DE2252210A1 - Schwerentflammbare thermoplastische polyester - Google Patents
Schwerentflammbare thermoplastische polyesterInfo
- Publication number
- DE2252210A1 DE2252210A1 DE2252210A DE2252210A DE2252210A1 DE 2252210 A1 DE2252210 A1 DE 2252210A1 DE 2252210 A DE2252210 A DE 2252210A DE 2252210 A DE2252210 A DE 2252210A DE 2252210 A1 DE2252210 A1 DE 2252210A1
- Authority
- DE
- Germany
- Prior art keywords
- polyester
- radical
- weight
- saturated
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920000728 polyester Polymers 0.000 title claims description 31
- 229920001169 thermoplastic Polymers 0.000 title claims description 5
- 239000004416 thermosoftening plastic Substances 0.000 title claims description 5
- -1 cyclic alkyl radical Chemical class 0.000 claims description 21
- 238000004519 manufacturing process Methods 0.000 claims description 11
- 229920006395 saturated elastomer Polymers 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 5
- 239000000835 fiber Substances 0.000 claims description 4
- 238000001746 injection moulding Methods 0.000 claims description 4
- 150000003009 phosphonic acids Chemical class 0.000 claims description 4
- 150000003254 radicals Chemical class 0.000 claims description 4
- 150000001447 alkali salts Chemical class 0.000 claims description 3
- 239000003365 glass fiber Substances 0.000 claims description 3
- 229920000642 polymer Polymers 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 238000001125 extrusion Methods 0.000 claims description 2
- 239000000945 filler Substances 0.000 claims description 2
- 238000000748 compression moulding Methods 0.000 claims 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 11
- 238000000465 moulding Methods 0.000 description 9
- 229920000139 polyethylene terephthalate Polymers 0.000 description 8
- 239000005020 polyethylene terephthalate Substances 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 6
- 238000009833 condensation Methods 0.000 description 5
- 229920001283 Polyalkylene terephthalate Polymers 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 150000002009 diols Chemical class 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 238000007792 addition Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 150000003018 phosphorus compounds Chemical class 0.000 description 3
- KSKSMWHBMWHUAL-UHFFFAOYSA-M sodium;ethyl(hydroxy)phosphinate Chemical compound [Na+].CCP(O)([O-])=O KSKSMWHBMWHUAL-UHFFFAOYSA-M 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000002667 nucleating agent Substances 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- 239000007790 solid phase Substances 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- JHDJUJAFXNIIIW-UHFFFAOYSA-N (4-phosphonophenyl)phosphonic acid Chemical class OP(O)(=O)C1=CC=C(P(O)(O)=O)C=C1 JHDJUJAFXNIIIW-UHFFFAOYSA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- XYJLPCAKKYOLGU-UHFFFAOYSA-N 2-phosphonoethylphosphonic acid Chemical class OP(O)(=O)CCP(O)(O)=O XYJLPCAKKYOLGU-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- DZKUVVFEQHCDSK-UHFFFAOYSA-N P([O-])([O-])[O-].[Ge+3] Chemical compound P([O-])([O-])[O-].[Ge+3] DZKUVVFEQHCDSK-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- JXSJBGJIGXNWCI-UHFFFAOYSA-N diethyl 2-[(dimethoxyphosphorothioyl)thio]succinate Chemical compound CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC JXSJBGJIGXNWCI-UHFFFAOYSA-N 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 229940042400 direct acting antivirals phosphonic acid derivative Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000007706 flame test Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000012784 inorganic fiber Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229940071125 manganese acetate Drugs 0.000 description 1
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000009347 mechanical transmission Effects 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- RXOHFPCZGPKIRD-UHFFFAOYSA-N naphthalene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(C(=O)O)=CC=C21 RXOHFPCZGPKIRD-UHFFFAOYSA-N 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- 150000003007 phosphonic acid derivatives Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- BESAEFHCILHDTB-UHFFFAOYSA-M sodium;benzyl(hydroxy)phosphinate Chemical compound [Na+].OP([O-])(=O)CC1=CC=CC=C1 BESAEFHCILHDTB-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/51—Phosphorus bound to oxygen
- C08K5/53—Phosphorus bound to oxygen bound to oxygen and to carbon only
- C08K5/5317—Phosphonic compounds, e.g. R—P(:O)(OR')2
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polyesters Or Polycarbonates (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2252210A DE2252210A1 (de) | 1972-10-25 | 1972-10-25 | Schwerentflammbare thermoplastische polyester |
| NL7314425A NL7314425A (cg-RX-API-DMAC10.html) | 1972-10-25 | 1973-10-19 | |
| CH1486073A CH555870A (de) | 1972-10-25 | 1973-10-22 | Schwerentflammbare thermoplastische polyester. |
| IT30478/73A IT998899B (it) | 1972-10-25 | 1973-10-23 | Poliesteri termoplastici difficil mente infiammabili |
| JP48118589A JPS4974735A (cg-RX-API-DMAC10.html) | 1972-10-25 | 1973-10-23 | |
| AU61718/73A AU6171873A (en) | 1972-10-25 | 1973-10-23 | Thermoplastic polyesters |
| US408646A US3894986A (en) | 1972-10-25 | 1973-10-23 | Flame resistant thermoplastic polyesters |
| BR8327/73A BR7308327D0 (pt) | 1972-10-25 | 1973-10-24 | Composicao de poliesteres termoplasticos |
| ZA738244A ZA738244B (en) | 1972-10-25 | 1973-10-24 | Flame resistant thermoplastic polyesters |
| BE137070A BE806520A (fr) | 1972-10-25 | 1973-10-25 | Polyesters thermoplastiques peu inflammables |
| FR7338039A FR2204658B1 (cg-RX-API-DMAC10.html) | 1972-10-25 | 1973-10-25 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2252210A DE2252210A1 (de) | 1972-10-25 | 1972-10-25 | Schwerentflammbare thermoplastische polyester |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2252210A1 true DE2252210A1 (de) | 1974-05-09 |
Family
ID=5859967
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2252210A Pending DE2252210A1 (de) | 1972-10-25 | 1972-10-25 | Schwerentflammbare thermoplastische polyester |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3894986A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS4974735A (cg-RX-API-DMAC10.html) |
| AU (1) | AU6171873A (cg-RX-API-DMAC10.html) |
| BE (1) | BE806520A (cg-RX-API-DMAC10.html) |
| BR (1) | BR7308327D0 (cg-RX-API-DMAC10.html) |
| CH (1) | CH555870A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2252210A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2204658B1 (cg-RX-API-DMAC10.html) |
| IT (1) | IT998899B (cg-RX-API-DMAC10.html) |
| NL (1) | NL7314425A (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA738244B (cg-RX-API-DMAC10.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1739122A1 (de) * | 2005-06-30 | 2007-01-03 | Lanxess Deutschland GmbH | Polymerzubereitungen enthaltend ein Metallsalz einer Phosphonsäure |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7510243A (nl) * | 1974-09-04 | 1976-03-08 | Hoechst Ag | Gestabiliseerde polyalkeenvormmassa. |
| DE2447727A1 (de) * | 1974-10-07 | 1976-04-08 | Hoechst Ag | Schwerentflammbare polyamidformmassen |
| US4288489A (en) * | 1978-02-06 | 1981-09-08 | Ciba-Geigy Corporation | Process for flameproofing organic fibrous material with phosphonic acid salts |
| US4224203A (en) * | 1978-09-05 | 1980-09-23 | Argus Chemical Corporation | Vinyl chloride polymer stabilizer comprising a metal organophosphonate |
| US4383066A (en) * | 1980-04-15 | 1983-05-10 | Mitsubishi Gas Chemical Company, Inc. | Polyphenylene ether resin composition |
| FR2512039B1 (fr) * | 1981-08-26 | 1985-10-11 | Ato Chimie | Composition de resine synthetique ayant une bonne resistance au feu renfermant un polycarbonate, un additif ignifugeant phosphore, et eventuellement d'autres additifs et/ou des charges et objets conformes |
| GB8611357D0 (en) * | 1986-05-09 | 1986-06-18 | Ciba Geigy Ag | Flame retardent polymer compositions |
| NL8703025A (nl) * | 1987-12-15 | 1989-07-03 | Gen Electric | Polymeer samenstelling met lithiumzout van fosfonzuur en lithiumzout. |
| GB8912388D0 (en) * | 1989-05-30 | 1989-07-12 | Ici Plc | 3-hydroxybutyrate polymer composition |
| AU1894799A (en) * | 1998-09-08 | 2000-03-27 | Isle Firestop Ltd. | Combustion retardant for polymeric materials |
| RU2281992C1 (ru) * | 2005-03-02 | 2006-08-20 | Государственное образовательное учреждение высшего профессионального образования Саратовский государственный технический университет (ГОУ ВПО СГТУ) | Способ получения огнезащищенного полиэфирного волокнистого материала |
| DE102008063668A1 (de) * | 2008-12-18 | 2010-07-01 | Clariant International Limited | Verfahren zur Herstellung von Alkylphosponsäuren, -estern und -salzen mittels Oxidation von Alkylphosphonigsäuren und ihre Verwendung |
| US9745449B2 (en) * | 2013-07-24 | 2017-08-29 | Lanxess Solutions Us Inc. | Phosphorus containing flame retardants |
| US9765204B2 (en) | 2013-07-24 | 2017-09-19 | Lanxess Solutions Us Inc. | Halogen free high temperature polyamide compositions comprising phosphorus containing flame retardants |
| EP3172217B1 (en) | 2014-07-22 | 2021-09-01 | LANXESS Corporation | Phosphorus containing flame retardants |
| US10035896B2 (en) | 2014-07-29 | 2018-07-31 | Lanxess Solutions Us Inc. | Salts of pyrophosphonic acid as flame retardants |
| JP6559240B2 (ja) * | 2015-01-09 | 2019-08-14 | ランクセス ソリューションズ ユーエス インコーポレイテッド | リン含有難燃剤を含むポリマー組成物の加工安定化 |
| US9752009B2 (en) | 2015-01-26 | 2017-09-05 | Lanxess Solutions Us Inc. | Flame retardant polymer compositions comprising heat treated phosphorus compounds and melam |
| US9534108B2 (en) | 2015-03-13 | 2017-01-03 | Chemtura Corporation | Flame retardant epoxy resins comprising phosphorus containing flame retardants |
| KR102799160B1 (ko) | 2018-12-20 | 2025-04-22 | 란세스 코포레이션 | 용이하게 처리가능하고 열적으로 안정한 인 함유 난연성 물질을 제조하는 방법 |
| ES3040659T3 (en) | 2020-06-17 | 2025-11-04 | Lanxess Corp | Flame retardant and stabilizer combined for use with thermoplastics |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3474047A (en) * | 1959-08-28 | 1969-10-21 | Wyandotte Chemicals Corp | Polyurethane compositions |
| US3471552A (en) * | 1965-08-24 | 1969-10-07 | Plains Chem Dev Co | Aliphatic polyphosphonic acids and derivatives thereof |
| US3463835A (en) * | 1965-10-05 | 1969-08-26 | Plains Chem Dev Co | Aromatic polyphosphonic acids,salts and esters |
| US3576793A (en) * | 1967-05-08 | 1971-04-27 | Monsanto Co | Polymers of alkylene diphosphonic acids and salts and copolymers thereof |
| US3522204A (en) * | 1968-07-01 | 1970-07-28 | American Cyanamid Co | Synergistic flame-retardant compositions |
| US3676393A (en) * | 1968-10-14 | 1972-07-11 | Goodyear Tire & Rubber | Polyesters stabilized by phosphorus compounds |
| DE1934903A1 (de) * | 1969-07-10 | 1971-01-14 | Hoechst Ag | Thermoplastische Formmassen auf Basis Polyester |
| BE754116A (fr) * | 1969-07-29 | 1971-01-29 | Hoechst Ag | Matieres a mouler thermoplastiques a base de polyesters |
| US3664975A (en) * | 1970-04-13 | 1972-05-23 | Monsanto Co | Flame resistant polyurethane prepared by adding an ethane diphosphonate into the urethane-forming mixture |
| US3751396A (en) * | 1970-11-27 | 1973-08-07 | Celanese Corp | Reinforced polyalkylene terephthalate molding resin having reduced burning properties in thin sections |
-
1972
- 1972-10-25 DE DE2252210A patent/DE2252210A1/de active Pending
-
1973
- 1973-10-19 NL NL7314425A patent/NL7314425A/xx unknown
- 1973-10-22 CH CH1486073A patent/CH555870A/xx not_active IP Right Cessation
- 1973-10-23 JP JP48118589A patent/JPS4974735A/ja active Pending
- 1973-10-23 US US408646A patent/US3894986A/en not_active Expired - Lifetime
- 1973-10-23 IT IT30478/73A patent/IT998899B/it active
- 1973-10-23 AU AU61718/73A patent/AU6171873A/en not_active Expired
- 1973-10-24 ZA ZA738244A patent/ZA738244B/xx unknown
- 1973-10-24 BR BR8327/73A patent/BR7308327D0/pt unknown
- 1973-10-25 BE BE137070A patent/BE806520A/xx unknown
- 1973-10-25 FR FR7338039A patent/FR2204658B1/fr not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1739122A1 (de) * | 2005-06-30 | 2007-01-03 | Lanxess Deutschland GmbH | Polymerzubereitungen enthaltend ein Metallsalz einer Phosphonsäure |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2204658A1 (cg-RX-API-DMAC10.html) | 1974-05-24 |
| AU6171873A (en) | 1975-04-24 |
| IT998899B (it) | 1976-02-20 |
| NL7314425A (cg-RX-API-DMAC10.html) | 1974-04-29 |
| US3894986A (en) | 1975-07-15 |
| BR7308327D0 (pt) | 1974-09-05 |
| FR2204658B1 (cg-RX-API-DMAC10.html) | 1977-03-11 |
| JPS4974735A (cg-RX-API-DMAC10.html) | 1974-07-18 |
| CH555870A (de) | 1974-11-15 |
| BE806520A (fr) | 1974-04-25 |
| ZA738244B (en) | 1974-10-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2252210A1 (de) | Schwerentflammbare thermoplastische polyester | |
| DE2252258A1 (de) | Schwerentflammbare thermoplastische polyester | |
| DE2255971C2 (de) | Neue cyclische Phosphonatester, Verfahren zu deren Herstellung und deren Verwendung als Flammverzögerungsmittel | |
| DE2346787C3 (de) | Schwer entflammbare lineare Polyester, Verfahren zu deren Herstellung und deren Verwendung | |
| JPS59202240A (ja) | 難燃性熱可塑性樹脂組成物 | |
| CH640547A5 (de) | Verfahren zur herstellung eines linearen homo- oder copolyesters mit verbesserter hitzestabilitaet. | |
| DE2454189A1 (de) | Verfahren zur herstellung schwer entflammbarer linearer polyester | |
| EP0327092B1 (de) | Phosphonate, Verfahren zu deren Herstellung und deren Verwendung als Flammschutzmittel in Kunststoffen | |
| DE69226503T2 (de) | Polymerzusammensetzung mit phosphorhaltigen linearen Copolyestern | |
| DE2706128C2 (de) | Schnell kristallisierende Polyestermassen und Verfahren zu ihrer Herstellung | |
| EP0970093B1 (de) | Aluminiumsalze von alkylhydroxymethylphosphinsäuren | |
| DE2653120C2 (de) | Schnellkristallisierende Polyestermassen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE4221678C2 (de) | Hydroxyalkan-phosphonate von Polyolen | |
| DE2706123C2 (cg-RX-API-DMAC10.html) | ||
| EP0048878B1 (de) | Neue Hydroxiphenylgruppen enthaltende Phosphorigsäureester, Verfahren zu ihrer Herstellung und ihre Verwendung als Stabilisatoren für thermoplastische Polyester | |
| DE2238222A1 (de) | Schwerentflammbare thermoplastische polyester | |
| EP0304785B1 (de) | Polyphenylensulfid-Formmassen mit verbesserten elektrischen Eigenschaften | |
| US3883474A (en) | Flame resistant thermoplastic polyesters | |
| DE2236039A1 (de) | Schwerentflammbare, glasklare thermoplastische polyester | |
| AT264140B (de) | Verfahren zur Herstellung 2,5-Dihydroxyterephthalsäure enthaltender Polyester und Copolyester | |
| DE2258663A1 (de) | Schwerentflammbare thermoplastische polyester | |
| US4210740A (en) | Copolyesters prepared from phosphorus compounds which can be shaped and which have reduced flammability | |
| AT257940B (de) | Verfahren zur Herstellung linearer Copolyester | |
| DE2008984A1 (en) | Linear copolyester for transparent injection mouldings | |
| AT340570B (de) | Geformte gegenstande, wie faden, fasern, folien und formkorper |