DE2335080A1 - Neue cyclohexenonester, verfahren zu ihrer herstellung und diese ester enthaltende arzneimittel - Google Patents
Neue cyclohexenonester, verfahren zu ihrer herstellung und diese ester enthaltende arzneimittelInfo
- Publication number
- DE2335080A1 DE2335080A1 DE19732335080 DE2335080A DE2335080A1 DE 2335080 A1 DE2335080 A1 DE 2335080A1 DE 19732335080 DE19732335080 DE 19732335080 DE 2335080 A DE2335080 A DE 2335080A DE 2335080 A1 DE2335080 A1 DE 2335080A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- formula
- ester
- oxo
- alkyl group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000002148 esters Chemical class 0.000 title claims description 22
- 238000000034 method Methods 0.000 title claims description 22
- 238000004519 manufacturing process Methods 0.000 title description 2
- 229940126601 medicinal product Drugs 0.000 title description 2
- -1 hydroxyalkoxyalkoxy Chemical group 0.000 claims description 67
- 150000001875 compounds Chemical class 0.000 claims description 48
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 39
- 125000000217 alkyl group Chemical group 0.000 claims description 35
- 238000006243 chemical reaction Methods 0.000 claims description 32
- 239000002253 acid Substances 0.000 claims description 23
- 229910052739 hydrogen Inorganic materials 0.000 claims description 21
- 150000003839 salts Chemical class 0.000 claims description 21
- 239000001257 hydrogen Substances 0.000 claims description 20
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohex-2-enone Chemical class O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 claims description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 17
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 15
- 125000003118 aryl group Chemical group 0.000 claims description 13
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 13
- 150000002431 hydrogen Chemical class 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 150000002085 enols Chemical class 0.000 claims description 12
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 11
- 125000004494 ethyl ester group Chemical group 0.000 claims description 11
- 150000004820 halides Chemical class 0.000 claims description 9
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 8
- 239000007858 starting material Substances 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 239000003814 drug Substances 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- 125000003944 tolyl group Chemical group 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 150000002576 ketones Chemical class 0.000 claims description 5
- 229910052717 sulfur Chemical group 0.000 claims description 5
- 150000003573 thiols Chemical class 0.000 claims description 5
- 239000004480 active ingredient Substances 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- 238000005804 alkylation reaction Methods 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 229910021645 metal ion Inorganic materials 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 239000004094 surface-active agent Substances 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000005083 alkoxyalkoxy group Chemical group 0.000 claims description 2
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 2
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 claims description 2
- KIWVTIOKMDRCLB-UHFFFAOYSA-N ethyl 1-[2-(dimethylamino)ethyl]-4-ethoxy-2-oxo-6-phenylcyclohex-3-ene-1-carboxylate Chemical compound C1C(OCC)=CC(=O)C(C(=O)OCC)(CCN(C)C)C1C1=CC=CC=C1 KIWVTIOKMDRCLB-UHFFFAOYSA-N 0.000 claims description 2
- LYKUHJVSOCSSNR-UHFFFAOYSA-N ethyl 4-ethoxy-6-(4-methylphenyl)-2-oxocyclohex-3-ene-1-carboxylate Chemical compound C1C(OCC)=CC(=O)C(C(=O)OCC)C1C1=CC=C(C)C=C1 LYKUHJVSOCSSNR-UHFFFAOYSA-N 0.000 claims description 2
- 230000002140 halogenating effect Effects 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000005113 hydroxyalkoxy group Chemical group 0.000 claims description 2
- 239000007927 intramuscular injection Substances 0.000 claims description 2
- 238000010255 intramuscular injection Methods 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- 150000002825 nitriles Chemical class 0.000 claims description 2
- 230000020477 pH reduction Effects 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 125000005017 substituted alkenyl group Chemical group 0.000 claims description 2
- 125000005415 substituted alkoxy group Chemical group 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical class O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims 1
- 239000002671 adjuvant Substances 0.000 claims 1
- 229920005556 chlorobutyl Polymers 0.000 claims 1
- ZRTSTJAFVXPQLC-UHFFFAOYSA-N ethyl 4-ethoxy-6-(3-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate Chemical compound C1C(OCC)=CC(=O)C(C(=O)OCC)C1C1=CC=CC(OC)=C1 ZRTSTJAFVXPQLC-UHFFFAOYSA-N 0.000 claims 1
- 125000002541 furyl group Chemical group 0.000 claims 1
- 238000001990 intravenous administration Methods 0.000 claims 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 claims 1
- GFTRBVNZPKTVMB-UHFFFAOYSA-N methyl 4-ethoxy-6-(4-methylphenyl)-2-oxocyclohex-3-ene-1-carboxylate Chemical compound C1C(OCC)=CC(=O)C(C(=O)OC)C1C1=CC=C(C)C=C1 GFTRBVNZPKTVMB-UHFFFAOYSA-N 0.000 claims 1
- 230000000144 pharmacologic effect Effects 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 64
- 239000000203 mixture Substances 0.000 description 32
- 239000000243 solution Substances 0.000 description 31
- 238000002844 melting Methods 0.000 description 28
- 230000008018 melting Effects 0.000 description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 22
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 20
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- 239000012043 crude product Substances 0.000 description 13
- 239000011734 sodium Substances 0.000 description 11
- 229910052708 sodium Inorganic materials 0.000 description 11
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- 241000551547 Dione <red algae> Species 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- WDJHALXBUFZDSR-UHFFFAOYSA-N acetoacetic acid Chemical class CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 9
- 238000001953 recrystallisation Methods 0.000 description 9
- 238000010992 reflux Methods 0.000 description 9
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 9
- 159000000000 sodium salts Chemical class 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- 229910000029 sodium carbonate Inorganic materials 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 6
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- 238000002211 ultraviolet spectrum Methods 0.000 description 6
- 241001342522 Vampyrum spectrum Species 0.000 description 5
- 230000003444 anaesthetic effect Effects 0.000 description 5
- 239000012259 ether extract Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- 206010002091 Anaesthesia Diseases 0.000 description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- 230000037005 anaesthesia Effects 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 238000007363 ring formation reaction Methods 0.000 description 4
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 229940093495 ethanethiol Drugs 0.000 description 3
- 150000002366 halogen compounds Chemical class 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 238000004237 preparative chromatography Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000011241 protective layer Substances 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- IUJDSEJGGMCXSG-UHFFFAOYSA-N Thiopental Chemical compound CCCC(C)C1(CC)C(=O)NC(=S)NC1=O IUJDSEJGGMCXSG-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000003193 general anesthetic agent Substances 0.000 description 2
- 230000006698 induction Effects 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052987 metal hydride Inorganic materials 0.000 description 2
- 150000004681 metal hydrides Chemical class 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- WPSNJCPNIUVDHW-BQYQJAHWSA-N (e)-4-(2-methylphenyl)but-3-en-2-one Chemical compound CC(=O)\C=C\C1=CC=CC=C1C WPSNJCPNIUVDHW-BQYQJAHWSA-N 0.000 description 1
- GBKGJMYPQZODMI-SNAWJCMRSA-N (e)-4-(furan-2-yl)but-3-en-2-one Chemical compound CC(=O)\C=C\C1=CC=CO1 GBKGJMYPQZODMI-SNAWJCMRSA-N 0.000 description 1
- LQLJZSJKRYTKTP-UHFFFAOYSA-N 2-dimethylaminoethyl chloride hydrochloride Chemical compound Cl.CN(C)CCCl LQLJZSJKRYTKTP-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- BQJFBHBDOAIIGS-HJWRWDBZSA-N 3-methyl-4-phenyl-3-buten-2-one Chemical compound CC(=O)C(\C)=C/C1=CC=CC=C1 BQJFBHBDOAIIGS-HJWRWDBZSA-N 0.000 description 1
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 1
- JCTPLVWHJQUYBY-UHFFFAOYSA-N 4-pyridin-4-ylbut-3-en-2-one Chemical compound CC(=O)C=CC1=CC=NC=C1 JCTPLVWHJQUYBY-UHFFFAOYSA-N 0.000 description 1
- 241000531891 Alburnus alburnus Species 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- KBEBGUQPQBELIU-CMDGGOBGSA-N Ethyl cinnamate Chemical compound CCOC(=O)\C=C\C1=CC=CC=C1 KBEBGUQPQBELIU-CMDGGOBGSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- 238000006845 Michael addition reaction Methods 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- 241000711981 Sais Species 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-M acetoacetate Chemical compound CC(=O)CC([O-])=O WDJHALXBUFZDSR-UHFFFAOYSA-M 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 229940035674 anesthetics Drugs 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- KBEBGUQPQBELIU-UHFFFAOYSA-N cinnamic acid ethyl ester Natural products CCOC(=O)C=CC1=CC=CC=C1 KBEBGUQPQBELIU-UHFFFAOYSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 238000005837 enolization reaction Methods 0.000 description 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- IMKVSWPEZCELRM-CMDGGOBGSA-N ethyl (e)-3-(4-methylphenyl)prop-2-enoate Chemical compound CCOC(=O)\C=C\C1=CC=C(C)C=C1 IMKVSWPEZCELRM-CMDGGOBGSA-N 0.000 description 1
- NIUIOGUZYGVBDV-UHFFFAOYSA-N ethyl 2-(2-methylphenyl)-4,6-dioxocyclohexane-1-carboxylate Chemical compound C1C(=O)CC(=O)C(C(=O)OCC)C1C1=CC=CC=C1C NIUIOGUZYGVBDV-UHFFFAOYSA-N 0.000 description 1
- CPFQRJDFXLQNAD-UHFFFAOYSA-N ethyl 2-(4-methylphenyl)-4,6-dioxocyclohexane-1-carboxylate Chemical compound C1C(=O)CC(=O)C(C(=O)OCC)C1C1=CC=C(C)C=C1 CPFQRJDFXLQNAD-UHFFFAOYSA-N 0.000 description 1
- YNLQURMLYFGCDV-UHFFFAOYSA-N ethyl 2-(furan-2-yl)-4,6-dioxocyclohexane-1-carboxylate Chemical compound C1C(=O)CC(=O)C(C(=O)OCC)C1C1=CC=CO1 YNLQURMLYFGCDV-UHFFFAOYSA-N 0.000 description 1
- PZEAIQIDRYBWDW-UHFFFAOYSA-N ethyl 2-cyclohex-3-en-1-yl-1-methyl-4,6-dioxocyclohexane-1-carboxylate Chemical compound C1C(=O)CC(=O)C(C(=O)OCC)(C)C1C1CC=CCC1 PZEAIQIDRYBWDW-UHFFFAOYSA-N 0.000 description 1
- FNENWZWNOPCZGK-UHFFFAOYSA-N ethyl 2-methyl-3-oxobutanoate Chemical compound CCOC(=O)C(C)C(C)=O FNENWZWNOPCZGK-UHFFFAOYSA-N 0.000 description 1
- BOIWYTYYWPXGAT-UHFFFAOYSA-N ethyl 2-phenylprop-2-enoate Chemical compound CCOC(=O)C(=C)C1=CC=CC=C1 BOIWYTYYWPXGAT-UHFFFAOYSA-N 0.000 description 1
- YOOQVENYBWCBFM-UHFFFAOYSA-N ethyl 3-(cyclohexen-1-yl)prop-2-enoate Chemical compound CCOC(=O)C=CC1=CCCCC1 YOOQVENYBWCBFM-UHFFFAOYSA-N 0.000 description 1
- RWCZHRMVVBLZQD-UHFFFAOYSA-N ethyl 3-methyl-4,6-dioxo-2-phenylcyclohexane-1-carboxylate Chemical compound CC1C(=O)CC(=O)C(C(=O)OCC)C1C1=CC=CC=C1 RWCZHRMVVBLZQD-UHFFFAOYSA-N 0.000 description 1
- YSAFJZHMOCZSMT-UHFFFAOYSA-N ethyl 4-chloro-6-(4-methylphenyl)-2-oxocyclohex-3-ene-1-carboxylate Chemical compound C1C(Cl)=CC(=O)C(C(=O)OCC)C1C1=CC=C(C)C=C1 YSAFJZHMOCZSMT-UHFFFAOYSA-N 0.000 description 1
- BPDADECIALRGJY-UHFFFAOYSA-N ethyl 4-ethoxy-2-oxo-5-phenylcyclohex-3-ene-1-carboxylate Chemical compound CCOC1=CC(=O)C(C(=O)OCC)CC1C1=CC=CC=C1 BPDADECIALRGJY-UHFFFAOYSA-N 0.000 description 1
- GCDHEAKPIYXHJP-UHFFFAOYSA-N ethyl 4-ethoxy-5-methyl-2-oxo-6-phenylcyclohex-3-ene-1-carboxylate Chemical compound CC1C(OCC)=CC(=O)C(C(=O)OCC)C1C1=CC=CC=C1 GCDHEAKPIYXHJP-UHFFFAOYSA-N 0.000 description 1
- JQQBSBZVIVWXEP-UHFFFAOYSA-N ethyl 4-ethoxy-6-(2-methylphenyl)-2-oxocyclohex-3-ene-1-carboxylate Chemical compound C1C(OCC)=CC(=O)C(C(=O)OCC)C1C1=CC=CC=C1C JQQBSBZVIVWXEP-UHFFFAOYSA-N 0.000 description 1
- PTZUTNGZXLIKAD-UHFFFAOYSA-N ethyl 4-ethylsulfanyl-6-(4-methylphenyl)-2-oxocyclohex-3-ene-1-carboxylate Chemical compound C1C(SCC)=CC(=O)C(C(=O)OCC)C1C1=CC=C(C)C=C1 PTZUTNGZXLIKAD-UHFFFAOYSA-N 0.000 description 1
- IMKVSWPEZCELRM-UHFFFAOYSA-N ethyl p-methylcinnamate Natural products CCOC(=O)C=CC1=CC=C(C)C=C1 IMKVSWPEZCELRM-UHFFFAOYSA-N 0.000 description 1
- 238000002695 general anesthesia Methods 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- TVDSBUOJIPERQY-UHFFFAOYSA-N prop-2-yn-1-ol Chemical compound OCC#C TVDSBUOJIPERQY-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000028527 righting reflex Effects 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/74—Esters of carboxylic acids having an esterified carboxyl group bound to a carbon atom of a ring other than a six-membered aromatic ring
- C07C69/757—Esters of carboxylic acids having an esterified carboxyl group bound to a carbon atom of a ring other than a six-membered aromatic ring having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/55—Acids; Esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/65—One oxygen atom attached in position 3 or 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/30—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/16—Systems containing only non-condensed rings with a six-membered ring the ring being unsaturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3307072A GB1416705A (en) | 1972-07-14 | 1972-07-14 | Keto-esters |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2335080A1 true DE2335080A1 (de) | 1974-01-31 |
Family
ID=10348151
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732335080 Pending DE2335080A1 (de) | 1972-07-14 | 1973-07-10 | Neue cyclohexenonester, verfahren zu ihrer herstellung und diese ester enthaltende arzneimittel |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3997590A (enExample) |
| JP (1) | JPS4985051A (enExample) |
| BE (1) | BE802240A (enExample) |
| CA (1) | CA999593A (enExample) |
| CH (1) | CH598186A5 (enExample) |
| DE (1) | DE2335080A1 (enExample) |
| ES (1) | ES416909A1 (enExample) |
| FR (1) | FR2192824B1 (enExample) |
| GB (1) | GB1416705A (enExample) |
| IE (1) | IE38088B1 (enExample) |
| LU (1) | LU68019A1 (enExample) |
| NL (1) | NL7309899A (enExample) |
| ZA (1) | ZA734415B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4945178A (en) * | 1986-02-03 | 1990-07-31 | Eastman Kodak Company | Preparation of 4-carboalkoxy-1,3-cyclohexanedione type compounds |
| US5041613A (en) * | 1989-08-28 | 1991-08-20 | Eastman Kodak Company | Organic compositions and their manufacture |
| US5225589A (en) * | 1989-08-28 | 1993-07-06 | Eastman Kodak Company | Organic compositions and their manufacture |
| US5260301A (en) * | 1990-03-01 | 1993-11-09 | Fujisawa Pharmaceutical Co., Ltd. | Pharmaceutical solution containing FK-506 |
| DE102005052501A1 (de) * | 2005-11-03 | 2007-05-16 | Univ Ernst Moritz Arndt | Neue Leitstrukturen für zytostatische Verbindungen auf Basis von Spiroverbindungen |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB924256A (en) | 1960-10-19 | 1963-04-24 | Basil Charles Leicester Weedon | Cyclopentane derivatives and a process for the manufacture thereof |
-
1972
- 1972-07-14 GB GB3307072A patent/GB1416705A/en not_active Expired
-
1973
- 1973-06-26 IE IE1066/73A patent/IE38088B1/xx unknown
- 1973-06-28 ZA ZA734415A patent/ZA734415B/xx unknown
- 1973-06-28 US US05/374,817 patent/US3997590A/en not_active Expired - Lifetime
- 1973-07-06 CA CA175,800A patent/CA999593A/en not_active Expired
- 1973-07-10 DE DE19732335080 patent/DE2335080A1/de active Pending
- 1973-07-11 CH CH1013073A patent/CH598186A5/xx not_active IP Right Cessation
- 1973-07-12 BE BE133385A patent/BE802240A/xx unknown
- 1973-07-12 FR FR7325553A patent/FR2192824B1/fr not_active Expired
- 1973-07-13 ES ES416909A patent/ES416909A1/es not_active Expired
- 1973-07-13 LU LU68019A patent/LU68019A1/xx unknown
- 1973-07-14 JP JP48079750A patent/JPS4985051A/ja active Pending
- 1973-07-16 NL NL7309899A patent/NL7309899A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU5785073A (en) | 1975-01-09 |
| NL7309899A (enExample) | 1974-01-16 |
| JPS4985051A (enExample) | 1974-08-15 |
| ZA734415B (en) | 1974-06-26 |
| BE802240A (fr) | 1973-11-05 |
| FR2192824A1 (enExample) | 1974-02-15 |
| US3997590A (en) | 1976-12-14 |
| ES416909A1 (es) | 1976-06-16 |
| IE38088L (en) | 1974-01-14 |
| FR2192824B1 (enExample) | 1976-08-13 |
| CA999593A (en) | 1976-11-09 |
| IE38088B1 (en) | 1977-12-21 |
| LU68019A1 (enExample) | 1973-09-14 |
| CH598186A5 (enExample) | 1978-04-28 |
| GB1416705A (en) | 1975-12-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1543427C3 (enExample) | ||
| DE2651500A1 (de) | Di(phenoxy-2 alkancarbonsaeuren), verfahren zu deren herstellung und diese enthaltende arzneimittel | |
| DE2047658B2 (de) | 2-Styryl- und 2-Phenyläthinylbenzylaminderivate, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| DE2009408A1 (de) | 5-Pyridyl-2-imidazolone | |
| DE1445837A1 (de) | Verfahren zur Herstellung von neuen Piperidinderivaten | |
| DE2637098A1 (de) | Phenoxyalkylcarbonsaeurederivate und verfahren zu ihrer herstellung | |
| DE2335080A1 (de) | Neue cyclohexenonester, verfahren zu ihrer herstellung und diese ester enthaltende arzneimittel | |
| DE2035186B2 (de) | 4' Tetrahydropyranyl bzw Tetra hydrothiapyranyl phenylessigsauredenvate und diese enthaltende Arzneimittel | |
| DD147234A5 (de) | Verfahren zur herstellung eines alkenderivates | |
| DE1470314C3 (enExample) | ||
| DE3129718C2 (enExample) | ||
| DE2000030B2 (de) | 3 Alkoxy und 3 Phenoxy 2 (diphenyl hydroxy)methyl propylamine und diese enthaltende Arzneimittel | |
| DE2039426B2 (enExample) | ||
| DE2640884A1 (de) | Neue entzuendungshemmende l-oxo-isoindolin-derivate und verfahren zu ihrer herstellung | |
| DE2521920A1 (de) | Neue derivate von 1h-triazolo(4,5-c) pyridin-7-carbonsaeuren und -saeureestern | |
| DE2164662A1 (de) | Indanderivate und Verfahren zu ihrer Herstellung | |
| DE2020762A1 (de) | Azainden-3-niedrigaliphatische-Saeuren und Verfahren zu deren Herstellung | |
| DE2157694C3 (de) | Phenylessigsäurederivate, Verfahren zu ihrer Herstellung und Phenylessigsäurederivate enthaltende pharmazeutische Zubereitungen | |
| DE1695731A1 (de) | Neue organische Verbindungen | |
| DE2142196C3 (de) | 3- (N- Acyl-indoly I) -essigsäurederivate, Verfahren zu ihrer Herstellung und Arzneipräparate | |
| DE2536675A1 (de) | Neue 3-(4-thieno-bzw.-furo eckige klammer auf 3,2-c eckige klammer zu pyridinyloxy) -2- propanol-derivate, ihre verwendung und herstellung | |
| DE2243444C3 (de) | 4-(3'-Benzoylphenyl)-butter - oder -butensäurederivate, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE1695080A1 (de) | Verfahren zur Herstellung von neuen N-heterocyclischen Verbindungen | |
| DE1795671C3 (de) | Verfahren zur Herstellung von i-Acyl-3-indolylcarbonsäureverbindungen | |
| DE1793216C3 (de) | 2-Oxa-3-oxo-13 ß -äthyl-gona-4,9, 11-triene, Verfahren zu deren Herstellung und diese enthaltende pharmazeut ische Zusammensetzungen sowie 13 ß -Äthyl-des-A-gonen-Verbindungen als Zwischenprodukte |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHA | Expiration of time for request for examination |