DE2338418B2 - Geraffte und zusammengepreßte schlauchtormige Hülle - Google Patents
Geraffte und zusammengepreßte schlauchtormige HülleInfo
- Publication number
- DE2338418B2 DE2338418B2 DE2338418A DE2338418A DE2338418B2 DE 2338418 B2 DE2338418 B2 DE 2338418B2 DE 2338418 A DE2338418 A DE 2338418A DE 2338418 A DE2338418 A DE 2338418A DE 2338418 B2 DE2338418 B2 DE 2338418B2
- Authority
- DE
- Germany
- Prior art keywords
- casing
- barrier layer
- gathered
- tubular
- coating
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 230000004888 barrier function Effects 0.000 claims description 22
- 239000001913 cellulose Substances 0.000 claims description 6
- 229920002678 cellulose Polymers 0.000 claims description 6
- 239000004627 regenerated cellulose Substances 0.000 claims description 3
- 239000010410 layer Substances 0.000 description 24
- 239000011248 coating agent Substances 0.000 description 16
- 238000000576 coating method Methods 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 229920001577 copolymer Polymers 0.000 description 7
- 235000013305 food Nutrition 0.000 description 6
- 238000000034 method Methods 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- 238000012545 processing Methods 0.000 description 4
- 235000013580 sausages Nutrition 0.000 description 4
- 239000000853 adhesive Substances 0.000 description 3
- 230000001070 adhesive effect Effects 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 2
- 239000004677 Nylon Substances 0.000 description 2
- 239000012790 adhesive layer Substances 0.000 description 2
- 230000032683 aging Effects 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 235000015250 liver sausages Nutrition 0.000 description 2
- 229920001778 nylon Polymers 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 230000035699 permeability Effects 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- -1 polyethylene terephthalate Polymers 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 230000035882 stress Effects 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- PYGXAGIECVVIOZ-UHFFFAOYSA-N Dibutyl decanedioate Chemical compound CCCCOC(=O)CCCCCCCCC(=O)OCCCC PYGXAGIECVVIOZ-UHFFFAOYSA-N 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000012237 artificial material Substances 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 229920006026 co-polymeric resin Polymers 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920005672 polyolefin resin Polymers 0.000 description 1
- 229920005749 polyurethane resin Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 235000021067 refined food Nutrition 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A22—BUTCHERING; MEAT TREATMENT; PROCESSING POULTRY OR FISH
- A22C—PROCESSING MEAT, POULTRY, OR FISH
- A22C13/00—Sausage casings
-
- A—HUMAN NECESSITIES
- A22—BUTCHERING; MEAT TREATMENT; PROCESSING POULTRY OR FISH
- A22C—PROCESSING MEAT, POULTRY, OR FISH
- A22C13/00—Sausage casings
- A22C13/0013—Chemical composition of synthetic sausage casings
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Food Science & Technology (AREA)
- Processing Of Meat And Fish (AREA)
- Containers And Plastic Fillers For Packaging (AREA)
- Laminated Bodies (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US276919A US3886979A (en) | 1972-08-01 | 1972-08-01 | Shirred tubular food casings having a barrier coating |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2338418A1 DE2338418A1 (de) | 1974-02-21 |
| DE2338418B2 true DE2338418B2 (de) | 1979-05-31 |
Family
ID=23058633
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2338418A Ceased DE2338418B2 (de) | 1972-08-01 | 1973-07-28 | Geraffte und zusammengepreßte schlauchtormige Hülle |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3886979A (enFirst) |
| JP (1) | JPS5345756B2 (enFirst) |
| AT (1) | AT341873B (enFirst) |
| BE (1) | BE803079A (enFirst) |
| BR (1) | BR7305794D0 (enFirst) |
| CA (1) | CA1005683A (enFirst) |
| CH (1) | CH581954A5 (enFirst) |
| DE (1) | DE2338418B2 (enFirst) |
| DK (1) | DK152956C (enFirst) |
| FI (1) | FI57340C (enFirst) |
| FR (1) | FR2194549B1 (enFirst) |
| GB (1) | GB1444442A (enFirst) |
| IT (1) | IT991925B (enFirst) |
| NL (1) | NL7310592A (enFirst) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2512994C3 (de) * | 1975-03-24 | 1979-03-01 | Hoechst Ag, 6000 Frankfurt | Folienschlauch, insbesondere Verpackungshülle, sowie Verfahren zu seiner Herstellung und seine Verwendung |
| US4867204A (en) * | 1976-05-13 | 1989-09-19 | Viskase Corporation | Moisturized tubular cellulosic food casing and process for preparing |
| CA1096230A (en) * | 1976-05-13 | 1981-02-24 | David E. Ellis | Tubular cellulosic food casing |
| FI63661B (fi) * | 1976-10-15 | 1983-04-29 | Union Carbide Corp | Stort utan bloetning fyllbart cellulosahoelje foer foedoaemnen |
| US4162557A (en) * | 1976-12-23 | 1979-07-31 | Union Carbide Corporation | Process for turning a coated casing inside out |
| FI780226A7 (fi) * | 1977-01-27 | 1978-07-28 | Union Carbide Corp | Pao foerhand fuktat cellulosahoelje |
| DE2860840D1 (en) * | 1977-08-05 | 1981-10-22 | Hoechst Ag | Tubular casing based on cellulose hydrate, especially package cassing e.g. saurage casing and process for its manufacture |
| US4296142A (en) * | 1978-06-26 | 1981-10-20 | Union Carbide Corporation | Method for coating a tubular food casing |
| DE2832926A1 (de) * | 1978-07-27 | 1980-02-07 | Hoechst Ag | Cellulosehydratschlauch mit alterungsbestaendiger sperrschicht aus synthetischem copolymerisat auf der aussenseite sowie verfahren zu seiner herstellung |
| DE2912720A1 (de) * | 1979-03-30 | 1980-10-09 | Hoechst Ag | Funktionelle einheit, umfassend einen hohlstab aus laengsweise geraffter, flexibler, schlauchfoermiger verpackungshuelle auf basis von cellulosehydrat mit hohem wassergehalt und den hohlstab umgebende stuetz- und schutzhuelle |
| DE3012252C2 (de) | 1980-03-28 | 1982-09-23 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung eines Schlauchs auf Basis von Cellulosehydrat mit einem Überzug auf der Innenseite sowie Vorrichtung zur Durchführung des Verfahrens und Verwendung des Schlauchs |
| DE3108795A1 (de) * | 1981-03-07 | 1982-09-16 | Hoechst Ag, 6000 Frankfurt | Fuer lebensmittel, insbesondere wurstwaren, geeignete faserverstaerkte schlauchhuelle und verfahren zu ihrer herstellung |
| DE3113959C2 (de) | 1981-04-07 | 1983-02-03 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Innenbeschichtung eines Schlauchs sowie Anordnung zur Durchführung des Verfahrens |
| JPS5929614U (ja) * | 1982-08-19 | 1984-02-24 | 旭化成株式会社 | 床暖房放熱装置 |
| JPS6337917U (enFirst) * | 1986-08-28 | 1988-03-11 | ||
| JPS6337918U (enFirst) * | 1986-08-28 | 1988-03-11 | ||
| JPS6337916U (enFirst) * | 1986-08-28 | 1988-03-11 | ||
| YU6299A (en) * | 1996-08-09 | 1999-11-22 | Heinz & Stemmler Andreas Stemmler | Method of coating long-keeping-sausages and hard cheeses |
| DE19742719A1 (de) | 1997-09-26 | 1999-04-01 | Kalle Nalo Gmbh | Innenbeschichtete Nahrungsmittelhüllen auf Basis von regenerierter Cellulose |
| RU2131670C1 (ru) * | 1998-08-28 | 1999-06-20 | Общество С Ограниченной Ответственностью Производственно-Коммерческая Фирма "Атлантис-Пак" | Легкоснимаемая рукавная колбасно-сосисочная оболочка |
| EP3497157B1 (en) * | 2016-10-03 | 2020-09-16 | Viskase Companies, Inc. | Method of manufacturing food packaging plastic films and food packaging plastic films thus produced |
| WO2018067110A1 (en) | 2016-10-03 | 2018-04-12 | Viskase Companies, Inc. | Method of manufacturing food packaging cellulosic films and food packaging cellulosic films thus produced |
Family Cites Families (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE189794C1 (enFirst) * | 1964-01-01 | |||
| SE192992C1 (enFirst) * | 1964-01-01 | |||
| US2105773A (en) * | 1931-01-17 | 1938-01-18 | Gottlieb R Magney | Humidifier with truncated cones |
| US2144889A (en) * | 1936-12-03 | 1939-01-24 | M A Ferst Ltd | Vehicle supporting structure |
| US2201457A (en) * | 1937-05-03 | 1940-05-21 | Visking Corp | Moistureproof sausage casing and method of making same |
| US2477611A (en) * | 1948-03-09 | 1949-08-02 | Dow Chemical Co | Vinylidene chloride-vinyl chloride copolymer composition for making shrinkable, translucent films |
| NL98488C (enFirst) * | 1955-10-12 | |||
| BE551624A (enFirst) * | 1955-10-13 | |||
| NL244482A (enFirst) * | 1958-10-20 | |||
| LU37923A1 (enFirst) * | 1958-11-17 | |||
| US3135613A (en) * | 1959-08-17 | 1964-06-02 | Union Carbide Corp | Impregnated paper web and method of making sausage casings therefrom |
| BE633564A (enFirst) * | 1962-06-13 | |||
| US3378379A (en) * | 1963-05-21 | 1968-04-16 | Union Carbide Corp | Food casing and method of producing same |
| NL138341C (enFirst) * | 1963-05-22 | |||
| NL130708C (enFirst) * | 1963-06-14 | |||
| SE318101B (enFirst) * | 1963-09-12 | 1969-12-01 | Union Carbide Corp | |
| DE1571022C3 (de) * | 1963-11-14 | 1976-01-08 | Hoechst Ag, 6000 Frankfurt | Verfahren zum kontinuierlichen Beschichten von thermoplastischen Polyesterfolien |
| US3328330A (en) * | 1964-03-09 | 1967-06-27 | Grace W R & Co | Vinylidene chloride copolymer latices |
| DK112148B (da) * | 1964-07-23 | 1968-11-11 | Wolff & Co Kg | Krympedygtig kunsttarm, og fremgangsmåde til dennes fremstilling. |
| US3397069A (en) * | 1964-12-15 | 1968-08-13 | Union Carbide Corp | Coherent self-sustaining stick of shirred and compressed tubular sausage casing |
| US3451827A (en) * | 1965-11-22 | 1969-06-24 | Tee Pak Inc | Method of coating the interior of a sausage casing |
| US3433633A (en) * | 1967-03-15 | 1969-03-18 | Polaroid Corp | Photographic products and processes |
| FI48682C (fi) * | 1967-12-18 | 1974-12-10 | Hoechst Ag | Menetelmä ja laite letkun jatkuvaksi sisäpuoliseksi päällystämiseksi. |
| US3794515A (en) * | 1968-04-03 | 1974-02-26 | Tee Pak Inc | Saran coating of cellulosic casing |
| IE33888B1 (en) * | 1969-01-06 | 1974-11-27 | Union Carbide Corp | Method of producing flexible regenerated cellulosic tubing and tubing obtained by the method |
| US3657769A (en) * | 1969-12-29 | 1972-04-25 | Tee Pak Inc | Humidification of synthetic sausage casings |
-
1972
- 1972-08-01 US US276919A patent/US3886979A/en not_active Expired - Lifetime
-
1973
- 1973-07-06 CA CA175,974A patent/CA1005683A/en not_active Expired
- 1973-07-28 DE DE2338418A patent/DE2338418B2/de not_active Ceased
- 1973-07-31 BR BR5794/73A patent/BR7305794D0/pt unknown
- 1973-07-31 CH CH1115073A patent/CH581954A5/xx not_active IP Right Cessation
- 1973-07-31 JP JP8555773A patent/JPS5345756B2/ja not_active Expired
- 1973-07-31 FR FR7327968A patent/FR2194549B1/fr not_active Expired
- 1973-07-31 AT AT671773A patent/AT341873B/de not_active IP Right Cessation
- 1973-07-31 FI FI2416/73A patent/FI57340C/fi active
- 1973-07-31 GB GB3634173A patent/GB1444442A/en not_active Expired
- 1973-07-31 NL NL7310592A patent/NL7310592A/xx unknown
- 1973-07-31 BE BE134117A patent/BE803079A/xx not_active IP Right Cessation
- 1973-07-31 DK DK419973A patent/DK152956C/da not_active IP Right Cessation
- 1973-07-31 IT IT69318/73A patent/IT991925B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| NL7310592A (enFirst) | 1974-02-05 |
| IT991925B (it) | 1975-08-30 |
| CH581954A5 (enFirst) | 1976-11-30 |
| FR2194549A1 (enFirst) | 1974-03-01 |
| JPS5345756B2 (enFirst) | 1978-12-08 |
| BE803079A (fr) | 1974-01-31 |
| DE2338418A1 (de) | 1974-02-21 |
| JPS4952088A (enFirst) | 1974-05-21 |
| DK152956C (da) | 1988-10-24 |
| ATA671773A (de) | 1977-06-15 |
| FR2194549B1 (enFirst) | 1976-06-18 |
| FI57340B (fi) | 1980-04-30 |
| DK152956B (da) | 1988-06-06 |
| AU5870673A (en) | 1975-02-06 |
| CA1005683A (en) | 1977-02-22 |
| GB1444442A (en) | 1976-07-28 |
| FI57340C (fi) | 1980-08-11 |
| US3886979A (en) | 1975-06-03 |
| BR7305794D0 (pt) | 1974-07-25 |
| AT341873B (de) | 1978-03-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2338418B2 (de) | Geraffte und zusammengepreßte schlauchtormige Hülle | |
| DE69305565T2 (de) | Verpackung für vorgekochte Nahrungsmittel | |
| DE4002083A1 (de) | Flaechen- oder schlauchfoermige folie auf basis von cellulosehydrat | |
| DE3732021A1 (de) | Flache nahrungsmittelhuellen aus faseriger cellulose mit einem geringen gesamtgehalt an weichmacher | |
| EP1703798B1 (de) | Proteinhaltige, schlauchförmige nahrungsmittelhülle mit innenverstärkung | |
| EP0101892A1 (de) | Leichtschälbare Wursthülle mit einer Klebenaht, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0100056B1 (de) | Schlauchförmige Lebensmittelhülle, insbesondere Wursthülle | |
| EP0008646B1 (de) | Cellulosehydratschlauch mit alterungsbeständiger Sperrschicht aus synthetischem Copolymerisat auf der Aussenseite sowie Verfahren zu seiner Herstellung und seine Verwendung | |
| DE2646619A1 (de) | Verfahren zur bereitung von wursthuellen | |
| DE2721427C2 (de) | Verfahren zum Herstellen einer Lebensmittelhülle aus Zellulose | |
| DE1492699A1 (de) | Huellen fuer Fleischwaren und Verfahren zu deren Herstellung | |
| DE3743656C2 (enFirst) | ||
| DE3343635A1 (de) | Folie aus faserverstaerkter regenerierter cellulose mit gasundurchlaessiger schicht zur herstellung von schlauchhuellen | |
| DE3310707C2 (enFirst) | ||
| DE3538702A1 (de) | Sauerstoff- und wasserdampfundurchlaessige folie zur herstellung geraffter schlauchhuellen, insbesondere wursthuellen | |
| DE69413150T2 (de) | Faserige Nahrungsmittelhülle mit verbesserten Abschälungseigenschaften und Verfahren zur Herstellung davon | |
| DE2756683A1 (de) | Verfahren zum umdrehen eines langgestreckten flexiblen schlauches | |
| DE2352553C3 (de) | Verwendung eines PA-PE Verbundschlauches als Wursthülle für Brühwürste | |
| EP0378069B1 (de) | Schlauchförmige Nahrungsmittelhülle aus Cellulosehydrat, insbesondere künstliche Wursthülle | |
| EP1524908B1 (de) | Schlauchförmige, essbare nahrungsmittelhülle, hergestellt nach dem aminoxidverfahren | |
| DE2745991A1 (de) | Nahrungsmittelhuelle aus zellulose | |
| DE4127604A1 (de) | Schlauchfoermige nahrungsmittelhuelle mit verbesserten hafteigenschaften gegenueber dem fuellgut | |
| DE10054882A1 (de) | Verpackungshülle für Fleischprodukte | |
| DE2803043A1 (de) | Nahrungsmittelhuelle aus zellulose | |
| EP0068349B1 (de) | Zweischichtige Wursthülle aus einem äusseren Textilgewebe und einer innenliegenden Kollagenbeschichtung und Verfahren zu ihrer Herstellung sowie unter Verwendung dieser Wursthülle hergestellte Roh- und Brühwurst |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8235 | Patent refused |