DE2345068C2 - Verfahren zur Herstellung von Indolo[2,3-a]chinolizinen - Google Patents
Verfahren zur Herstellung von Indolo[2,3-a]chinolizinenInfo
- Publication number
- DE2345068C2 DE2345068C2 DE19732345068 DE2345068A DE2345068C2 DE 2345068 C2 DE2345068 C2 DE 2345068C2 DE 19732345068 DE19732345068 DE 19732345068 DE 2345068 A DE2345068 A DE 2345068A DE 2345068 C2 DE2345068 C2 DE 2345068C2
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- reaction mixture
- acid
- ethyl
- reacts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 15
- 238000002360 preparation method Methods 0.000 title claims description 5
- CMLQXZNMSSZRCH-UHFFFAOYSA-N indolo[2,3-a]quinolizine Chemical class C1=CC=CC2=C3N=C(C=CC=C4)C4=C3C=CN21 CMLQXZNMSSZRCH-UHFFFAOYSA-N 0.000 title claims description 4
- APJYDQYYACXCRM-UHFFFAOYSA-N tryptamine Chemical compound C1=CC=C2C(CCN)=CNC2=C1 APJYDQYYACXCRM-UHFFFAOYSA-N 0.000 claims description 28
- 239000011541 reaction mixture Substances 0.000 claims description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 19
- 239000002904 solvent Substances 0.000 claims description 12
- 239000002585 base Substances 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 9
- 239000000155 melt Substances 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 238000002955 isolation Methods 0.000 claims description 5
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical class CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 claims description 3
- AFCIMSXHQSIHQW-UHFFFAOYSA-N [O].[P] Chemical compound [O].[P] AFCIMSXHQSIHQW-UHFFFAOYSA-N 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- 150000001447 alkali salts Chemical class 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 3
- 239000012433 hydrogen halide Substances 0.000 claims description 3
- 150000002475 indoles Chemical class 0.000 claims description 3
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical group N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims description 2
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 2
- 239000012458 free base Substances 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 150000002690 malonic acid derivatives Chemical class 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 125000004309 pyranyl group Chemical class O1C(C=CC=C1)* 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 16
- 229910052739 hydrogen Inorganic materials 0.000 description 16
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 16
- HEDRZPFGACZZDS-UHFFFAOYSA-N chloroform Substances ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 13
- -1 phosphorus halogen compound Chemical class 0.000 description 13
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 238000010438 heat treatment Methods 0.000 description 8
- 229910052698 phosphorus Inorganic materials 0.000 description 8
- 239000011574 phosphorus Substances 0.000 description 8
- 238000004458 analytical method Methods 0.000 description 7
- 238000009835 boiling Methods 0.000 description 7
- 238000002329 infrared spectrum Methods 0.000 description 7
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 6
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- LZLZSSGOHJSSBO-UHFFFAOYSA-N 2-ethyl-2-(3-hydroxypropyl)propanedioic acid Chemical compound CCC(C(O)=O)(C(O)=O)CCCO LZLZSSGOHJSSBO-UHFFFAOYSA-N 0.000 description 5
- MNMHTBMXCUARLR-UHFFFAOYSA-N 3-ethyloxan-2-one Chemical compound CCC1CCCOC1=O MNMHTBMXCUARLR-UHFFFAOYSA-N 0.000 description 5
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- NCRIPSDAPUGTIK-UHFFFAOYSA-N 2-ethyl-5-hydroxy-n-[2-(1h-indol-3-yl)ethyl]pentanamide Chemical compound C1=CC=C2C(CCNC(=O)C(CCCO)CC)=CNC2=C1 NCRIPSDAPUGTIK-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- SNJHPBCJDWASBR-UHFFFAOYSA-O 1-ethyl-2,3,4,6,7,12-hexahydro-1h-indolo[2,3-a]quinolizin-5-ium Chemical compound N1C2=CC=CC=C2C(CC2)=C1C1=[N+]2CCCC1CC SNJHPBCJDWASBR-UHFFFAOYSA-O 0.000 description 3
- YFJDVVOPVKIXCY-UHFFFAOYSA-N 3-butyloxan-2-one Chemical compound CCCCC1CCCOC1=O YFJDVVOPVKIXCY-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- RXPRRQLKFXBCSJ-GIVPXCGWSA-N vincamine Chemical compound C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)C[C@](O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-GIVPXCGWSA-N 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- DFCXCIIPZTXJGS-UHFFFAOYSA-N 1-butyl-2,3,4,6,7,12-hexahydro-1h-indolo[2,3-a]quinolizin-5-ium;perchlorate Chemical compound [O-]Cl(=O)(=O)=O.N1C2=CC=CC=C2C(CC2)=C1C1=[N+]2CCCC1CCCC DFCXCIIPZTXJGS-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000002211 ultraviolet spectrum Methods 0.000 description 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- XDJWZONZDVNKDU-UHFFFAOYSA-N 1314-24-5 Chemical compound O=POP=O XDJWZONZDVNKDU-UHFFFAOYSA-N 0.000 description 1
- SYHCXSQXKZKYIW-UHFFFAOYSA-N 5-bromo-2-ethylpentanoic acid Chemical compound CCC(C(O)=O)CCCBr SYHCXSQXKZKYIW-UHFFFAOYSA-N 0.000 description 1
- ZNSMNVMLTJELDZ-UHFFFAOYSA-N Bis(2-chloroethyl)ether Chemical compound ClCCOCCCl ZNSMNVMLTJELDZ-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 206010057040 Temperature intolerance Diseases 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- ZNJPKZMTMAYNGM-UHFFFAOYSA-N diethyl 2-(3-bromopropyl)-2-ethylpropanedioate Chemical compound CCOC(=O)C(CC)(CCCBr)C(=O)OCC ZNJPKZMTMAYNGM-UHFFFAOYSA-N 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- RXPRRQLKFXBCSJ-UHFFFAOYSA-N dl-Vincamin Natural products C1=CC=C2C(CCN3CCC4)=C5C3C4(CC)CC(O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-UHFFFAOYSA-N 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- OQQLWUFRRFRZIW-UHFFFAOYSA-N ethyl 5-chloro-2-cyanopentanoate Chemical compound ClCCCC(C(=O)OCC)C#N OQQLWUFRRFRZIW-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000008543 heat sensitivity Effects 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- VSAISIQCTGDGPU-UHFFFAOYSA-N phosphorus trioxide Inorganic materials O1P(O2)OP3OP1OP2O3 VSAISIQCTGDGPU-UHFFFAOYSA-N 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 238000006257 total synthesis reaction Methods 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 1
- 235000019801 trisodium phosphate Nutrition 0.000 description 1
- 229960002726 vincamine Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D315/00—Heterocyclic compounds containing rings having one oxygen atom as the only ring hetero atom according to more than one of groups C07D303/00 - C07D313/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/14—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
- C07D209/16—Tryptamines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains three hetero rings
- C07D471/14—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HURI000485 HU167366B (enExample) | 1972-09-06 | 1972-09-06 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2345068A1 DE2345068A1 (de) | 1974-03-14 |
| DE2345068C2 true DE2345068C2 (de) | 1986-06-05 |
Family
ID=11000906
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732345068 Expired DE2345068C2 (de) | 1972-09-06 | 1973-09-06 | Verfahren zur Herstellung von Indolo[2,3-a]chinolizinen |
Country Status (13)
| Country | Link |
|---|---|
| JP (1) | JPS5221517B2 (enExample) |
| AT (1) | AT327908B (enExample) |
| BE (1) | BE804495A (enExample) |
| CS (1) | CS175358B2 (enExample) |
| DD (1) | DD107281A5 (enExample) |
| DE (1) | DE2345068C2 (enExample) |
| DK (1) | DK140761B (enExample) |
| FR (1) | FR2197873B1 (enExample) |
| GB (1) | GB1401579A (enExample) |
| HU (1) | HU167366B (enExample) |
| NL (1) | NL180421C (enExample) |
| SU (1) | SU535909A3 (enExample) |
| YU (1) | YU36954B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZA786426B (en) * | 1977-11-25 | 1979-10-31 | Scras | New indulo(2,3-a)quinolizidines,preparation and therapeutic use |
| US4315011A (en) * | 1978-07-12 | 1982-02-09 | Richter Gedeon Vegyeszeti Gyar Rt. | 1-Alkyl-9-bromohexahydroindolo quinolizium salts and use thereof to increase blood flow |
| HU207070B (en) * | 1990-10-31 | 1993-03-01 | Richter Gedeon Vegyeszet | Process for producing 1beta-ethyl-1alpha-hydroxymethyl-1,2,3,4,6,712,12balpha-octahydroindolo(2,3-a) quinolizine |
| US7270799B2 (en) * | 2004-01-15 | 2007-09-18 | Nst Neurosurvival Technologies Ltd. | Perturbed membrane-binding compounds and methods of using the same |
| US7947253B2 (en) * | 2004-01-15 | 2011-05-24 | Aposense Ltd. | Perturbed membrane-binding compounds and methods of using the same |
| EP1994081B1 (en) * | 2006-03-21 | 2014-05-21 | The Governors of the University of Alberta | Novel poly(ethylene oxide)-block-poly(ester) block copolymers |
| CN103626651B (zh) * | 2012-08-27 | 2015-07-22 | 东北制药集团股份有限公司 | 一种制备合成长春西汀中间体γ-羟丙基-乙基丙二酸的方法 |
| CN108047224A (zh) * | 2017-11-24 | 2018-05-18 | 东北制药集团股份有限公司 | 一种制备烯胺高氯酸盐的方法 |
-
1972
- 1972-09-06 HU HURI000485 patent/HU167366B/hu unknown
-
1973
- 1973-08-28 AT AT746473A patent/AT327908B/de not_active IP Right Cessation
- 1973-08-31 NL NL7312084A patent/NL180421C/xx not_active IP Right Cessation
- 1973-09-03 CS CS613073A patent/CS175358B2/cs unknown
- 1973-09-04 DD DD17327173A patent/DD107281A5/xx unknown
- 1973-09-04 FR FR7331939A patent/FR2197873B1/fr not_active Expired
- 1973-09-05 DK DK488273A patent/DK140761B/da not_active IP Right Cessation
- 1973-09-05 BE BE135349A patent/BE804495A/xx not_active IP Right Cessation
- 1973-09-05 SU SU1956238A patent/SU535909A3/ru active
- 1973-09-06 GB GB4204473A patent/GB1401579A/en not_active Expired
- 1973-09-06 JP JP10072573A patent/JPS5221517B2/ja not_active Expired
- 1973-09-06 DE DE19732345068 patent/DE2345068C2/de not_active Expired
- 1973-09-08 YU YU238173A patent/YU36954B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| HU167366B (enExample) | 1975-09-27 |
| JPS5221517B2 (enExample) | 1977-06-10 |
| CS175358B2 (enExample) | 1977-05-31 |
| JPS5040597A (enExample) | 1975-04-14 |
| YU238173A (en) | 1982-02-25 |
| SU535909A3 (ru) | 1976-11-15 |
| FR2197873B1 (enExample) | 1982-04-02 |
| BE804495A (fr) | 1974-01-02 |
| NL180421C (nl) | 1987-02-16 |
| DD107281A5 (enExample) | 1974-07-20 |
| NL7312084A (enExample) | 1974-03-08 |
| DK140761B (da) | 1979-11-12 |
| ATA746473A (de) | 1975-05-15 |
| FR2197873A1 (enExample) | 1974-03-29 |
| DE2345068A1 (de) | 1974-03-14 |
| DK140761C (enExample) | 1980-04-14 |
| YU36954B (en) | 1984-08-31 |
| GB1401579A (en) | 1975-07-16 |
| AT327908B (de) | 1976-02-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69131636T2 (de) | (6,7-substituierte-8-Alkoxy-1-cyclopropyl-1,4-dihydro-4-oxo-3-chinolinkarbonsäure-03,04)-bis(acyloxy-0)-Borate und ihre Salze sowie Methoden zu ihrer Herstellung | |
| DE2345068C2 (de) | Verfahren zur Herstellung von Indolo[2,3-a]chinolizinen | |
| DE2003430A1 (de) | Phenoxy-alkyl-carbonsaeurederivate | |
| CH640224A5 (de) | 2-pyrrolidonderivate, verfahren zu ihrer herstellung und ihre verwendung zur herstellung von 4-aminohex-5-ensaeure. | |
| DE2414751A1 (de) | Neue 4h-pyrido-eckige klammer auf 1,2a eckige klammer zu-pyrimidin-derivate und verfahren zur herstellung derselben | |
| DD269848A5 (de) | Verfahren zur herstellung von chinolincarbonsaeure | |
| DE2365302C3 (de) | Verfahren zur herstellung von 2- amino-nicotino-nitrilen | |
| DD201592A5 (de) | Verfahren zur herstellung neuer indolochinolisinester-derivate | |
| DE60022684T2 (de) | Verfahren zur Herstellung von 6-Methyl-2-(4-methyl-phenyl)-imidazo [1,2-A]pyridin-3-(N,N-dimethyl-acetamid) und Zwischenprodukte | |
| DE1967178C2 (de) | Verfahren zur Herstellung von Chinuclidinyl-4-chinolinmethanolderivaten | |
| CH619955A5 (enExample) | ||
| DE1518337A1 (de) | Neue Roentgenkontrastmittel und Verfahren zur Herstellung derselben | |
| DE3851854T2 (de) | Verfahren zur Herstellung von 1-Alkoxy-3-carboxy-4-cinnolonen. | |
| DE2110363A1 (de) | Carbonsaeureamid- und Carbonsaeurehydrazidderivate von 4,5-Diphenyloxazol und Verfahren zu ihrer Herstellung | |
| DE2644789A1 (de) | Alkylen-di-phenylalk(en)ylcarbonsaeuren und ihre herstellung und verwendung | |
| DE2222186C3 (de) | Verfahren zur Herstellung von Vincamin und analogen Verbindungen | |
| DE3231449A1 (de) | Imidazolderivate und verfahren zu ihrer herstellung | |
| DE1229095B (de) | Verfahren zur Herstellung von substituierten 4-Nitro-pyrazol-5-carbonsaeuren | |
| AT269151B (de) | Verfahren zur Herstellung von neuen Oxazinverbindungen | |
| AT384221B (de) | Verfahren zur herstellung von neuen 3-substituierten tetrahydro-pyrrolo(1,2-a) pyrimidin-derivaten sowie von deren saeureadditions- und quaternaeren salzen | |
| CH623585A5 (en) | Process for the preparation of hexahydroindolo[2,3-a]quinolizine derivatives | |
| DE2715675A1 (de) | Verfahren zur herstellung von 4-chlor-5-alkoxycarbonyl-2-methoxypyrimidinen | |
| EP0633249B1 (de) | Verfahren zur Herstellung von 2,4-Pyridindicarbonsäure | |
| AT283364B (de) | Verfahren zur Herstellung neuer Zimtsäureamide | |
| AT330779B (de) | Verfahren zur herstellung von neuen chinolinessigsaurederivaten und ihren salzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: KINZEBACH, W., DIPL.-CHEM. DR.PHIL. RIEDL, P., DIP |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |