DE2361338A1 - Verfahren zur herstellung von furanverbindungen - Google Patents
Verfahren zur herstellung von furanverbindungenInfo
- Publication number
- DE2361338A1 DE2361338A1 DE2361338A DE2361338A DE2361338A1 DE 2361338 A1 DE2361338 A1 DE 2361338A1 DE 2361338 A DE2361338 A DE 2361338A DE 2361338 A DE2361338 A DE 2361338A DE 2361338 A1 DE2361338 A1 DE 2361338A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- compounds
- compound
- carbon atoms
- general formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000004519 manufacturing process Methods 0.000 title description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical class C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 title 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 39
- 150000001875 compounds Chemical class 0.000 claims description 36
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 15
- 239000002904 solvent Substances 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 150000001412 amines Chemical class 0.000 claims description 8
- 238000009833 condensation Methods 0.000 claims description 8
- 230000005494 condensation Effects 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 150000002240 furans Chemical class 0.000 claims description 5
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 4
- 150000004679 hydroxides Chemical class 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 150000001408 amides Chemical class 0.000 claims description 3
- 230000021615 conjugation Effects 0.000 claims description 3
- 125000004122 cyclic group Chemical group 0.000 claims description 3
- 229910052700 potassium Inorganic materials 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- 238000007363 ring formation reaction Methods 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- 150000001339 alkali metal compounds Chemical class 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 150000002500 ions Chemical class 0.000 claims description 2
- 239000002798 polar solvent Substances 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 150000003568 thioethers Chemical class 0.000 claims description 2
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 claims 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical group OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims 1
- 150000001341 alkaline earth metal compounds Chemical class 0.000 claims 1
- 125000003368 amide group Chemical group 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 230000008030 elimination Effects 0.000 claims 1
- 238000003379 elimination reaction Methods 0.000 claims 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- -1 heterocyclic radical Chemical class 0.000 description 14
- 150000003254 radicals Chemical class 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 7
- 239000012043 crude product Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 125000005842 heteroatom Chemical group 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000006798 ring closing metathesis reaction Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 3
- HJIAMFHSAAEUKR-UHFFFAOYSA-N (2-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC=CC=C1C(=O)C1=CC=CC=C1 HJIAMFHSAAEUKR-UHFFFAOYSA-N 0.000 description 2
- JODRRPJMQDFCBJ-UHFFFAOYSA-N 2-Hydroxy-4-methylbenzaldehyde Chemical compound CC1=CC=C(C=O)C(O)=C1 JODRRPJMQDFCBJ-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 229940127557 pharmaceutical product Drugs 0.000 description 2
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000002130 sulfonic acid ester group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical compound C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 1
- UWHSPZZUAYSGTB-UHFFFAOYSA-N 1,1,3,3-tetraethylurea Chemical compound CCN(CC)C(=O)N(CC)CC UWHSPZZUAYSGTB-UHFFFAOYSA-N 0.000 description 1
- QWUWMCYKGHVNAV-UHFFFAOYSA-N 1,2-dihydrostilbene Chemical group C=1C=CC=CC=1CCC1=CC=CC=C1 QWUWMCYKGHVNAV-UHFFFAOYSA-N 0.000 description 1
- BBXDMCQDLOCXRA-UHFFFAOYSA-N 1-(chloromethyl)-2-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC=C1CCl BBXDMCQDLOCXRA-UHFFFAOYSA-N 0.000 description 1
- ALRMNLNSZWHIKU-UHFFFAOYSA-N 1-(chloromethyl)-2h-pyridine Chemical compound ClCN1CC=CC=C1 ALRMNLNSZWHIKU-UHFFFAOYSA-N 0.000 description 1
- XGASTRVQNVVYIZ-UHFFFAOYSA-N 1-(chloromethyl)-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(CCl)=C1 XGASTRVQNVVYIZ-UHFFFAOYSA-N 0.000 description 1
- MCHDHQVROPEJJT-UHFFFAOYSA-N 1-(chloromethyl)-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(CCl)C=C1 MCHDHQVROPEJJT-UHFFFAOYSA-N 0.000 description 1
- FGRBYDKOBBBPOI-UHFFFAOYSA-N 10,10-dioxo-2-[4-(N-phenylanilino)phenyl]thioxanthen-9-one Chemical compound O=C1c2ccccc2S(=O)(=O)c2ccc(cc12)-c1ccc(cc1)N(c1ccccc1)c1ccccc1 FGRBYDKOBBBPOI-UHFFFAOYSA-N 0.000 description 1
- ARJOJUQBOMFBDN-UHFFFAOYSA-N 2-(bromomethyl)-1-benzofuran Chemical compound C1=CC=C2OC(CBr)=CC2=C1 ARJOJUQBOMFBDN-UHFFFAOYSA-N 0.000 description 1
- ANRDUCQCZKLSGF-UHFFFAOYSA-N 2-(chloromethyl)-1,3-benzoxazole Chemical compound C1=CC=C2OC(CCl)=NC2=C1 ANRDUCQCZKLSGF-UHFFFAOYSA-N 0.000 description 1
- PJNPZIYGODMAQE-UHFFFAOYSA-N 2-(chloromethyl)-4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1CCl PJNPZIYGODMAQE-UHFFFAOYSA-N 0.000 description 1
- QYKBOTFPQQSPNT-UHFFFAOYSA-N 2-(chloromethyl)-5,6-dimethyl-1,3-benzoxazole Chemical compound C1=C(C)C(C)=CC2=C1OC(CCl)=N2 QYKBOTFPQQSPNT-UHFFFAOYSA-N 0.000 description 1
- CJQUDOZMHRJOSI-UHFFFAOYSA-N 2-(chloromethyl)cyclopenta[c][2,1]benzoxazine Chemical compound O1N=C2C=CC=CC2=C2C1=CC(CCl)=C2 CJQUDOZMHRJOSI-UHFFFAOYSA-N 0.000 description 1
- CKCWXDDNIZVNCW-UHFFFAOYSA-N 2-(chloromethyl)cyclopenta[f][1,2]benzoxazine Chemical compound C1=C2ON=C(CCl)C=C2C2=CC=CC2=C1 CKCWXDDNIZVNCW-UHFFFAOYSA-N 0.000 description 1
- NJWIMFZLESWFIM-UHFFFAOYSA-N 2-(chloromethyl)pyridine Chemical compound ClCC1=CC=CC=N1 NJWIMFZLESWFIM-UHFFFAOYSA-N 0.000 description 1
- DDEAEWMDOSXKBX-UHFFFAOYSA-N 2-(chloromethyl)quinoline Chemical compound C1=CC=CC2=NC(CCl)=CC=C21 DDEAEWMDOSXKBX-UHFFFAOYSA-N 0.000 description 1
- RZXUCEISQDQBBF-UHFFFAOYSA-N 2-ethyl-6-hydroxybenzaldehyde Chemical compound CCC1=CC=CC(O)=C1C=O RZXUCEISQDQBBF-UHFFFAOYSA-N 0.000 description 1
- DSXKMMAQDSAZAC-UHFFFAOYSA-N 2-hydroxy-3,5-dimethylbenzaldehyde Chemical compound CC1=CC(C)=C(O)C(C=O)=C1 DSXKMMAQDSAZAC-UHFFFAOYSA-N 0.000 description 1
- IKYDTCFKUJZPPO-UHFFFAOYSA-N 2-hydroxy-3-phenylbenzaldehyde Chemical compound OC1=C(C=O)C=CC=C1C1=CC=CC=C1 IKYDTCFKUJZPPO-UHFFFAOYSA-N 0.000 description 1
- PWFKERWVXUISSK-UHFFFAOYSA-N 2-hydroxy-4,5-dimethylbenzaldehyde Chemical compound CC1=CC(O)=C(C=O)C=C1C PWFKERWVXUISSK-UHFFFAOYSA-N 0.000 description 1
- ILEIUTCVWLYZOM-UHFFFAOYSA-N 2-hydroxy-5-methylbenzaldehyde Chemical compound CC1=CC=C(O)C(C=O)=C1 ILEIUTCVWLYZOM-UHFFFAOYSA-N 0.000 description 1
- NAUBSKHQFFCEMQ-UHFFFAOYSA-N 2-hydroxy-5-phenylbenzaldehyde Chemical compound C1=C(C=O)C(O)=CC=C1C1=CC=CC=C1 NAUBSKHQFFCEMQ-UHFFFAOYSA-N 0.000 description 1
- ZWVHTXAYIKBMEE-UHFFFAOYSA-N 2-hydroxyacetophenone Chemical compound OCC(=O)C1=CC=CC=C1 ZWVHTXAYIKBMEE-UHFFFAOYSA-N 0.000 description 1
- JBIJLHTVPXGSAM-UHFFFAOYSA-N 2-naphthylamine Chemical compound C1=CC=CC2=CC(N)=CC=C21 JBIJLHTVPXGSAM-UHFFFAOYSA-N 0.000 description 1
- JHZOXYGFQMROFJ-UHFFFAOYSA-N 3,5-dibromo-2-hydroxybenzaldehyde Chemical compound OC1=C(Br)C=C(Br)C=C1C=O JHZOXYGFQMROFJ-UHFFFAOYSA-N 0.000 description 1
- FABVMBDCVAJXMB-UHFFFAOYSA-N 3,5-dichloro-2-hydroxybenzaldehyde Chemical compound OC1=C(Cl)C=C(Cl)C=C1C=O FABVMBDCVAJXMB-UHFFFAOYSA-N 0.000 description 1
- SBVIQSGWXNGYOC-UHFFFAOYSA-N 3-(2-bromoethyl)-1-benzofuran Chemical compound C1=CC=C2C(CCBr)=COC2=C1 SBVIQSGWXNGYOC-UHFFFAOYSA-N 0.000 description 1
- GNTABMURWRWYSV-UHFFFAOYSA-N 3-(2-chloroethyl)pyridine Chemical compound ClCCC1=CC=CN=C1 GNTABMURWRWYSV-UHFFFAOYSA-N 0.000 description 1
- KBWHYRUAHXHHFO-UHFFFAOYSA-N 3-(bromomethyl)thiophene Chemical compound BrCC=1C=CSC=1 KBWHYRUAHXHHFO-UHFFFAOYSA-N 0.000 description 1
- STBGLXMINLWCNL-UHFFFAOYSA-N 3-bromo-2-hydroxybenzaldehyde Chemical compound OC1=C(Br)C=CC=C1C=O STBGLXMINLWCNL-UHFFFAOYSA-N 0.000 description 1
- RUROFEVDCUGKHD-UHFFFAOYSA-N 3-bromoprop-1-enylbenzene Chemical compound BrCC=CC1=CC=CC=C1 RUROFEVDCUGKHD-UHFFFAOYSA-N 0.000 description 1
- DOHOPUBZLWVZMZ-UHFFFAOYSA-N 3-chloro-2-hydroxybenzaldehyde Chemical compound OC1=C(Cl)C=CC=C1C=O DOHOPUBZLWVZMZ-UHFFFAOYSA-N 0.000 description 1
- NWDHTEIVMDYWQJ-UHFFFAOYSA-N 3-fluoro-2-hydroxybenzaldehyde Chemical compound OC1=C(F)C=CC=C1C=O NWDHTEIVMDYWQJ-UHFFFAOYSA-N 0.000 description 1
- IPPQNXSAJZOTJZ-UHFFFAOYSA-N 3-methylsalicylaldehyde Chemical compound CC1=CC=CC(C=O)=C1O IPPQNXSAJZOTJZ-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- KTFSQBCKLKHZRU-UHFFFAOYSA-N 4-(bromomethyl)-n,n-dimethylbenzenesulfonamide Chemical compound CN(C)S(=O)(=O)C1=CC=C(CBr)C=C1 KTFSQBCKLKHZRU-UHFFFAOYSA-N 0.000 description 1
- LOQLDQJTSMKBJU-UHFFFAOYSA-N 4-(chloromethyl)benzonitrile Chemical compound ClCC1=CC=C(C#N)C=C1 LOQLDQJTSMKBJU-UHFFFAOYSA-N 0.000 description 1
- GHKLSRUKZUYUAD-UHFFFAOYSA-N 4-ethyl-2-hydroxybenzaldehyde Chemical compound CCC1=CC=C(C=O)C(O)=C1 GHKLSRUKZUYUAD-UHFFFAOYSA-N 0.000 description 1
- IRWXGDBFGWSFSF-UHFFFAOYSA-N 5-(bromomethyl)furan-2-carbonitrile Chemical compound BrCC1=CC=C(C#N)O1 IRWXGDBFGWSFSF-UHFFFAOYSA-N 0.000 description 1
- GOXDYXBTGGZHMD-UHFFFAOYSA-N 5-(bromomethyl)thiophene-2-carbonitrile Chemical compound BrCC1=CC=C(C#N)S1 GOXDYXBTGGZHMD-UHFFFAOYSA-N 0.000 description 1
- MKKSTJKBKNCMRV-UHFFFAOYSA-N 5-bromo-2-hydroxybenzaldehyde Chemical compound OC1=CC=C(Br)C=C1C=O MKKSTJKBKNCMRV-UHFFFAOYSA-N 0.000 description 1
- LGKANOVVJSORFA-UHFFFAOYSA-N 5-bromopenta-1,3-diene Chemical compound BrCC=CC=C LGKANOVVJSORFA-UHFFFAOYSA-N 0.000 description 1
- TVDVRKLTHSTZTH-UHFFFAOYSA-N 5-chloro-2-hydroxy-4-methylbenzaldehyde Chemical compound CC1=CC(O)=C(C=O)C=C1Cl TVDVRKLTHSTZTH-UHFFFAOYSA-N 0.000 description 1
- FUGKCSRLAQKUHG-UHFFFAOYSA-N 5-chloro-2-hydroxybenzaldehyde Chemical compound OC1=CC=C(Cl)C=C1C=O FUGKCSRLAQKUHG-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- IWTYTFSSTWXZFU-QPJJXVBHSA-N [(e)-3-chloroprop-1-enyl]benzene Chemical compound ClC\C=C\C1=CC=CC=C1 IWTYTFSSTWXZFU-QPJJXVBHSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000005392 carboxamide group Chemical group NC(=O)* 0.000 description 1
- 150000001733 carboxylic acid esters Chemical group 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000005594 diketone group Chemical group 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000006575 electron-withdrawing group Chemical group 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- NZZLGVIQLWHWCI-UHFFFAOYSA-N methyl 4-(bromomethyl)naphthalene-1-carboxylate Chemical compound C1=CC=C2C(C(=O)OC)=CC=C(CBr)C2=C1 NZZLGVIQLWHWCI-UHFFFAOYSA-N 0.000 description 1
- SATDLKYRVXFXRE-UHFFFAOYSA-N methyl 4-(chloromethyl)benzoate Chemical compound COC(=O)C1=CC=C(CCl)C=C1 SATDLKYRVXFXRE-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- KGCNHWXDPDPSBV-UHFFFAOYSA-N p-nitrobenzyl chloride Chemical compound [O-][N+](=O)C1=CC=C(CCl)C=C1 KGCNHWXDPDPSBV-UHFFFAOYSA-N 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000005208 trialkylammonium group Chemical group 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/92—Naphthofurans; Hydrogenated naphthofurans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Furan Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Physical Or Chemical Processes And Apparatus (AREA)
- Color Printing (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1839772A CH583723A5 (forum.php) | 1972-12-18 | 1972-12-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2361338A1 true DE2361338A1 (de) | 1974-06-20 |
Family
ID=4432711
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2361338A Withdrawn DE2361338A1 (de) | 1972-12-18 | 1973-12-08 | Verfahren zur herstellung von furanverbindungen |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3892807A (forum.php) |
| JP (1) | JPS5849553B2 (forum.php) |
| AR (1) | AR207750A1 (forum.php) |
| AT (1) | AT338778B (forum.php) |
| BE (1) | BE808779R (forum.php) |
| BR (1) | BR7309875D0 (forum.php) |
| CA (1) | CA1042899A (forum.php) |
| CH (1) | CH583723A5 (forum.php) |
| DD (1) | DD117070A6 (forum.php) |
| DE (1) | DE2361338A1 (forum.php) |
| DK (1) | DK133506B (forum.php) |
| ES (1) | ES421404A1 (forum.php) |
| FR (1) | FR2210608B2 (forum.php) |
| GB (1) | GB1450120A (forum.php) |
| IN (1) | IN138819B (forum.php) |
| NL (1) | NL7317104A (forum.php) |
| SE (1) | SE402107B (forum.php) |
| SU (2) | SU663304A3 (forum.php) |
| YU (1) | YU326473A (forum.php) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0010063B1 (de) * | 1978-10-04 | 1982-12-29 | Ciba-Geigy Ag | Verfahren zur Herstellung von Furanyl-benzazolen |
| US5326491A (en) * | 1989-04-28 | 1994-07-05 | Ciba-Geigy Corporation | Detergents containing certain sulfonated dibenzofuranylbiphenyls |
| DE10356130A1 (de) * | 2003-11-28 | 2005-06-23 | Dyomics Gmbh | Neue Polymethinfarbstoffe auf Cumarin-Basis mit einstellbarem Stokes-Shift |
| US9464067B2 (en) | 2011-06-16 | 2016-10-11 | Katholieke Universiteit Leuven K.U. Leuven R & D | Indanone derivatives, pharmaceutically acceptable salts or optical isomers thereof, preparation method for same, and pharmaceutical compositions containing same as active ingredient for preventing or treating viral diseases |
| ES2863985T3 (es) | 2012-12-14 | 2021-10-13 | Korea Res Inst Chemical Tech | Nuevo compuesto, sal farmacéuticamente aceptable o isómero óptico del mismo, método para prepararlo y composición farmacéutica para la prevención o el tratamiento de enfermedades virales que lo contienen como ingrediente activo |
| CN107089959A (zh) * | 2017-05-25 | 2017-08-25 | 浙江明生新材料有限公司 | 一种高日晒牢度棉用增白剂及其合成方法 |
| CN112457308B (zh) * | 2019-09-09 | 2024-01-02 | 上海长森药业有限公司 | 新型三环芳香杂环化合物,及其制备方法、药物组合物和应用 |
| TW202448874A (zh) | 2020-04-20 | 2024-12-16 | 瑞士商諾華公司 | 抗病毒性1,3-二氧代茚化合物 |
| KR20230024887A (ko) | 2020-04-20 | 2023-02-21 | 노파르티스 아게 | 항바이러스성 1,3-디-옥소-인덴 화합물 |
| CN111533717B (zh) * | 2020-06-01 | 2023-02-07 | 谷利军 | 一种蓝光激发下合成3-芳甲基苯并[b]呋喃化合物的方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3772370A (en) * | 1970-04-17 | 1973-11-13 | Sterling Drug Inc | N,n'-bis(4(4'-(nitro or amino)-phenoxy)benzyl)-n,n'-bridged-diamines |
| CH550777A (de) * | 1970-10-01 | 1974-06-28 | Ciba Geigy Ag | Verfahren zur herstellung von distyryldiphenylverbindungen. |
-
1972
- 1972-12-18 CH CH1839772A patent/CH583723A5/xx not_active IP Right Cessation
-
1973
- 1973-01-01 AR AR251551A patent/AR207750A1/es active
- 1973-12-08 DE DE2361338A patent/DE2361338A1/de not_active Withdrawn
- 1973-12-12 ES ES421404A patent/ES421404A1/es not_active Expired
- 1973-12-13 US US427016A patent/US3892807A/en not_active Expired - Lifetime
- 1973-12-13 NL NL7317104A patent/NL7317104A/xx not_active Application Discontinuation
- 1973-12-17 JP JP48139730A patent/JPS5849553B2/ja not_active Expired
- 1973-12-17 YU YU03264/73A patent/YU326473A/xx unknown
- 1973-12-17 CA CA188,308A patent/CA1042899A/en not_active Expired
- 1973-12-17 DK DK684373AA patent/DK133506B/da unknown
- 1973-12-17 AT AT1053373A patent/AT338778B/de active
- 1973-12-17 BR BR9875/73A patent/BR7309875D0/pt unknown
- 1973-12-17 SU SU731981053A patent/SU663304A3/ru active
- 1973-12-17 DD DD175391A patent/DD117070A6/xx unknown
- 1973-12-18 GB GB5849773A patent/GB1450120A/en not_active Expired
- 1973-12-18 BE BE138996A patent/BE808779R/xx active
- 1973-12-18 FR FR7345241A patent/FR2210608B2/fr not_active Expired
- 1973-12-18 SE SE7317062A patent/SE402107B/xx unknown
- 1973-12-19 IN IN2765/CAL/73A patent/IN138819B/en unknown
-
1976
- 1976-01-28 SU SU762317501A patent/SU725559A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| CH583723A5 (forum.php) | 1977-01-14 |
| CA1042899A (en) | 1978-11-21 |
| DK133506C (forum.php) | 1976-12-20 |
| BR7309875D0 (pt) | 1974-08-29 |
| ES421404A1 (es) | 1977-06-16 |
| JPS5849553B2 (ja) | 1983-11-05 |
| DK133506B (da) | 1976-05-31 |
| US3892807A (en) | 1975-07-01 |
| DD117070A6 (forum.php) | 1975-12-20 |
| SE402107B (sv) | 1978-06-19 |
| AT338778B (de) | 1977-09-12 |
| YU326473A (en) | 1982-06-18 |
| ATA1053373A (de) | 1977-01-15 |
| GB1450120A (en) | 1976-09-22 |
| SU725559A1 (ru) | 1980-03-30 |
| BE808779R (fr) | 1974-06-18 |
| JPS4987653A (forum.php) | 1974-08-22 |
| AR207750A1 (es) | 1976-10-29 |
| SU725559A3 (en) | 1980-03-30 |
| FR2210608A2 (forum.php) | 1974-07-12 |
| NL7317104A (forum.php) | 1974-06-20 |
| AU6367173A (en) | 1975-06-19 |
| SU663304A3 (ru) | 1979-05-15 |
| IN138819B (forum.php) | 1976-04-03 |
| FR2210608B2 (forum.php) | 1980-01-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2238628A1 (de) | Verfahren zur herstellung von furanverbindungen | |
| DE939505C (de) | Verfahren zur Herstellung von neuen wasserloeslichen Derivaten von Imidazolen | |
| DE1924770A1 (de) | Basische Azoverbindungen,ihre Herstellung und Verwendung | |
| DE2030507A1 (de) | Oxazolyl-essigsäurederivate und Oxyzolyl-cumarine | |
| DE2361338A1 (de) | Verfahren zur herstellung von furanverbindungen | |
| AT200578B (de) | Verfahren zur Herstellung von neuen N-Aminoalkylderivaten von Azepinen | |
| EP0010652B1 (de) | Neue 4-Chloroxazole, Verfahren zu deren Herstellung und deren Verwendung in photoleitenden Schichten in der Elektrophotographie und als optische Aufheller | |
| DE1965981C3 (de) | 9-Phenyl-lO-oxopiperazino [l,2-a]-indole und Verfahren zu ihrer Herstellung | |
| DE1645960A1 (de) | Verfahren zur Herstellung von 1-substituierten-3,3-disubstituierten 2-Vinylen-3H-indolen und deren Verwendung als Farbstoffe | |
| CH615209A5 (forum.php) | ||
| EP0184981A1 (de) | Neue Pyrrolinone und deren Zwischenprodukte | |
| DE1493809A1 (de) | Verfahren zur Herstellung von Benzophenon-Derivaten | |
| DE2242784C3 (de) | Verfahren zur Herstellung von 2-Aryl-v-triazolen | |
| DE2522139A1 (de) | Organische verbindungen, deren herstellung und verwendung | |
| AT250338B (de) | Verfahren zur Herstellung neuer, basischer Derivate von substituierten Benzofuran-2-carbonsäuren und deren Salzen | |
| DE1545803B2 (de) | Verfahren zur herstellung von 7-aminocarbostyril-verbindungen | |
| DE1817794C3 (de) | Verfahren zur Herstellung von 2-Benzyloxycarbonylglycylamidobenzophenonen | |
| DE1077222B (de) | Verfahren zur Herstellung von Benzimidazolylidenverbindungen | |
| DE2604248A1 (de) | Verfahren zur herstellung von thienopyridinderivaten | |
| DE937606C (de) | Verfahren zur Herstellung von Trimethincyanin-Farbstoffen | |
| AT211822B (de) | Verfahren zur Herstellung von neuen Aryloxyessigsäureamiden | |
| DE1793003A1 (de) | Basische Farbstoffe,ihre Herstellung und Verwendung | |
| AT274816B (de) | Verfahren zur Herstellung von 1,2-Dihydrobenzodiazepinen und von Säureadditionssalzen dieser Verbindungen | |
| DE1137155B (de) | Verfahren zur Herstellung wasserloeslicher Tetrazaporphinfarbstoffe | |
| DE1543655A1 (de) | Verfahren zur Herstellung von 2-Acylamino-phenyl-arylketonen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |