilin
N-Propyl-N-cyclopropylmethy1-2,6-dinitro-4-trifluormethylanilin
N-Propyl-N-allyl-2,6-dinitro-4-methylsulfonylanilin Ν,Ν-Bis-(n-propyl)-2,6-dinitro-4-methylsulfonylanilin
Ν,Ν-Bis-(n-propyl)-2,6-dinitro-4-aminosulfonylanilin
Ν,Ν-Bis-(n-propyl)-2,6-dinitro-4-methylanilin Ν,Ν-Bis-(sec-butyl)-2,6-dinitro-4-tert.butylanilin
Ν,Ν-Bis-(n-propyl)-2,6-dinitro-4-isopropylanilin
N,N-Diäthyl-2,6-dinitro->amino-4-trifluormethylanilin
N-Methyl-N-ß-chloräthyl-2,6-dinitro-4-methylanilin
Ν,Ν-Bis-(n-propyl)-2,6-dinitro-4-methoxyanilin
Ν,Ν-Bis-(ß-chloräthyl)-2,6-dinitro-4-methylanilin
409885/1338 /10
- 10 - O.Z. ?9 964
N,N-Dilsopropyl-thiolcarbatninsäure-2,3-dichlorallylester
2-(2,6-Dinitro-4-toluidin)-N-propion-methylamid
N,N-Diisopropyl-thiolcarbaminsäure-2,3*3-trichlorallylester
N-Äthyl-N- butyl- thiolcarbaminsäuB-n-propylester
N,N-Di-(n-propyl)-thiolcarbaminsäureäthylester
N,N-DI-(n-propyl)-thiolcarbamlnsäure-n-propylester
N, N-Di- (n-propyl) - thiolcarbaminsäure-1 er t. butylester
NiN-Diisobutyl-thiolcarbaminsäureäthylester
N,N-Di-(n-butyl)-thiolcarbaminsäureäthylester NiN-Diäthyl-thiolcarbaminsäurebutylester
N,N-Diäthyl-dithiocarbaminsäure-2-chlorallylester
N-Äthyl-N-cyclohexyl-thiolcarbaminsäureäthylester
N-Bicyclo- (2, 2,1 J-heptyl-N-äthylthiolcarbaminsäureäthylester
N-I- oder -2-Bicyclo-(3,5,0)-octyl-N-äthyl-thiolcarbaminsäure-
äthylester
NiN-DIäthyl-thlolcarbaminsäure-p-chlorbenzylester
N-Bicyclo- (2, 2, l)-heptyl-N-äthyl-dithiocarbaminsäureäthylester
N-I- oder -2-Bicyclo-(3,3,0)-N-äthyl-thiocarbaminsäure!so-
propylester
N-Propargyl-N-cyclohexyl-thiolcarbaminsäure-äthylester
N-Äthyl-N-o-methylcyclohexyl-thiolcarbaminsäureäthylester
N-Phenylcarbaminsäure-isopropylester N-m-Chlorphenylcarbaminsäure-isopropylester
N-m-Chlorphenylcarbaminsäure-butin-l-yl-3-ester
N-m- Chlorphenylcarbatninsäure- 4- chlorbutin-2-yl-1-ester
N-3,4-Dichlorphenylcarbaminsäuremethylester N-Methylcarbaminsäure-3,4-dichlorbenzylester
N-Methylcarbaminsäure-2,6-di- (tert.butyl)-p-tolylester
0-(N-Phenylcarbamoyl)-propanonoxim
3-Methoxycarbonylaminophenyl-N- (31 -methylphenyl)-carbamat
l-Phenyl-4-amino-5-chlorpyridazon-(6)
l-Phenyl-4-a-hydroxy-ß,ß,ß-trichloräthylamino-5-brom-pyridazon-
l-Phenyl-4-a-hydroxy-ß,ß,ß-trichloräthylamino-5-brom-pyridazon-
in Mischung an den in den Beispielen genannten Pflanzen geprüft. Die Aufwandmengen betrugen Jeweils 0,1 bis 15 kg/ha Wirkstoff.
Bei diesen. Prüfungen hat sich ergeben, daß die genannten Verbindungen
biologisch entsprechend wirksam sind wie die in den Beispielen 1 bis 10 angeführten Mischungen.
409885/1338 /u
- 11 - CZ, 29 964
Eine landwirtschaftliche Nutzfläche wurde mit folgenden Einzelwirkstoffen
und deren Mischungen als Granulat behandelt:
I N,N-Di-n-propyl-2,6-dinitro-4-trifluormethylanilin
II N-n-Propyl-N-ß-chloräthyl-2,6-dinitro-4-trifluormethylanilin
III N-Allyl-N-ß-chloräthyl-2,6-dinitro-4-trifluormethylanilin
IV N,N-Di-n-propyl-2,6-dinitro-4-aminosulfonylanilin
V Ν,Ν-Dilsopropyl-thiolcarbaminsäure-2,3-dichlorallylester
VI N,N-Diisopropyl-thiolcarbaminsäure-2,3>3-trichlorallylester
VII l-Phenyl-^-amino-S-chlorpyridazon-(6)
mit je 0,15, 0,25, 0,5, 1, 1,5 "und 1,8 kg/ha a. S.
I+VI+VII, II+VI+VII, III+VI+VII, IV+VI+VII, I+V+VII, II+V+VII
mit je 1,5+0,15+0,25, 0,25+0,25+1,5, 0,15+1,5+0,15, 0,5+0,5+0,5, 0,25+0,25+0,5, 0,25+0,5+0,25 und 0,5+0,25+0,25
kg/ha aktive Substanz
und der Boden anschließend mit den Samen verschiedener Pflanzen besät.
Nach 3 bis 4 Wochen wurde festgestellt, daß die Mischungen
eine bessere herbizide Wirkung bei gleicher Verträglichkeit an der Kulturpflanze zeigten als die Wirkstoffe I bis VII·
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen.
4G988S/1338 /12
Wirkstoff I II
kg/ha a. S. 0,15 0,25 0,5 1 1,5 1*8 0,15 0,25 0,5 1 1,5 1*8
Nutzpflanzen: | 0 | 0 | 0 | 0 | III | 0 | 5 | 0 | 0 | 0 | 0 | IV | 0 | 5 | I H* |
Beta vulgaris | IU I |
||||||||||||||
unerwünschte Pflanzen: | 8 | 23 | 41 | 63 | 75 | 87 | 9 | 20 | 40 | 60 | 75 | 90 | |||
Alopecurus myosuroides | 7 | 18 | 34 | 51 | 73 | 78 | 5 | 15 | 30 | 50 | 65 | 75 | |||
Avena fatua | 16 | 25 | 45 | 70 | 80 | 100 | 20 | 30 | 57 | 85 | 97 | 100 | |||
Digitaria sanguinalis | 15 | 32 | 50 | 70 | 80 | 88 | 20 | 30 | 45 | 75 | 80 | 100 | |||
Echinochloa crus-galli | 20 | 37 | 46 | 65 | 90 | 100 | 25 | 35 | 60 | 90 | 96 | 100 | |||
Setaria faberii | 2 | 5 | 7 | 16 | 20 | 25 | 2 | 3 | 6 | 13 | 17 | 20 | |||
Stellaria media | |||||||||||||||
Wirkstoff | |||||||||||||||
o> Beta vulgaris 0 0 0 0 0
Alopecurus myosuroides 8 17 35 55 71 83 9 20 36 58 70 80
Avena fatua 7 14 26 44 63 71 10 14 30 48 65 70
Digitaria sanguinalis | 15 | 25 | 45 | 70 | 76 | 80 | 15 | 28 | 55 | 84 | 95 | 100 | K) | IN |
Echinochloa crus-galli | 15 | 25 | 40 | 70 | 80 | 87 | 20 | 34 | 50 | 76 | 87 | 94 | 334563 | (V) VO VO σ 4= |
Setaria faberii | 10 | 20 | 35 | 50 | 55 | 65 | 25 | 33 | 58 | 87 | 95 | 100 | ||
Stellaria media | 2 | 4 | 8 | 17 | 20 | 24 | 3 | 5 | 8 | 15 | 18 | 22 | ||
ca oo ca cn
■Wirkstoff kg/ha a. S.
V
0,15 0,25 0,5 1 1,5 1,8
0,15 0,25 0,5 1 1,5 1,8
VI
0,15 0,25 0,5 1
0,15 0,25 0,5 1
Beta vulgaris
Alopecurus myosuroides Avena fatua Digitarla sanguinalis
Echlnochloa crus-galli Setarla faberii Stellarla media
Wirkstoff
0 0
VII
Beta vulgaris
Alopecurus myosuroides Avena fatua Digitaria sanguinalis
Echinochloa crus-galli Setaria faberii Stellaria media
0 - ohne Schädigung 100 = totale Schädigung
7 | 11 | 26 | 58 | 85 | 94 |
6 | 10 | 20 | 50 | 63 | 78 |
0 | 0 | 3 | 9 | 12 | 15 |
0 | 0 | 6 | 16 | 19 | 21 |
0 | 2 | 5 | 10 | 15 | 20 |
2 | 6 | 7 | 13 | 15 | 19 |
0 | 0 | 2 | 15 | 19 | 20 |
0 | 0 | 2 | 6 | 15 | 19 |
0 | 2 | 5 | 10 | 25 | 30 |
0 | 5 | 10 | 20 | 25 | 29 |
0 | 10 | 20 | 30 | 35 | 35 |
6 | 10 | 20 | 45 | 60 | 75 |
15
15
15
30
25
10
7
7
7
6ο
60
10
20
60
10
20
15
15
15
1,5 1,8
90 90 13 30 20 20
98 97 15 35 23 22
to OO
co
•Ρ-
cn
CD CO
Wirkstoff I + VI + VII
kg/ha a. S. 1,5+ 0,15+ 0,15+ 0,5+ 0,5+ 0,25+ 0,25+
0,15+ 0,15+ 1,5+ 0,5+ 0,25+ 0,5+ 0,25+
0,15 1,5 0,15 0,5 0,25 0,25 0,5
Beta vulgarls | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |
Alopecurus myosuroides | 100 | 69 | 100 | 98 | 90 | 87 | 82 | |
Avena fatua | 100 | 65 | 100 | 95 | 84 | 80 | 70 | |
Digitaria sangulnalis | 100 | 74 | 63 | 90 | 82 | 65 | 64 | |
Echinochloa crus-galli | 100 | 80 | 88 | 100 | 96 | 92 | 80 | |
O | Setaria faberii | 100 | 84 | 81 | 100 | 94 | 93 | 92 |
co α> |
Stellaria media | 64 | 100 | 60 | 66 | 59 | 56 | 72 |
OO | ||||||||
cn | ||||||||
Wirkstoff | II + | VI + | VII |
J£ Beta vulgaris 0 0 0 0 0 0 0
Alopecurus myosuroides 100 75 100 100 91 88 84
Avena fatua 100 72 100 88 78 80 70
Digitaria sanguinalis 100 77 70 98 94 76 78
Echinochloa crus-galli 100 85 84 96 90 82 76
Setaria faberii 100 95 87 100 97 94 90
Stellaria media 58 100 63 66 58 62 67
I-» ■ir
co 0^ co
co οσ cn
σ\
Wirkstoff kg/ha a. S.
Ill + VI + VII
1,5+ 0,15+ 0,15+ 0,5+ 0,15+ 0,15+ 1,5+ 0,5+ 0,15 1,5 0,15 0,5
0,5+ 0,25+ 0,25+ 0,25+ 0,5+ 0,25+ 0,25 0,25 0,5
Beta vulgaris | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
Alopecurus myosuroides | 97 | 72 | 100 | 98 | 87 | 84 | 80 |
Avena fatua | 95 | 69 | 100 | 95 | 7^ | 73 | 70 |
Digitaria sanguinalis | 100 | 75 | 70 | 87 | 85 | 67 | 65 |
Echinochloa crus-galli | 100 | 85 | 83 | 90 | 83 | 76 | 75 |
Setaria faberii | 96 | 76 | 73 | 95 | 86 | 74 | 71 |
Stellaria media | 68 | 97 | 57 | 68 | 55 | 57 | 64 |
Wirkstoff | I + | V + VII |
Beta vulgaris
Alopecurus myosuroides Avena fatua Digitaria sanguinalis
Echinochloa crus-galli Setaria faberii Stellaria media
100 | 65 | 100 | 95 | 87 | 85 | 80 |
100 | 63 | 100 | 91 | 80 | 82 | 72 |
100 | 70 | 60 | 92 | 85 | 63 | 60 |
100 | 78 | 85 | 100 | 95 | 80 | 84 |
100 | 83 | 80 | 100 | 91 | 90 | 90 |
58 65 60 55
70
O CO OO OO
Wirkstoff | II + | V + VI] | C | 0,15+ 1,5+ 0,15 |
0 | 0,5+ 0,5+ 0,5 |
0,5+ 0,25+ 0,25 |
ooo to to to WUlW Ul + Ul |
ooo to to to UlWW UlUI + + |
kg/ha a. S. | 1,5+ 0,15+ 0,15 |
0,15+ 0,15+ 1,5 |
0 | 100 | 0 | 0 | 0 | 0 | |
Beta vulgarls | 0 | 0 | 100 | 100 | 100 | 90 | 86 | 80 | |
Alopecurus myosuroides | 100 | 73 | 100 | 65 | 86 | 75 | 77 | 68 | |
Avena fatua | 100 | 70 | 68 | 82 | 95 | 95 | 75 | 75 | |
Digitaria sanguinalis | 100 | 78 | 85 | 95 | 93 | 92 | 80 | 75 | |
Echinochloa crus-galli | 100 | 85 | 85 | 73 | 100 | 95 | 92 | 88 | |
Setaria faberli | 100 | 93 | 65 | 65 | 55 | 60 | 66 | ||
Stellaria media | 55 | 100 | VI + VII | ||||||
Wirkstoff | IV + | 0 | 0 | 0 | 0 | 0 | |||
Beta vulgaris | 0 | 74 | 100 | 85 | 83 | 80 | |||
Alopecurus myosuroides | 100 | 72 | 94 | 80 | 75 | 70 | |||
Avena fatua | 100 | 70 | 95 | 90 | 68 | 70 | |||
Digitaria sanguinalis | 100 | 84 | 97 | 95 | 84 | 80 | |||
Echinochloa crus-galli | 100 | 93 | 100 | 100 | 85 | 84 | |||
Setaria faberii | 100 | 92 | 73 | 54 | 53 | 60 | |||
Stellaria media | 65 |
- 17 - O.Z, 29 964
Im Gewächshaus wurden Versuchsgefäße mit lehmigen Sandboden gefüllt und mit verschiedenen Samen besät. Danach wurde der
so vorbereitete Boden mit folgenden Einzelwirkstoffen und
deren Mischungen als Dispersion behandelt und eingearbeitet:
I N,N-Di~n-propyl-2,ö-dinitro-4-trifluormethylanilin
II N-rn- Propyl-N-ß-chloräthyl-2,6-dini tro-4-trifluormethylanilin
IV N,N-Di-n-propyl-2J6-dinitro-4-aminosulfonyl-anilin
VII l-Phenyl-4-amino-5-öhlorpyridazon-(6)
VIII N-Äthyl-N-cyclohexyl-thiolcarbaminsäure-äthylester
mit je 0,15, 0,25, 0,5, 1, 1,5 und 1,8 kg/ha a. S.
I+VII+VIII )
II+VII+VIII ) mit je 1,5+0,15+0,15, 0,15+0,15+1,5,
IV+VII+VIII ) 0,15+1,5+0,15, 0,5+0,5+0,5, 0,5+0,25+0,25,
0,25+0,5+0,25 und 0,25+0,25+0,5 kg/ha a. S.
Nach 3 bis 4 Wochen wurde festgestellt, daß die Mischungen
eine bessere herbizide Wirkung bei gleicher Verträglichkeit an der Kulturpflanze zeigten als die Wirkstoffe I, II, IV,
VII und VIII.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen.
409885/1338 /18
Wirkstoff kg/ha a. S.
0,15 0,25 0,5 1 1,5 1,8
II
0,15 0,25 0,5 1
0,15 0,25 0,5 1
1,5 1,8
Nutzpflanzen; Beta vulgaris
unerwünschte Pflanzen:
Alopecurus myosuroides | 8 | 23 | 41 | 63 | 75 | 87 | 9 | 20 | 40 | 60 | 75 | 90 |
Avena fatua | 7 | 18 | 34 | 51 | 73 | 78 | 5 | 15 | 30 | 50 | 65 | 75 |
Dlgitaria sanguinalis | 16 | 25 | 45 | 70 | 80 | 100 | 20 | 30 | 57 | 85 | 97 | 100 |
Echinochloa crus-galli | 15 | 32 | 50 | 70 | 80 | 88 | 20 | 30 | 45 | 75 | 80 | 100 |
Setaria faberii | 20 | 37 | 46 | 65 | 90 | 100 | 25 | 35 | 60 | 90 | 96 | 100 |
Stellaria media | 2 | 5 | 7 | 16 | 20 | 25 | 2 | 3 | 6 | 13 | 17 | 20 |
Wirkstoff
IV
VII
Beta vulgaris
Alopecurus myosuroides Avena fatua Digitaria sanguinalis Echinochloa crus-galli
Setaria faberii Stellaria media
0 = ohne Schädigung 100 » totale Schädigung
20 36 58 70 80
10 | 14 | 30 | 48 | 65 | 70 |
15 | 28 | 55 | 84 | 95 | 100 |
20 | 34 | 50 | 76 | 87 | 94 |
25 | 33 | 58 | 87 | 95 | 100 |
3 | 5 | 8 | 15 | 18 | 22 |
vo
O | O | 2 | 15 | 19 | 20 | 233^ | ο N |
O | O | 2 | 6 | 15 | 19 | ;563 | ro VO vo |
O | 2 | 5 | 10 | 25 | 30 | 4=" | |
3 | 5 | 10 | 20 | 25 | 29 | ||
O | 10 | 20 | 30 | 35 | 35 | ||
6 | 10 | 20 | 45 | 60 | 75 | ||
O CD CO GO
Wirkstoff | 0, | 15 0,25 | VIII | 1 | 1,5 | 1,8 |
kg/ha a. S. | 0 | 0 | 0,5 | 0 | 0 | 0 |
Beta vulgaris | 5 | 10 | 0 | 68 | 80 | 87 |
Alopecurus rayosuroides | 3 | 5 | 15 | 27 | 40 | 46 |
Avena fatua | 5 | 15 | 10 | 50 | 70 | 75 |
Digitaria sanguinalis | 7 | 15 | 32 | 48 | 70 | 78 |
Echinochloa crus-galli | 5 | 12 | 25 | 45 | 67 | 80 |
Setaria faberii | 0 | 5 | 27 | 20 | 28 | 40 |
Stellaria media | 12 | |||||
co, 0 = ohne Schädigung
JJ 100 = totale Schädigung
VO
Ca> OO
Wirkstoff kg/ha a. S.
I + VII +VIII
1,5+ 0,15+ 0,15+ 0,5+ 0,5+ 0,25+ 0,25+
0,15+ 0,15+ 1,5+ 0,5+ 0,25+ 0,5+ 0,25+
0,15 1,5 0,15 0,5 0,25 0,25 0,5
Beta vulgar!s | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
Alopecurus myosuroides | 100 | 100 | 70 | 100 | 93 | 68 | 75 |
Avena fatua | 100 | 86 | 63 | 80 | 75 | 62 | 66 |
Digitaria sanguinalis | 100 | 100 | 78 | 100 | 95 | 80 | 95 |
Echinochloa crus-galli | 100 | 100 | 85 | 100 | 100 | 90 | 96 |
Setarla faberli | 100 | 98 | 96 | 100 | 93 | 96 | 98 |
Stellaria media | 62 | 73 | 98 | 76 | 60 | 68 | 64 |
Wirkstoff | II + | VII + | VIII |
Beta vulgaris
Alopecurus myosuroides Avena fatua Digitaria sanguinalis
Echinochloa crus-galll Setaria faberli
Stellaria media
100 100 72 96 90 70 75
98 | 83 | 66 | 80 | 74 | 64 | 60 |
100 | 100 | 92 | 100 | 100 | 84 | 94 |
100 | 100 | 90 | 100 | 100 | 88 | 95 |
100 | 100 | 95 | 100 | 100 | 98 | 100 |
58 | 75 | 97 | 80 | 57 | 69 | 65 |
ro
INJ
CJ OJ
Wirkstoff IV + VII + VIII
kg/ha a. S. 1,5+ 0,15+ 0,15+ 0,5+ 0,5+ 0,25+ 0,25+
0,15+ 0,15+ 1,5+ 0,5+ 0,25+ 0,5+ 0,25+ 0,15 1,5 0,15 0,5 0,25 0,25 0,5
Beta vulgaris 0 0 0 0 0 0 0
Alopecurus myosuroides J^ Avena fatua
° Dlgitaria sanguinalis
cx> Echinochloa crus-galli , . „
S Setaria faberii 100 100 92 100 98 93 100 M
"^ Stellaria media 68 73 100 80 66 70 65 l
100 | 100 | 70 | 100 | 83 | 70 | 75 |
100 | 87 | 68 | 84 | 75 | 58 | 60 |
100 | 100 | 84 | 100 | 100 | 85 | 92 |
100 | 100 | 90 | 100 | 100 | 96 | 98 |
0 = ohne Schädigung 100 * totale Schädigung
ο csr TO
ίο1 cn
- 22 - 0.2. 29 964
Eine landwirtschaftliche Nutzfläche wurde mit folgenden
Einzelwirkstoffen und deren Mischungen als Granulat behandelt:
I N,N-Di(n-propyl)-2,6-dinitro-4-trifluormethylanilin
II N-n-Propyl-N-ß-chloräthyl-2,6-dinitro-4-trifluormethylanilin
V Ν,Ν-Diisopropyl-thiocarbaminsäure-^,3-dichlorallylester
VI N, N-Diisopropyl-thiocarbaminsäure-^,^ 3-triehlorallylester
VIII N-Äthyl-N-cyclohexyl-thiolcarbaminsäure-äthylester
mit je 0,25, 0,5 und 1 kg/ha a. S.
I+V+VIII, I+VI+VIII, II+V+VIII und II+VI+VIII
mit je 0,25+0,25+0,5, 0,25+0,5+0,25 und 0,5+0,25+0,25 kg/ha aktive Substanz,
und der Boden anschließend mit den Samen verschiedener Pflanzen besät.
Nach 3 bis 4 Wochen wurde festgestellt, daß die Mischungen eine bessere herbizide Wirkung bei gleicher Verträglichkeit
an der Kulturpflanze zeigten als die Einzelwirkstoffe I, II, V, VI und VIII.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen.
4 0 9 8 δ S / 1 3 3 8
Wirkstoff | 0,25 | I | 1 | 0,25 | II | 1 | 0,25 | V | 1 | |
kg/ha a. S. | 0,5 | 0,5 | 0,5 | |||||||
Nutzpflanzen: | O | O | 0 | 0 | 0 | 0 | ||||
Beta vulgaris | O | 0 | 0 | |||||||
unerwünschte Pflanzen: | 23 | 63 | 20 | 60 | 11 | 58 | ||||
Alopecurus myosuroides | 18 | in | 51 | 15 | 40 | 50 | 10 | 26 | 50 | |
Avena fatua | 32 | 34 | 70 | 30 | 30 | 75 | 0 | 20 | 16 | |
Echinochloa crus-galli | 37 | 50 | 65 | 35 | 45 | 90 | 2 | 6 | 10 | |
es ca ca /VV |
Setaria faberii Wirkstoff |
0,25 | 46 VI |
1 | 0,25 | 60 VIII |
1 | 5 | ||
CJl
~»^ |
kg/ha a. S. | O | 0,5 | O | 0 | 0,5 | 0 | |||
Ca> | Beta vulgaris | 15 | O | 60 | 10 | 0 | 68 | |||
t*> | Alopecurus myosuroides | 15 | 30 | 60 | 5 | 15 | 27 | |||
Avena fatua | 5 | 25 | 20 | 15 | 10 | 48 | ||||
Echinochloa crus-galli | 4 | 10 | 15 | 12 | 25 | 45 | ||||
Setaria faberii | 7 | 27 | ||||||||
Γ0 4
<J1
Wirkstoff kg/ha a. S.
I + V + VIII
0,25+ 0,25+ 0,5+ 0,25+ 0,5+ 0,25+ 0,5 0,25 0,25 I + VI + VIII
0,25+ C, .25+ 0,5+
0,25+ 0,5+ 0,25+
0,5 0,25 0,25
0,25+ 0,5+ 0,25+
0,5 0,25 0,25
II ■;- V + VIII
0,25+0,25+ 0,5+ 0,25+ 0,5+ 0,25+ 0,5 0,25 0,25
Beta vulgar!s
CJO OO OO
Alopecurus myosuroides Avena fatua
Echinochloa crus-galli Setaria faberii
Wirkstoff
90 | • 96 | 87 |
72 | 78 | 70 |
95 | 90 | 92 |
97 | 90 | 96 |
II + VI + VIII
95 98
80 85
97 96
100 92
100
90
90
100
97
97
82
70
93
98
95 74 87 86
97 80
95 100
Beta vulgar!s
COCO-OO
Alopecurus myosuroides | 90 | 95 | 100 |
Avena fatua | 84 | 79 | 86 |
Echinochloa crus-galli | 97 | 92 | 100 |
Setaria faberii | 98 | 90 | 100 |
ro
Ul
0 = ohne Schädigung 100 = totale Schädigung cn
OJ
- 25 - O.Z. 29 964
Im Gewächshaus wurden Versuchsgefäße mit lehmigen Sandboden gefüllt und mit Samen von verschiedenen Pflanzen besät. Danach
wurde der so vorbereitete Boden mit folgenden Einzelwirkstoffen und deren Mischungen als Granulat behandelt und eingearbeitet:
I N,N-Di-(n-propyl)-2,6-dinitro-4-trifluormethylanilin
II N-n-Propyl-N-ß-chloräthyl-2,6-dinitro-4-trifluormethylanilin
IV N,N-Di-(n-propyl)-2,6-dinitro-4-aminosulfonylanilin
VII l-Phenyl-4-amino-5-chlorpyridazon-(6) mit je 0,25* 0,75, 0,5 und 1 kg/ha aktive Substanz
I+VII, II+VII und IV+VII
mit je 0,75+0,25, 0,25+0,25 und 0,25+0,75 kg/ha a. S.
Nach j5 bis 4 Wochen wurde festgestellt, daß die Mischungen
eine bessere herbizide Wirkung bei gleicher Verträglichkeit an den Kulturpflanzen zeigten als die Wirkstoffe I, II, XV und
VII.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen.
409806/1333
/26
Wirkstoff | 0,25 | I | 0,5 | 0,75 | 1 | 0,25 | II | 0,75 | 1 | 0,25 | IV | 0,75 | 1 |
kg/ha a. S. | 0,5 | 0,5 | |||||||||||
Nutzpflanz en: | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||
Beta vulgaris | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |
Pisum sativum | 0 | 0 | |||||||||||
unerwünschte Pflanzen: | 23 | 41 | 50 | 63 | 20 | 52 | 60 | 20 | 45 | 58 | |||
Alopecurus myosuroides | 18 | 34 | 45 | 51 | 15 | 40 | 43 | 50 | 14 | 36 | 37 | 48 | |
Avena f atua | 25 | 45 | 56 | 70 | 30 | 30 | 70 | 85 | 28 | 30 | 68 | 84 | |
Digitaria sanguinalis | 57 | 55 | |||||||||||
S Echinochloa crus-galli 32 50 58 70 30 45 58 75 34 50 65
m Stellarla media 5 7 10 l6 3 6 11 13 5 8 10 15 ro
-■«·.■ σ\
Setaria faberii 37 46 55 65 35 60 74 90 33 58 70
2 Wirkstoff VII
Beta vulgaris | 0 | 0 | 0 | 0 |
Pisum sativum | 0 | 0 | 0 | 0 |
Alopecurus myosuroides | 0 | 2 | 9 | 15 |
Avena fatua | 0 | 2 | 5 | 6 |
Digitaria sanguhalis | 2 | 5 | 6 | 10 |
Echinochloa crus-galli | 5 | 10 | 14 | 20 |
Setaria faberii | 10 | 20 | 26 | 30 |
Stellaria media | 10 | 20 | 35 | 45 |
O | |
IVJ | N |
-OJ | ro |
Jfri. | VO |
01 | VC |
■cn | -ta- |
co |
Wirkstoff kg/ha a. S.
I + VII
0,75+ 0,25+ 0,25+ 0,25 0,25 0,75
II + VII
0,75+ 0,25+ 0,25+
0,25 0,25 0,75
0,25 0,25 0,75
rV + VII
0,75+ 0,25+ 0,25+
0,25 0,25 0,75
0,25 0,25 0,75
Beta vulgar!s
co co coot
Alopecurus myosuroides Avena fatua
Digitaria sanguinalis Echinochloa crus-galli
Setaria faberii Stellaria media
0 = ohne Schädigung 100 = totale Schädigung
80 | . 58 | 64 |
70 | 50 | 55 |
83 | 62 | 70 |
93 | 68 | 75 |
95 | 75 | 84 |
48 | 40 | 68 |
76 | 55 | 65 |
65 | 48 | 54 |
86 | 70 | 80 |
79 | 60 | 78 |
97 | 80 | 92 |
65 | 43 | 68 |
75 | 50 | 60 |
63 | 40 | 50 |
98 | 65 | 70 |
95 | 70 | 73 |
100 | 70 | 90 |
53 | 40 | 65 |
ro co
CD
CO
- aß - ο.ζ. 29 964
Eine landwirtschaftliche Nutzfläche wurde mit verschiedenen
Samen besät. Unmittelbar danach wurde der so vorbereitete Boden mit folgenden Einzelwirkstoffen und deren Mischungen als Paste behandelt:
Samen besät. Unmittelbar danach wurde der so vorbereitete Boden mit folgenden Einzelwirkstoffen und deren Mischungen als Paste behandelt:
I N,N-Di-(n-propyl)-2,6-dinitro-4-trifluormethylanilin
II N-n-Propyl-N-ß-chloräthyl-2,6-dinitro-4-trifluormethylanilin
IV NjN-Di-(n-propyl)-2,6-dinitro-4-aminosulfonylanilin
V N, N-Diisopropyl-thiocarbaminsäure^, 3-dlchlorallylester
VI N,N-Diisopropyl-thiolcarbaminsäure-2,3#5-trichlorallylester
VIII N-Äthyl-N-cyclohexyl-thiolcarbaminsäure-äthylester
mit je 0,25, 0,5* 0,75 und 1 kg/ha a. S.
I+VIII, II+VIII, IV+VIII, II+V, II+VI, IVfV und IV+VI
mit jeweils 0,75+0,25, 0,25+0,25 und 0,25+0,75 kg/ha
aktive Substanz.
Nach 3 bis 4 Wochen wurde festgestellt, daß die Mischungen
eine besser herbizide Wirkung bei gleicher Verträglichkeit an den Kulturpflanzen zeigten als die Wirkstoffe I, II, IV,
V, VI und VIII.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen.
409885/1338
Wirkstoff | 0,25 | I | 0,5 | V | 0,5 | 0,75 | 1 | 0,25 | o, | II | VI | 1 | 0,25 | o, | IV | 1 | ro VO |
|
kg/ha a. S. | O | 5 0,75 | 5 0,75 | 5 0,75 | 1 | |||||||||||||
Nutzpflanzen: | O | O | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | |||||||
Beta vulgaris | 0 | 0 | ||||||||||||||||
unervrtinschte Pflanzen: | 23 | 41 | 50 | 63 | 20 | 40 | 60 | 20 | 36 | 58 | ||||||||
Alopecurus myosuroides | 18 | 34 | 45 | 51 | 15 | 30 | 52 | 50 | 14 | 30 | 45 | 48 | ||||||
Avena fatua | 25 | 45 | 56 | 70 | 30 | 57 | 43 | 85 | 28 | 55 | 37 | 84 | ||||||
Digitaria sanguinalis | 32 | 50 | 58 | 70 | 30 | 45 | 70 | 75 | 34 | 50 | 68 | 76 | ||||||
*·- | Echinochloa crus-galli | 37 | 46 | 55 | 65 | 35 | 60 | 58 | 90 | 33 | 58 | 65 | 87 | |||||
O
COi |
Setaria faberii | 5 | 7 | 10 | 16 | 3 | 6 | 74 | 13 | 5 | 8 | 70 | 15 | |||||
co
OO CTB |
Stellaria media | 11 | 10 | |||||||||||||||
Wirkstoff | 0,25 | 0,75 | 1 | 0,25 | 0, | 1 | 0,25 | 0, | VIII | 1 | ||||||||
Ca» | kg/ha a. S. | O | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 5 0,75 | 0 | |||||||
co | Beta vulgaris | 0 | ||||||||||||||||
Alopecurus myosuroides Avena fatua Digitaria sanguinalis Echinochloa crus-galli
Setaria faberii Stellaria media
11 26 45 58
10 20 35 50
0 3 5 9
0 6 10 16
2 5 8 10
6 7 10 13
15 30 46 60
15 25 45 60
3 5 7 10
5 10 16 20
5 10 16 20
4 7 10 15
3 7 10 15
3 7 10 15
10 15 40 68
5 10 15 27
15 32 40 50
15 25 39 48
12 27 35 45
5 12 17 20
IS» co |
O m ca |
ro VD |
|
CD
LO |
VD
4=· |
Wirkstoff
kg/ha a. S.
kg/ha a. S.
I + VIII
0,75+ 0,25+ 0,25+ 0,25 0,25 0,75
ir + viii
0,75+ 0,25+ 0,25+ 0,25 0,25 0,73
:ύ + viii
5,75+ 0,25+ 0,25+ 0,25 0,25 0,75
Beta vulgarls | 0 | 0 | 0 | 0 | 0 | 0 | C | 0 | 0 | I | |
Alopecurus myosuroides | 90 | 60 | 92 | 96 | 64 | 9? | 30 | 60 | 88 | VjJ O I |
|
Avena fatua | 85 | '64 | 66 | 75 | 50 | 62 | VC | 62 | 65 | ||
Digitarla sangulnalis | 98 | 70 | 92 | 100 | 70 | 98 | 100 | 75 | 95 | ||
Echinochloa crus-galli | 96 | 75 | 98 | 100 | 72 | 96 | 100 | 73 | 100 | ||
Setaria faberii | 95 | 78 | 98 | 100 | 75 | 9S | 100 | 78 | 94 | ||
CX co> |
Stellaria media | 46 | 40 | 50 | 45 | 40 | 5- | 44 | 40 | 53 | |
885/ | Wirkstoff | II | + V | II + | VI | IV + | V | ||||
Beta vulgaris 0 0
Alopecurus myosuroides 93 63
84 50
Avena fatua
Digitaria sanguinalis | 98 | 60 | 68 |
Echinochloa crus-galli | 92 | 61 | 68 |
Setaria faberii | 97 . | 65 | 75 |
Stellaria media | 50 | 40 | 43 |
65 66 65 72 40
95 85 70 81 80 44
96 | 60 | 90 |
80 | 49 | 84 |
100 | 55 | 65 |
100 | 60 | 75 |
100 | 69 | 74 |
50 | 41 | 49 |
VjJ
O co co co OTE |
Wirkstoff | rv + | VI | 0,25+ 0,75 |
|
1338 | kg/ha a. S. | 0,75+ 0,25 |
0,25+ 0,25 |
0 | |
Beta vulgaris | 0 | 0 | 90 | ||
Γ | Alopecurus rayosuroides | 92 | 60 | 84 | |
Avena fatua | 80 | •65 | 66 | ||
Digitaria sanguinalis | 98 | 64 | 74 | ||
Echinochloa crus-galli | 98 | 70 | 65 | ||
Setaria faberii | 100 | 60 | 45 | ||
Stellaria media O = ohne Schädigung |
40 | ||||
100 = totale Schädigung | |||||
ro
1λ> | VO |
<jj | VC |
-P- | σ |
cn | |
CD | |
OJ |
- 32 - 0.2. 2? 964
Im Gewächshaus wurden verschiedene Pflanzen bei einer Wuchshöhe von 2 bis 15 cm mit folgenden Einzelwirkstoffen und deren
Mischungen als Emulsion behandelt:
I N,N-Di-(n-propyl)-2,6-dinitro-4-trifluormethylanilin
II N-n-Propyl-N-ß-chloräthyl-2,6-dinitro-4-trifluormethylanilin
IV N,N-Di- (n-propyl)-2,6-dinitro-4-aminosulfonylanilin
VII l-Phenyl-^amino-S-chlorpyridazon- (6)
VIII N-Äthyl-N-cyclohexylthiolcarbaminsäureäthylester
mit je 0,25, 0,5 und 1 kg/ha aktive Substanz
I+VII+VIII, II+VII+VIII und IV+VII+VIII
mit je 0,25+0,25+0,5, 0,25+0,5+0,25 und 0,5+0,25+0,25 kg/ha aktive Substanz.
Nach 2 bis 3 Wochen wurde festgestellt, daß die Mischungen
eine bessere herbizide Wirkung bei gleicher Verträglichkeit an der Kulturpflanze zeigten als die Einzelwirkstoffe.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen.
409885/1338
ot> cocn
v»
Wirkstoff kg/ha a. S.
0,25 0,5
II IV
0,25 0,5 1 0,25 0,5 1
Nutzpflanzen; Beta vulgaris
unerwünschte Pflanzen; Alopecurus myosuroides Avena fatua Echinochloa crus-galli
Stellaria media Raphanus raphanistrum
Wirkstoff
15 | 25 | 38 |
10 | 18 | 35 |
10 | 15 | 25 |
5 | 12 | 30 |
6 | 10 | 20 |
VII
Beta vulgar!s
Alopecurus myosuroides | 2 | 5 | 35 |
Avena fatua | 3 | Ul | 10 |
Echinochloa crus-galli | 10 | 15 | 25 |
Stellaria media | 10 | 20 | 40 |
Raphanus raphanistrum | 10 | 16 | 32 |
13 | 24 | 42 | 10 | 18 | 30 |
6 | 14 | 30 | Ul | 8 | 18 |
15 | 20 | 37 | 11 | 16 | 30 |
6 | 10 | 25 | VJl | 9 | 21 |
4 | 10 | 18 | 5 | 9 | 27 |
VIII
5 7 18
4 5 20
7 12 20
0 5 10
0 2 3
ro
οι cc»
ON -Pr
Wirkstoff | I + VII + VIII | ooo to to to ro ui ro Ul + UI + |
ooo to to to ro ro ui UlUl + |
II + | VII + | VIII | IV + | VII + | VIII | |
kg/ha a. S. | 0,25+ 0,25+ 0,5 |
0 | 0 | ooo to to to ui ro ro UiUi + + |
ooo to to to ro ui to U1 + U1 |
ooo to to to ro ro ui UlUl + + |
0,25+ 0,25+ 0,5 |
ooo to to to ro ui ro Ul + Ul |
0,5+ 0,25+ 0,25 |
|
Beta vulgaris | 0 | 64 | 70 | 0 | 0 | 0 | 0 | 0 | 0 | |
Alopecurus myosuroides | 63 | 60 | 63 | 60 | 62 | 70 | 60 | 57 | 63 | |
Avena fatua | 62 | 70 | 68 | 52 | 54 | 60 | 50 | 53 | 55 | |
Echinochloa crus-galli | 71 | 63 | 60 | 75 | 70 | 74 | 70 | 67 | 71 | |
Stellaria media | 60 | 64 | 58 | 59 | 65 | 58 | 60 | 62 | 57 | |
O co 00 00 cn |
Raphanus raphanistrum | 55 | 56 | 59 | 57 | 55 | 60 | 58 | ||
Ca> | O = ohne Schädigung | |||||||||
c*> QO- |
100 = totale Schädigung |
Ul
co
Nl
VO On
- 35 - C-.Z. 29 964
Im Gewächshaus wurden verschiedene Pflanzen bei einer Wuchshöhe von 2 bis 12 cm mit folgenden Einzelwirkstoffen und deren
Mischungen als öldispersion behandelt:
I N,N-Di-(n-propyl)-2,6-dinitro-4-trifluormethylanilin
II N-n-Propyl-N-ß-chloräthyl-2,6-dinitro-4-trifluormethylanilin
IV N,N-Di-(n-propyl)-2,6-dinitro-4-aminosulfonylanilin
V N,N-Diisopropyl-thiolcarbamins*äure-2,3-cliGhlorallylester
VI N,N-Diisopropyl-thiocarbaminsäure-^, 3,3-triehlorallylester
VII l-Phenyl-4-amino-5-chlorpyridazon-(6)
VIII N-Äthyl-N-cyclohexyl-thiolcarbaminsäureäthylester
mit je 0,25, 0,5, 0,75 und 1 kg/ha aktive Substanz
I+VIII, II+VIII, IV+VIII, II+V, IV+V, I+VII, II+VII und IV+VII
mit Je 0,25+0,75, 0,25+0,25, 0,75+0,25 kg/ha a. S.
Nach 2 bis 5 Wochen wurde festgestellt, daß die Mischungen
eine bessere herbizide Wirkung bei gleicher Verträglichkeit an der Kulturpflanze zeigten als die Einzelwirkstoffe.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen.
Λ0988Β/1338
Wirkstoff I II IV
kg/ha a. S. 0,25 0,5 0,75 1 0,25 0,5 0,75 1 0,25 0,5 0,75 1
Beta vulgaris 0000 0 000 0000
unerwünschte Pflanzen:
Alopecurus myosuroides | 15 | 25 | 30 | 38 | 13 | 24 | 35 | 42 | 10 | 18 | 23 | 30 |
Avena fatua | 10 | 18 | 25 | 35 | 6 | 14 | 20 | 30 | VJl | 8 | 11 | 18 |
Echinochloa crus-galli | 10 | 15 | 19 | 25 | 15 | 20 | 30 | 37 | 11 | 16 | 20 | 30 |
Stellaria media | VJl | 12 | 22 | 30 | 6 | 10 | 17 | 25 | VJl | 9 | 15 | 21 |
J£ Wirkstoff V VI VII
Beta vulgaris 0000 0000 0000
Alopecurus myosuroides
«v Avena fatua
Echinochloa crus-galli Stellaria media
Wirkstoff
10 | 0 | 20 | 25 | VIII | 0 | 0 | 35 | 0 | 7 | 13 | 20 | 30 | 2 | 5 | 15 | 35 |
10 | VJl | 15 | 24 | 7 | 10 | 35 | 18 | 10 | 18 | 25 | 35 | 3 | VJl | 8 | 10 | |
VJI | 4 | 10 | 18 | 5 | 12 | 25 | 20 | VJI | 15 | 20 | 25 | 10 | 15 | 20 | 25 | |
1 | 7 | 3 | VJl | 12 | 15 | 7 | 20 | 2 | 3 | VJl | 8 | 10 | 20 | 30 | 40 | |
0 | 5 | 7 | 10 | |||||||||||||
Beta vulgaris
Alopecurus myosuroides 5 7 10 18 InJ
Avena fatua 4 5 12 20 <*>
Echinochloa crus-galli -7 io ic ολ no
Stellaria media 0 5 7 10 *£}
CD σ\
Wirkstoff | I + VIII |
OO
te te ro ro UlUl |
0,75+ 0,25 |
II + | VIII | 0 | 0,75+ 0,25 |
IV + | VIII | 0 | 0 | - 0,75+ 0,25 |
co | Schädigung | |
kg/ha a. S. | 0,25+ 0,75 |
O | O | 0,25+ 0,25+ 0,75 0,25 |
46 | 0 |
oo
te te -3 ro UlUl OO te te ro ro UlUl 4. |
100 = | 46 | 0 | ohne Schädigung j>- | ||||
Beta vulgaris | O | 47 | 62 | 0 | 40 | 70 | 0 | 35 | 56 | totale | |||||
Alopecurus myosuroides | 50 | 44 | 58 | 53 | 51 | 52 | 48 | 54 | 42 | ||||||
Avena fatua | 48 | 45 | 52 | 45 | 29 | 64 | 45 | 36 | 56 | ||||||
Echinochloa crus-galli | 54 | 30 | 50 | 62 | VI | 48 | 55 | VII | 42 | ||||||
Stellaria media | 42 | V | 45 | 0 | 38 | 0 | |||||||||
O ca OO |
Wirkstoff | II + | O | 0 | IV + | 45 | 0 | I + | 45 | 0 | |||||
00 cn |
Beta vulgaris | 0 | 46 | 70 | 0 | 42 | 58 | 0 | 40 | 60 | |||||
Alopecurus myosuroides | 66 | 43 | 56 | 60 | 45 | 50 | 62 | 48 | 54 | ||||||
Ca> | Avena fatua | 57 | 50 | 63 | 57 | 35 | 53 | 44 | 46 | 59 | |||||
OO | Echinochloa crus-galli | 60 | 35 | 46 | 62 | VII | 45 | 60 | 65 | ||||||
Stellaria media | 40 | VII | 43 | 0 | 64 | ||||||||||
Wirkstoff | TI + | O | 0 | rv + | 41 | 0 | |||||||||
Beta vulgaris | 0 | 45 | 70 | 0 | 32 | 55 | |||||||||
Alopecurus myosuroides | 58 . | 38 | 52 | 54 | 40 | 41 | |||||||||
Avena fatua | 42 | 48 | 66 | 40 | 46 | 57 | |||||||||
Echinochloa crus-galli | 64 | 31 | 48 | 60 | 54 | ||||||||||
Stellaria media | 63 | 63 |
ro
VD
σ\
4=·
- 38 - O.Z. 29 964
Im Gewächshaus wurden Versuchsgefäße mit lehmigen Sandboden gefüllt und mit verschiedenen Samen besät. Danach wurde der so
vorbereitete Boden mit folgenden Einzelwirkstoffen und deren Mischungen als Dispersion oder Staub behandelt:
I N,N-Di-(n-propyl)-2,6-dinitro-4-trifluörmethylanilin
II N-n-Propyl-N-ß-chloräthyl-2,6-dinitro-4- trif luormethylanilin
III N-Allyl-N-ß-chloräthyl-2,6-dinitro-4-trifluormethylanilin
IV N,N-Di-(n-propyl)-2,6-dinitro-4-aminosulfonylanilin
V N,N-Diisopropyl-thiolcarbaminsäure-2,3-dichlorallylester
VI NjN-Diisopropyl-thiolcarbaminsäure^jJ^-trichlorallylester
VII l-Phenyl-4-amino-5-chlorpyridazon-(6)
mit je 0,5* 6 und 6,6 kg/ha aktive Substanz
I+VI+VII, II+VI+VII, III+VI+VII, IV+VI+VII, I+V+VII und II+V+VII
mit je 0,6+0,6+6,0, 0,6+6,0+0,6 und 6,0+0,6+0,6 kg/ha
aktive Substanz,
im Vergleich mit
IX N-p-Chlorphenyl-N',Nf-dimethylharnstoff
0,6, 6 und 6,6 kg/ha a. S.
IX+V+II
IX+V+II
0,6+0,6+6,0, 0,6+6,0+0,6 und 6+0,6+0,6 kg/ha a. S.
Nach 3 bis 4 Wochen wurde festgestellt, daß die Mischungen gegenüber dem Vergleichsprodukt IX und der Mischung IX+V+II
eine bessere Verträglichkeit an der Kulturpflanze zeigten.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen.
409885/1338
ca a> oo cn
CaX Ca>
ot>
Wirkstoff | 0,6 | O | I | 6,6 | 0,6 | II | 6,6 | 0,6 | III | 6,6 | 0,6 | IV | 6,6 |
kg/ha a. S. | 33 | 6,0 | 6,0 | 6,0 | 6,0 | ||||||||
Nutzpflanze: | O | 28 | 60 | 0 | 55 | 0 | 50 | 0 | 55 | ||||
Beta vulgaris | 5 | 55 | 50 | 45 | 53 | ||||||||
unerwünschte Pflanzen: | 48 | 10 | 100 | 45 | 100 | 41 | 100 | 40 | 100 | ||||
Alopecurus myosuroides | 40 | 7 | 100 | 100 | 35 | 100 | 100 | 30 | 100 | 100 | 33 | 100 | 100 |
Avena fatua | 52 | 8 | 100 | 100 | 63 | 100 | 100 | 57 | 100 | 100 | 58 | 100 | 100 |
Digitaria sanguinalis | 53 | 100 | 100 | 49 | 100 | 100 | 45 | 100 | 100 | 52 | 100 | 100 | |
Echinochloa crus-galli | 54 | 100 | 100 | 70 | 100 | 100 | 40 | 100 | 100 | 60 | 100 | 100 | |
Setaria faberii | 7 | 100 | 70 | 10 | 100 | 70 | 11 | 100 | 72 | 10 | 100 | 72 | |
Stellaria media | 67 | 65 | 70 | 65 | |||||||||
Wirkstoff | V | 28 | 0 | VI | 30 | 0 | VII | 23 | |||||
Beta vulgaris | 23 | 100 | 35 | 25 | 100 | 7 | 20 | 100 | |||||
Alopecurus myosuroides | 100 | 100 | 30 | 100 | 100 | 3 | 95 | 95 | |||||
Avena fatua | 100 | 50 | 7 | 100 | 59 | 5 | 90 | 100 | |||||
Digitaria sanguinalis | 48 | 62 | 12 | 54 | 75 | 14 | 100 | 100 | |||||
Echinochloa crus-galli | 60 | 54 | 10 | 68 | 60 | 24 | 90 | 100 | |||||
Setaria faberii | 50 | 63 | 9 | 58 | 68 | 22 | 100 | 100 | |||||
Stellaria media | 60 | 65 | 100 | ||||||||||
VjJ VO
-F=- O
O | |
!si | |
CO | * |
CO | ro |
-Ο« | |
cn | VD |
CD | σ\ |
CO | Jt= |
OO
QO
CJT
Ca>
OO
Wirkstoff
kg/ha a. S.
kg/ha a. S.
I+VI+VII
0,6+ 0,6+ 6,0+ 0,6+ 6,0+ 0,6+ 6,0 0,6 0,6
II+VI+VII
0,6+ 0,6+ 6,0+ 0,6+ 6,0+ 0,6+ 6,0 0,6 0,6
III+VI+VII
0,6+ 0,6+ 6,0+
0,6+ 6,0+ 0,6+
6,0 0,6 0,6
0,6+ 6,0+ 0,6+
6,0 0,6 0,6
IV+VI+VII
0,6+ 0,6+ 6,0+ 0,6+ 6,0+ 0,6+ 6,0 0,6 0,6
Beta vulgaris | 20 | 25 | 0,6+ 6,0+ 0,6 |
55 | 20 | 25 | 0,6+ 6,0+ 0,6 |
50 | 20 | 25 | 45 | 20 | 25 | 0,6+ 6,0+ 0,6 |
53 | -t=· O |
Alopecurus myosuroldes | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | ||||
Avena fatua | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | ||||
Digitaria sanguinalis | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | ||||
Echinochloa crus-galli | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | ||||
Setaria faberii | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | ||||
Stellaria media | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | 100 | ||||
Wirkstoff | I+V+VII | II+V+VII | IX | IX+V+II | ||||||||||||
kg/ha a. S. | 0,6+ 0,6+ 6,0 |
6,0+ 0,6+ 0,6 |
0,6+ 0,6+ 6,0 |
6,0+ 0,6+ 0,6 |
0,6 | 6,0 | 6t6 | 0,6+ 0,6+ 6,0 |
6,0+ 0,6+ 0,6 |
|||||||
Beta vulgaris
Alopecurus myosuroides
Digitaria sanguinalis
Avena fatua
Echinochloa crus-galll
Setaria faberii
Stellaria media
Digitaria sanguinalis
Avena fatua
Echinochloa crus-galll
Setaria faberii
Stellaria media
20 23 55
100 100 100
100 100 100
100 100 100
100 100 100
100 100 100
100 100 100
20 23 50
100 100 100
100 100 100
100 100 100
100 100 100
100 100 100
100 100 100
20 100 100 100 40 70
50 | 100 | 100 | 100 | 100 | 100 | K) | O N |
45 | 100 | 100 | 100 | 100 | 100 | 334563 | ro VO VO σ^ -Pr |
46 | 100 | 100 | 100 | 100 | 100 | ||
57 | 100 | 100 | 100 | 100 | 100 | ||
52 60 |
100 100 |
100 100 |
100 100 |
100 100 |
100 100 |
||
- 41 - O.Z. 29 S<64
Im Gewächshaus wurden Versuchsgefäße mit lehmigen Sandboden gefüllt und mit verschiedenen Samen besät. Danach wurde der
so vorbereite Boden mit folgenden Einzelwirkstoffen und deren Mischungen als Emulsion-Dispersion-Tankmix behandelt:
I N,N-Di-n-propyl-2,6-dinitro-4-trifluormethylanilin
II N-n-Propyl-N-ß-chloräthyl-2,6-dinitro-4-trifluormethylanilin
VII l-Phenyl-4-amino-5-chlorpyridazon-(6)
IX N-Phenylcarbaminsäure-isopropylester mit je 0,5, 1 und 2 kg/ha a. S.
I+VII+IX, II+VII+IX
mit je 1+0,5+0,5* 0,5+1+0,5, 0,5+0,5+1 kg/ha a. S.
Nach 3 bis 4 Wochen wurde festgestellt, daß die Mischungen
eine bessere herbizide Wirkung bei gleicher Verträglichkeit an der Kulturpflanze zeigten als die Wirkstoffe I, II, VII
und IX.
Das Versuchsergebnis ist aus nachfolgender Tabelle zu ersehen.
5/1338
Wirkstoff | I | 0,5 | 0,5+ 0,5+ 1 |
II | 0,; | 10 | 0,5+ 1+ 0,5 |
VII | 2 | 0,5 | IX | 2 | |
kg/ha a. S. | 0,5 1 2 | 1 2 | 30 | 5 1 | 1 | ||||||||
Nutzpflanze: | 0 | 0 | 0 | 20 | 0 | 0 | 0 | 0 | |||||
Beta vulgaris | 0 0 0 | 100 | 0 0 | II+VII+IX | 100 | 0 | 0 | ||||||
unerwünschte Pflanzen: | 40 | 100 | 60 100 2 | 1+ 0,5+ 0,5 |
100 | 20 | 35 | 100 | |||||
Alopecurus myosuroides | 41 63 95 | 45 | 100 | 75 80 | 100 | 15 | 40 | 11 | 56 | 40 | |||
Echinochloa crus-galli | 50 70 90 | 0 | 80 | 0 0 | 0 | 92 | 20 | 80 | 18 | 18 | 78 | ||
Matricaria chamomilla | 0 0 0 | 6 | 13 25 | 100 | 50 | 80 | 0 | 40 | 10 | ||||
O co. 00 |
Stellaria media | 7 16 30 | 100 | 45 | 5 | ||||||||
00 OT. |
Wirkstoff | I+VII+IX | 91 | ||||||||||
<*> | kg/ha a. S. | 1+ 0,5+ 0,5+ 1+ 0,5 0,5 |
80 | 0,5+ 0,5+ 1 |
|||||||||
OO | |||||||||||||
Beta vulgaris | 0 0 | 0 | |||||||||||
Alopecurus myosuroides | 100 100 | 100 | |||||||||||
Echinochloa crus-galli | 100 100 | 100 | |||||||||||
Matricarla chamomilla | 90 100 | 100 | |||||||||||
Stellaria media | 75 96 | 76 | |||||||||||
0 = ohne Schädigung 100 = totale Schädigung
ο | |
N | |
co co |
η VO |
-P- cn |
V.O er. |
CD | |
co |
- 43 - O.Z. 29 964
Im Gewächshaus wurden verschiedene Pflanzen bei einer Wuchshöhe von 2 bis 8 cm mit folgenden Einzelwirkstoffen und deren
Mischungen als Emulsion-Dispersion-Tankmix behandelt:
II N-n-Propyl-N-ß-chloräthyl-2,6-dinitro-4-trifluormethyl-
anllin VII l-Phenyl-^amino^-chlorpyridazon- (6)
X N^-Chloi^henyl-earbaminsäure^-chlor-butin^-yl-l-ester
XI 3-Methoxycarbonylaminophenyl-N-(3'-methylphenyl)-carbamat
mit je 0,5, 1 und 2 kg/ha a. S.
II+VII+X und XI+VII+II
mit je 1+0,5+0,5» 0,5+1+0,5, 0,5+0,5+1 kg/ha aktive Substanz.
Nach 10 bis 14 Tagen wurde festgestellt, daß die Mischungen
eine bessere herbizide Wirkung bei gleicher Verträglichkeit an der Kulturpflanze zeigten als die Einzelwirkstoffe.
Das Versuchsergebnis ist aus der nachfolgenden Tabelle zu ersehen.
409885/1338 /44
Wirkstoff | 0,5 | II | 2 | 0,5 | VII | 2 | 0,5 | X | 2 | 0,5 | XI | 2 |
kg/ha a. S. | 1 | 1 | 1 | 1 | ||||||||
Nutzpflanze: | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 20 | ||||
Beta vulgaris | 0 | 0 | 0 | 0 | ||||||||
unerwünschte Pflanzen: | 10 | 54 | 10 | 22 | 30 | 90 | 3 | 30 | ||||
Avena fatua | 7 | 30 | 47 | 35 | 12 | 60 | 6 | 70 | 20 | 20 | 20 | 80 |
Matricaria chamomilla | 8 | 25 | 50 | 30 | 45 | 80 | 6 | 10 | 30 | 45 | 30 | 95 |
Stellaria media | 25 | 40 | 10 | 60 | ||||||||
2 Wirkstoff II+VII+X II+VII+XI
oo kg/ha a. S. 1+ 0,5+ 0,5+ 1+ 0,5+ 0,5+
00 0,5+ 1+ 0,5+ 0,5+ 1+ 0,5+
^ 0,5 0,5 1 0,5 0,5 1
0^ Beta vulgaris 0 0 0 0 0 0
Avena fatua Matricaria chamomilla Stellaria media
0 = ohne Schädigung 100 = totale Schädigung
100 | 95 | 100 | 80 | 68 | 82 |
100 | 100 | 90 | 100 | 100 | 100 |
98 | 97 | 90 | 100 | 100 | 100 |
233 | C N· |
cn | VO |
CO | VO ON |
Claims (1)
- Patentanspruchin der X niederes Alkyl, Halogenalkyl, Alkylsulfonyl, Methoxy, Aminosulfonyl, Y Wasserstoff oder Amino, R1 einen Tetrahydrofurfurylrest, Cyclopropylrest oder den Cyclopropylmethylrest oder einen gegebenenfalls durch Halogen oder Alkoxy substituierten niederen Alkyl-, Alkenyl- oder Alkinylrest, R einen Alkoxyalkylrest oder Propionmethylamidrest oder einen gegebenenfalls durch Halogen substituierten niederen Alkyl-, Alkenyl- oder Alkinylrest bedeutetundb) einer Verbindung der Formel1^N-C-A-R0 Xin der R Alkyl, Alkenyl, Alkinyl, Bi- oder Tricycloalkyl, einen gegebenenfalls durch Halogen oder Alkyl substituierten Phenyl- oder Cycloalkylrest, R1 Wasserstoff, einen aliphatischen Rest bis 4 C-Atome, R2 einen gegebenenfalls durch Halogen oder Alkoxy substituierten Alkyl-, Alkenyl-, Alkinylrest, einen gegebenenfalls durch Halogen, Halogenalkyl, Alkyl, Alkoxy substituierten Phenyl- oder Benzylrest, 3-Methoxycarbonylaminophenylrest oder den Rest -N=CCIq1J? , A Sauerstoff oder Schwefel, X Sauerstoff oder Schwefel ^und/oderc) einer Verbindung der Formel409885/1338 /460.3. 29 964in der X Amino oder a~Hydroxy-ß,ß,ß-trichloräthylamino, Y Chlor, Brom bedeutet.BASF Aktiengesellschaft/,09885/1338
Priority Applications (26)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DE19732334563 DE2334563A1 (de) | 1973-07-07 | 1973-07-07 | Herbizid |
BG26996A BG22056A3 (de) | 1973-07-07 | 1974-06-17 | |
BG028827A BG25636A3 (bg) | 1973-07-07 | 1974-06-17 | Хербицидно средство |
AR254225A AR217032A1 (es) | 1973-07-07 | 1974-06-17 | Composicion herbicida de accion sinergica selectiva |
IL45060A IL45060A (en) | 1973-07-07 | 1974-06-18 | Herbicidal compositions containing a dinitroaniline derivative and a carbamate thiolcarbamate or dithiocarbamate and/or a pyridazone derivative |
AU70287/74A AU489388B2 (en) | 1973-07-07 | 1974-06-20 | Herbicide |
JP49071970A JPS5036636A (de) | 1973-07-07 | 1974-06-25 | |
RO7479338A RO69333A (ro) | 1973-07-07 | 1974-06-28 | Compozitie erbicida sinergetica |
ZA00744217A ZA744217B (en) | 1973-07-07 | 1974-07-01 | Herbicides |
NO742394A NO742394L (de) | 1973-07-07 | 1974-07-01 | |
FR7423307A FR2235645B1 (de) | 1973-07-07 | 1974-07-04 | |
BR5534/74A BR7405534D0 (pt) | 1973-07-07 | 1974-07-04 | Composicoes herbicidas a base de uma mistura de substancias ativas |
NL7409071A NL7409071A (nl) | 1973-07-07 | 1974-07-04 | Werkwijze voor het bereiden van herbiciden. |
SE7408882A SE7408882L (de) | 1973-07-07 | 1974-07-05 | |
BE146264A BE817305A (fr) | 1973-07-07 | 1974-07-05 | Nouvelles compositions herbicides selectives |
CS744807A CS189658B2 (en) | 1973-07-07 | 1974-07-05 | Herbicide agent |
LU70472A LU70472A1 (de) | 1973-07-07 | 1974-07-05 | |
PL1974172460A PL94007B1 (de) | 1973-07-07 | 1974-07-05 | |
IT51942/74A IT1049296B (it) | 1973-07-07 | 1974-07-05 | Diserbante |
GB2987074A GB1471772A (en) | 1973-07-07 | 1974-07-05 | Herbicide |
DK361174A DK137742C (da) | 1973-07-07 | 1974-07-05 | Herbicid |
DD179738A DD111778A5 (de) | 1973-07-07 | 1974-07-05 | |
SU7402042434A SU579844A3 (ru) | 1973-07-07 | 1974-07-05 | Гербицидный состав |
HUBA3109A HU169820B (de) | 1973-07-07 | 1974-07-05 | |
CH926774A CH585005A5 (de) | 1973-07-07 | 1974-07-05 | |
ES428035A ES428035A1 (es) | 1973-07-07 | 1974-07-06 | Procedimiento para preparar herbicidas a base de derivados de dinitroanilina. |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DE19732334563 DE2334563A1 (de) | 1973-07-07 | 1973-07-07 | Herbizid |
Publications (1)
Publication Number | Publication Date |
---|---|
DE2334563A1 true DE2334563A1 (de) | 1975-01-30 |
Family
ID=5886189
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE19732334563 Withdrawn DE2334563A1 (de) | 1973-07-07 | 1973-07-07 | Herbizid |
Country Status (24)
Country | Link |
---|---|
JP (1) | JPS5036636A (de) |
AR (1) | AR217032A1 (de) |
BE (1) | BE817305A (de) |
BG (2) | BG25636A3 (de) |
BR (1) | BR7405534D0 (de) |
CH (1) | CH585005A5 (de) |
CS (1) | CS189658B2 (de) |
DD (1) | DD111778A5 (de) |
DE (1) | DE2334563A1 (de) |
DK (1) | DK137742C (de) |
ES (1) | ES428035A1 (de) |
FR (1) | FR2235645B1 (de) |
GB (1) | GB1471772A (de) |
HU (1) | HU169820B (de) |
IL (1) | IL45060A (de) |
IT (1) | IT1049296B (de) |
LU (1) | LU70472A1 (de) |
NL (1) | NL7409071A (de) |
NO (1) | NO742394L (de) |
PL (1) | PL94007B1 (de) |
RO (1) | RO69333A (de) |
SE (1) | SE7408882L (de) |
SU (1) | SU579844A3 (de) |
ZA (1) | ZA744217B (de) |
Families Citing this family (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPS5520919A (en) * | 1978-07-31 | 1980-02-14 | Nihon Radiator Co | Parts connecting method to aluminium pipe |
DE2909158A1 (de) * | 1979-03-08 | 1980-09-11 | Basf Ag | Herbizide mischungen |
PT82293B (en) * | 1985-04-08 | 1988-01-11 | Stauffer Chemical Co | Process for the preparation of synergetic herbicide compositions containing a tiolcarbamate and a by product with benzene |
Family Cites Families (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3449111A (en) * | 1966-12-08 | 1969-06-10 | Lilly Co Eli | Method of eliminating weeds |
US3518076A (en) * | 1967-05-17 | 1970-06-30 | Lilly Co Eli | Method of fliminating weed species with herbicidal combination |
-
1973
- 1973-07-07 DE DE19732334563 patent/DE2334563A1/de not_active Withdrawn
-
1974
- 1974-06-17 BG BG028827A patent/BG25636A3/xx unknown
- 1974-06-17 AR AR254225A patent/AR217032A1/es active
- 1974-06-17 BG BG26996A patent/BG22056A3/xx unknown
- 1974-06-18 IL IL45060A patent/IL45060A/en unknown
- 1974-06-25 JP JP49071970A patent/JPS5036636A/ja active Pending
- 1974-06-28 RO RO7479338A patent/RO69333A/ro unknown
- 1974-07-01 NO NO742394A patent/NO742394L/no unknown
- 1974-07-01 ZA ZA00744217A patent/ZA744217B/xx unknown
- 1974-07-04 BR BR5534/74A patent/BR7405534D0/pt unknown
- 1974-07-04 NL NL7409071A patent/NL7409071A/xx not_active Application Discontinuation
- 1974-07-04 FR FR7423307A patent/FR2235645B1/fr not_active Expired
- 1974-07-05 BE BE146264A patent/BE817305A/xx unknown
- 1974-07-05 LU LU70472A patent/LU70472A1/xx unknown
- 1974-07-05 CH CH926774A patent/CH585005A5/xx not_active IP Right Cessation
- 1974-07-05 DK DK361174A patent/DK137742C/da not_active IP Right Cessation
- 1974-07-05 CS CS744807A patent/CS189658B2/cs unknown
- 1974-07-05 PL PL1974172460A patent/PL94007B1/pl unknown
- 1974-07-05 IT IT51942/74A patent/IT1049296B/it active
- 1974-07-05 SE SE7408882A patent/SE7408882L/xx unknown
- 1974-07-05 HU HUBA3109A patent/HU169820B/hu unknown
- 1974-07-05 SU SU7402042434A patent/SU579844A3/ru active
- 1974-07-05 DD DD179738A patent/DD111778A5/xx unknown
- 1974-07-05 GB GB2987074A patent/GB1471772A/en not_active Expired
- 1974-07-06 ES ES428035A patent/ES428035A1/es not_active Expired
Also Published As
Publication number | Publication date |
---|---|
BR7405534D0 (pt) | 1975-05-06 |
BG22056A3 (de) | 1976-11-25 |
CH585005A5 (de) | 1977-02-28 |
ZA744217B (en) | 1975-08-27 |
AR217032A1 (es) | 1980-02-29 |
SU579844A3 (ru) | 1977-11-05 |
CS189658B2 (en) | 1979-04-30 |
IL45060A0 (en) | 1974-09-10 |
IL45060A (en) | 1977-10-31 |
JPS5036636A (de) | 1975-04-05 |
GB1471772A (en) | 1977-04-27 |
BE817305A (fr) | 1975-01-06 |
LU70472A1 (de) | 1974-11-28 |
DK137742B (da) | 1978-05-01 |
FR2235645B1 (de) | 1978-07-07 |
DK137742C (da) | 1978-10-09 |
HU169820B (de) | 1977-02-28 |
NL7409071A (nl) | 1975-01-09 |
SE7408882L (de) | 1975-01-08 |
NO742394L (de) | 1975-02-03 |
PL94007B1 (de) | 1977-07-30 |
AU7028774A (en) | 1976-01-08 |
DD111778A5 (de) | 1975-03-12 |
IT1049296B (it) | 1981-01-20 |
ES428035A1 (es) | 1977-02-01 |
DK361174A (de) | 1975-02-24 |
FR2235645A1 (de) | 1975-01-31 |
RO69333A (ro) | 1980-06-15 |
BG25636A3 (bg) | 1978-11-10 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE2324592A1 (de) | Substituierte benzofuranylester | |
DE2546845A1 (de) | Substituierte 2-(chinolyl-xy)- und 2-(isochinolyl-oxy)-carbonsaeurederivate | |
DE2341594A1 (de) | Herbizid | |
DE2349114C2 (de) | 3-sek.-Butyl-2,1,3-benzothiadiazin-(4)-on-2,2-dioxid | |
DE2417764A1 (de) | O-aminosulfonyl-glykolsaeureanilide | |
DE2334563A1 (de) | Herbizid | |
DE2310757A1 (de) | Substituierte o-(aminosulfonyl)glykolsaeureanilide | |
DE2334787A1 (de) | Herbizid | |
DE2526643A1 (de) | Substituierte pyridazone | |
DE2343293A1 (de) | Herbizid | |
DE2312045A1 (de) | Carbothiolate | |
DE2425668C3 (de) | Herbizides Mittel auf Benzothiadiazinondioxid-Basis | |
DE2404795A1 (de) | Pyrazoliumsalze | |
DE2453908A1 (de) | Herbizide mischungen | |
CH615087A5 (de) | ||
US3992188A (en) | Herbicidal mixtures of pyridazones and phenylsulfonyl methanesulfone O-alkylbenzene | |
US4165977A (en) | Herbicidal compositions | |
DE2411900A1 (de) | Verfahren zur bekaempfung unerwuenschter pflanzen | |
DE2311661A1 (de) | Verfahren zur bekaempfung unerwuenschter pflanzen | |
DE2333397A1 (de) | Carbothiolate substituierter azepine | |
DE2336444A1 (de) | Herbizid | |
DE2341629A1 (de) | Herbizid | |
DE2457688A1 (de) | Carbaminsaeurethiolester | |
DE2460474A1 (de) | Herbizide mischung | |
DE2334601A1 (de) | Thiolcarbamate |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
8130 | Withdrawal |