DE2330087C3 - Verfahren zur Herstellung von 1,2-Diazacyclododecatrienen-(1,5,9) oder l^-Diazacyclododecaenen-d) - Google Patents
Verfahren zur Herstellung von 1,2-Diazacyclododecatrienen-(1,5,9) oder l^-Diazacyclododecaenen-d)Info
- Publication number
- DE2330087C3 DE2330087C3 DE2330087A DE2330087A DE2330087C3 DE 2330087 C3 DE2330087 C3 DE 2330087C3 DE 2330087 A DE2330087 A DE 2330087A DE 2330087 A DE2330087 A DE 2330087A DE 2330087 C3 DE2330087 C3 DE 2330087C3
- Authority
- DE
- Germany
- Prior art keywords
- hydrazine
- general formula
- mol
- reaction
- nickel
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 17
- 238000002360 preparation method Methods 0.000 title claims description 3
- 238000006243 chemical reaction Methods 0.000 description 34
- 229910052739 hydrogen Inorganic materials 0.000 description 23
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 22
- -1 nitro, Cyano, phenyl Chemical group 0.000 description 20
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 18
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 229910052757 nitrogen Inorganic materials 0.000 description 18
- 239000003054 catalyst Substances 0.000 description 17
- 150000001875 compounds Chemical class 0.000 description 16
- 238000001228 spectrum Methods 0.000 description 16
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 15
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 125000000217 alkyl group Chemical group 0.000 description 11
- 239000012634 fragment Substances 0.000 description 11
- 239000013078 crystal Substances 0.000 description 10
- 238000004821 distillation Methods 0.000 description 9
- 229910052759 nickel Inorganic materials 0.000 description 9
- CWLGEPSKQDNHIO-JOBJLJCHSA-N (e)-n-[(e)-benzylideneamino]-1-phenylmethanimine Chemical compound C=1C=CC=CC=1/C=N/N=C/C1=CC=CC=C1 CWLGEPSKQDNHIO-JOBJLJCHSA-N 0.000 description 8
- SHWZFQPXYGHRKT-FDGPNNRMSA-N (z)-4-hydroxypent-3-en-2-one;nickel Chemical compound [Ni].C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O SHWZFQPXYGHRKT-FDGPNNRMSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 229910052799 carbon Inorganic materials 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 7
- 239000007795 chemical reaction product Substances 0.000 description 7
- 150000001993 dienes Chemical class 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- SFPJUOWIPYEZJK-UHFFFAOYSA-N 1,2-diazacyclododeca-1,9,11-triene Chemical class N1=NC=CC=CCCCCCC1 SFPJUOWIPYEZJK-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 5
- 125000001931 aliphatic group Chemical group 0.000 description 5
- GCPCLEKQVMKXJM-UHFFFAOYSA-N ethoxy(diethyl)alumane Chemical compound CCO[Al](CC)CC GCPCLEKQVMKXJM-UHFFFAOYSA-N 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 241000196324 Embryophyta Species 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 238000011065 in-situ storage Methods 0.000 description 4
- AYNNMBYJCNKVIJ-UHFFFAOYSA-N n-(ethylideneamino)ethanimine Chemical compound CC=NN=CC AYNNMBYJCNKVIJ-UHFFFAOYSA-N 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- HVLLSGMXQDNUAL-UHFFFAOYSA-N triphenyl phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)OC1=CC=CC=C1 HVLLSGMXQDNUAL-UHFFFAOYSA-N 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- PFLUPZGCTVGDLV-UHFFFAOYSA-N acetone azine Chemical compound CC(C)=NN=C(C)C PFLUPZGCTVGDLV-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 230000002363 herbicidal effect Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 150000002816 nickel compounds Chemical class 0.000 description 3
- 238000006384 oligomerization reaction Methods 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- FDHFFSOZYINJQR-UHFFFAOYSA-N 1-(4-chlorophenyl)-n-[(4-chlorophenyl)methylideneamino]methanimine Chemical compound C1=CC(Cl)=CC=C1C=NN=CC1=CC=C(Cl)C=C1 FDHFFSOZYINJQR-UHFFFAOYSA-N 0.000 description 2
- SVAKQZXLNBBOTG-UHFFFAOYSA-N 1-(4-methoxyphenyl)-n-[(4-methoxyphenyl)methylideneamino]methanimine Chemical compound C1=CC(OC)=CC=C1C=NN=CC1=CC=C(OC)C=C1 SVAKQZXLNBBOTG-UHFFFAOYSA-N 0.000 description 2
- JDSLSASVXZTPLL-UHFFFAOYSA-N 1-(4-methylphenyl)-n-[(4-methylphenyl)methylideneamino]methanimine Chemical compound C1=CC(C)=CC=C1C=NN=CC1=CC=C(C)C=C1 JDSLSASVXZTPLL-UHFFFAOYSA-N 0.000 description 2
- FQAZCJVOZQHKGK-UHFFFAOYSA-N 1-cyclohexyl-n-(cyclohexylmethylideneamino)methanimine Chemical compound C1CCCCC1C=NN=CC1CCCCC1 FQAZCJVOZQHKGK-UHFFFAOYSA-N 0.000 description 2
- VKDRLYGAGSHPHD-UHFFFAOYSA-N 2-methyl-n-(2-methylpropylideneamino)propan-1-imine Chemical compound CC(C)C=NN=CC(C)C VKDRLYGAGSHPHD-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- ZVQOOHYFBIDMTQ-UHFFFAOYSA-N [methyl(oxido){1-[6-(trifluoromethyl)pyridin-3-yl]ethyl}-lambda(6)-sulfanylidene]cyanamide Chemical compound N#CN=S(C)(=O)C(C)C1=CC=C(C(F)(F)F)N=C1 ZVQOOHYFBIDMTQ-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000006074 cyclodimerization reaction Methods 0.000 description 2
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 150000007857 hydrazones Chemical class 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- MTIYWYGVHDRHCG-UHFFFAOYSA-N n-(cyclododecylideneamino)cyclododecanimine Chemical compound C1CCCCCCCCCCC1=NN=C1CCCCCCCCCCC1 MTIYWYGVHDRHCG-UHFFFAOYSA-N 0.000 description 2
- GACCVWSAZXERLE-UHFFFAOYSA-N n-(heptylideneamino)heptan-1-imine Chemical compound CCCCCCC=NN=CCCCCCC GACCVWSAZXERLE-UHFFFAOYSA-N 0.000 description 2
- RPFMGCRMNJQDOS-UHFFFAOYSA-N n-(propylideneamino)propan-1-imine Chemical compound CCC=NN=CCC RPFMGCRMNJQDOS-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 2
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- SVAKQZXLNBBOTG-JYFOCSDGSA-N (e)-1-(4-methoxyphenyl)-n-[(e)-(4-methoxyphenyl)methylideneamino]methanimine Chemical compound C1=CC(OC)=CC=C1\C=N\N=C\C1=CC=C(OC)C=C1 SVAKQZXLNBBOTG-JYFOCSDGSA-N 0.000 description 1
- RPFMGCRMNJQDOS-KQQUZDAGSA-N (e)-n-[(e)-propylideneamino]propan-1-imine Chemical compound CC\C=N\N=C\CC RPFMGCRMNJQDOS-KQQUZDAGSA-N 0.000 description 1
- AYNNMBYJCNKVIJ-GLIMQPGKSA-N (z)-n-[(z)-ethylideneamino]ethanimine Chemical compound C\C=N/N=C\C AYNNMBYJCNKVIJ-GLIMQPGKSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 241000209763 Avena sativa Species 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 239000002879 Lewis base Substances 0.000 description 1
- 240000004296 Lolium perenne Species 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- DSVGQVZAZSZEEX-UHFFFAOYSA-N [C].[Pt] Chemical compound [C].[Pt] DSVGQVZAZSZEEX-UHFFFAOYSA-N 0.000 description 1
- SFYLHIMXJQGKGZ-DUXPYHPUSA-N acetaldehyde (E)-hydrazone Chemical compound C\C=N\N SFYLHIMXJQGKGZ-DUXPYHPUSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229910002090 carbon oxide Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- NQLVCAVEDIGMMW-UHFFFAOYSA-N cyclopenta-1,3-diene;cyclopentane;nickel Chemical compound [Ni].C=1C=C[CH-]C=1.[CH-]1[CH-][CH-][CH-][CH-]1 NQLVCAVEDIGMMW-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000006006 cyclotrimerization reaction Methods 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- HQWPLXHWEZZGKY-UHFFFAOYSA-N diethylzinc Chemical compound CC[Zn]CC HQWPLXHWEZZGKY-UHFFFAOYSA-N 0.000 description 1
- BBRIBFLKHBEEPX-UHFFFAOYSA-N diphenyl (2-phenylphenyl) phosphite Chemical compound C=1C=CC=CC=1OP(OC=1C(=CC=CC=1)C=1C=CC=CC=1)OC1=CC=CC=C1 BBRIBFLKHBEEPX-UHFFFAOYSA-N 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 239000012493 hydrazine sulfate Substances 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000007527 lewis bases Chemical class 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- GYQYUOSKLVIRAB-UHFFFAOYSA-N n-(cyclohexylideneamino)cyclohexanimine Chemical compound C1CCCCC1=NN=C1CCCCC1 GYQYUOSKLVIRAB-UHFFFAOYSA-N 0.000 description 1
- KFQDLKRAVRTKMF-UHFFFAOYSA-N n-(cyclopentylideneamino)cyclopentanimine Chemical compound C1CCCC1=NN=C1CCCC1 KFQDLKRAVRTKMF-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- UNMGLSGVXHBBPH-BVHINDLDSA-L nickel(2+) (NE)-N-[(3E)-3-oxidoiminobutan-2-ylidene]hydroxylamine Chemical compound [Ni++].C\C(=N/O)\C(\C)=N\[O-].C\C(=N/O)\C(\C)=N\[O-] UNMGLSGVXHBBPH-BVHINDLDSA-L 0.000 description 1
- MNSHGRXIICSKRQ-UHFFFAOYSA-L nickel(2+);3-oxobutanoate Chemical compound [Ni+2].CC(=O)CC([O-])=O.CC(=O)CC([O-])=O MNSHGRXIICSKRQ-UHFFFAOYSA-L 0.000 description 1
- HZPNKQREYVVATQ-UHFFFAOYSA-L nickel(2+);diformate Chemical compound [Ni+2].[O-]C=O.[O-]C=O HZPNKQREYVVATQ-UHFFFAOYSA-L 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- NZFNXWQNBYZDAQ-UHFFFAOYSA-N thioridazine hydrochloride Chemical compound Cl.C12=CC(SC)=CC=C2SC2=CC=CC=C2N1CCC1CCCCN1C NZFNXWQNBYZDAQ-UHFFFAOYSA-N 0.000 description 1
- WLPUWLXVBWGYMZ-UHFFFAOYSA-N tricyclohexylphosphine Chemical compound C1CCCCC1P(C1CCCCC1)C1CCCCC1 WLPUWLXVBWGYMZ-UHFFFAOYSA-N 0.000 description 1
- WWVNWQJKWKSDQM-UHFFFAOYSA-N triethylarsane Chemical compound CC[As](CC)CC WWVNWQJKWKSDQM-UHFFFAOYSA-N 0.000 description 1
- RXJKFRMDXUJTEX-UHFFFAOYSA-N triethylphosphine Chemical compound CCP(CC)CC RXJKFRMDXUJTEX-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 1
- BPLUKJNHPBNVQL-UHFFFAOYSA-N triphenylarsine Chemical compound C1=CC=CC=C1[As](C=1C=CC=CC=1)C1=CC=CC=C1 BPLUKJNHPBNVQL-UHFFFAOYSA-N 0.000 description 1
- HVYVMSPIJIWUNA-UHFFFAOYSA-N triphenylstibine Chemical compound C1=CC=CC=C1[Sb](C=1C=CC=CC=1)C1=CC=CC=C1 HVYVMSPIJIWUNA-UHFFFAOYSA-N 0.000 description 1
- BKHZQJRTFNFCTG-UHFFFAOYSA-N tris(2-methylphenyl) phosphite Chemical compound CC1=CC=CC=C1OP(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C BKHZQJRTFNFCTG-UHFFFAOYSA-N 0.000 description 1
- DAZUWKNHFLGZSN-UHFFFAOYSA-N tris(2-phenylphenyl) phosphite Chemical compound C=1C=CC=C(C=2C=CC=CC=2)C=1OP(OC=1C(=CC=CC=1)C=1C=CC=CC=1)OC1=CC=CC=C1C1=CC=CC=C1 DAZUWKNHFLGZSN-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D245/00—Heterocyclic compounds containing rings of more than seven members having two nitrogen atoms as the only ring hetero atoms
- C07D245/02—Heterocyclic compounds containing rings of more than seven members having two nitrogen atoms as the only ring hetero atoms not condensed with other rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH911272A CH570389A5 (enExample) | 1972-06-16 | 1972-06-16 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2330087A1 DE2330087A1 (de) | 1974-01-03 |
| DE2330087B2 DE2330087B2 (de) | 1980-05-29 |
| DE2330087C3 true DE2330087C3 (de) | 1981-02-05 |
Family
ID=4348444
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2330087A Expired DE2330087C3 (de) | 1972-06-16 | 1973-06-13 | Verfahren zur Herstellung von 1,2-Diazacyclododecatrienen-(1,5,9) oder l^-Diazacyclododecaenen-d) |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3939147A (enExample) |
| JP (1) | JPS5550945B2 (enExample) |
| CH (1) | CH570389A5 (enExample) |
| DE (1) | DE2330087C3 (enExample) |
| FR (1) | FR2189408B1 (enExample) |
| GB (1) | GB1399182A (enExample) |
| IT (1) | IT989076B (enExample) |
| NL (1) | NL174463C (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH626348A5 (enExample) * | 1977-07-19 | 1981-11-13 | Ciba Geigy Ag | |
| CH631190A5 (de) * | 1977-10-28 | 1982-07-30 | Ciba Geigy Ag | Verfahren zur herstellung von neuen transparenten polyamiden. |
| CH630932A5 (de) * | 1977-10-28 | 1982-07-15 | Ciba Geigy Ag | Verfahren zur herstellung von neuen transparenten polyamiden. |
| CH631191A5 (de) * | 1977-10-28 | 1982-07-30 | Ciba Geigy Ag | Verfahren zur herstellung von neuen transparenten polyamiden. |
| CH631189A5 (de) * | 1977-10-28 | 1982-07-30 | Ciba Geigy Ag | Verfahren zur herstellung von neuen transparenten aliphatischen polyamiden. |
| EP0001786B1 (de) * | 1977-10-28 | 1983-01-05 | Ciba-Geigy Ag | Kristallines Polyamid, seine Verwendung und Diamine |
| DE2962152D1 (en) * | 1978-10-18 | 1982-03-25 | Ciba Geigy Ag | Substituted 1,11-diamino undecanes, processes for their preparation and their use |
| US4297480A (en) * | 1978-10-18 | 1981-10-27 | Giba-Geigy Corporation | Transparent polyamide from branched chain C11 diamine |
| US4277621A (en) * | 1978-10-18 | 1981-07-07 | Ciba-Geigy Corporation | Substituted 11-amino-undeca-4,8-dienal and 11-amino-undecanal derivatives and processes for their preparation |
| US4255559A (en) * | 1978-10-18 | 1981-03-10 | Ciba-Geigy Corporation | Transparent copolyamide from 1,10-disubstituted-1,10 diamine |
| DE3903990A1 (de) * | 1989-02-10 | 1990-08-30 | Basf Ag | Phenylhydrazone, ihre herstellung und daraus hergestellte arzneimittel und kosmetika |
| US20250082589A1 (en) * | 2021-12-16 | 2025-03-13 | Neurawell Therapeutics | Phenylethylidenehydrazine dimers and methods of using same |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3641175A (en) * | 1959-12-22 | 1972-02-08 | Gunther Wilke | Process for the production of dimers and trimers of conjugated dienes |
| NL135124C (enExample) * | 1960-09-21 | 1900-01-01 | ||
| GB977108A (en) * | 1962-03-26 | 1964-12-02 | Studiengesellschaft Kohle Mbh | Process of co-oligomerisation |
-
1972
- 1972-06-16 CH CH911272A patent/CH570389A5/xx not_active IP Right Cessation
-
1973
- 1973-06-12 IT IT25267/73A patent/IT989076B/it active
- 1973-06-13 DE DE2330087A patent/DE2330087C3/de not_active Expired
- 1973-06-13 GB GB2818373A patent/GB1399182A/en not_active Expired
- 1973-06-14 US US05/370,081 patent/US3939147A/en not_active Expired - Lifetime
- 1973-06-15 NL NLAANVRAGE7308381,A patent/NL174463C/xx not_active IP Right Cessation
- 1973-06-15 FR FR7321907A patent/FR2189408B1/fr not_active Expired
- 1973-06-16 JP JP6821873A patent/JPS5550945B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL174463B (nl) | 1984-01-16 |
| JPS4954535A (enExample) | 1974-05-27 |
| IT989076B (it) | 1975-05-20 |
| NL174463C (nl) | 1984-06-18 |
| GB1399182A (en) | 1975-06-25 |
| US3939147A (en) | 1976-02-17 |
| DE2330087A1 (de) | 1974-01-03 |
| FR2189408B1 (enExample) | 1976-06-11 |
| JPS5550945B2 (enExample) | 1980-12-20 |
| CH570389A5 (enExample) | 1975-12-15 |
| DE2330087B2 (de) | 1980-05-29 |
| NL7308381A (enExample) | 1973-12-18 |
| FR2189408A1 (enExample) | 1974-01-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2330087C3 (de) | Verfahren zur Herstellung von 1,2-Diazacyclododecatrienen-(1,5,9) oder l^-Diazacyclododecaenen-d) | |
| DE3123018A1 (de) | Substituierte cyclohexan-1,3-dion-derivate, verfahren zu deren herstellung und herbicide mittel | |
| DE1695594A1 (de) | In 2-Stellung substituierte delta1-Pyrrolinverbindungen und Verfahren zu ihrer Herstellung | |
| DE2524577A1 (de) | Oxacyclohexanderivate, verfahren zu ihrer herstellung und ihre verwendung als wirkstoffe in herbiziden | |
| DE3422346A1 (de) | Neue herbizid wirksame 5-amino-3-oxo-4-(subst.-phenyl)-2,3-dihydrofurane und derivate davon, verfahren zu ihrer herstellung sowie diese verbindungen enthaltende herbizide mittel | |
| DE2231249A1 (de) | Carbamat | |
| EP0108908B1 (de) | Neue Benzotriazole, ihre Herstellung und ihre Verwendung als biozide Wirkstoffe | |
| DE2507007C2 (de) | Verfahren zur Herstellung von ungesättigten Nonylaminen | |
| DE1239700B (de) | Verfahren zur Herstellung von N, N'-disubstituierten Sulfurylamiden | |
| DE1810185B2 (de) | Nickel (0)-katalysatoren, Verfahren zu deren Herstellung und deren Verwendung zur Oligomerisation von Butadien | |
| DE2831353C2 (enExample) | ||
| DE4205115C1 (enExample) | ||
| DE2831385C2 (enExample) | ||
| DE1668874C2 (de) | Verfahren zur Herstellung von 2,3,6-Trimethylphenol | |
| DE960813C (de) | Verfahren zur Herstellung von ungesaettigten ª†- und ª€-Laktonen | |
| DE2439104C3 (de) | Cyclohexanderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE964236C (de) | Verfahren zur Herstellung von N, N'-disubstituierten 1, 4-Diaminobutadienen-(1, 3) | |
| DE1957312C3 (de) | Verfahren zur Herstellung von 4,5,6,7-Tetrahydro-cyclopenta-13-dioxinonen-(4) | |
| DE1946062A1 (de) | Verfahren zur katalytischen Herstellung zyklischer Trimere von 1,3-Dienen | |
| DE1445655C3 (de) | Verfahren zur Herstellung von in 3-Stellung gamma-Aminopropylgruppen enthaltenden 3,4,5,6-Tetrahydropyridinderivaten | |
| DE2548898A1 (de) | Benzothiazolderivate, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| DE1593387C (de) | Verfahren zur Herstellung eines Di hydrochrysanthemolactons | |
| DE894844C (de) | Verfahren zur Herstellung von aromatischen Oxyaldehyden | |
| DE1088055B (de) | Verfahren zur Herstellung von Hexahydrophenthiazin-9-dioxyden | |
| DE2930728A1 (de) | Phenoxybutane und derivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |