DE2310088A1 - Tarnnetz - Google Patents
TarnnetzInfo
- Publication number
- DE2310088A1 DE2310088A1 DE19732310088 DE2310088A DE2310088A1 DE 2310088 A1 DE2310088 A1 DE 2310088A1 DE 19732310088 DE19732310088 DE 19732310088 DE 2310088 A DE2310088 A DE 2310088A DE 2310088 A1 DE2310088 A1 DE 2310088A1
- Authority
- DE
- Germany
- Prior art keywords
- camouflage net
- net according
- camouflage
- attached
- basic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004744 fabric Substances 0.000 claims description 8
- 239000006260 foam Substances 0.000 claims description 7
- 210000000056 organ Anatomy 0.000 claims description 7
- 239000003973 paint Substances 0.000 claims description 7
- 239000000654 additive Substances 0.000 claims description 4
- 230000000996 additive effect Effects 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 239000003575 carbonaceous material Substances 0.000 claims description 3
- 239000011888 foil Substances 0.000 claims description 3
- 238000005470 impregnation Methods 0.000 claims description 3
- 239000004033 plastic Substances 0.000 claims description 2
- 239000002985 plastic film Substances 0.000 claims description 2
- 229920006255 plastic film Polymers 0.000 claims description 2
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims 1
- 239000003063 flame retardant Substances 0.000 claims 1
- 230000003014 reinforcing effect Effects 0.000 claims 1
- 239000007921 spray Substances 0.000 claims 1
- 230000005855 radiation Effects 0.000 description 7
- 239000003086 colorant Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F41—WEAPONS
- F41H—ARMOUR; ARMOURED TURRETS; ARMOURED OR ARMED VEHICLES; MEANS OF ATTACK OR DEFENCE, e.g. CAMOUFLAGE, IN GENERAL
- F41H3/00—Camouflage, i.e. means or methods for concealment or disguise
- F41H3/02—Flexible, e.g. fabric covers, e.g. screens, nets characterised by their material or structure
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Aiming, Guidance, Guns With A Light Source, Armor, Camouflage, And Targets (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Saccharide Compounds (AREA)
- Shielding Devices Or Components To Electric Or Magnetic Fields (AREA)
- Laminated Bodies (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732310088 DE2310088A1 (de) | 1973-03-01 | 1973-03-01 | Tarnnetz |
| NO74740575A NO137734C (no) | 1973-03-01 | 1974-02-21 | Kamuflasjenett. |
| CH272774A CH568540A5 (enExample) | 1973-03-01 | 1974-02-26 | |
| SE7402587A SE408961B (sv) | 1973-03-01 | 1974-02-27 | Maskeringsnet |
| FR7406659A FR2220056B1 (enExample) | 1973-03-01 | 1974-02-27 | |
| GB940574A GB1404121A (en) | 1973-03-01 | 1974-03-01 | Camouflage net |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732310088 DE2310088A1 (de) | 1973-03-01 | 1973-03-01 | Tarnnetz |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2310088A1 true DE2310088A1 (de) | 1974-09-19 |
Family
ID=5873421
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732310088 Pending DE2310088A1 (de) | 1973-03-01 | 1973-03-01 | Tarnnetz |
Country Status (6)
| Country | Link |
|---|---|
| CH (1) | CH568540A5 (enExample) |
| DE (1) | DE2310088A1 (enExample) |
| FR (1) | FR2220056B1 (enExample) |
| GB (1) | GB1404121A (enExample) |
| NO (1) | NO137734C (enExample) |
| SE (1) | SE408961B (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2616730A1 (de) * | 1975-04-16 | 1976-10-28 | Barracudaverken Ab | Tarnmaterial mit radarueberwindenden eigenschaften |
| DE2847269A1 (de) * | 1978-10-31 | 1982-06-09 | Industrieanlagen-Betriebsgesellschaft Mbh, 8012 Ottobrunn | Multispektrale militaerische tarnung |
| US4473826A (en) * | 1977-11-15 | 1984-09-25 | Gunter Pusch | Arrangement broad-band camouflaging of military targets |
| EP0311698A3 (en) * | 1987-06-24 | 1989-11-08 | Fibrotex Ltd. | Three dimensional camouflage net |
| DE3840664A1 (de) * | 1988-12-02 | 1990-06-07 | Messerschmitt Boelkow Blohm | Multispektrales tarnnetz (radartarnnetz) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK144954C (da) * | 1978-07-28 | 1983-11-07 | Gottlieb Commercial | Maatte til multispektral sloering af objekter eller anlaeg |
| US4308882A (en) * | 1979-05-31 | 1982-01-05 | Pusch Guenter | Tents for military use and providing protection against modern sight and IR-optical search methods |
| DE2943430C2 (de) | 1979-10-26 | 1986-12-18 | Pusch, Günter, Dr.-Ing., 6903 Neckargemünd | Tarnnetz |
| FR2484073A1 (fr) * | 1980-06-04 | 1981-12-11 | Barracuda France | Filet de camouflage |
| US4442162A (en) * | 1981-10-09 | 1984-04-10 | Brunswick Corporation | Chemical and biological resistant material and method of fabricating same |
| EP0116586A4 (en) * | 1982-08-19 | 1985-12-11 | Commw Of Australia | INFRARED UMBRELLA. |
| SE444979B (sv) * | 1983-01-14 | 1986-05-20 | Diab Barracuda Ab | Termiskt kamouflage med hog transmissivitet hos ytterskiktet i omradena 3-5 um och 8-14 um |
| DK149518C (da) * | 1983-03-14 | 1986-12-29 | Willi Gottlieb | Sloeringsmateriale til brug ved beskyttelse mod radarobservation |
| SE457115B (sv) * | 1983-03-25 | 1988-11-28 | Diab Barracuda Ab | Termisk och optisk kamouflage |
| US4465731A (en) * | 1983-06-27 | 1984-08-14 | Gunter Pusch | Universal camouflage for military objects |
| RU2175105C2 (ru) * | 1999-10-15 | 2001-10-20 | ООО Научно-технический центр "Версия" | Маскировочное покрытие |
-
1973
- 1973-03-01 DE DE19732310088 patent/DE2310088A1/de active Pending
-
1974
- 1974-02-21 NO NO74740575A patent/NO137734C/no unknown
- 1974-02-26 CH CH272774A patent/CH568540A5/xx not_active IP Right Cessation
- 1974-02-27 FR FR7406659A patent/FR2220056B1/fr not_active Expired
- 1974-02-27 SE SE7402587A patent/SE408961B/sv not_active IP Right Cessation
- 1974-03-01 GB GB940574A patent/GB1404121A/en not_active Expired
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2616730A1 (de) * | 1975-04-16 | 1976-10-28 | Barracudaverken Ab | Tarnmaterial mit radarueberwindenden eigenschaften |
| US4473826A (en) * | 1977-11-15 | 1984-09-25 | Gunter Pusch | Arrangement broad-band camouflaging of military targets |
| DE2847269A1 (de) * | 1978-10-31 | 1982-06-09 | Industrieanlagen-Betriebsgesellschaft Mbh, 8012 Ottobrunn | Multispektrale militaerische tarnung |
| EP0311698A3 (en) * | 1987-06-24 | 1989-11-08 | Fibrotex Ltd. | Three dimensional camouflage net |
| DE3840664A1 (de) * | 1988-12-02 | 1990-06-07 | Messerschmitt Boelkow Blohm | Multispektrales tarnnetz (radartarnnetz) |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2220056B1 (enExample) | 1978-10-27 |
| FR2220056A1 (enExample) | 1974-09-27 |
| NO740575L (no) | 1974-08-29 |
| NO137734C (no) | 1978-04-19 |
| GB1404121A (en) | 1975-08-28 |
| SE408961B (sv) | 1979-07-16 |
| CH568540A5 (enExample) | 1975-10-31 |
| NO137734B (no) | 1978-01-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2310088A1 (de) | Tarnnetz | |
| EP0468173A1 (de) | Tarnnetz | |
| DE8201511U1 (de) | Mehrschichten-Schalldämmplatte für Kraftfahrzeuge od.dgl. | |
| DE19645030A1 (de) | Geräuschdämpfender Verbundwerkstoff | |
| DE69823798T2 (de) | Verbundplatte mit stossgeschützten kanten | |
| EP1429104B1 (de) | Wärmetarnplane | |
| DE69212086T2 (de) | Moire Muster für Fahrzeugdächer | |
| EP0032258A1 (de) | Isoliertapete | |
| DE69309489T2 (de) | Radardämpfende textilien | |
| DE4307519C2 (de) | Spiegel für Synchrotronstrahlung | |
| DE69912821T2 (de) | Tarnmaterial | |
| DE3014911A1 (de) | Anordnung zur induzierten absorption elektromagnetischer strahlung | |
| EP0947798B1 (de) | Tarnmaterial und Verfahren zur Herstellung eines solchen breitbandigen Tarnmaterials | |
| DE10223333A1 (de) | Tarnnetz | |
| DE19962489C1 (de) | Kabinenfenster für Passagierkabinen, insbesondere in einem Verkehrsflugzeug | |
| DE2532576A1 (de) | Teppichbeschlag | |
| DE2207785C3 (de) | Optischer Interferenzfilter | |
| DE29716362U1 (de) | Wärmetarnplane | |
| DE68910200T2 (de) | Zurückstrahlendes texturiertes oberflächensystem mit festigkeit gegen schaden. | |
| DE20213477U1 (de) | Beschichtetes Glasfasergewebe | |
| DE2838509A1 (de) | Anordnung bei schirmen zum hervorbringen von moire-mustern | |
| DE69028181T2 (de) | Dünnes Prepreg mit einseitig gerichteten Glasfasern | |
| DE867442C (de) | Dem Sonnenlicht wehrender Vorhang | |
| EP0372280A2 (de) | Tarnnetz | |
| EP1091030B1 (de) | Markisenstoff |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |