DE2229365C2 - Lichtempfindliches, positiv arbeitendes Gemisch zur Herstellung von Druckformen nach photomechanischen Verfahren, seine Herstellung und Verwendung - Google Patents
Lichtempfindliches, positiv arbeitendes Gemisch zur Herstellung von Druckformen nach photomechanischen Verfahren, seine Herstellung und VerwendungInfo
- Publication number
- DE2229365C2 DE2229365C2 DE2229365A DE2229365A DE2229365C2 DE 2229365 C2 DE2229365 C2 DE 2229365C2 DE 2229365 A DE2229365 A DE 2229365A DE 2229365 A DE2229365 A DE 2229365A DE 2229365 C2 DE2229365 C2 DE 2229365C2
- Authority
- DE
- Germany
- Prior art keywords
- photosensitive
- mixture
- diazonium salt
- production
- light
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims description 53
- 238000004519 manufacturing process Methods 0.000 title claims description 10
- 238000000034 method Methods 0.000 title claims description 8
- 230000008569 process Effects 0.000 title claims description 7
- 239000012954 diazonium Substances 0.000 claims description 34
- 150000001989 diazonium salts Chemical class 0.000 claims description 29
- 229920003986 novolac Polymers 0.000 claims description 27
- -1 azo compound Chemical class 0.000 claims description 15
- 229920005989 resin Polymers 0.000 claims description 13
- 239000011347 resin Substances 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 6
- 230000008878 coupling Effects 0.000 claims description 5
- 238000010168 coupling process Methods 0.000 claims description 5
- 238000005859 coupling reaction Methods 0.000 claims description 5
- HWTDZAGRHRSTSM-UHFFFAOYSA-N 4-[(N-phenylanilino)diazenyl]phenol Chemical compound OC1=CC=C(C=C1)N=NN(C1=CC=CC=C1)C1=CC=CC=C1 HWTDZAGRHRSTSM-UHFFFAOYSA-N 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims 1
- 230000008859 change Effects 0.000 description 17
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 14
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 13
- 229910052782 aluminium Inorganic materials 0.000 description 13
- WTQZSMDDRMKJRI-UHFFFAOYSA-N 4-diazoniophenolate Chemical compound [O-]C1=CC=C([N+]#N)C=C1 WTQZSMDDRMKJRI-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000987 azo dye Substances 0.000 description 9
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 5
- 229930003836 cresol Natural products 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000001488 sodium phosphate Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000010186 staining Methods 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 3
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 3
- 235000019801 trisodium phosphate Nutrition 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- LOUPRKONTZGTKE-WZBLMQSHSA-N Quinine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-WZBLMQSHSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229910052724 xenon Inorganic materials 0.000 description 2
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 2
- FKJVJEMZVNDLMM-UHFFFAOYSA-N 1-[(N-phenylanilino)diazenyl]naphthalen-2-ol Chemical compound OC1=C(C2=CC=CC=C2C=C1)N=NN(C1=CC=CC=C1)C1=CC=CC=C1 FKJVJEMZVNDLMM-UHFFFAOYSA-N 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- KGWYICAEPBCRBL-UHFFFAOYSA-N 1h-indene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)C=CC2=C1 KGWYICAEPBCRBL-UHFFFAOYSA-N 0.000 description 1
- QSVZBUNHQZUHJX-UHFFFAOYSA-N 2-(N-phenyldiazenylanilino)phenol Chemical class OC1=C(C=CC=C1)N(C1=CC=CC=C1)N=NC1=CC=CC=C1 QSVZBUNHQZUHJX-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- RGCITEKHKXPDDH-UHFFFAOYSA-N 4-(diethylamino)benzenediazonium Chemical compound CCN(CC)C1=CC=C([N+]#N)C=C1 RGCITEKHKXPDDH-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 235000001258 Cinchona calisaya Nutrition 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 101001018064 Homo sapiens Lysosomal-trafficking regulator Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 102100033472 Lysosomal-trafficking regulator Human genes 0.000 description 1
- 235000010703 Modiola caroliniana Nutrition 0.000 description 1
- 244000038561 Modiola caroliniana Species 0.000 description 1
- 229930192627 Naphthoquinone Natural products 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- GTSPAFVQXWRWLJ-UHFFFAOYSA-N [Cl-].SC1=C(C=CC=C1)[N+]#N Chemical compound [Cl-].SC1=C(C=CC=C1)[N+]#N GTSPAFVQXWRWLJ-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000011889 copper foil Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- VXLFYNFOITWQPM-UHFFFAOYSA-N n-phenyl-4-phenyldiazenylaniline Chemical compound C=1C=C(N=NC=2C=CC=CC=2)C=CC=1NC1=CC=CC=C1 VXLFYNFOITWQPM-UHFFFAOYSA-N 0.000 description 1
- 150000002791 naphthoquinones Chemical class 0.000 description 1
- ATGUVEKSASEFFO-UHFFFAOYSA-N p-aminodiphenylamine Chemical compound C1=CC(N)=CC=C1NC1=CC=CC=C1 ATGUVEKSASEFFO-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000007793 ph indicator Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- IYDGMDWEHDFVQI-UHFFFAOYSA-N phosphoric acid;trioxotungsten Chemical compound O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.OP(O)(O)=O IYDGMDWEHDFVQI-UHFFFAOYSA-N 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000005588 protonation Effects 0.000 description 1
- 239000001047 purple dye Substances 0.000 description 1
- 229960000948 quinine Drugs 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- GDESWOTWNNGOMW-UHFFFAOYSA-N resorcinol monobenzoate Chemical compound OC1=CC=CC(OC(=O)C=2C=CC=CC=2)=C1 GDESWOTWNNGOMW-UHFFFAOYSA-N 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 150000003839 salts Chemical group 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 238000011179 visual inspection Methods 0.000 description 1
- 230000003313 weakening effect Effects 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03F—PHOTOMECHANICAL PRODUCTION OF TEXTURED OR PATTERNED SURFACES, e.g. FOR PRINTING, FOR PROCESSING OF SEMICONDUCTOR DEVICES; MATERIALS THEREFOR; ORIGINALS THEREFOR; APPARATUS SPECIALLY ADAPTED THEREFOR
- G03F7/00—Photomechanical, e.g. photolithographic, production of textured or patterned surfaces, e.g. printing surfaces; Materials therefor, e.g. comprising photoresists; Apparatus specially adapted therefor
- G03F7/004—Photosensitive materials
- G03F7/016—Diazonium salts or compounds
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2857471 | 1971-06-17 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2229365A1 DE2229365A1 (de) | 1972-12-21 |
| DE2229365C2 true DE2229365C2 (de) | 1984-05-03 |
Family
ID=10277767
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2229365A Expired DE2229365C2 (de) | 1971-06-17 | 1972-06-16 | Lichtempfindliches, positiv arbeitendes Gemisch zur Herstellung von Druckformen nach photomechanischen Verfahren, seine Herstellung und Verwendung |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3929488A (enExample) |
| AT (1) | AT320685B (enExample) |
| AU (1) | AU457866B2 (enExample) |
| BE (1) | BE784985A (enExample) |
| CA (1) | CA970203A (enExample) |
| CH (1) | CH542460A (enExample) |
| DE (1) | DE2229365C2 (enExample) |
| ES (1) | ES404282A1 (enExample) |
| FR (1) | FR2147938B1 (enExample) |
| GB (1) | GB1347759A (enExample) |
| MY (1) | MY7500114A (enExample) |
| NL (1) | NL174089C (enExample) |
| NO (1) | NO139873C (enExample) |
| SE (1) | SE380636B (enExample) |
| SU (1) | SU544394A3 (enExample) |
| YU (1) | YU34743B (enExample) |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2331377C2 (de) * | 1973-06-20 | 1982-10-14 | Hoechst Ag, 6000 Frankfurt | Lichtempfindliches Kopiermaterial |
| DE2641099A1 (de) * | 1976-09-13 | 1978-03-16 | Hoechst Ag | Lichtempfindliche kopierschicht |
| US4102687A (en) * | 1977-02-14 | 1978-07-25 | General Electric Company | UV Curable composition of a thermosetting condensation resin and Group VIa onium salt |
| US4132553A (en) * | 1977-03-24 | 1979-01-02 | Polychrome Corporation | Color proofing guide |
| GB1604652A (en) * | 1977-04-12 | 1981-12-16 | Vickers Ltd | Radiation sensitive materials |
| GB2005855A (en) * | 1977-10-03 | 1979-04-25 | Polychrome Corp | Lithographic imaging composition having improved image visibility |
| US4299907A (en) * | 1978-08-10 | 1981-11-10 | Polychrome Corporation | Storage stable photosensitive diazo lithographic printing plates |
| NL7808418A (nl) * | 1978-08-14 | 1980-02-18 | Oce Nederland Bv | Werkwijze voor het vervaardigen van een elektrofoto- grafisch element. |
| JPS5560944A (en) * | 1978-10-31 | 1980-05-08 | Fuji Photo Film Co Ltd | Image forming method |
| JPS5677843A (en) * | 1979-11-30 | 1981-06-26 | Fujitsu Ltd | Resist pattern forming method |
| US4326020A (en) * | 1980-09-10 | 1982-04-20 | Polychrome Corporation | Method of making positive acting diazo lithographic printing plate |
| JPS5772140A (en) * | 1980-10-22 | 1982-05-06 | Hitachi Ltd | Photosensitive composition and formation of pattern |
| ZA821588B (en) * | 1981-03-24 | 1983-02-23 | Sensitisers Ltd | Photosensitive relief image-forming materials |
| DE3144480A1 (de) * | 1981-11-09 | 1983-05-19 | Hoechst Ag, 6230 Frankfurt | Lichtempfindliches gemisch und daraus hergestelltes lichtempfindliches kopiermaterial |
| EP0089506A3 (de) * | 1982-03-18 | 1984-04-11 | American Hoechst Corporation | Lichtempfindliches Gemisch auf Basis von Diazoniumsalz-Polykondensationsprodukten und daraus hergestelltes lichtempfindliches Aufzeichnungsmaterial |
| JPS58211141A (ja) * | 1982-06-02 | 1983-12-08 | Fuji Photo Film Co Ltd | ネガ型感光性平版印刷版 |
| JPS61141442A (ja) * | 1984-12-14 | 1986-06-28 | Fuji Photo Film Co Ltd | 光可溶化組成物 |
| US4672021A (en) * | 1985-06-03 | 1987-06-09 | Fairmount Chemical Company | Contrast enhancement layer composition with naphthoquinone diazide, indicator dye and polymeric binder |
| US4721665A (en) * | 1986-09-29 | 1988-01-26 | Polychrome Corporation | Method for neutralizing acidic novolak resin in a lithographic coating composition |
| DE3729035A1 (de) * | 1987-08-31 | 1989-03-09 | Hoechst Ag | Positiv arbeitendes lichtempfindliches gemisch und daraus hergestelltes photolithographisches aufzeichnungsmaterial |
| JP2602511B2 (ja) * | 1987-10-30 | 1997-04-23 | 株式会社日立製作所 | パターン形成方法 |
| US5212044A (en) * | 1988-09-08 | 1993-05-18 | The Mead Corporation | Photoresist composition including polyphenol and sensitizer |
| GB9012021D0 (en) * | 1990-05-30 | 1990-07-18 | Cookson Group Plc | Light sensitive materials for lithographic plates |
| US7041427B2 (en) * | 2001-09-27 | 2006-05-09 | Agfa Gevaert | Heat-sensitive lithographic printing plate precursor |
| US7198877B2 (en) * | 2002-10-15 | 2007-04-03 | Agfa-Gevaert | Heat-sensitive lithographic printing plate precursor |
| JP2005070319A (ja) * | 2003-08-22 | 2005-03-17 | Canon Inc | 近接場露光用フォトレジスト、及びこれを用いた微細パターンの作製方法 |
| US20070003875A1 (en) * | 2005-06-30 | 2007-01-04 | Agfa-Gevaert | Method for preparing a lithographic printing plate precursor |
| US20070003869A1 (en) * | 2005-06-30 | 2007-01-04 | Agfa-Gevaert | Heat-sensitive lithographic printing plate-precursor |
| US7678533B2 (en) * | 2005-06-30 | 2010-03-16 | Agfa Graphics, N.V. | Heat-sensitive lithographic printing plate precursor |
| ES2365930T3 (es) | 2006-02-28 | 2011-10-13 | Agfa Graphics N.V. | Un precursor de plancha de impresión litográfica que funciona como positivo sensible al calor. |
| EP1854627A1 (en) * | 2006-05-12 | 2007-11-14 | Agfa Graphics N.V. | Method for making a lithographic printing plate |
| ATE516953T1 (de) * | 2007-04-27 | 2011-08-15 | Agfa Graphics Nv | Lithographiedruckplattenvorläufer |
| ATE509764T1 (de) * | 2007-08-14 | 2011-06-15 | Agfa Graphics Nv | Verfahren zur herstellung einer lithographiedruckform |
| ATE552111T1 (de) * | 2008-09-02 | 2012-04-15 | Agfa Graphics Nv | Wärmeempfindlicher, positiv arbeitender lithographiedruckformvorläufer |
| EP2213690B1 (en) | 2009-01-30 | 2015-11-11 | Agfa Graphics N.V. | A new alkali soluble resin |
| ES2395993T3 (es) | 2010-03-19 | 2013-02-18 | Agfa Graphics N.V. | Precursor de plancha de impresión litográfica |
| BR112014005196A2 (pt) | 2011-09-08 | 2017-03-21 | Agfa Graphics Nv | método para fabricar uma chapa de impressão litográfica |
| WO2014106554A1 (en) | 2013-01-01 | 2014-07-10 | Agfa Graphics Nv | (ethylene, vinyl acetal) copolymers and their use in lithographic printing plate precursors |
| EP2933278B1 (en) | 2014-04-17 | 2018-08-22 | Agfa Nv | (Ethylene, vinyl acetal) copolymers and their use in lithographic printing plate precursors |
| ES2617557T3 (es) | 2014-05-15 | 2017-06-19 | Agfa Graphics Nv | Copolímeros (de etileno, vinilacetal) y su uso en precursores de plancha de impresión litográfica |
| EP2955198B8 (en) | 2014-06-13 | 2018-01-03 | Agfa Nv | Ethylene/vinyl acetal-copolymers and their use in lithographic printing plate precursors |
| EP2963496B1 (en) | 2014-06-30 | 2017-04-05 | Agfa Graphics NV | A lithographic printing plate precursor including ( ethylene, vinyl acetal ) copolymers |
| EP3130465B1 (en) | 2015-08-12 | 2020-05-13 | Agfa Nv | Heat-sensitive lithographic printing plate precursor |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2551133A (en) * | 1946-08-29 | 1951-05-01 | Du Pont | Photographic light-sensitive diazo element |
| NL76414C (enExample) * | 1949-07-23 | |||
| NL78025C (enExample) * | 1951-02-02 | |||
| NL254350A (enExample) * | 1959-07-29 | |||
| NL270834A (enExample) * | 1960-10-31 | |||
| BE613039A (enExample) * | 1961-01-25 | |||
| NL301574A (enExample) * | 1962-12-14 | |||
| DE1522496A1 (de) * | 1966-02-12 | 1969-09-11 | Kalle Ag | Lichtreprographische Kopiermasse und damit beschichtetes Kopiermaterial |
| GB1187814A (en) * | 1967-10-19 | 1970-04-15 | Ilford Ltd | Presentized Lithographic Plates. |
| US3679419A (en) * | 1969-05-20 | 1972-07-25 | Azoplate Corp | Light-sensitive diazo condensate containing reproduction material |
| JPS492284B1 (enExample) * | 1969-05-30 | 1974-01-19 | ||
| US3669658A (en) * | 1969-06-11 | 1972-06-13 | Fuji Photo Film Co Ltd | Photosensitive printing plate |
-
1971
- 1971-06-17 GB GB2857471A patent/GB1347759A/en not_active Expired
-
1972
- 1972-06-13 CA CA144,515A patent/CA970203A/en not_active Expired
- 1972-06-15 ES ES404282A patent/ES404282A1/es not_active Expired
- 1972-06-16 NO NO2158/72A patent/NO139873C/no unknown
- 1972-06-16 AU AU43493/72A patent/AU457866B2/en not_active Expired
- 1972-06-16 CH CH900472A patent/CH542460A/fr not_active IP Right Cessation
- 1972-06-16 NL NLAANVRAGE7208251,A patent/NL174089C/xx not_active IP Right Cessation
- 1972-06-16 SU SU1802969A patent/SU544394A3/ru active
- 1972-06-16 AT AT520572A patent/AT320685B/de active
- 1972-06-16 SE SE7207951A patent/SE380636B/xx unknown
- 1972-06-16 FR FR7221903A patent/FR2147938B1/fr not_active Expired
- 1972-06-16 DE DE2229365A patent/DE2229365C2/de not_active Expired
- 1972-06-16 BE BE784985A patent/BE784985A/xx not_active IP Right Cessation
- 1972-06-16 YU YU1618/72A patent/YU34743B/xx unknown
-
1974
- 1974-06-25 US US483027A patent/US3929488A/en not_active Expired - Lifetime
-
1975
- 1975-12-30 MY MY114/75A patent/MY7500114A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SU544394A3 (ru) | 1977-01-25 |
| NL7208251A (enExample) | 1972-12-19 |
| FR2147938B1 (enExample) | 1977-08-26 |
| NO139873C (no) | 1979-05-23 |
| SE380636B (sv) | 1975-11-10 |
| AU4349372A (en) | 1973-12-20 |
| AU457866B2 (en) | 1975-01-24 |
| US3929488A (en) | 1975-12-30 |
| CH542460A (fr) | 1973-09-30 |
| NO139873B (no) | 1979-02-12 |
| FR2147938A1 (enExample) | 1973-03-11 |
| CA970203A (en) | 1975-07-01 |
| MY7500114A (en) | 1975-12-31 |
| YU161872A (en) | 1979-07-10 |
| NL174089C (nl) | 1984-04-16 |
| GB1347759A (en) | 1974-02-27 |
| YU34743B (en) | 1979-12-31 |
| BE784985A (enExample) | 1972-10-16 |
| DE2229365A1 (de) | 1972-12-21 |
| ES404282A1 (es) | 1975-06-01 |
| NL174089B (nl) | 1983-11-16 |
| AT320685B (de) | 1975-02-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2229365C2 (de) | Lichtempfindliches, positiv arbeitendes Gemisch zur Herstellung von Druckformen nach photomechanischen Verfahren, seine Herstellung und Verwendung | |
| DE2331377C2 (de) | Lichtempfindliches Kopiermaterial | |
| DE2147947C2 (de) | Lichtempfindliches Gemisch | |
| DE2641100C2 (de) | Lichtempfindliches Gemisch | |
| EP0131238B1 (de) | Verfahren zur Herstellung negativer Kopien mittels eines Materials auf Basis von 1,2-Chinondiaziden | |
| DE1285877B (de) | Lichtempfindliche Schichten | |
| DE2641099C2 (enExample) | ||
| DE3325022A1 (de) | Verfahren zur herstellung negativer kopien mittels eines materials auf basis von 1,2-chinondiaziden | |
| DE1447016B2 (de) | Vorsensibilisierte druckplatte | |
| DE3123752C2 (enExample) | ||
| DE3201151A1 (de) | Positive lichtempfindliche masse und diese enthaltendes positives lichtempfindliches aufzeichnungsmaterial | |
| EP0078981B1 (de) | Lichtempfindliches Gemisch und daraus hergestelltes lichtempfindliches Kopiermaterial | |
| DE4013575A1 (de) | Verfahren zur herstellung negativer reliefkopien | |
| DE1597614A1 (de) | Lichtempfindliche Kopierschicht | |
| DE3725949A1 (de) | Lichtempfindliches gemisch, daraus hergestelltes lichtempfindliches kopiermaterial und verfahren zur herstellung von negativen reliefkopien | |
| EP0134407A1 (de) | Entwickler und Verfahren zum Entwickeln für bestrahlte negativ-arbeitende Reproduktionsschichten | |
| DE3240935A1 (de) | Positiv abbildende, strahlungsempfindliche masse, positiv abbildendes, strahlungsempfindliches element und positiv abbildende, lithografische platte | |
| DE1447011A1 (de) | Mit o-Naphtholchinondiaziden vorsensibilisierte Druckplatten | |
| DE3100856A1 (de) | Lichtempfindliches gemisch auf basis von o-napthochinondiaziden und daraus hergestelltes lichtempfindliches kopiermaterial | |
| DE3144657A1 (de) | Lichtempfindliche masse | |
| DE1522501C3 (de) | Vorsensibilisierte Flachdruckplatte | |
| DE1670652A1 (de) | Azoniadiazoketone sowie Verwendung derselben zur Herstellung lichtempfindlicher,photographischer Materialien | |
| DE1572069A1 (de) | Lichtempfindliche Schicht zur Herstellung von Druckformen | |
| EP0303945B1 (de) | Lichtempfindliches Gemisch auf Basis von 1,2-Naphthochinondiaziden und hiermit hergestelltes Kopiermaterial | |
| DE3437687A1 (de) | Verfahren zum herstellen negativer kopien mittels eines materials auf basis von 1,2-chinondiaziden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |