DE223669A - - Google Patents
Info
- Publication number
- DE223669A DE223669A DE223669A DE 223669 A DE223669 A DE 223669A DE 223669 A DE223669 A DE 223669A
- Authority
- DE
- Germany
- Prior art keywords
- strip
- digits
- digit
- windows
- window
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004744 fabric Substances 0.000 claims description 4
- 239000012780 transparent material Substances 0.000 claims 1
- 229920002160 Celluloid Polymers 0.000 description 5
- 238000007689 inspection Methods 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- PCTMTFRHKVHKIS-BMFZQQSSSA-N (1s,3r,4e,6e,8e,10e,12e,14e,16e,18s,19r,20r,21s,25r,27r,30r,31r,33s,35r,37s,38r)-3-[(2r,3s,4s,5s,6r)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-19,25,27,30,31,33,35,37-octahydroxy-18,20,21-trimethyl-23-oxo-22,39-dioxabicyclo[33.3.1]nonatriaconta-4,6,8,10 Chemical compound C1C=C2C[C@@H](OS(O)(=O)=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2.O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 PCTMTFRHKVHKIS-BMFZQQSSSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3884099T2 (de) | Farbeanzeige. | |
| DE2840772C3 (de) | Mehrschichtige Flüssigkristall-Anzeigeeinrichtung mit Matrix-Elektrodenmuster | |
| DE2511596A1 (de) | Einrichtung zur gemeinsamen auswertung von mehreren periodischen vorgaengen | |
| DE223669A (enExample) | ||
| DE2503558C3 (de) | Digitale Anzeigevorrichtung | |
| CH567307A5 (en) | Aid to number selection for betting games - sets chosen systematically from larger set in various combinations | |
| AT47843B (de) | Multiplikationsvorrichtung. | |
| DE2806482A1 (de) | Lehrmittel zur erlernung der grundbegriffe des rechnens | |
| DE2847100A1 (de) | Rechner fuer kontrollzahlen | |
| DE819738C (de) | Produktionskontrollbrett | |
| DE3303695C1 (de) | Vorrichtung zur Darstellung des Zahlenaufbaus und der Maechtigkeit von Mengen | |
| DE222755A (enExample) | ||
| DE2853096A1 (de) | Lehrspiel | |
| DE10063411B4 (de) | Mechanische Lernhilfe | |
| DE363136C (de) | Rechenlehrmittel | |
| DE1665298B2 (de) | Druckknopfschaltanordnung | |
| DE827877C (de) | Geraet zum Setzen von Buchstaben, insbesondere Lesekasten | |
| DE540556C (de) | Rechenvorrichtung | |
| DE2250926A1 (de) | Unterrichtsmaschine | |
| DE454290C (de) | Rechenaufgabensteller | |
| EP1129652B1 (de) | Verkaufsdisplay | |
| DE2407127A1 (de) | Didaktische vorrichtung | |
| DE2716843A1 (de) | Strichcode-druckvorrichtung | |
| AT165263B (enExample) | ||
| DE8615226U1 (de) | Vorrichtung zum Umrechnen von Binärzahlen in Dezimalzahlen |