DE2401924A1 - Verfahren zur herstellung von symmetrischen 1:2 chromkomplexen aus azofarbstoffen - Google Patents
Verfahren zur herstellung von symmetrischen 1:2 chromkomplexen aus azofarbstoffenInfo
- Publication number
- DE2401924A1 DE2401924A1 DE2401924A DE2401924A DE2401924A1 DE 2401924 A1 DE2401924 A1 DE 2401924A1 DE 2401924 A DE2401924 A DE 2401924A DE 2401924 A DE2401924 A DE 2401924A DE 2401924 A1 DE2401924 A1 DE 2401924A1
- Authority
- DE
- Germany
- Prior art keywords
- azo dyes
- chromium
- amino
- oxalate
- sulfonic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 13
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical class [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 title claims description 7
- 239000000987 azo dye Substances 0.000 claims description 15
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 claims description 11
- UBFMILMLANTYEU-UHFFFAOYSA-H chromium(3+);oxalate Chemical compound [Cr+3].[Cr+3].[O-]C(=O)C([O-])=O.[O-]C(=O)C([O-])=O.[O-]C(=O)C([O-])=O UBFMILMLANTYEU-UHFFFAOYSA-H 0.000 claims description 6
- 229910052804 chromium Inorganic materials 0.000 claims description 5
- 239000000243 solution Substances 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 3
- 239000011541 reaction mixture Substances 0.000 claims description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000012429 reaction media Substances 0.000 claims description 2
- 125000000565 sulfonamide group Chemical group 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 150000001844 chromium Chemical class 0.000 description 5
- 239000011651 chromium Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 238000001465 metallisation Methods 0.000 description 4
- -1 sulfo, sulfonamido Chemical group 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- RXCMFQDTWCCLBL-UHFFFAOYSA-N 4-amino-3-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(N)=C(O)C=C(S(O)(=O)=O)C2=C1 RXCMFQDTWCCLBL-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000004532 chromating Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 235000006408 oxalic acid Nutrition 0.000 description 3
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 150000001845 chromium compounds Chemical class 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 235000002639 sodium chloride Nutrition 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- VLZVIIYRNMWPSN-UHFFFAOYSA-N 2-Amino-4-nitrophenol Chemical compound NC1=CC([N+]([O-])=O)=CC=C1O VLZVIIYRNMWPSN-UHFFFAOYSA-N 0.000 description 1
- DOPJTDJKZNWLRB-UHFFFAOYSA-N 2-Amino-5-nitrophenol Chemical compound NC1=CC=C([N+]([O-])=O)C=C1O DOPJTDJKZNWLRB-UHFFFAOYSA-N 0.000 description 1
- WLJLENRIPLYJSZ-UHFFFAOYSA-N 2-amino-4-(2-methylbutan-2-yl)-6-nitrophenol Chemical compound CCC(C)(C)C1=CC(N)=C(O)C([N+]([O-])=O)=C1 WLJLENRIPLYJSZ-UHFFFAOYSA-N 0.000 description 1
- SWFNPENEBHAHEB-UHFFFAOYSA-N 2-amino-4-chlorophenol Chemical compound NC1=CC(Cl)=CC=C1O SWFNPENEBHAHEB-UHFFFAOYSA-N 0.000 description 1
- DHXPRBHRJQAXHK-UHFFFAOYSA-N 4-amino-3-hydroxy-7-nitronaphthalene-1-sulfonic acid Chemical compound [O-][N+](=O)C1=CC=C2C(N)=C(O)C=C(S(O)(=O)=O)C2=C1 DHXPRBHRJQAXHK-UHFFFAOYSA-N 0.000 description 1
- DQIVFTJHYKDOMZ-UHFFFAOYSA-N 96-67-3 Chemical compound NC1=CC([N+]([O-])=O)=CC(S(O)(=O)=O)=C1O DQIVFTJHYKDOMZ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000005236 alkanoylamino group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229950011260 betanaphthol Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- QELUYTUMUWHWMC-UHFFFAOYSA-N edaravone Chemical compound O=C1CC(C)=NN1C1=CC=CC=C1 QELUYTUMUWHWMC-UHFFFAOYSA-N 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000009938 salting Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
- C09B45/01—Complex metal compounds of azo dyes characterised by the method of metallisation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH69073 | 1973-01-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2401924A1 true DE2401924A1 (de) | 1974-07-25 |
Family
ID=4192881
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2401924A Pending DE2401924A1 (de) | 1973-01-18 | 1974-01-16 | Verfahren zur herstellung von symmetrischen 1:2 chromkomplexen aus azofarbstoffen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3941765A (enExample) |
| JP (1) | JPS5052123A (enExample) |
| DE (1) | DE2401924A1 (enExample) |
| FR (1) | FR2214732B1 (enExample) |
| GB (1) | GB1415622A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3705646A1 (de) * | 1987-02-21 | 1988-09-01 | Basf Ag | Chromkomplexfarbstoff |
| US8206750B2 (en) * | 2005-03-24 | 2012-06-26 | Cerenis Therapeutics Holding S.A. | Charged lipoprotein complexes and their uses |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2906746A (en) * | 1959-09-29 | Metalliferous azo dyestuffs | ||
| US1918938A (en) * | 1930-11-14 | 1933-07-18 | Soc Of Chemical Ind | Azo-dyestuffs containing chromium and process of making same |
| US2829139A (en) * | 1953-10-30 | 1958-04-01 | Gen Aniline & Film Corp | Metalliferous azo dyestuff |
| US2921061A (en) * | 1956-06-05 | 1960-01-12 | Geigy Ag J R | Azo dyestuffs containing chromium bound in complex linkage |
| US2891938A (en) * | 1957-03-29 | 1959-06-23 | Geigy Ag J R | Chromium-containing monoazo dyestuffs |
| US3185676A (en) * | 1960-08-12 | 1965-05-25 | Gen Aniline & Film Corp | Method of azo dye chromation |
-
1973
- 1973-11-17 JP JP48128813A patent/JPS5052123A/ja active Pending
-
1974
- 1974-01-08 FR FR7400599A patent/FR2214732B1/fr not_active Expired
- 1974-01-10 US US05/433,012 patent/US3941765A/en not_active Expired - Lifetime
- 1974-01-16 GB GB199074A patent/GB1415622A/en not_active Expired
- 1974-01-16 DE DE2401924A patent/DE2401924A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| FR2214732B1 (enExample) | 1976-11-26 |
| JPS5052123A (enExample) | 1975-05-09 |
| FR2214732A1 (enExample) | 1974-08-19 |
| GB1415622A (en) | 1975-11-26 |
| US3941765A (en) | 1976-03-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2401924A1 (de) | Verfahren zur herstellung von symmetrischen 1:2 chromkomplexen aus azofarbstoffen | |
| DE2006170A1 (de) | Azofarbstoffe, ihre Herstellung und Verwendung | |
| EP0187621A2 (de) | Verfahren zur Herstellung von metallisierbaren Azofarbstoffen | |
| DE3841038C2 (enExample) | ||
| DE3841037C2 (enExample) | ||
| DE925904C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE1224421B (de) | Verfahren zur Herstellung chromhaltiger Azo- oder Azomethinfarbstoffe | |
| CH273302A (de) | Verfahren zur Herstellung eines metallhaltigen Monoazofarbstoffes. | |
| DE2503654C2 (de) | Neuer sulfonierter Triazofarbstoff | |
| DE567524C (de) | Verfahren zur Darstellung von Azofarbstoffen | |
| DE659840C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE2457589A1 (de) | Neue metallkomplexfarbstoffe, deren herstellung und verwendung | |
| CH287116A (de) | Verfahren zur Herstellung eines chromhaltigen Azofarbstoffes. | |
| CH287095A (de) | Verfahren zur Herstellung eines chromhaltigen Azofarbstoffes. | |
| CH86685A (de) | Verfahren zur Herstellung eines chromhaltigen sauren Farbstoffs. | |
| CH287106A (de) | Verfahren zur Herstellung eines chromhaltigen Azofarbstoffes. | |
| CH233086A (de) | Verfahren zur Darstellung eines chromierbaren Monoazofarbstoffes. | |
| CH233085A (de) | Verfahren zur Darstellung eines chromierbaren Monoazofarbstoffes. | |
| DE1061922B (de) | Verfahren zur Herstellung von Schwermetallkomplexverbindungen von Azofarbstoffen | |
| CH303886A (de) | Verfahren zur Herstellung eines metallhaltigen Azofarbstoffes. | |
| CH307198A (de) | Verfahren zur Herstellung eines metallhaltigen Azofarbstoffes. | |
| CH287091A (de) | Verfahren zur Herstellung eines chromhaltigen Azofarbstoffes. | |
| CH303880A (de) | Verfahren zur Herstellung eines metallhaltigen Azofarbstoffes. | |
| CH287094A (de) | Verfahren zur Herstellung eines chromhaltigen Azofarbstoffes. | |
| CH300458A (de) | Verfahren zur Herstellung eines metallhaltigen Azofarbstoffes. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |