DE2364320A1 - Leuchtstoffe aus oxysulfiden seltener erden - Google Patents
Leuchtstoffe aus oxysulfiden seltener erdenInfo
- Publication number
- DE2364320A1 DE2364320A1 DE2364320A DE2364320A DE2364320A1 DE 2364320 A1 DE2364320 A1 DE 2364320A1 DE 2364320 A DE2364320 A DE 2364320A DE 2364320 A DE2364320 A DE 2364320A DE 2364320 A1 DE2364320 A1 DE 2364320A1
- Authority
- DE
- Germany
- Prior art keywords
- flux
- phosphor
- alkali metal
- oxide
- metal ion
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229910052761 rare earth metal Inorganic materials 0.000 title claims description 22
- 150000002910 rare earth metals Chemical class 0.000 title claims description 14
- 230000004907 flux Effects 0.000 claims description 55
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 43
- 239000000203 mixture Substances 0.000 claims description 37
- 239000011734 sodium Substances 0.000 claims description 22
- 239000000047 product Substances 0.000 claims description 21
- 239000000463 material Substances 0.000 claims description 20
- 239000013078 crystal Substances 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 17
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 13
- 229910052744 lithium Inorganic materials 0.000 claims description 13
- 238000010438 heat treatment Methods 0.000 claims description 12
- 238000004519 manufacturing process Methods 0.000 claims description 12
- 229910001413 alkali metal ion Inorganic materials 0.000 claims description 11
- -1 preslodymium Chemical compound 0.000 claims description 11
- 229910005793 GeO 2 Inorganic materials 0.000 claims description 10
- 229910004298 SiO 2 Inorganic materials 0.000 claims description 10
- 229910001404 rare earth metal oxide Inorganic materials 0.000 claims description 8
- 229910052693 Europium Inorganic materials 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 6
- UAHZTKVCYHJBJQ-UHFFFAOYSA-N [P].S=O Chemical compound [P].S=O UAHZTKVCYHJBJQ-UHFFFAOYSA-N 0.000 claims description 6
- 229910052700 potassium Inorganic materials 0.000 claims description 6
- 239000011591 potassium Substances 0.000 claims description 6
- 229910052708 sodium Inorganic materials 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 6
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 claims description 5
- 238000005245 sintering Methods 0.000 claims description 5
- 239000007795 chemical reaction product Substances 0.000 claims description 4
- 230000007935 neutral effect Effects 0.000 claims description 4
- 229910052727 yttrium Inorganic materials 0.000 claims description 4
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 claims description 4
- 229910052688 Gadolinium Inorganic materials 0.000 claims description 3
- 229910052692 Dysprosium Inorganic materials 0.000 claims description 2
- 229910052691 Erbium Inorganic materials 0.000 claims description 2
- 229910052689 Holmium Inorganic materials 0.000 claims description 2
- 229910052765 Lutetium Inorganic materials 0.000 claims description 2
- 229910052779 Neodymium Inorganic materials 0.000 claims description 2
- 229910052772 Samarium Inorganic materials 0.000 claims description 2
- 229910052771 Terbium Inorganic materials 0.000 claims description 2
- 229910052775 Thulium Inorganic materials 0.000 claims description 2
- KBQHZAAAGSGFKK-UHFFFAOYSA-N dysprosium atom Chemical compound [Dy] KBQHZAAAGSGFKK-UHFFFAOYSA-N 0.000 claims description 2
- UYAHIZSMUZPPFV-UHFFFAOYSA-N erbium Chemical compound [Er] UYAHIZSMUZPPFV-UHFFFAOYSA-N 0.000 claims description 2
- UIWYJDYFSGRHKR-UHFFFAOYSA-N gadolinium atom Chemical compound [Gd] UIWYJDYFSGRHKR-UHFFFAOYSA-N 0.000 claims description 2
- KJZYNXUDTRRSPN-UHFFFAOYSA-N holmium atom Chemical compound [Ho] KJZYNXUDTRRSPN-UHFFFAOYSA-N 0.000 claims description 2
- 229910052746 lanthanum Inorganic materials 0.000 claims description 2
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 claims description 2
- OHSVLFRHMCKCQY-UHFFFAOYSA-N lutetium atom Chemical compound [Lu] OHSVLFRHMCKCQY-UHFFFAOYSA-N 0.000 claims description 2
- QEFYFXOXNSNQGX-UHFFFAOYSA-N neodymium atom Chemical compound [Nd] QEFYFXOXNSNQGX-UHFFFAOYSA-N 0.000 claims description 2
- KZUNJOHGWZRPMI-UHFFFAOYSA-N samarium atom Chemical compound [Sm] KZUNJOHGWZRPMI-UHFFFAOYSA-N 0.000 claims description 2
- GZCRRIHWUXGPOV-UHFFFAOYSA-N terbium atom Chemical compound [Tb] GZCRRIHWUXGPOV-UHFFFAOYSA-N 0.000 claims description 2
- 238000002156 mixing Methods 0.000 claims 3
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims 2
- 238000001816 cooling Methods 0.000 claims 1
- 239000004088 foaming agent Substances 0.000 claims 1
- 239000002245 particle Substances 0.000 description 21
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 16
- XTQHKBHJIVJGKJ-UHFFFAOYSA-N sulfur monoxide Chemical class S=O XTQHKBHJIVJGKJ-UHFFFAOYSA-N 0.000 description 12
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- 238000005259 measurement Methods 0.000 description 7
- 239000012190 activator Substances 0.000 description 6
- 229910052977 alkali metal sulfide Inorganic materials 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 238000000137 annealing Methods 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 150000003891 oxalate salts Chemical class 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 239000012611 container material Substances 0.000 description 2
- 238000011109 contamination Methods 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- PAZHGORSDKKUPI-UHFFFAOYSA-N lithium metasilicate Chemical compound [Li+].[Li+].[O-][Si]([O-])=O PAZHGORSDKKUPI-UHFFFAOYSA-N 0.000 description 2
- 229910052912 lithium silicate Inorganic materials 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 229910021193 La 2 O 3 Inorganic materials 0.000 description 1
- FFJZODLGGHJTTI-UHFFFAOYSA-N O=S.[Y].[P] Chemical compound O=S.[Y].[P] FFJZODLGGHJTTI-UHFFFAOYSA-N 0.000 description 1
- 229910052777 Praseodymium Inorganic materials 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- PPTSBERGOGHCHC-UHFFFAOYSA-N boron lithium Chemical compound [Li].[B] PPTSBERGOGHCHC-UHFFFAOYSA-N 0.000 description 1
- 229910052810 boron oxide Inorganic materials 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 1
- PVDYMOCCGHXJAK-UHFFFAOYSA-H europium(3+);oxalate Chemical class [Eu+3].[Eu+3].[O-]C(=O)C([O-])=O.[O-]C(=O)C([O-])=O.[O-]C(=O)C([O-])=O PVDYMOCCGHXJAK-UHFFFAOYSA-H 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- PUDIUYLPXJFUGB-UHFFFAOYSA-N praseodymium atom Chemical compound [Pr] PUDIUYLPXJFUGB-UHFFFAOYSA-N 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000003377 silicon compounds Chemical class 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- RIUWBIIVUYSTCN-UHFFFAOYSA-N trilithium borate Chemical compound [Li+].[Li+].[Li+].[O-]B([O-])[O-] RIUWBIIVUYSTCN-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K11/00—Luminescent, e.g. electroluminescent, chemiluminescent materials
- C09K11/08—Luminescent, e.g. electroluminescent, chemiluminescent materials containing inorganic luminescent materials
- C09K11/77—Luminescent, e.g. electroluminescent, chemiluminescent materials containing inorganic luminescent materials containing rare earth metals
- C09K11/7766—Luminescent, e.g. electroluminescent, chemiluminescent materials containing inorganic luminescent materials containing rare earth metals containing two or more rare earth metals
- C09K11/7767—Chalcogenides
- C09K11/7769—Oxides
- C09K11/7771—Oxysulfides
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K11/00—Luminescent, e.g. electroluminescent, chemiluminescent materials
- C09K11/08—Luminescent, e.g. electroluminescent, chemiluminescent materials containing inorganic luminescent materials
- C09K11/77—Luminescent, e.g. electroluminescent, chemiluminescent materials containing inorganic luminescent materials containing rare earth metals
- C09K11/7783—Luminescent, e.g. electroluminescent, chemiluminescent materials containing inorganic luminescent materials containing rare earth metals containing two or more rare earth metals one of which being europium
- C09K11/7784—Chalcogenides
- C09K11/7787—Oxides
- C09K11/7789—Oxysulfides
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Luminescent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US318171A US3878119A (en) | 1972-12-26 | 1972-12-26 | Preparation of rare-earth oxysulfide phosphors |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2364320A1 true DE2364320A1 (de) | 1974-07-04 |
Family
ID=23236974
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2364320A Pending DE2364320A1 (de) | 1972-12-26 | 1973-12-22 | Leuchtstoffe aus oxysulfiden seltener erden |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3878119A (enExample) |
| JP (1) | JPS4997786A (enExample) |
| DE (1) | DE2364320A1 (enExample) |
| FR (1) | FR2211521B1 (enExample) |
| GB (1) | GB1467010A (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3950668A (en) * | 1973-08-27 | 1976-04-13 | U.S. Radium Corporation | Cathode ray tube containing silicon sensitized rare earth oxysulfide phosphors |
| US4288264A (en) | 1979-11-21 | 1981-09-08 | Emi Limited | Detector construction |
| EP0030853B1 (en) * | 1979-12-12 | 1984-09-12 | Hitachi, Ltd. | Phosphor and method of manufacturing the phosphor |
| JPS6015484A (ja) * | 1983-07-08 | 1985-01-26 | Hitachi Ltd | インデツクス方式カラ−受像管 |
| DE3466998D1 (en) * | 1983-09-09 | 1987-12-03 | Kasei Optonix | Radiographic intensifying screen |
| FR2574583B1 (fr) * | 1984-12-07 | 1989-04-28 | Commissariat Energie Atomique | Ecran radioluminescent en couche epaisse, son procede de fabrication et dispositif pour la mise en oeuvre du procede |
| FR2647803A1 (fr) * | 1989-05-30 | 1990-12-07 | Thomson Tubes Electroniques | Materiau luminescent a base d'oxysulfure de lanthane pour ecran de tube cathodique utilisable dans des dispositifs holographiques |
| JP2878337B2 (ja) * | 1989-10-31 | 1999-04-05 | 化成オプトニクス株式会社 | 蛍光体の製造方法 |
| US5391884A (en) * | 1993-05-24 | 1995-02-21 | Eastman Kodak Company | Barium gadolinate phosphor activated by terbium and/or samarium |
| US5830629A (en) * | 1995-11-01 | 1998-11-03 | Eastman Kodak Company | Autoradiography assemblage using transparent screen |
| US6193908B1 (en) * | 1997-02-24 | 2001-02-27 | Superior Micropowders Llc | Electroluminescent phosphor powders, methods for making phosphor powders and devices incorporating same |
| AU2003225781A1 (en) * | 2002-03-13 | 2003-09-29 | University Of Florida | Novel methods for preparing rare-earth oxysulfide phosphors, and resulting materials |
| RU2614688C2 (ru) * | 2015-05-18 | 2017-03-28 | Общество с ограниченной ответственностью научно-производственная фирма "ЛЮМ" | ЛЮМИНОФОР КОМПЛЕКСНОГО ПРИНЦИПА ДЕЙСТВИЯ НА ОСНОВЕ ОКСИСУЛЬФИДОВ РЕДКОЗЕМЕЛЬНЫХ ЭЛЕМЕНТОВ, АКТИВИРОВАННЫЙ ИОНАМИ Ho3+ И Yb3+ |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3418247A (en) * | 1965-03-24 | 1968-12-24 | Rca Corp | Rare earth activated lanthanum and lutetium oxy-chalcogenide phosphors |
| NL129105C (enExample) * | 1965-11-22 | |||
| US3502590A (en) * | 1967-03-01 | 1970-03-24 | Rca Corp | Process for preparing phosphor |
| US3647707A (en) * | 1969-09-08 | 1972-03-07 | Gen Electric | Alkali monosulfide recrystallization of lanthanide oxysulfide luminescent material |
| US3650975A (en) * | 1969-10-31 | 1972-03-21 | Sylvania Electric Prod | Rare earth oxide phosphors containing alkali metal silicates and germanates |
| US3759835A (en) * | 1971-03-22 | 1973-09-18 | Gte Sylvania Inc | Process for producing rare earth oxide phosphors |
| US3721630A (en) * | 1971-09-27 | 1973-03-20 | Gte Sylvania Inc | Sulfur modified yttrium oxide phosphor |
-
1972
- 1972-12-26 US US318171A patent/US3878119A/en not_active Expired - Lifetime
-
1973
- 1973-12-22 DE DE2364320A patent/DE2364320A1/de active Pending
- 1973-12-26 JP JP48144171A patent/JPS4997786A/ja active Pending
- 1973-12-26 FR FR7346204A patent/FR2211521B1/fr not_active Expired
- 1973-12-27 GB GB5980873A patent/GB1467010A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2211521A1 (enExample) | 1974-07-19 |
| US3878119A (en) | 1975-04-15 |
| GB1467010A (en) | 1977-03-16 |
| JPS4997786A (enExample) | 1974-09-17 |
| FR2211521B1 (enExample) | 1977-08-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3236111C2 (enExample) | ||
| DE1951953C3 (de) | Verfahren zur Herstellung kristalliner Oxychlorid- und/oder Oxybromid- Leuchtstoffe des Yttriums und der Seltenen Erden | |
| DE2364320A1 (de) | Leuchtstoffe aus oxysulfiden seltener erden | |
| DE1952309A1 (de) | Gasreaktionsverfahren zur Herstellung von Leuchtstoffen aus Oxyhalogeniden und Oxiden des Yttrium und der Seltenen Erden | |
| DE4402258C2 (de) | Leuchtstoff mit reduziertem Nachleuchten | |
| DE1792502A1 (de) | Leuchtstoff auf Chalcogenidbasis mit einem Lanthanidenelement als Aktivator | |
| DE1717197B1 (de) | Verfahren zum herstellen von mit europium aktivierten leucht stoffen auf basis von oxysulfiden der seltenen // erden | |
| DE69904390T2 (de) | Phosphoreszierendes Oxidglas mit langanhaltendem Nachleuchten und mit photostimulierter Luminiszenz | |
| DE69731126T2 (de) | Lichtspeicherndes Fluoreszenzpigment zur Verwendung als Anzeigeelement | |
| DE112008000505T5 (de) | Verfahren zur Darstellung von grün emittierenden Borat-Leuchtstoffen | |
| DE2226234A1 (enExample) | ||
| DE1149141B (de) | Einschmelzemail fuer phosphoreszierende Stoffe | |
| DE2260047A1 (de) | Verfahren zum herstellen eines oxids von yttrium und/oder lanthan und/oder den lanthaniden | |
| DE2126190A1 (de) | Verfahren zur Gewinnung von Sulfiden sowie Oxysulfiden der Lanthanoide und des Yttriums sowie von festen Lösungen dieser Sulfide und Oxysulfide | |
| DE1299787B (de) | Verfahren zum Herstellen eines mit Europium aktivierten Yttriumvanadat-Leuchtstoffes | |
| DE2109682A1 (de) | Verfahren zur Herstellung eines lumi neszierenden Oxysulfids | |
| DE4427022A1 (de) | Leuchtstoff mit Zusatz zur Verringerung des Nachleuchtens | |
| DE2215695B2 (de) | Verfahren zur reindarstellung von metallen | |
| DE2522867C3 (de) | Verfahren zum Herstellen eines Seltenen Erdaluminats, insbesondere eines leuchtenden Seltenen Erdaluminats | |
| DE2202485A1 (de) | Verfahren zur herstellung mit cer aktivierter yttriumsilikat-leuchtstoffe | |
| DE2608514C2 (de) | Leuchtendes Yttriumdisilikat, Verfahren zu dessen Herstellung und dessen Verwendung | |
| DE1717197C (de) | Verfahren zum Herstellen von mit Europium aktivierten Leuchtstoffen auf Basis von Oxysulfiden der seltenen Erden | |
| DE2050830A1 (de) | Seltenerdoxydleuchtstoff und Ver fahren zu seiner Herstellung | |
| DE2009441C3 (de) | Verfahren zum Rekristallisieren von Oxysulfiden | |
| DE1285649B (de) | Europium-aktivierter Yttriumvanadat-Leuchtstoff |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |