DE2250050C2 - Farbphotographisches Aufzeichnungsmaterial - Google Patents
Farbphotographisches AufzeichnungsmaterialInfo
- Publication number
- DE2250050C2 DE2250050C2 DE2250050A DE2250050A DE2250050C2 DE 2250050 C2 DE2250050 C2 DE 2250050C2 DE 2250050 A DE2250050 A DE 2250050A DE 2250050 A DE2250050 A DE 2250050A DE 2250050 C2 DE2250050 C2 DE 2250050C2
- Authority
- DE
- Germany
- Prior art keywords
- silver
- color
- layer
- recording material
- silver halide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 title claims description 170
- 229910052709 silver Inorganic materials 0.000 claims description 166
- 239000004332 silver Substances 0.000 claims description 166
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 93
- -1 silver halide Chemical class 0.000 claims description 89
- 239000000839 emulsion Substances 0.000 claims description 73
- 239000000975 dye Substances 0.000 claims description 56
- 108010010803 Gelatin Proteins 0.000 claims description 48
- 239000000084 colloidal system Substances 0.000 claims description 48
- 229920000159 gelatin Polymers 0.000 claims description 48
- 239000008273 gelatin Substances 0.000 claims description 48
- 235000019322 gelatine Nutrition 0.000 claims description 48
- 235000011852 gelatine desserts Nutrition 0.000 claims description 48
- 239000000758 substrate Substances 0.000 claims description 18
- 239000011230 binding agent Substances 0.000 claims description 13
- 239000001043 yellow dye Substances 0.000 claims description 6
- 239000001046 green dye Substances 0.000 claims description 5
- 238000001228 spectrum Methods 0.000 claims description 5
- 230000003595 spectral effect Effects 0.000 claims description 4
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 claims description 3
- 239000001047 purple dye Substances 0.000 claims description 3
- 206010030113 Oedema Diseases 0.000 claims 1
- 239000010410 layer Substances 0.000 description 144
- 238000000034 method Methods 0.000 description 35
- 238000011161 development Methods 0.000 description 21
- 239000003795 chemical substances by application Substances 0.000 description 19
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 16
- 239000003446 ligand Substances 0.000 description 14
- 238000004519 manufacturing process Methods 0.000 description 14
- 230000008569 process Effects 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- 230000035945 sensitivity Effects 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 11
- 239000007800 oxidant agent Substances 0.000 description 11
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 10
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 8
- 150000004696 coordination complex Chemical class 0.000 description 8
- 230000001965 increasing effect Effects 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 150000001450 anions Chemical class 0.000 description 7
- 235000019445 benzyl alcohol Nutrition 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 229910017052 cobalt Inorganic materials 0.000 description 6
- 239000010941 cobalt Substances 0.000 description 6
- 238000006479 redox reaction Methods 0.000 description 6
- 238000012546 transfer Methods 0.000 description 6
- WYMDDFRYORANCC-UHFFFAOYSA-N 2-[[3-[bis(carboxymethyl)amino]-2-hydroxypropyl]-(carboxymethyl)amino]acetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)CN(CC(O)=O)CC(O)=O WYMDDFRYORANCC-UHFFFAOYSA-N 0.000 description 5
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 4
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 4
- 150000001868 cobalt Chemical class 0.000 description 4
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 4
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 4
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- 229910002651 NO3 Inorganic materials 0.000 description 3
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 3
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 229960002380 dibutyl phthalate Drugs 0.000 description 3
- 230000006872 improvement Effects 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 150000003142 primary aromatic amines Chemical class 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- ZRHUHDUEXWHZMA-UHFFFAOYSA-N 1,4-dihydropyrazol-5-one Chemical compound O=C1CC=NN1 ZRHUHDUEXWHZMA-UHFFFAOYSA-N 0.000 description 2
- ZNBNBTIDJSKEAM-UHFFFAOYSA-N 4-[7-hydroxy-2-[5-[5-[6-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]-3-methyloxolan-2-yl]-5-methyloxolan-2-yl]-2,8-dimethyl-1,10-dioxaspiro[4.5]decan-9-yl]-2-methyl-3-propanoyloxypentanoic acid Chemical compound C1C(O)C(C)C(C(C)C(OC(=O)CC)C(C)C(O)=O)OC11OC(C)(C2OC(C)(CC2)C2C(CC(O2)C2C(CC(C)C(O)(CO)O2)C)C)CC1 ZNBNBTIDJSKEAM-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 2
- 229910021607 Silver chloride Inorganic materials 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000004700 cobalt complex Chemical class 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 229910000378 hydroxylammonium sulfate Inorganic materials 0.000 description 2
- 150000002540 isothiocyanates Chemical class 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 230000002787 reinforcement Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 2
- 239000002356 single layer Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 150000005671 trienes Chemical class 0.000 description 2
- SWGJCIMEBVHMTA-UHFFFAOYSA-K trisodium;6-oxido-4-sulfo-5-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate Chemical compound [Na+].[Na+].[Na+].C1=CC=C2C(N=NC3=C4C(=CC(=CC4=CC=C3O)S([O-])(=O)=O)S([O-])(=O)=O)=CC=C(S([O-])(=O)=O)C2=C1 SWGJCIMEBVHMTA-UHFFFAOYSA-K 0.000 description 2
- ILKZXYARHQNMEF-UHFFFAOYSA-N (4-azaniumyl-3-methylphenyl)-ethyl-(2-methoxyethyl)azanium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1.CC1=CC=C(S(O)(=O)=O)C=C1.COCCN(CC)C1=CC=C(N)C(C)=C1 ILKZXYARHQNMEF-UHFFFAOYSA-N 0.000 description 1
- NZTCRHBIQWZHEY-UHFFFAOYSA-N (4-azaniumylphenyl)-methylazanium;sulfate Chemical compound OS(O)(=O)=O.CNC1=CC=C(N)C=C1 NZTCRHBIQWZHEY-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- 241000792859 Enema Species 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 239000002879 Lewis base Substances 0.000 description 1
- 244000000231 Sesamum indicum Species 0.000 description 1
- 235000003434 Sesamum indicum Nutrition 0.000 description 1
- IEIREBQISNYNTN-UHFFFAOYSA-K [Ag](I)(Br)Cl Chemical compound [Ag](I)(Br)Cl IEIREBQISNYNTN-UHFFFAOYSA-K 0.000 description 1
- SJOOOZPMQAWAOP-UHFFFAOYSA-N [Ag].BrCl Chemical compound [Ag].BrCl SJOOOZPMQAWAOP-UHFFFAOYSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 230000032900 absorption of visible light Effects 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- 159000000021 acetate salts Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- QZPSXPBJTPJTSZ-UHFFFAOYSA-N aqua regia Chemical compound Cl.O[N+]([O-])=O QZPSXPBJTPJTSZ-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- ZEUDGVUWMXAXEF-UHFFFAOYSA-L bromo(chloro)silver Chemical compound Cl[Ag]Br ZEUDGVUWMXAXEF-UHFFFAOYSA-L 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- PKCHODKZKBAVIJ-UHFFFAOYSA-L chloro(iodo)silver Chemical compound Cl[Ag]I PKCHODKZKBAVIJ-UHFFFAOYSA-L 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 description 1
- LBFUKZWYPLNNJC-UHFFFAOYSA-N cobalt(ii,iii) oxide Chemical compound [Co]=O.O=[Co]O[Co]=O LBFUKZWYPLNNJC-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229940075933 dithionate Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000007920 enema Substances 0.000 description 1
- 229940095399 enema Drugs 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 1
- BICAGYDGRXJYGD-UHFFFAOYSA-N hydrobromide;hydrochloride Chemical compound Cl.Br BICAGYDGRXJYGD-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000011229 interlayer Substances 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 150000007527 lewis bases Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- PQCWTNQXCXUEAO-UHFFFAOYSA-N n,n-diethylaniline;hydron;chloride Chemical compound Cl.CCN(CC)C1=CC=CC=C1 PQCWTNQXCXUEAO-UHFFFAOYSA-N 0.000 description 1
- XULSCZPZVQIMFM-IPZQJPLYSA-N odevixibat Chemical compound C12=CC(SC)=C(OCC(=O)N[C@@H](C(=O)N[C@@H](CC)C(O)=O)C=3C=CC(O)=CC=3)C=C2S(=O)(=O)NC(CCCC)(CCCC)CN1C1=CC=CC=C1 XULSCZPZVQIMFM-IPZQJPLYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000033458 reproduction Effects 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- HLWRUJAIJJEZDL-UHFFFAOYSA-M sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate Chemical compound [Na+].OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC([O-])=O HLWRUJAIJJEZDL-UHFFFAOYSA-M 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 150000003567 thiocyanates Chemical class 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000001429 visible spectrum Methods 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C7/00—Multicolour photographic processes or agents therefor; Regeneration of such processing agents; Photosensitive materials for multicolour processes
- G03C7/30—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials
- G03C7/3017—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials with intensification of the image by oxido-reduction
- G03C7/3018—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials with intensification of the image by oxido-reduction using cobalt compounds
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S430/00—Radiation imagery chemistry: process, composition, or product thereof
- Y10S430/137—Cobalt complex containing
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US18933071A | 1971-10-14 | 1971-10-14 | |
| US00285399A US3822129A (en) | 1971-10-14 | 1972-08-31 | Photographic materials and processes |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2250050A1 DE2250050A1 (de) | 1973-04-26 |
| DE2250050C2 true DE2250050C2 (de) | 1982-05-06 |
Family
ID=26885029
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2250050A Expired DE2250050C2 (de) | 1971-10-14 | 1972-10-12 | Farbphotographisches Aufzeichnungsmaterial |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3822129A (enExample) |
| JP (1) | JPS561626B2 (enExample) |
| AR (1) | AR195882A1 (enExample) |
| AU (1) | AU468916B2 (enExample) |
| BE (1) | BE790101A (enExample) |
| CA (1) | CA995957A (enExample) |
| CH (1) | CH552833A (enExample) |
| DD (1) | DD106481A5 (enExample) |
| DE (1) | DE2250050C2 (enExample) |
| ES (1) | ES407588A1 (enExample) |
| FR (1) | FR2156330B1 (enExample) |
| GB (1) | GB1403418A (enExample) |
| IT (1) | IT968887B (enExample) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4134767A (en) * | 1973-10-22 | 1979-01-16 | Konishiroku Photo Industry Co., Ltd. | Silver halide photosensitive material for color photography |
| US4113490A (en) * | 1974-07-12 | 1978-09-12 | Konishiroku Photo Industry Co., Ltd. | Method for processing light-sensitive silver halide photographic materials |
| GB1524027A (en) * | 1974-09-03 | 1978-09-06 | Agfa Gevaert | Colour radiographic silver halide process |
| JPS5211034A (en) * | 1975-07-17 | 1977-01-27 | Fuji Photo Film Co Ltd | Image formation method by color intensification processing |
| JPS589940B2 (ja) * | 1975-08-11 | 1983-02-23 | 富士写真フイルム株式会社 | ガゾウケイセイホウホウ |
| CA1064311A (en) * | 1975-09-02 | 1979-10-16 | Vernon L. Bissonette | Redox amplification process employing cobalt iii complex and peroxide as oxidizing agents |
| JPS604979B2 (ja) * | 1975-10-07 | 1985-02-07 | コニカ株式会社 | 色素画像の補強方法 |
| JPS5251941A (en) * | 1975-10-24 | 1977-04-26 | Konishiroku Photo Ind Co Ltd | Processing of silver halide photographic light sensitive material |
| JPS544125A (en) * | 1977-06-11 | 1979-01-12 | Mitsubishi Paper Mills Ltd | Multilayer photosensitive material for color photography |
| JPS56165145A (en) * | 1980-05-26 | 1981-12-18 | Fuji Photo Film Co Ltd | Bleach-fixing method for color sensitive silver halide material |
| JPH01170228U (enExample) * | 1988-05-20 | 1989-12-01 | ||
| JPH01178024U (enExample) * | 1988-06-07 | 1989-12-20 | ||
| JPH03138646A (ja) * | 1989-10-25 | 1991-06-13 | Konica Corp | ハロゲン化銀写真感光材料の処理方法 |
| DE4143566C2 (de) * | 1990-03-24 | 1999-09-02 | Aioi Seiki Kk | Drehantrieb mit einem Schraubgetriebe |
| GB9008750D0 (en) * | 1990-04-18 | 1990-06-13 | Kodak Ltd | Method and apparatus for photographic processing solution replenishment |
| GB9016472D0 (en) * | 1990-07-26 | 1990-09-12 | Kodak Ltd | Photographic bleach compositions |
| GB9022779D0 (en) * | 1990-10-19 | 1990-12-05 | Kodak Ltd | Photographic processing apparatus |
| GB9022781D0 (en) * | 1990-10-19 | 1990-12-05 | Kodak Ltd | Photographic processing apparatus |
| GB9024783D0 (en) * | 1990-11-14 | 1991-01-02 | Kodak Ltd | Method of processing a photographic silver halide colour material |
| GB9114090D0 (en) * | 1991-06-29 | 1991-08-14 | Kodak Ltd | Photographic processing apparatus |
| GB9114933D0 (en) * | 1991-07-11 | 1991-08-28 | Kodak Ltd | Method for forming a photographic colour image |
| JPH0553264A (ja) * | 1991-08-23 | 1993-03-05 | Konica Corp | ハロゲン化銀カラー写真感光材料 |
| GB9118299D0 (en) * | 1991-08-24 | 1991-10-09 | Kodak Ltd | Method of photographic processing |
| US5702873A (en) * | 1991-12-03 | 1997-12-30 | Eastman Kodak Company | Redox amplification solutions containing metal ion sequestering agents |
| GB9126386D0 (en) * | 1991-12-12 | 1992-02-12 | Kodak Ltd | Method of making stable colour photographic prints |
| EP0620495A1 (en) * | 1993-04-13 | 1994-10-19 | Kodak Limited | Photographic processing apparatus |
| GB9315366D0 (en) * | 1993-07-24 | 1993-09-08 | Kodak Ltd | Method of photographic processing |
| GB9315769D0 (en) * | 1993-07-30 | 1993-09-15 | Kodak Ltd | Method of photographic processing |
| GB9317035D0 (en) * | 1993-08-16 | 1993-09-29 | Kodak Ltd | Photographic colour couplers and photographic materials containing them |
| GB9423382D0 (en) | 1994-11-19 | 1995-01-11 | Kodak Ltd | Photographic developer/amplifier compositions |
| GB9423381D0 (en) | 1994-11-19 | 1995-01-11 | Kodak Ltd | Photographic developer/amplifier compositions |
| DE69525516T2 (de) * | 1994-12-24 | 2002-10-31 | Eastman Kodak Co., Rochester | Fotografisches Silberhalogenidmaterial mit verbesserter Körnigkeit und verbessertem Farbton |
| GB9426275D0 (en) * | 1994-12-24 | 1995-02-22 | Kodak Ltd | Photographic silver halide material having improved spectral characteristics |
| GB2302596B (en) * | 1995-06-22 | 1999-02-03 | Kodak Ltd | Method of photographic processing with solution replenishment |
| GB9516578D0 (en) | 1995-08-12 | 1995-10-11 | Kodak Ltd | Method of processing photographic silver halide materials |
| GB9517895D0 (en) * | 1995-09-02 | 1995-11-01 | Kodak Ltd | Method of processing a colour photographic silver halide material |
| GB9525771D0 (en) | 1995-12-16 | 1996-02-14 | Kodak Ltd | Treatment method for treating effluents from a photographic development process |
| GB9600112D0 (en) | 1996-01-04 | 1996-03-06 | Kodak Ltd | Improvements in or relating to photographic processsing apparatus |
| US5916739A (en) * | 1996-11-22 | 1999-06-29 | Konica Corporation | Silver halide light sensitive photographic material and image forming method by use thereof |
| DE102011000658A1 (de) * | 2011-02-11 | 2012-08-16 | Realeyes Gmbh | Mehrschichtfarbfilm |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3361565A (en) * | 1964-01-21 | 1968-01-02 | Du Pont | Silver halide photographic element containing a polyanionic color former and a gelatin antiabrasion layer |
-
0
- BE BE790101D patent/BE790101A/xx not_active IP Right Cessation
-
1972
- 1972-08-31 US US00285399A patent/US3822129A/en not_active Expired - Lifetime
- 1972-09-25 CA CA152,426A patent/CA995957A/en not_active Expired
- 1972-10-11 AU AU47633/72A patent/AU468916B2/en not_active Expired
- 1972-10-12 GB GB4719172A patent/GB1403418A/en not_active Expired
- 1972-10-12 IT IT30398/72A patent/IT968887B/it active
- 1972-10-12 DE DE2250050A patent/DE2250050C2/de not_active Expired
- 1972-10-13 FR FR7236309A patent/FR2156330B1/fr not_active Expired
- 1972-10-13 ES ES407588A patent/ES407588A1/es not_active Expired
- 1972-10-13 CH CH1502872A patent/CH552833A/fr not_active IP Right Cessation
- 1972-10-13 DD DD166321A patent/DD106481A5/xx unknown
- 1972-10-13 AR AR244611A patent/AR195882A1/es active
- 1972-10-14 JP JP10317072A patent/JPS561626B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4848130A (enExample) | 1973-07-07 |
| FR2156330A1 (enExample) | 1973-05-25 |
| ES407588A1 (es) | 1975-11-16 |
| DE2250050A1 (de) | 1973-04-26 |
| CH552833A (fr) | 1974-08-15 |
| IT968887B (it) | 1974-03-20 |
| AR195882A1 (es) | 1973-11-15 |
| US3822129A (en) | 1974-07-02 |
| BE790101A (fr) | 1973-04-13 |
| CA995957A (en) | 1976-08-31 |
| AU468916B2 (en) | 1976-01-29 |
| JPS561626B2 (enExample) | 1981-01-14 |
| FR2156330B1 (enExample) | 1977-08-05 |
| AU4763372A (en) | 1974-04-26 |
| GB1403418A (en) | 1975-08-28 |
| DD106481A5 (enExample) | 1974-06-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2250050C2 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE3700419C2 (de) | Farbphotographisches Silberhalogenidaufzeichnungsmaterial | |
| DE1547675A1 (de) | Farbphotographisches Material fuer das Silberfarbbleichverfahren | |
| DE3850221T2 (de) | Photographische Elemente, die einen Bleich-Beschleuniger-Vorläufer enthalten. | |
| DE3409445A1 (de) | Silberchloridreiche emulsion, fotografisches aufzeichnungsmaterial und verfahren zur herstellung fotografischer aufzeichnungen | |
| DE3885201T3 (de) | Farbphotographisches Element. | |
| DE69325949T2 (de) | Verfahren zur Entwicklung eines photographischen Elementes mit einem Persäure-Bleichmittel | |
| DE2357694C3 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE2937991C2 (de) | Lichtempfindliches farbphotographisches Silberhalogenid-Aufzeichnungsmaterial | |
| DE2226770C2 (de) | Phtographisches Verfarhen zur Herstellung von Bildern | |
| DE3687573T2 (de) | Verfahren zur behandlung eines farbphotographischen lichtempfindlichen silberhalogenidmaterials. | |
| DE1547759B1 (de) | Silberfarbbleichverfahren | |
| DE1472870C3 (de) | Photographisches Aufzeichnungsmaterial | |
| EP0044813B1 (de) | Verfahren zur Herstellung negativer Farbbilder nach dem Silberfarbbleichverfahren und das in diesem Verfahren verwendete Silberfarbbleichmaterial | |
| DE69020718T2 (de) | Farbphotographisches aufzeichnungsmaterial. | |
| DE2831814A1 (de) | Verfahren zur herstellung maskierter positiver farbbilder nach dem silberfarbbleichverfahren | |
| DE1597550A1 (de) | Verfahren zur Herstellung von farbigen Bildern | |
| DE2166672C3 (de) | Verfahren zur Herstellung negativer, farbiger, photographischer Bilder | |
| DE1002198B (de) | Verfahren zur Herstellung von farbenphotographischen Bildern | |
| DE2453641A1 (de) | Mehrschichtiges farbphotographisches aufzeichnungsmaterial sowie verfahren zur herstellung positiver farbphotographischer bilder | |
| DE2421068C2 (de) | Farbphotographisches mehrschichtiges Aufzeichnungsmaterial | |
| DE2711220A1 (de) | Lichtempfindliches photographisches silberhalogenid-aufzeichnungsmaterial | |
| DE69205263T2 (de) | Photographisches Umkehrelement und dessen Verarbeitungsverfahren. | |
| DE2405279C2 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE2324794A1 (de) | Farbphotographische materialien |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8125 | Change of the main classification |
Ipc: G03C 7/26 |
|
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: BRANDES, J., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 8000 MUENCHEN |
|
| 8365 | Fully valid after opposition proceedings |