DE2247691A1 - Alkoxyzimtsaeureester basisch substituierter cumarinderivate - Google Patents
Alkoxyzimtsaeureester basisch substituierter cumarinderivateInfo
- Publication number
- DE2247691A1 DE2247691A1 DE19722247691 DE2247691A DE2247691A1 DE 2247691 A1 DE2247691 A1 DE 2247691A1 DE 19722247691 DE19722247691 DE 19722247691 DE 2247691 A DE2247691 A DE 2247691A DE 2247691 A1 DE2247691 A1 DE 2247691A1
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- atom
- acid
- general formula
- basic substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000002253 acid Substances 0.000 title claims description 10
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N coumarin Chemical class C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 title description 2
- 150000002148 esters Chemical class 0.000 title description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000003341 7 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 150000004982 aromatic amines Chemical class 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 150000001893 coumarin derivatives Chemical class 0.000 claims 2
- 239000004480 active ingredient Substances 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 8
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 150000004775 coumarins Chemical class 0.000 description 6
- -1 N atom aromatic amine Chemical class 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- KVRKWGMQOATVAE-UHFFFAOYSA-N 7,8-dimethoxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=C(OC)C(OC)=CC=C21 KVRKWGMQOATVAE-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 150000003254 radicals Chemical group 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- XYXOUBBEZYLFKO-UHFFFAOYSA-N 2,3,4-trimethoxy-n-methyl-n-propan-2-ylaniline Chemical compound COC1=CC=C(N(C)C(C)C)C(OC)=C1OC XYXOUBBEZYLFKO-UHFFFAOYSA-N 0.000 description 1
- YDFMLJHTEKBSQG-UHFFFAOYSA-N 2,3-dimethoxy-3-(2-methoxyphenyl)prop-2-enoyl chloride Chemical compound COC(C(Cl)=O)=C(OC)C1=CC=CC=C1OC YDFMLJHTEKBSQG-UHFFFAOYSA-N 0.000 description 1
- VBQGETSLMXRMTB-UHFFFAOYSA-N 2-(2,6-dimethylphenyl)-2-piperazin-1-ylacetamide Chemical compound CC1=CC=CC(C)=C1C(C(N)=O)N1CCNCC1 VBQGETSLMXRMTB-UHFFFAOYSA-N 0.000 description 1
- XNIOWJUQPMKCIJ-UHFFFAOYSA-N 2-(benzylamino)ethanol Chemical compound OCCNCC1=CC=CC=C1 XNIOWJUQPMKCIJ-UHFFFAOYSA-N 0.000 description 1
- LJDSTRZHPWMDPG-UHFFFAOYSA-N 2-(butylamino)ethanol Chemical compound CCCCNCCO LJDSTRZHPWMDPG-UHFFFAOYSA-N 0.000 description 1
- RILLZYSZSDGYGV-UHFFFAOYSA-N 2-(propan-2-ylamino)ethanol Chemical compound CC(C)NCCO RILLZYSZSDGYGV-UHFFFAOYSA-N 0.000 description 1
- WFCSWCVEJLETKA-UHFFFAOYSA-N 2-piperazin-1-ylethanol Chemical compound OCCN1CCNCC1 WFCSWCVEJLETKA-UHFFFAOYSA-N 0.000 description 1
- XBSMHLZMLQNTLY-UHFFFAOYSA-N 3,4,5-trimethoxy-n-methylaniline Chemical compound CNC1=CC(OC)=C(OC)C(OC)=C1 XBSMHLZMLQNTLY-UHFFFAOYSA-N 0.000 description 1
- KRGXWTOLFOPIKV-UHFFFAOYSA-N 3-(methylamino)propan-1-ol Chemical compound CNCCCO KRGXWTOLFOPIKV-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- XCEYKKJMLOFDSS-UHFFFAOYSA-N 4-chloro-n-methylaniline Chemical compound CNC1=CC=C(Cl)C=C1 XCEYKKJMLOFDSS-UHFFFAOYSA-N 0.000 description 1
- JFXDIXYFXDOZIT-UHFFFAOYSA-N 4-methoxy-n-methylaniline Chemical compound CNC1=CC=C(OC)C=C1 JFXDIXYFXDOZIT-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- 206010020400 Hostility Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 1
- PAMIQIKDUOTOBW-UHFFFAOYSA-N N-methylcyclohexylamine Natural products CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N cinnamic acid group Chemical class C(C=CC1=CC=CC=C1)(=O)O WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000003218 coronary vasodilator agent Substances 0.000 description 1
- 235000001671 coumarin Nutrition 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- RIWRFSMVIUAEBX-UHFFFAOYSA-N n-methyl-1-phenylmethanamine Chemical compound CNCC1=CC=CC=C1 RIWRFSMVIUAEBX-UHFFFAOYSA-N 0.000 description 1
- VEBLEROFGPOMPB-UHFFFAOYSA-N n-methylcyclopropanamine Chemical compound CNC1CC1 VEBLEROFGPOMPB-UHFFFAOYSA-N 0.000 description 1
- IOXXVNYDGIXMIP-UHFFFAOYSA-N n-methylprop-2-en-1-amine Chemical compound CNCC=C IOXXVNYDGIXMIP-UHFFFAOYSA-N 0.000 description 1
- 230000001537 neural effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- UNEIHNMKASENIG-UHFFFAOYSA-N para-chlorophenylpiperazine Chemical compound C1=CC(Cl)=CC=C1N1CCNCC1 UNEIHNMKASENIG-UHFFFAOYSA-N 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003510 tertiary aliphatic amines Chemical class 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/06—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2
- C07D311/08—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2 not hydrogenated in the hetero ring
- C07D311/16—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2 not hydrogenated in the hetero ring substituted in position 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrane Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722247691 DE2247691A1 (de) | 1972-09-28 | 1972-09-28 | Alkoxyzimtsaeureester basisch substituierter cumarinderivate |
| US397145A US3897419A (en) | 1972-09-28 | 1973-09-13 | Basically substituted coumarin derivatives |
| GB4532673A GB1385639A (en) | 1972-09-28 | 1973-09-27 | Basically substituted coumarin derivatives |
| SU1960557A SU489319A3 (ru) | 1972-09-28 | 1973-09-27 | Способ получени производных кумарина |
| JP48108095A JPS4970974A (enExample) | 1972-09-28 | 1973-09-27 | |
| FR7334789A FR2201091B1 (enExample) | 1972-09-28 | 1973-09-28 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722247691 DE2247691A1 (de) | 1972-09-28 | 1972-09-28 | Alkoxyzimtsaeureester basisch substituierter cumarinderivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2247691A1 true DE2247691A1 (de) | 1974-04-11 |
Family
ID=5857678
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722247691 Pending DE2247691A1 (de) | 1972-09-28 | 1972-09-28 | Alkoxyzimtsaeureester basisch substituierter cumarinderivate |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3897419A (enExample) |
| JP (1) | JPS4970974A (enExample) |
| DE (1) | DE2247691A1 (enExample) |
| FR (1) | FR2201091B1 (enExample) |
| GB (1) | GB1385639A (enExample) |
| SU (1) | SU489319A3 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5554611A (en) * | 1993-11-08 | 1996-09-10 | Cassella Aktiengesellschaft | Use of coumarin derivatives |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN112778258B (zh) * | 2021-01-05 | 2022-02-01 | 苏州大学 | 酰胺衍生物中性线粒体荧光标记物及其制备方法和应用 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3538098A (en) * | 1966-11-02 | 1970-11-03 | Cassella Farbwerke Mainkur Ag | Process for the production of coumarin derivatives |
| US3652557A (en) * | 1968-01-19 | 1972-03-28 | Cassella Farbwerke Mainkur Ag | 3-(gamma-tertiary amino-beta-alkoxy benzoyloxy-propyl) - 4 -hydrocarbon - 5 8 - alkoxy coumarins |
| DE1962154A1 (de) * | 1968-01-19 | 1971-06-16 | Cassella Farbwerke Mainkur Ag | Basisch substituierte Cumarinderivate |
-
1972
- 1972-09-28 DE DE19722247691 patent/DE2247691A1/de active Pending
-
1973
- 1973-09-13 US US397145A patent/US3897419A/en not_active Expired - Lifetime
- 1973-09-27 JP JP48108095A patent/JPS4970974A/ja active Pending
- 1973-09-27 SU SU1960557A patent/SU489319A3/ru active
- 1973-09-27 GB GB4532673A patent/GB1385639A/en not_active Expired
- 1973-09-28 FR FR7334789A patent/FR2201091B1/fr not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5554611A (en) * | 1993-11-08 | 1996-09-10 | Cassella Aktiengesellschaft | Use of coumarin derivatives |
Also Published As
| Publication number | Publication date |
|---|---|
| SU489319A3 (ru) | 1975-10-25 |
| JPS4970974A (enExample) | 1974-07-09 |
| FR2201091A1 (enExample) | 1974-04-26 |
| FR2201091B1 (enExample) | 1976-08-13 |
| US3897419A (en) | 1975-07-29 |
| GB1385639A (en) | 1975-02-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0726899B1 (de) | Neue pyrazincarboxamidderivate, ihre herstellung und ihre verwendung in arzneimitteln | |
| JPS6111955B2 (enExample) | ||
| DE2508045A1 (de) | Substituierte n-(1-benzylpyrrolidinyl-2-alkyl)-benzamide, verfahren zu deren herstellung und diese enthaltende arzneimittel | |
| US2520153A (en) | N-(diarylmethyl)-tertiary-aminoalkanamides and their preparation | |
| DE1545575B1 (de) | N,N'-Bis-[3-(3',4',5'-trimethoxybenzoyloxy)-propyl]-homopiperazin | |
| DE2247691A1 (de) | Alkoxyzimtsaeureester basisch substituierter cumarinderivate | |
| CH534687A (de) | Verfahren zur Herstellung von Derivaten des 2-Oxo-1,2-dihydro-chinolins | |
| US2606205A (en) | Dihalogen benzoic acid esters of amino alcohols | |
| EP0472166A1 (de) | Tricyclische Pyridonderivate | |
| DE2114884A1 (de) | Basisch substituierte Derivate des 1(2H)-Phthalazinons | |
| DE69818988T2 (de) | 9,10-diazatryclo[4.2.11 2,5]decan- und 9,10-diazatricyclo[3.3.1.1 2,6]decanderive mit analgetischer wirkung | |
| EP1525195A2 (de) | Verfahren zur herstellung von phenylalanin-derivaten | |
| DE844154C (de) | Verfahren zur Herstellung von Phenthiazinderivaten mit einer externen quartaeren Ammoniumgruppe | |
| DE69713128T2 (de) | 4-(1-piperazinyl)benzosäurederivate, verfahren zu ihrer herstellung und ihre therapeutischen verwendungen | |
| SU566521A3 (ru) | Способ получени лактамов | |
| SU795487A3 (ru) | Способ получени производных геллебри-гЕНиНА или иХ СОлЕй | |
| DE1926076B2 (de) | 3-(3-Amino-2-hydroxy-propyl)-6,7>8trimethoxy-SH-M^-benzotriazin^-on-Derivate und ihre Herstellung | |
| DE1668877A1 (de) | Basisch substituierte Cumarinderivate | |
| DE2339664A1 (de) | Alkoxyzimtsaeureester basisch substituierter heterocyclischer verbindungen | |
| DE69310186T2 (de) | 1,2-dihydro-2-oxo-3-aminochinoxalin derivate, ihre verwendung als heilmittel | |
| US2662885A (en) | Antihistamine compounds | |
| AT224644B (de) | Verfahren zur Herstellung von neuen Benzoesäure-Derivaten | |
| DE1668877C3 (de) | Basisch substituierte Cumarinderivate und deren pharmakologisch verträgliche Salze und Verfahren zu deren Herstellung | |
| DE1246755B (de) | Verfahren zur Herstellung von substituierten Cumaronen | |
| DE2020233A1 (de) | Basisch substituierte Derivate des 4(3H)-Chinazolinons |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |