DE2306085A1 - Nachfuellbare spruehvorrichtung - Google Patents
Nachfuellbare spruehvorrichtungInfo
- Publication number
- DE2306085A1 DE2306085A1 DE2306085A DE2306085A DE2306085A1 DE 2306085 A1 DE2306085 A1 DE 2306085A1 DE 2306085 A DE2306085 A DE 2306085A DE 2306085 A DE2306085 A DE 2306085A DE 2306085 A1 DE2306085 A1 DE 2306085A1
- Authority
- DE
- Germany
- Prior art keywords
- liquid
- cap
- piston
- container
- spray
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000007921 spray Substances 0.000 title claims description 44
- 239000007788 liquid Substances 0.000 claims description 39
- 230000004044 response Effects 0.000 claims description 5
- 239000012530 fluid Substances 0.000 claims description 4
- 239000000344 soap Substances 0.000 claims 1
- 238000005507 spraying Methods 0.000 description 8
- 239000000443 aerosol Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- 238000007789 sealing Methods 0.000 description 4
- -1 polyethylene Polymers 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- 238000000429 assembly Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000003595 mist Substances 0.000 description 2
- 230000002093 peripheral effect Effects 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 239000003380 propellant Substances 0.000 description 2
- 238000003892 spreading Methods 0.000 description 2
- 230000007480 spreading Effects 0.000 description 2
- DMYOHQBLOZMDLP-UHFFFAOYSA-N 1-[2-(2-hydroxy-3-piperidin-1-ylpropoxy)phenyl]-3-phenylpropan-1-one Chemical compound C1CCCCN1CC(O)COC1=CC=CC=C1C(=O)CCC1=CC=CC=C1 DMYOHQBLOZMDLP-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 241000188250 Idas Species 0.000 description 1
- 101150057104 MCIDAS gene Proteins 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920001079 Thiokol (polymer) Polymers 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000002781 deodorant agent Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000008266 hair spray Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 210000002105 tongue Anatomy 0.000 description 1
- 239000011800 void material Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B05—SPRAYING OR ATOMISING IN GENERAL; APPLYING FLUENT MATERIALS TO SURFACES, IN GENERAL
- B05B—SPRAYING APPARATUS; ATOMISING APPARATUS; NOZZLES
- B05B9/00—Spraying apparatus for discharge of liquids or other fluent material, without essentially mixing with gas or vapour
- B05B9/03—Spraying apparatus for discharge of liquids or other fluent material, without essentially mixing with gas or vapour characterised by means for supplying liquid or other fluent material
- B05B9/04—Spraying apparatus for discharge of liquids or other fluent material, without essentially mixing with gas or vapour characterised by means for supplying liquid or other fluent material with pressurised or compressible container; with pump
- B05B9/08—Apparatus to be carried on or by a person, e.g. of knapsack type
- B05B9/085—Apparatus to be carried on or by a person, e.g. of knapsack type with a liquid pump
- B05B9/0877—Apparatus to be carried on or by a person, e.g. of knapsack type with a liquid pump the pump being of pressure-accumulation type or being connected to a pressure accumulation chamber
- B05B9/0883—Apparatus to be carried on or by a person, e.g. of knapsack type with a liquid pump the pump being of pressure-accumulation type or being connected to a pressure accumulation chamber having a discharge device fixed to the container
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US22620472A | 1972-02-14 | 1972-02-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2306085A1 true DE2306085A1 (de) | 1973-08-30 |
Family
ID=22847991
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2306085A Pending DE2306085A1 (de) | 1972-02-14 | 1973-02-08 | Nachfuellbare spruehvorrichtung |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3790034A (xx) |
| JP (1) | JPS5249561B2 (xx) |
| AT (1) | AT327087B (xx) |
| BE (1) | BE795375A (xx) |
| BR (1) | BR7301050D0 (xx) |
| CA (1) | CA1083099A (xx) |
| CH (1) | CH566820A5 (xx) |
| DE (1) | DE2306085A1 (xx) |
| ES (1) | ES408179A1 (xx) |
| FI (1) | FI54769C (xx) |
| FR (1) | FR2172677A5 (xx) |
| GB (1) | GB1389702A (xx) |
| IL (1) | IL40491A (xx) |
| IT (1) | IT974304B (xx) |
| LU (1) | LU67020A1 (xx) |
| NL (1) | NL155462B (xx) |
| NO (1) | NO135165C (xx) |
| PT (1) | PT65134B (xx) |
| ZA (1) | ZA728968B (xx) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2632320A1 (de) * | 1975-07-21 | 1977-02-17 | Spatz Corp | Vorrichtung zur abgabe von fluessigkeiten in form eines nebels |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3940029A (en) * | 1972-02-14 | 1976-02-24 | Thiokol Corporation | Rechargeable sprayer with improved valve system and charge cycle limit stop therefor |
| US3901414A (en) * | 1972-07-06 | 1975-08-26 | Nicholas G Capra | Liquid dispenser |
| JPS55104B2 (xx) * | 1973-03-06 | 1980-01-05 | ||
| JPS55103B2 (xx) * | 1973-03-06 | 1980-01-05 | ||
| US4057176A (en) * | 1975-07-18 | 1977-11-08 | Plastic Research Products, Inc. | Manually operated spray pump |
| US4033700A (en) * | 1976-02-02 | 1977-07-05 | Spatz Corporation | Dispenser for fluent material |
| US4167941A (en) * | 1976-10-05 | 1979-09-18 | James D. Pauls, Ltd. (Limited Partnership) | Mechanically operated dispensing device for increasing discharge pressure and dispensing time |
| IT8223675V0 (it) * | 1982-12-10 | 1982-12-10 | Sar Spa | Contenitore per sostanze fluide utilizzabile con pompette azionabili a mano per l'erogazione di tali sostanze. |
| EP0112950A1 (fr) * | 1982-12-30 | 1984-07-11 | COMPAGNIE CENTRALE SICLI (Société Anonyme) | Appareil extincteur d'incendie |
| US5186395A (en) * | 1988-07-29 | 1993-02-16 | Brody David E | Air powered particle sprayer with air flow control means |
| US4872595A (en) * | 1988-09-27 | 1989-10-10 | Roy Hammett | Mechanically pressurized aerosol dispenser |
| DE69033466T2 (de) * | 1989-12-28 | 2000-11-02 | Yoshino Kogyosho Co Ltd | Flüssigkeitsstrahl-Erzeuger |
| SG45171A1 (en) * | 1990-03-21 | 1998-01-16 | Boehringer Ingelheim Int | Atomising devices and methods |
| GB2251898A (en) * | 1990-11-29 | 1992-07-22 | D M W | Metered dose spray system |
| IL100224A (en) * | 1990-12-04 | 1994-10-21 | Dmw Tech Ltd | Spray nozzle |
| DK0560858T3 (da) * | 1990-12-04 | 1996-07-08 | Dmw Tech Ltd | Dyseanordning til at forhindre tilbagestrømning |
| US5339988A (en) * | 1992-10-19 | 1994-08-23 | Ballard Medical Products | Disposable tray sump foamer, assembly and methods |
| DE19536902A1 (de) * | 1995-10-04 | 1997-04-10 | Boehringer Ingelheim Int | Vorrichtung zur Hochdruckerzeugung in einem Fluid in Miniaturausführung |
| US6745763B2 (en) * | 1998-10-27 | 2004-06-08 | Garth T. Webb | Vaporizing device for administering sterile medication |
| US6543703B2 (en) | 2000-12-26 | 2003-04-08 | William S. Blake | Flexible face non-clogging actuator assembly |
| US6708852B2 (en) * | 2001-08-20 | 2004-03-23 | Alternative Packaging Solutions, L.P. | Non-chemical aerosol dispenser |
| FR2879173B1 (fr) * | 2004-12-15 | 2009-12-11 | Nouvel Oeuvre | Dispositif de distribution |
| US8177101B1 (en) * | 2007-02-06 | 2012-05-15 | William Sydney Blake | One turn actuated duration spray pump mechanism |
| US8286837B1 (en) * | 2008-07-14 | 2012-10-16 | William Sydney Blake | One turn actuated duration dual mechanism spray dispenser pump |
| US9415401B2 (en) | 2012-04-04 | 2016-08-16 | Alternative Packaging Solutions Llc | One turn actuated duration spray pump mechanism |
| US8973847B2 (en) | 2012-07-09 | 2015-03-10 | Easy Spray Llc | Non-aerosol liquid spray device with continuous spray |
| US9648992B2 (en) | 2013-12-19 | 2017-05-16 | Gojo Industries, Inc. | Pumps with vents to vent inverted containers and refill units having non-collapsing containers |
| AU2015218741B2 (en) * | 2014-02-24 | 2019-07-11 | Gojo Industries, Inc. | Vented non-collapsing containers, refillable refill containers, dispensers and refill units |
| CA2956212C (en) | 2014-07-30 | 2023-03-28 | Gojo Industries, Inc. | Vented refill units and dispensers having vented refill units |
| MX2021013445A (es) * | 2019-05-06 | 2022-04-07 | Alternative Packaging Solutions Llc | Rociador y metodos de ensamble y uso. |
| US20220314252A1 (en) * | 2021-04-05 | 2022-10-06 | Market Ready, Inc. | Trigger sprayer assembly with dual valve system |
-
0
- BE BE795375D patent/BE795375A/xx unknown
-
1972
- 1972-02-14 US US00226204A patent/US3790034A/en not_active Expired - Lifetime
- 1972-09-22 GB GB4402972A patent/GB1389702A/en not_active Expired
- 1972-09-29 CH CH1423172A patent/CH566820A5/xx not_active IP Right Cessation
- 1972-10-03 IL IL40491A patent/IL40491A/en unknown
- 1972-11-02 ES ES408179A patent/ES408179A1/es not_active Expired
- 1972-12-19 ZA ZA728968A patent/ZA728968B/xx unknown
- 1972-12-22 IT IT55011/72A patent/IT974304B/it active
- 1972-12-29 CA CA000160302A patent/CA1083099A/en not_active Expired
-
1973
- 1973-01-03 FI FI7/73A patent/FI54769C/fi active
- 1973-01-11 AT AT23473*#A patent/AT327087B/de not_active IP Right Cessation
- 1973-02-08 DE DE2306085A patent/DE2306085A1/de active Pending
- 1973-02-13 BR BR731050A patent/BR7301050D0/pt unknown
- 1973-02-13 FR FR7304998A patent/FR2172677A5/fr not_active Expired
- 1973-02-13 LU LU67020A patent/LU67020A1/xx unknown
- 1973-02-13 NO NO573/73A patent/NO135165C/no unknown
- 1973-02-13 NL NL7301993.A patent/NL155462B/xx not_active IP Right Cessation
- 1973-02-14 JP JP48018223A patent/JPS5249561B2/ja not_active Expired
-
1976
- 1976-05-25 PT PT65134A patent/PT65134B/pt unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2632320A1 (de) * | 1975-07-21 | 1977-02-17 | Spatz Corp | Vorrichtung zur abgabe von fluessigkeiten in form eines nebels |
Also Published As
| Publication number | Publication date |
|---|---|
| NO135165C (xx) | 1977-02-23 |
| ES408179A1 (es) | 1975-11-01 |
| LU67020A1 (xx) | 1974-02-21 |
| FR2172677A5 (xx) | 1973-09-28 |
| US3790034A (en) | 1974-02-05 |
| IL40491A0 (en) | 1972-12-29 |
| IL40491A (en) | 1974-12-31 |
| JPS5249561B2 (xx) | 1977-12-17 |
| JPS4892910A (xx) | 1973-12-01 |
| BR7301050D0 (pt) | 1973-12-18 |
| BE795375A (fr) | 1973-08-13 |
| IT974304B (it) | 1974-06-20 |
| AT327087B (de) | 1976-01-12 |
| NO135165B (xx) | 1976-11-15 |
| ZA728968B (en) | 1973-09-26 |
| AU4709372A (en) | 1974-04-04 |
| ATA23473A (de) | 1975-03-15 |
| FI54769B (fi) | 1978-11-30 |
| NL7301993A (xx) | 1973-08-16 |
| NL155462B (nl) | 1978-01-16 |
| FI54769C (fi) | 1979-03-12 |
| PT65134B (en) | 1977-10-12 |
| CA1083099A (en) | 1980-08-05 |
| CH566820A5 (xx) | 1975-09-30 |
| GB1389702A (en) | 1975-04-09 |
| PT65134A (en) | 1976-06-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2306085A1 (de) | Nachfuellbare spruehvorrichtung | |
| DE60132791T2 (de) | Abgasevorrichtung für aerosole | |
| DE60205469T2 (de) | Ventil | |
| DE2713447A1 (de) | Zerstaeubungspumpenauslass | |
| DE10220557A1 (de) | Spender zum Austrag fließfähiger Medien | |
| DE2238743A1 (de) | Spruehkopf | |
| DE1457440B2 (de) | Vorrichtung zum Abgeben eines Gemisches aus zwei treibmittelbeauf schlagten flussigen Komponenten | |
| DE1400733B2 (de) | Einrichtung für die Abgabe von dosierten Teilmengen eines in einem Behälter befindlichen Füllgutes | |
| DE2655046A1 (de) | Fluessigkeitsspender mit handbetaetigung | |
| DE2645089A1 (de) | Betaetigungsvorrichtung fuer einen ausgabemechanismus fuer fluessige, halbfluessige oder gasfoermige substanzen | |
| DE1184104B (de) | Verfahren und Vorrichtung zur Ausgabe einer vorbestimmten Menge einer Fluessigkeit aus einem Behaelter | |
| DE1600757A1 (de) | Abgabeventil | |
| DE202007012331U1 (de) | Abgabevorrichtung | |
| DE2655445A1 (de) | Behaelter zur abgabe unter druck stehender fluessigkeiten | |
| DE2263852A1 (de) | Aerosolzerstaeuber | |
| EP0098373B1 (de) | Dosier- oder Zerstäuberpumpe mit einem Pumpengehäuse und einem Betätigungsdrücker | |
| DE3832852A1 (de) | Automatische spruehdose | |
| DE2640837A1 (de) | Manuell betaetigbare pumpe | |
| EP0464160B1 (de) | Sprühvorrichtung | |
| DE2605474A1 (de) | Dosierventil fuer aerosole | |
| DE10015968A1 (de) | Spender für Medien | |
| DE1750241A1 (de) | Drucknachfuellventil | |
| DE3741086C1 (de) | Vorrichtung zur Abgabe wenigstens zweier fliessfaehiger Stoffe | |
| DE1027945B (de) | Abgabeventil | |
| DE2127651C3 (de) | Zerstäubervorrichtung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHW | Rejection |