DE2359963C2 - Verfahren zur Herstellung von Malonsäuredialkylestern - Google Patents
Verfahren zur Herstellung von MalonsäuredialkylesternInfo
- Publication number
- DE2359963C2 DE2359963C2 DE2359963A DE2359963A DE2359963C2 DE 2359963 C2 DE2359963 C2 DE 2359963C2 DE 2359963 A DE2359963 A DE 2359963A DE 2359963 A DE2359963 A DE 2359963A DE 2359963 C2 DE2359963 C2 DE 2359963C2
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- mol
- yield
- malonate
- chloroacetate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 8
- 150000002690 malonic acid derivatives Chemical class 0.000 title claims description 5
- 238000002360 preparation method Methods 0.000 title claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 25
- 239000003795 chemical substances by application Substances 0.000 claims description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 4
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 4
- 230000003197 catalytic effect Effects 0.000 claims description 3
- MQIKJSYMMJWAMP-UHFFFAOYSA-N dicobalt octacarbonyl Chemical group [Co+2].[Co+2].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] MQIKJSYMMJWAMP-UHFFFAOYSA-N 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 2
- 150000001869 cobalt compounds Chemical class 0.000 claims description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- QABLOFMHHSOFRJ-UHFFFAOYSA-N methyl 2-chloroacetate Chemical compound COC(=O)CCl QABLOFMHHSOFRJ-UHFFFAOYSA-N 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 13
- 150000002148 esters Chemical class 0.000 description 13
- BEPAFCGSDWSTEL-UHFFFAOYSA-N dimethyl malonate Chemical compound COC(=O)CC(=O)OC BEPAFCGSDWSTEL-UHFFFAOYSA-N 0.000 description 11
- 229910017052 cobalt Inorganic materials 0.000 description 9
- 239000010941 cobalt Substances 0.000 description 9
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 150000001298 alcohols Chemical class 0.000 description 6
- VEUUMBGHMNQHGO-UHFFFAOYSA-N ethyl chloroacetate Chemical compound CCOC(=O)CCl VEUUMBGHMNQHGO-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- -1 alkali metal cyanide Chemical class 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- YIWUKEYIRIRTPP-UHFFFAOYSA-N 2-ethylhexan-1-ol Chemical compound CCCCC(CC)CO YIWUKEYIRIRTPP-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 230000006315 carbonylation Effects 0.000 description 3
- 238000005810 carbonylation reaction Methods 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 2
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- ZIYVHBGGAOATLY-UHFFFAOYSA-N methylmalonic acid Chemical compound OC(=O)C(C)C(O)=O ZIYVHBGGAOATLY-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- VODRWDBLLGYRJT-UHFFFAOYSA-N propan-2-yl 2-chloroacetate Chemical compound CC(C)OC(=O)CCl VODRWDBLLGYRJT-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- QZBQQHUYQKGPLQ-UHFFFAOYSA-N 2-ethylhexyl 2-chloroacetate Chemical compound CCCCC(CC)COC(=O)CCl QZBQQHUYQKGPLQ-UHFFFAOYSA-N 0.000 description 1
- NGGGZUAEOKRHMA-UHFFFAOYSA-M 3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoate Chemical compound CC(C)(C)OC(=O)CC([O-])=O NGGGZUAEOKRHMA-UHFFFAOYSA-M 0.000 description 1
- LIRDIZPKBSSVBK-UHFFFAOYSA-N 3-o-ethyl 1-o-methyl propanedioate Chemical compound CCOC(=O)CC(=O)OC LIRDIZPKBSSVBK-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910021446 cobalt carbonate Inorganic materials 0.000 description 1
- ZOTKGJBKKKVBJZ-UHFFFAOYSA-L cobalt(2+);carbonate Chemical compound [Co+2].[O-]C([O-])=O ZOTKGJBKKKVBJZ-UHFFFAOYSA-L 0.000 description 1
- OBWXQDHWLMJOOD-UHFFFAOYSA-H cobalt(2+);dicarbonate;dihydroxide;hydrate Chemical compound O.[OH-].[OH-].[Co+2].[Co+2].[Co+2].[O-]C([O-])=O.[O-]C([O-])=O OBWXQDHWLMJOOD-UHFFFAOYSA-H 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- OREAFAJWWJHCOT-UHFFFAOYSA-N dimethylmalonic acid Chemical compound OC(=O)C(C)(C)C(O)=O OREAFAJWWJHCOT-UHFFFAOYSA-N 0.000 description 1
- QRVSDVDFJFKYKA-UHFFFAOYSA-N dipropan-2-yl propanedioate Chemical compound CC(C)OC(=O)CC(=O)OC(C)C QRVSDVDFJFKYKA-UHFFFAOYSA-N 0.000 description 1
- CLPHAYNBNTVRDI-UHFFFAOYSA-N ditert-butyl propanedioate Chemical compound CC(C)(C)OC(=O)CC(=O)OC(C)(C)C CLPHAYNBNTVRDI-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- ZANNOFHADGWOLI-UHFFFAOYSA-N ethyl 2-hydroxyacetate Chemical compound CCOC(=O)CO ZANNOFHADGWOLI-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/34—Esters of acyclic saturated polycarboxylic acids having an esterified carboxyl group bound to an acyclic carbon atom
- C07C69/38—Malonic acid esters
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2359963A DE2359963C2 (de) | 1973-12-01 | 1973-12-01 | Verfahren zur Herstellung von Malonsäuredialkylestern |
| BE150808A BE822546A (fr) | 1973-12-01 | 1974-11-25 | Procede de preparation d'esters dialkyliques d'acide malonique |
| FR7439089A FR2253006B1 (OSRAM) | 1973-12-01 | 1974-11-28 | |
| FI3451/74A FI61683C (fi) | 1973-12-01 | 1974-11-28 | Foerfarande foer framstaellning av malonsyradialkylestrar |
| SU7402078987A SU580827A3 (ru) | 1973-12-01 | 1974-11-29 | Способ получени с-с-диалкиловых эфиров малоновой кислоты |
| DK622774A DK134779C (da) | 1973-12-01 | 1974-11-29 | Fremgangsmade til fremstilling af malonsyredialkylestere |
| NLAANVRAGE7415608,A NL185839C (nl) | 1973-12-01 | 1974-11-29 | Werkwijze voor het bereiden van malonzuur-dialkylesters. |
| DD182673A DD115350A5 (OSRAM) | 1973-12-01 | 1974-11-29 | |
| IT54311/74A IT1023464B (it) | 1973-12-01 | 1974-11-29 | Procedimento per la produzione di malonati dialchilici |
| CH1591374A CH605575A5 (OSRAM) | 1973-12-01 | 1974-11-29 | |
| GB5189474A GB1448646A (en) | 1973-12-01 | 1974-11-29 | Preparation of malonic acid dialkylesters |
| ES432479A ES432479A1 (es) | 1973-12-01 | 1974-11-30 | Procedimiento para la preparacion de esteres dialcohilicos de acido malonico. |
| JP13827974A JPS5324049B2 (OSRAM) | 1973-12-01 | 1974-12-02 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2359963A DE2359963C2 (de) | 1973-12-01 | 1973-12-01 | Verfahren zur Herstellung von Malonsäuredialkylestern |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2359963A1 DE2359963A1 (de) | 1975-06-05 |
| DE2359963C2 true DE2359963C2 (de) | 1982-01-28 |
Family
ID=5899624
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2359963A Expired DE2359963C2 (de) | 1973-12-01 | 1973-12-01 | Verfahren zur Herstellung von Malonsäuredialkylestern |
Country Status (13)
| Country | Link |
|---|---|
| JP (1) | JPS5324049B2 (OSRAM) |
| BE (1) | BE822546A (OSRAM) |
| CH (1) | CH605575A5 (OSRAM) |
| DD (1) | DD115350A5 (OSRAM) |
| DE (1) | DE2359963C2 (OSRAM) |
| DK (1) | DK134779C (OSRAM) |
| ES (1) | ES432479A1 (OSRAM) |
| FI (1) | FI61683C (OSRAM) |
| FR (1) | FR2253006B1 (OSRAM) |
| GB (1) | GB1448646A (OSRAM) |
| IT (1) | IT1023464B (OSRAM) |
| NL (1) | NL185839C (OSRAM) |
| SU (1) | SU580827A3 (OSRAM) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SU614742A3 (ru) * | 1975-06-02 | 1978-07-05 | Динамит Нобель Аг (Фирма) | Способ получени с - с диалкиловых эфиров малоновой кислоты |
| DE2603026C2 (de) * | 1976-01-28 | 1986-06-19 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Herstellung von Malonsäuredialkylester |
| IT1075123B (it) * | 1977-02-24 | 1985-04-22 | Snam Progetti | Processo per la preparazione di derivati dell'acido malonico |
| JPS54128512A (en) * | 1978-03-29 | 1979-10-05 | Denki Kagaku Kogyo Kk | Preparation of malonic acid dialkyl ester |
| JPS5921851B2 (ja) * | 1978-08-17 | 1984-05-22 | 電気化学工業株式会社 | アルキルカルボン酸エステルの製法 |
| FR2631623B1 (fr) * | 1988-05-19 | 1990-10-19 | Rhone Poulenc Chimie | Procede de preparation de malonates d'alkyle |
| IL133909A0 (en) | 1999-01-11 | 2001-04-30 | Lonza Ag | Process for preparing malonic esters |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2542767A (en) * | 1949-02-11 | 1951-02-20 | Du Pont | Organic ester synthesis |
| NL272335A (OSRAM) * | 1960-12-08 |
-
1973
- 1973-12-01 DE DE2359963A patent/DE2359963C2/de not_active Expired
-
1974
- 1974-11-25 BE BE150808A patent/BE822546A/xx not_active IP Right Cessation
- 1974-11-28 FR FR7439089A patent/FR2253006B1/fr not_active Expired
- 1974-11-28 FI FI3451/74A patent/FI61683C/fi active
- 1974-11-29 SU SU7402078987A patent/SU580827A3/ru active
- 1974-11-29 DD DD182673A patent/DD115350A5/xx unknown
- 1974-11-29 DK DK622774A patent/DK134779C/da active
- 1974-11-29 GB GB5189474A patent/GB1448646A/en not_active Expired
- 1974-11-29 NL NLAANVRAGE7415608,A patent/NL185839C/xx not_active IP Right Cessation
- 1974-11-29 CH CH1591374A patent/CH605575A5/xx not_active IP Right Cessation
- 1974-11-29 IT IT54311/74A patent/IT1023464B/it active
- 1974-11-30 ES ES432479A patent/ES432479A1/es not_active Expired
- 1974-12-02 JP JP13827974A patent/JPS5324049B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK134779B (da) | 1977-01-17 |
| JPS50111015A (OSRAM) | 1975-09-01 |
| DK134779C (da) | 1977-06-06 |
| FR2253006B1 (OSRAM) | 1978-12-08 |
| IT1023464B (it) | 1978-05-10 |
| NL185839C (nl) | 1990-08-01 |
| BE822546A (fr) | 1975-03-14 |
| GB1448646A (en) | 1976-09-08 |
| CH605575A5 (OSRAM) | 1978-09-29 |
| ES432479A1 (es) | 1976-11-16 |
| FR2253006A1 (OSRAM) | 1975-06-27 |
| FI61683C (fi) | 1982-09-10 |
| DK622774A (OSRAM) | 1975-08-11 |
| NL185839B (nl) | 1990-03-01 |
| FI345174A7 (OSRAM) | 1975-06-02 |
| SU580827A3 (ru) | 1977-11-15 |
| FI61683B (fi) | 1982-05-31 |
| JPS5324049B2 (OSRAM) | 1978-07-18 |
| NL7415608A (nl) | 1975-06-03 |
| DD115350A5 (OSRAM) | 1975-09-20 |
| DE2359963A1 (de) | 1975-06-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2828041C2 (de) | Verfahren zur Herstellung von Arylbrenztraubensäuren | |
| DE3432170C2 (OSRAM) | ||
| DE2259072C3 (de) | Verfahren zur Herstellung von Arylessigsäuren | |
| DE2600541C3 (de) | Verfahren zur Herstellung von Phenylbrenztraubensäure oder Arylbrenztraubensäuren | |
| DE2359963C2 (de) | Verfahren zur Herstellung von Malonsäuredialkylestern | |
| DE2801886A1 (de) | Verfahren zur herstellung der alkalisalze der phenylessigsaeure | |
| DE2404776C2 (de) | Verfahren zur Herstellung von β-Alkoxy-buttersäurealkylestern | |
| DE2410782C2 (de) | Phenylendiessigsäuredialkylester und Verfahren zu deren Herstellung | |
| DE2240398C3 (de) | Verfahren zur Herstellung von Arylessigsäurealkylestern | |
| DE2823309C2 (OSRAM) | ||
| DE3108602C2 (de) | Verfahren zur selektiven Herstellung von eine Perfluorkohlenstoffgruppe enthaltenden Aldehyden | |
| DE2436788C2 (de) | Verfahren zur Herstellung von α, β-ungesättigten Carbonsäureestern | |
| EP0048335B1 (de) | Verfahren zur Herstellung von Carbonsäurehalogeniden | |
| EP1207148A1 (de) | Verfahren zur Herstellung von Phenylessigsäurederivaten | |
| DE2240399C3 (de) | Verfahren zur Herstellung von Arylessigsäurealkylestem | |
| DE2403483A1 (de) | Verfahren zur herstellung von cyanessigsaeurealkylestern | |
| EP0623579B1 (de) | Verfahren zur Herstellung von Ethercarbonsäuren | |
| DE3122796C2 (de) | Verfahren zur Herstellung von Carbonsäurealkylestern | |
| DE2524389C2 (de) | Verfahren zur Herstellung von Malonsäuredialkylestern | |
| DE2446657C2 (de) | Verfahren zur Herstellung von Phenylessigsäurecarbonsäuredialkylestern | |
| DE2054988A1 (de) | Verfahren zur Herstellung von Methacrolein | |
| DE892893C (de) | Verfahren zur Herstellung von Carbonsaeureestern | |
| DE2606655A1 (de) | Verfahren zur herstellung von carbonsaeureestern | |
| DE2603026C2 (de) | Verfahren zur Herstellung von Malonsäuredialkylester | |
| DE2630235A1 (de) | Verfahren zur herstellung von isobuttersaeure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: HUELS TROISDORF AG, 5210 TROISDORF, DE |
|
| 8327 | Change in the person/name/address of the patent owner |
Owner name: HUELS AG, 4370 MARL, DE |