DE2259553B2 - Zwischenbehälter für Stranggießanlagen - Google Patents
Zwischenbehälter für StranggießanlagenInfo
- Publication number
- DE2259553B2 DE2259553B2 DE2259553A DE2259553A DE2259553B2 DE 2259553 B2 DE2259553 B2 DE 2259553B2 DE 2259553 A DE2259553 A DE 2259553A DE 2259553 A DE2259553 A DE 2259553A DE 2259553 B2 DE2259553 B2 DE 2259553B2
- Authority
- DE
- Germany
- Prior art keywords
- intermediate container
- refractory
- lining
- metal
- panels
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000009749 continuous casting Methods 0.000 title claims description 10
- 229910052751 metal Inorganic materials 0.000 claims description 43
- 239000002184 metal Substances 0.000 claims description 43
- 239000000463 material Substances 0.000 claims description 13
- 230000003628 erosive effect Effects 0.000 claims description 8
- 239000011819 refractory material Substances 0.000 claims description 6
- 239000011230 binding agent Substances 0.000 claims description 4
- 239000000835 fiber Substances 0.000 claims description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 3
- 238000003763 carbonization Methods 0.000 claims description 3
- 239000000945 filler Substances 0.000 claims description 3
- 239000011241 protective layer Substances 0.000 claims description 3
- 238000005245 sintering Methods 0.000 claims description 3
- 238000009413 insulation Methods 0.000 claims description 2
- 239000001095 magnesium carbonate Substances 0.000 claims description 2
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 claims description 2
- 229910000021 magnesium carbonate Inorganic materials 0.000 claims description 2
- 235000014380 magnesium carbonate Nutrition 0.000 claims description 2
- 230000009970 fire resistant effect Effects 0.000 claims 1
- 239000000565 sealant Substances 0.000 claims 1
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 claims 1
- 229910010271 silicon carbide Inorganic materials 0.000 claims 1
- 239000011449 brick Substances 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 238000005266 casting Methods 0.000 description 4
- 239000000919 ceramic Substances 0.000 description 4
- 239000012774 insulation material Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 229910000831 Steel Inorganic materials 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 239000004568 cement Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000011810 insulating material Substances 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 239000010959 steel Substances 0.000 description 3
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 2
- 229920001807 Urea-formaldehyde Polymers 0.000 description 2
- GZCGUPFRVQAUEE-SLPGGIOYSA-N aldehydo-D-glucose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O GZCGUPFRVQAUEE-SLPGGIOYSA-N 0.000 description 2
- 239000010425 asbestos Substances 0.000 description 2
- 229910021346 calcium silicide Inorganic materials 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229920001568 phenolic resin Polymers 0.000 description 2
- 229910052895 riebeckite Inorganic materials 0.000 description 2
- 238000007789 sealing Methods 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 238000007711 solidification Methods 0.000 description 2
- 230000008023 solidification Effects 0.000 description 2
- 229910052845 zircon Inorganic materials 0.000 description 2
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 2
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 208000010513 Stupor Diseases 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 239000000404 calcium aluminium silicate Substances 0.000 description 1
- 235000012215 calcium aluminium silicate Nutrition 0.000 description 1
- 229940078583 calcium aluminosilicate Drugs 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 230000000873 masking effect Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000011490 mineral wool Substances 0.000 description 1
- 239000012768 molten material Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- 239000011505 plaster Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000010079 rubber tapping Methods 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000002893 slag Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 239000008279 sol Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B22—CASTING; POWDER METALLURGY
- B22D—CASTING OF METALS; CASTING OF OTHER SUBSTANCES BY THE SAME PROCESSES OR DEVICES
- B22D41/00—Casting melt-holding vessels, e.g. ladles, tundishes, cups or the like
- B22D41/02—Linings
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B22—CASTING; POWDER METALLURGY
- B22D—CASTING OF METALS; CASTING OF OTHER SUBSTANCES BY THE SAME PROCESSES OR DEVICES
- B22D41/00—Casting melt-holding vessels, e.g. ladles, tundishes, cups or the like
- B22D41/50—Pouring-nozzles
- B22D41/502—Connection arrangements; Sealing means therefor
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Furnace Housings, Linings, Walls, And Ceilings (AREA)
- Compositions Of Oxide Ceramics (AREA)
- Continuous Casting (AREA)
- Casting Support Devices, Ladles, And Melt Control Thereby (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5687871 | 1971-12-07 | ||
| GB4824972A GB1364665A (en) | 1971-12-07 | 1972-10-19 | Tundishes |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2259553A1 DE2259553A1 (de) | 1973-06-20 |
| DE2259553B2 true DE2259553B2 (de) | 1979-04-19 |
Family
ID=26266234
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE7244587U Expired DE7244587U (de) | 1971-12-07 | 1972-12-06 | Zwischenbehaelter fuer stranggussanlagen |
| DE2259553A Ceased DE2259553B2 (de) | 1971-12-07 | 1972-12-06 | Zwischenbehälter für Stranggießanlagen |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE7244587U Expired DE7244587U (de) | 1971-12-07 | 1972-12-06 | Zwischenbehaelter fuer stranggussanlagen |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4245761A (OSRAM) |
| JP (1) | JPS5223323B2 (OSRAM) |
| AU (1) | AU463455B2 (OSRAM) |
| CA (1) | CA963231A (OSRAM) |
| CH (1) | CH559077A5 (OSRAM) |
| DE (2) | DE7244587U (OSRAM) |
| FR (1) | FR2169807B1 (OSRAM) |
| GB (1) | GB1364665A (OSRAM) |
| IT (1) | IT975972B (OSRAM) |
| NL (1) | NL169695B (OSRAM) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2530781A1 (de) * | 1974-07-11 | 1976-02-05 | Foseco Int | Behaelter fuer geschmolzenes metall und futterplatten zum ausmauern solcher behaelter |
| DE3119548C1 (de) * | 1981-05-16 | 1982-12-09 | Chamotte- u. Tonwerk Kurt Hagenburger, 6719 Hettenleidelheim | Verschleissschicht eines mit Dauerfutter ausgekleideten metallurgischen Gefaesses mit einer zum Dauerfutter hin nicht gesinterten Schicht |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1469513A (en) * | 1973-07-30 | 1977-04-06 | Foseco Trading Ag | Tundishes |
| GB1477632A (en) * | 1973-08-16 | 1977-06-22 | Foseco Int | Containers for molten metal |
| JPS5077410U (OSRAM) * | 1973-11-17 | 1975-07-05 | ||
| GB1517749A (en) * | 1975-02-10 | 1978-07-12 | Foseco Trading Ag | Refractory heat-insulating materials |
| LU72865A1 (OSRAM) * | 1975-06-30 | 1977-03-07 | ||
| FR2333599A1 (fr) * | 1975-12-02 | 1977-07-01 | Daussan Henri | Dispositif a element tubulaire pour la coulee des metaux fondus |
| GB1542962A (en) * | 1976-04-07 | 1979-03-28 | Foseco Trading Ag | Tundishes |
| GB1540090A (en) * | 1976-04-07 | 1979-02-07 | Foseco Trading Ag | Tundishes |
| JPS52149222A (en) * | 1976-06-08 | 1977-12-12 | Aikoh Co | Adiabatic plate for treatment of molten metal |
| GB1585180A (en) * | 1976-10-07 | 1981-02-25 | Foseco Trading Ag | Lining slabs for containers for molten metal |
| FR2367568A1 (fr) * | 1976-10-14 | 1978-05-12 | Daussan & Co | Dispositif de prechauffage pour repartiteurs de coulee a obturateurs |
| SE434352B (sv) * | 1976-11-04 | 1984-07-23 | Foseco Int | Forfarande och anordning for forvermning av samverkande delar av ett munstycke och en stopparstang i ett for smelt metall avsett kerl |
| GB1537739A (en) * | 1976-12-07 | 1979-01-04 | Foseco Trading Ag | Molten metal handling vessels |
| SE430574B (sv) * | 1977-03-28 | 1983-11-28 | Foseco Trading Ag | Forfarande och anordning for tappning av smelt metall ur en skenk i ett annat kerl under formedling av ett mellankerl |
| ZA814207B (en) * | 1980-07-02 | 1982-07-28 | Foseco Trading Ag | Metal casting and lined ladles therefor |
| US4330107A (en) | 1980-07-08 | 1982-05-18 | Foseco Trading A.G. | Teapot ladle and method of use |
| JPS5732857A (en) * | 1980-07-12 | 1982-02-22 | Foseco Trading Ag | Tundish |
| AT375850B (de) * | 1980-07-16 | 1984-09-10 | Voest Alpine Ag | Verfahren zur heissreparatur der schutzschicht auf dem dauerfutter eines zwischengefaesses einer stranggiessanlage |
| JPS57184884A (en) * | 1981-05-08 | 1982-11-13 | Fuaizaa Kuiguree Kk | Protective layer for metallurgical vessel |
| DE3271012D1 (en) * | 1981-09-19 | 1986-06-12 | Foseco Trading Ag | Molten metal transfer channels |
| US4623131A (en) * | 1981-12-24 | 1986-11-18 | Foseco Trading A.G. | Molten metal handling vessels |
| GB2121150B (en) * | 1982-05-27 | 1985-11-13 | Morganite Thermal Designs Limi | Linings for molten metal holders |
| US4618079A (en) * | 1982-12-01 | 1986-10-21 | Foseco Trading A.G. | Refractory, heat-insulating slabs |
| GB8301543D0 (en) * | 1983-01-20 | 1983-02-23 | Foseco Trading Ag | Refractory heat-insulating articles |
| GB8705736D0 (en) * | 1987-03-11 | 1987-04-15 | Jet Refractories Ltd | Refractory composition |
| US5147830A (en) * | 1989-10-23 | 1992-09-15 | Magneco/Metrel, Inc. | Composition and method for manufacturing steel-containment equipment |
| GB9012677D0 (en) * | 1990-06-07 | 1990-08-01 | Foseco Int | Refractory composition |
| GB9018205D0 (en) * | 1990-08-18 | 1990-10-03 | Foseco Int | Lining of metallurgical vessels |
| GB2257779B (en) * | 1991-07-17 | 1995-05-17 | Foseco Int | Lining of metallurical vessels |
| JPH0555445U (ja) * | 1991-12-27 | 1993-07-23 | ミツミ電機株式会社 | 電池収容ケース |
| US5507474A (en) * | 1994-01-13 | 1996-04-16 | Minerals Technologies, Inc. | Lining for molten metal handling vessles |
| RU2138366C1 (ru) * | 1998-02-10 | 1999-09-27 | Акционерное общество "Новолипецкий металлургический комбинат" | Способ футеровки сталеразливочного ковша |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB932073A (en) * | 1961-05-15 | 1963-07-24 | Campbell Gifford & Morton Ltd | Improvements in refractory-lined tundishes |
| US3392888A (en) * | 1966-04-22 | 1968-07-16 | Vesuvius Crucible Co | Exothermically heated molten metal pouring nozzle |
| US3333746A (en) * | 1966-05-19 | 1967-08-01 | Harbison Walker Refractories | Tundish ladles |
| US3508600A (en) * | 1967-10-16 | 1970-04-28 | William T Rawles | Process of casting with mold stool protection plate |
| US3552732A (en) * | 1967-12-21 | 1971-01-05 | Bethlehem Steel Corp | Refractory lined ladle having means to facilitate removal of the lining |
| FR2235115B1 (OSRAM) * | 1973-06-29 | 1977-01-07 | Lubrizol Corp |
-
1972
- 1972-10-19 GB GB4824972A patent/GB1364665A/en not_active Expired
- 1972-12-06 IT IT70848/72A patent/IT975972B/it active
- 1972-12-06 CA CA158,225FILED*7A patent/CA963231A/en not_active Expired
- 1972-12-06 DE DE7244587U patent/DE7244587U/de not_active Expired
- 1972-12-06 DE DE2259553A patent/DE2259553B2/de not_active Ceased
- 1972-12-06 AU AU49688/72A patent/AU463455B2/en not_active Expired
- 1972-12-07 JP JP47123308A patent/JPS5223323B2/ja not_active Expired
- 1972-12-07 NL NLAANVRAGE7216642,A patent/NL169695B/xx not_active Application Discontinuation
- 1972-12-07 CH CH1786672A patent/CH559077A5/xx not_active IP Right Cessation
- 1972-12-07 FR FR7243585A patent/FR2169807B1/fr not_active Expired
-
1977
- 1977-04-22 US US05/789,943 patent/US4245761A/en not_active Expired - Lifetime
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2530781A1 (de) * | 1974-07-11 | 1976-02-05 | Foseco Int | Behaelter fuer geschmolzenes metall und futterplatten zum ausmauern solcher behaelter |
| DE3119548C1 (de) * | 1981-05-16 | 1982-12-09 | Chamotte- u. Tonwerk Kurt Hagenburger, 6719 Hettenleidelheim | Verschleissschicht eines mit Dauerfutter ausgekleideten metallurgischen Gefaesses mit einer zum Dauerfutter hin nicht gesinterten Schicht |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7216642A (OSRAM) | 1973-06-12 |
| NL169695B (nl) | 1982-03-16 |
| AU4968872A (en) | 1974-06-06 |
| CH559077A5 (OSRAM) | 1975-02-28 |
| FR2169807B1 (OSRAM) | 1975-03-28 |
| JPS4866022A (OSRAM) | 1973-09-11 |
| AU463455B2 (en) | 1975-07-04 |
| JPS5223323B2 (OSRAM) | 1977-06-23 |
| DE7244587U (de) | 1976-02-19 |
| DE2259553A1 (de) | 1973-06-20 |
| CA963231A (en) | 1975-02-25 |
| FR2169807A1 (OSRAM) | 1973-09-14 |
| US4245761A (en) | 1981-01-20 |
| GB1364665A (en) | 1974-08-29 |
| IT975972B (it) | 1974-08-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2259553B2 (de) | Zwischenbehälter für Stranggießanlagen | |
| DE2627896C2 (de) | Bodenausguß für einen Zwischenbehälter für flüssige Metalle | |
| DE3010868C2 (OSRAM) | ||
| DE2439963C3 (de) | Behälter für geschmolzenes Metall | |
| DE2435895A1 (de) | Zwischenbehaelter fuer stranggussanlagen | |
| DE2646707B2 (de) | Tauchausguß aus feuerfestem Werkstoff für das Stranggießen von Stahl | |
| DE2653213A1 (de) | Vorrichtung zur vorwaermung von mit verschlussgliedern versehenen zwischenkannen | |
| DE3614730C2 (OSRAM) | ||
| DE3119548C1 (de) | Verschleissschicht eines mit Dauerfutter ausgekleideten metallurgischen Gefaesses mit einer zum Dauerfutter hin nicht gesinterten Schicht | |
| DE2148325A1 (de) | Metallurgischer behaelter | |
| US4165026A (en) | Tundish with expendable lining and easily removable nozzle | |
| DE69012299T2 (de) | Schutzschicht für metallurgische Ofenbeschichtungen und dergleichen. | |
| DE2754520C3 (de) | Gefäß zur Aufnahme von Metallschmelze | |
| DE2233894A1 (de) | Verfahren zum feuerfesten zustellen von gefaessen fuer metallschmelzen | |
| DE1925390C3 (de) | Vorrichtung zur Herabsetzung der Klebneigung des Stopfenkopfes auf dem Ausgußstein bei Stopfenverschlüssen an Gießeinrichtungen | |
| DE2363776B2 (de) | Verfahren zum Herstellen einer hitzebeständigen Auskleidung | |
| DE2630500C2 (de) | Schutzrohr für die Schmelzzuführung zu einem Zwischenbehälter | |
| EP0770440B1 (de) | Pfanne zum Aufnehmen von heissem, flüssigem Gussmaterial und für diese Pfanne bestimmter Randstein | |
| DE2010743C (de) | Zwischenbehälter für Stranggießkokillen | |
| DE1458173A1 (de) | Plattenanordnung zur Verwendung beim Halten einer in eine Kokille zu giessenden Masse aus geschmolzenem Metall | |
| EP0044826B1 (de) | Verfahren zur Heissreparatur eines Zwischengefässes einer Stranggiessanlage | |
| AT231340B (de) | Feuerfester Stein zum Aufbau der Auskleidung von Industrieöfen | |
| AT322758B (de) | Mehrteiliges gefäss zur aufnahme und flüssighaltung einer metall- oder metallegierungsschmelze | |
| DE2010743A1 (en) | Continuous casting tundish | |
| DE3744694C2 (OSRAM) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OGA | New person/name/address of the applicant | ||
| 8235 | Patent refused |