DE2329738A1 - Verfahren zur herstellung eines polymerisationskatalysators - Google Patents
Verfahren zur herstellung eines polymerisationskatalysatorsInfo
- Publication number
- DE2329738A1 DE2329738A1 DE2329738A DE2329738A DE2329738A1 DE 2329738 A1 DE2329738 A1 DE 2329738A1 DE 2329738 A DE2329738 A DE 2329738A DE 2329738 A DE2329738 A DE 2329738A DE 2329738 A1 DE2329738 A1 DE 2329738A1
- Authority
- DE
- Germany
- Prior art keywords
- catalyst
- titanium compound
- temperature
- titanium
- silica
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000002685 polymerization catalyst Substances 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 42
- 239000003054 catalyst Substances 0.000 claims description 42
- 238000000034 method Methods 0.000 claims description 41
- 150000003609 titanium compounds Chemical class 0.000 claims description 27
- 239000000377 silicon dioxide Substances 0.000 claims description 18
- 238000010438 heat treatment Methods 0.000 claims description 14
- 239000000463 material Substances 0.000 claims description 14
- 239000012876 carrier material Substances 0.000 claims description 13
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 12
- 150000001845 chromium compounds Chemical class 0.000 claims description 11
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 8
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 claims description 6
- PNWJTIFZRHJYLK-UHFFFAOYSA-N CC(C)(C)O[Cr](=O)(=O)OC(C)(C)C Chemical compound CC(C)(C)O[Cr](=O)(=O)OC(C)(C)C PNWJTIFZRHJYLK-UHFFFAOYSA-N 0.000 claims description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 3
- 239000011148 porous material Substances 0.000 claims description 3
- JMXKSZRRTHPKDL-UHFFFAOYSA-N titanium(IV) ethoxide Substances [Ti+4].CC[O-].CC[O-].CC[O-].CC[O-] JMXKSZRRTHPKDL-UHFFFAOYSA-N 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 claims description 2
- 235000012239 silicon dioxide Nutrition 0.000 claims description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 23
- 239000005977 Ethylene Substances 0.000 description 23
- 229920000642 polymer Polymers 0.000 description 22
- 238000006116 polymerization reaction Methods 0.000 description 17
- 239000003570 air Substances 0.000 description 16
- -1 k-Me thy1-1-pentene Natural products 0.000 description 15
- 239000010936 titanium Substances 0.000 description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 14
- 239000000155 melt Substances 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 229910052804 chromium Inorganic materials 0.000 description 12
- 239000011651 chromium Substances 0.000 description 12
- 239000003085 diluting agent Substances 0.000 description 12
- 229910052719 titanium Inorganic materials 0.000 description 12
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 11
- 239000003963 antioxidant agent Substances 0.000 description 10
- 239000007788 liquid Substances 0.000 description 10
- 239000004698 Polyethylene Substances 0.000 description 9
- 229920000573 polyethylene Polymers 0.000 description 9
- 239000001282 iso-butane Substances 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 238000000265 homogenisation Methods 0.000 description 6
- 239000003208 petroleum Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000007789 gas Substances 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 4
- 230000003078 antioxidant effect Effects 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 229910000423 chromium oxide Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 3
- 238000001994 activation Methods 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 239000000499 gel Substances 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- RYSXWUYLAWPLES-MTOQALJVSA-N (Z)-4-hydroxypent-3-en-2-one titanium Chemical class [Ti].C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O RYSXWUYLAWPLES-MTOQALJVSA-N 0.000 description 2
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- BCEIUDAMUFAQMG-UHFFFAOYSA-M CC(C)(C)O[Cr](O)(=O)=O Chemical compound CC(C)(C)O[Cr](O)(=O)=O BCEIUDAMUFAQMG-UHFFFAOYSA-M 0.000 description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical compound CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 239000003125 aqueous solvent Substances 0.000 description 2
- PHFQLYPOURZARY-UHFFFAOYSA-N chromium trinitrate Chemical compound [Cr+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O PHFQLYPOURZARY-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 238000007580 dry-mixing Methods 0.000 description 2
- 238000012685 gas phase polymerization Methods 0.000 description 2
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000005245 sintering Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- ADVORQMAWLEPOI-XHTSQIMGSA-N (e)-4-hydroxypent-3-en-2-one;oxotitanium Chemical compound [Ti]=O.C\C(O)=C/C(C)=O.C\C(O)=C/C(C)=O ADVORQMAWLEPOI-XHTSQIMGSA-N 0.000 description 1
- HSWXJVGZJWPVNY-UHFFFAOYSA-J 2-[bis(2-hydroxyethyl)amino]ethanol titanium(4+) tetrachloride Chemical compound [Cl-].N(CCO)(CCO)CCO.[Ti+4].[Cl-].[Cl-].[Cl-] HSWXJVGZJWPVNY-UHFFFAOYSA-J 0.000 description 1
- IHEDBVUTTQXGSJ-UHFFFAOYSA-M 2-[bis(2-oxidoethyl)amino]ethanolate;titanium(4+);hydroxide Chemical compound [OH-].[Ti+4].[O-]CCN(CC[O-])CC[O-] IHEDBVUTTQXGSJ-UHFFFAOYSA-M 0.000 description 1
- QUVMSYUGOKEMPX-UHFFFAOYSA-N 2-methylpropan-1-olate;titanium(4+) Chemical compound [Ti+4].CC(C)C[O-].CC(C)C[O-].CC(C)C[O-].CC(C)C[O-] QUVMSYUGOKEMPX-UHFFFAOYSA-N 0.000 description 1
- PMJNEQWWZRSFCE-UHFFFAOYSA-N 3-ethoxy-3-oxo-2-(thiophen-2-ylmethyl)propanoic acid Chemical compound CCOC(=O)C(C(O)=O)CC1=CC=CS1 PMJNEQWWZRSFCE-UHFFFAOYSA-N 0.000 description 1
- 238000012935 Averaging Methods 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 229910010413 TiO 2 Inorganic materials 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000000498 ball milling Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical class [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 1
- 150000001844 chromium Chemical class 0.000 description 1
- TYYBBNOTQFVVKN-UHFFFAOYSA-N chromium(2+);cyclopenta-1,3-diene Chemical compound [Cr+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 TYYBBNOTQFVVKN-UHFFFAOYSA-N 0.000 description 1
- UOUJSJZBMCDAEU-UHFFFAOYSA-N chromium(3+);oxygen(2-) Chemical class [O-2].[O-2].[O-2].[Cr+3].[Cr+3] UOUJSJZBMCDAEU-UHFFFAOYSA-N 0.000 description 1
- GRWVQDDAKZFPFI-UHFFFAOYSA-H chromium(III) sulfate Chemical compound [Cr+3].[Cr+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRWVQDDAKZFPFI-UHFFFAOYSA-H 0.000 description 1
- XEHUIDSUOAGHBW-UHFFFAOYSA-N chromium;pentane-2,4-dione Chemical compound [Cr].CC(=O)CC(C)=O.CC(=O)CC(C)=O.CC(=O)CC(C)=O XEHUIDSUOAGHBW-UHFFFAOYSA-N 0.000 description 1
- AHXGRMIPHCAXFP-UHFFFAOYSA-L chromyl dichloride Chemical compound Cl[Cr](Cl)(=O)=O AHXGRMIPHCAXFP-UHFFFAOYSA-L 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- AFABGHUZZDYHJO-UHFFFAOYSA-N dimethyl butane Natural products CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- ZSWFCLXCOIISFI-UHFFFAOYSA-N endo-cyclopentadiene Natural products C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Polymerization Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2724572A GB1429174A (en) | 1972-06-12 | 1972-06-12 | Polymerisation process and catalyst |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2329738A1 true DE2329738A1 (de) | 1974-01-03 |
Family
ID=10256467
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2329738A Withdrawn DE2329738A1 (de) | 1972-06-12 | 1973-06-12 | Verfahren zur herstellung eines polymerisationskatalysators |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3879362A (enExample) |
| JP (1) | JPS5629682B2 (enExample) |
| BE (1) | BE800809A (enExample) |
| DE (1) | DE2329738A1 (enExample) |
| ES (1) | ES415802A1 (enExample) |
| FR (1) | FR2187409B1 (enExample) |
| GB (1) | GB1429174A (enExample) |
| IT (1) | IT994067B (enExample) |
| NL (1) | NL7308128A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2713897A1 (de) * | 1976-04-07 | 1977-10-13 | Chemplex Co | Katalysatoren fuer die olefinpolymerisation, deren herstellung und verwendung |
| DE2802517A1 (de) * | 1977-01-21 | 1978-07-27 | Union Carbide Corp | Polymerisationskatalysator, dessen herstellung und verwendung |
| DK152736B (da) * | 1975-03-10 | 1988-05-02 | Union Carbide Corp | Fremgangsmaade til fremstilling af copolymere af ethylen og c3-6 alfa-olefiner |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1495547A (en) * | 1974-03-22 | 1977-12-21 | British Petroleum Co | Polymerisation catalyst |
| US4188471A (en) * | 1974-12-04 | 1980-02-12 | Phillips Petroleum Company | Organochromium on titanium-impregnated base as olefin polymerization catalyst |
| US4011382A (en) * | 1975-03-10 | 1977-03-08 | Union Carbide Corporation | Preparation of low and medium density ethylene polymer in fluid bed reactor |
| US4031298A (en) * | 1975-06-30 | 1977-06-21 | Chemplex Company | Polymerization catalyst and method |
| US4041224A (en) * | 1975-11-19 | 1977-08-09 | Chemplex Company | Catalyst, method and polymerization processes |
| US4041225A (en) * | 1975-12-29 | 1977-08-09 | Chemplex Company | Polymerization catalyst and method |
| US4053437A (en) * | 1976-03-04 | 1977-10-11 | Chemplex Company | Polyolefin catalyst and method for its preparation |
| US4101445A (en) * | 1976-09-22 | 1978-07-18 | Union Carbide Corporation | Preparation of modified and activated chromocene catalysts for ethylene polymerization |
| US4115425A (en) * | 1977-03-21 | 1978-09-19 | Union Carbide Corporation | Cyclopentadienyl chromium oxides |
| DE2722955A1 (de) * | 1977-05-20 | 1978-11-30 | Basf Ag | Verfahren zum herstellen von olefinpolymerisaten |
| JPS5454985A (en) * | 1977-10-07 | 1979-05-01 | Chemplex Co | Catalyst and polymerization process |
| USRE31443E (en) * | 1977-12-05 | 1983-11-15 | Phillips Petroleum Company | Treatment of silica |
| DE2802819A1 (de) * | 1978-01-23 | 1979-07-26 | Hoechst Ag | Verfahren zur herstellung eines katalysators |
| US4284527A (en) * | 1978-06-19 | 1981-08-18 | Chemplex Company | Polymerization catalyst |
| US4184979A (en) * | 1978-07-17 | 1980-01-22 | Chemplex Company | Catalyst and process of preparing the catalyst |
| US4224428A (en) * | 1979-02-02 | 1980-09-23 | Chemplex Company | Polymerization process |
| US4297460A (en) * | 1979-06-01 | 1981-10-27 | Phillips Petroleum Co. | Treatment of silica |
| US4303770A (en) * | 1979-10-24 | 1981-12-01 | Chemplex Company | Method of making polymers and copolymers of 1-olefins |
| US4397766A (en) * | 1979-12-14 | 1983-08-09 | Phillips Petroleum Company | Solubilized chromium salt in particulate support |
| US4368301A (en) * | 1979-12-14 | 1983-01-11 | Phillips Petroleum Company | Solubilized chromium salt in polymerization catalyst |
| US4312967A (en) * | 1980-02-06 | 1982-01-26 | Phillips Petroleum Co. | Polymerization catalyst and process |
| JPS5749605A (en) * | 1980-09-10 | 1982-03-23 | Showa Denko Kk | Solid catalyst of carrier supported type |
| US4792592A (en) * | 1981-03-26 | 1988-12-20 | Union Carbide Corporation | Process for reducing sheeting during polymerization of alpha-olefins |
| US4532311A (en) * | 1981-03-26 | 1985-07-30 | Union Carbide Corporation | Process for reducing sheeting during polymerization of alpha-olefins |
| US4460756A (en) * | 1981-04-02 | 1984-07-17 | Phillips Petroleum Company | Olefin polymerization method |
| US4397769A (en) * | 1981-04-02 | 1983-08-09 | Phillips Petroleum Company | Olefin polymerization catalyst |
| US4376065A (en) * | 1981-06-01 | 1983-03-08 | The Dow Chemical Company | Organo zirconium-chromium compound, catalyst prepared therefrom and polymerization of olefins therewith |
| NL8103703A (nl) * | 1981-08-06 | 1983-03-01 | Stamicarbon | Werkwijze voor de bereiding van een polymerisatiekatalysator en bereiding van etheenpolymeren daarmee. |
| US4405768A (en) * | 1981-08-14 | 1983-09-20 | Phillips Petroleum Company | Polymerization process using chromium on a support treated with titanium polymer |
| US4402864A (en) * | 1981-08-14 | 1983-09-06 | Phillips Petroleum Company | Catalyst support treated with titanium polymer |
| US4377497A (en) * | 1981-09-24 | 1983-03-22 | Mobil Oil Corporation | Catalyst for olefin polymerization |
| US4791089A (en) * | 1983-10-07 | 1988-12-13 | Enron Chemical Corporation | Zirconia-titania-silica tergels and their use as catalyst supports |
| CA1243010A (en) * | 1983-10-07 | 1988-10-11 | William Kirch | Zirconia-titania-silica tergels and their use as catalyst supports |
| GB0004044D0 (en) * | 2000-02-21 | 2000-04-12 | Borealis Polymers Oy | Polymer |
| US8247342B2 (en) * | 2008-07-23 | 2012-08-21 | Al-Arifi Abdullah Saad N | Polymer supported chrome catalyst for olefins polymerization |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1051004B (de) * | 1953-01-27 | 1959-02-19 | Phillips Petroleum Company, Bartlesville, OkIa. (V. St. A.) | Verfahren zur Herstellung von hochmolekularen Olefinpolymeren oder Olefinmischpolymeren |
| NL286866A (enExample) * | 1961-12-29 | |||
| US3485771A (en) * | 1966-12-29 | 1969-12-23 | Phillips Petroleum Co | Plasma activation of catalysts |
| US3622521A (en) * | 1967-08-21 | 1971-11-23 | Phillips Petroleum Co | Olefin polymerization with chromium and titanium-containing compounds |
| US3625864A (en) * | 1969-04-23 | 1971-12-07 | Phillips Petroleum Co | Polymerization catalyst system additives |
| US3780011A (en) * | 1971-04-09 | 1973-12-18 | Chemplex Co | Catalyst and catalytic process |
-
1972
- 1972-06-12 GB GB2724572A patent/GB1429174A/en not_active Expired
-
1973
- 1973-06-08 FR FR7320891A patent/FR2187409B1/fr not_active Expired
- 1973-06-08 US US368269A patent/US3879362A/en not_active Expired - Lifetime
- 1973-06-11 IT IT50665/73A patent/IT994067B/it active
- 1973-06-11 ES ES415802A patent/ES415802A1/es not_active Expired
- 1973-06-12 BE BE132181A patent/BE800809A/xx unknown
- 1973-06-12 JP JP6627073A patent/JPS5629682B2/ja not_active Expired
- 1973-06-12 NL NL7308128A patent/NL7308128A/xx not_active Application Discontinuation
- 1973-06-12 DE DE2329738A patent/DE2329738A1/de not_active Withdrawn
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK152736B (da) * | 1975-03-10 | 1988-05-02 | Union Carbide Corp | Fremgangsmaade til fremstilling af copolymere af ethylen og c3-6 alfa-olefiner |
| DE2713897A1 (de) * | 1976-04-07 | 1977-10-13 | Chemplex Co | Katalysatoren fuer die olefinpolymerisation, deren herstellung und verwendung |
| DE2802517A1 (de) * | 1977-01-21 | 1978-07-27 | Union Carbide Corp | Polymerisationskatalysator, dessen herstellung und verwendung |
Also Published As
| Publication number | Publication date |
|---|---|
| ES415802A1 (es) | 1976-05-16 |
| BE800809A (fr) | 1973-12-12 |
| IT994067B (it) | 1975-10-20 |
| GB1429174A (en) | 1976-03-24 |
| US3879362A (en) | 1975-04-22 |
| JPS4951192A (enExample) | 1974-05-17 |
| FR2187409B1 (enExample) | 1980-08-22 |
| FR2187409A1 (enExample) | 1974-01-18 |
| NL7308128A (enExample) | 1973-12-14 |
| JPS5629682B2 (enExample) | 1981-07-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2329738A1 (de) | Verfahren zur herstellung eines polymerisationskatalysators | |
| DE3228065C2 (enExample) | ||
| DE2110380C2 (enExample) | ||
| DE2735672C2 (enExample) | ||
| DE1958488C3 (de) | Polymerisationskatalysatoren, ihre Herstellung und Verwendung | |
| DE2729122B2 (de) | Katalysatorzusammensetzung und Verfahren zur Homo- oder Mischpolymerisation von Äthylen | |
| DE2809272A1 (de) | Katalysator fuer die herstellung von polyalkylenen | |
| DE2526512A1 (de) | Verfahren zur herstellung eines polyolefins | |
| DE3028759A1 (de) | Katalysatoren fuer die polymerisation und copolymerisation von olefinen, deren herstellung und mit ihnen durchgefuehrtes polymerisationsverfahren | |
| DE2630585B2 (de) | Katalysatoren für die Polymerisation von a -Olefinen, mit 2 bis 6 Kohlenstoffatomen und deren Verwendung für die Polymerisation von a -Olefinen mit 2 bis 6 Kohlenstoffatomen | |
| DE2724974A1 (de) | Katalysatorkomponente, verfahren zu ihrer herstellung und die sie enthaltenden katalysatoren | |
| DE1520721B2 (de) | Verfahren zur polymerisation von propylen in der wirbelschicht | |
| DE69126190T2 (de) | Stereoselektiver Katalysator für Olefinpolymerisation | |
| DE3036450C2 (enExample) | ||
| DE2525411A1 (de) | Herstellung und verwendung von einem polymerisationskatalysator | |
| DE2512242A1 (de) | Katalysator, dessen herstellung und verwendung | |
| DE3004768C2 (enExample) | ||
| EP0585683B1 (de) | Phillips-Katalysator zur Polymerisation von alpha-Olefinen | |
| DE1745375C3 (de) | Verfahren zur Herstellung von Polyäthylen mit einem Molekulargewicht von mindestens 500 000 und Katalysator zur Durchführung des Verfahrens | |
| DE2030753C3 (de) | Verfahren zur Herstellung von Polymerisationskatalysatoren | |
| DE2240246C2 (de) | Verfahren zur Polymerisation von Äthylen oder einer Äthylenmischung und Katalysator zur Durchführung dieses Verfahrens | |
| DE1520567A1 (de) | Verfahren zur Herstellung von kristallinen Polyolefinen | |
| DE1302896C2 (de) | Verfahren zur selektiven polymerisation von alpha-olefinen | |
| EP0520346A2 (de) | Phillips-Katalysator und seine Verwendung zur Herstellung von Ethylenhomopolymerisaten und -copolymerisaten | |
| DE1906589A1 (de) | Verfahren zur Polymerisation von AEthylen und Katalysator dafuer |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OGA | New person/name/address of the applicant | ||
| OD | Request for examination | ||
| 8139 | Disposal/non-payment of the annual fee |