DE2204724A1 - Elektrolyse-Verfahren zur Gewinnung von Metallen - Google Patents
Elektrolyse-Verfahren zur Gewinnung von MetallenInfo
- Publication number
- DE2204724A1 DE2204724A1 DE19722204724 DE2204724A DE2204724A1 DE 2204724 A1 DE2204724 A1 DE 2204724A1 DE 19722204724 DE19722204724 DE 19722204724 DE 2204724 A DE2204724 A DE 2204724A DE 2204724 A1 DE2204724 A1 DE 2204724A1
- Authority
- DE
- Germany
- Prior art keywords
- electrolyte
- metals
- lead
- metal
- sulphides
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 64
- 229910052751 metal Inorganic materials 0.000 title claims description 52
- 239000002184 metal Substances 0.000 title claims description 52
- 150000002739 metals Chemical class 0.000 title claims description 38
- 238000005868 electrolysis reaction Methods 0.000 title claims description 16
- 238000000605 extraction Methods 0.000 title claims description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 67
- 239000003792 electrolyte Substances 0.000 claims description 57
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 48
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims description 43
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 34
- 239000011133 lead Substances 0.000 claims description 33
- 239000011780 sodium chloride Substances 0.000 claims description 33
- 239000010949 copper Substances 0.000 claims description 32
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 29
- 229910052802 copper Inorganic materials 0.000 claims description 29
- 239000000126 substance Substances 0.000 claims description 27
- 150000004763 sulfides Chemical class 0.000 claims description 27
- 229910052717 sulfur Inorganic materials 0.000 claims description 26
- 239000011593 sulfur Substances 0.000 claims description 26
- 239000011701 zinc Substances 0.000 claims description 26
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 23
- 229910052725 zinc Inorganic materials 0.000 claims description 23
- 239000000203 mixture Substances 0.000 claims description 18
- 229910052759 nickel Inorganic materials 0.000 claims description 16
- 239000010941 cobalt Substances 0.000 claims description 14
- 229910017052 cobalt Inorganic materials 0.000 claims description 14
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 14
- 229910021653 sulphate ion Inorganic materials 0.000 claims description 11
- 229910001617 alkaline earth metal chloride Inorganic materials 0.000 claims description 10
- 239000002245 particle Substances 0.000 claims description 10
- 229910052709 silver Inorganic materials 0.000 claims description 10
- 239000004332 silver Substances 0.000 claims description 10
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 9
- 229910001514 alkali metal chloride Inorganic materials 0.000 claims description 9
- 239000003513 alkali Substances 0.000 claims description 8
- 239000000243 solution Substances 0.000 claims description 8
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 7
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 claims description 7
- 229910052737 gold Inorganic materials 0.000 claims description 7
- 239000010931 gold Substances 0.000 claims description 7
- 229910021645 metal ion Inorganic materials 0.000 claims description 7
- 238000010494 dissociation reaction Methods 0.000 claims description 6
- 230000005593 dissociations Effects 0.000 claims description 6
- 229910052976 metal sulfide Inorganic materials 0.000 claims description 6
- 230000000737 periodic effect Effects 0.000 claims description 6
- 239000001103 potassium chloride Substances 0.000 claims description 6
- MBMLMWLHJBBADN-UHFFFAOYSA-N Ferrous sulfide Chemical class [Fe]=S MBMLMWLHJBBADN-UHFFFAOYSA-N 0.000 claims description 5
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 claims description 5
- 229910052787 antimony Inorganic materials 0.000 claims description 5
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 5
- 229910052785 arsenic Inorganic materials 0.000 claims description 5
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims description 5
- 150000003841 chloride salts Chemical class 0.000 claims description 5
- 229910052711 selenium Inorganic materials 0.000 claims description 5
- 239000011669 selenium Substances 0.000 claims description 5
- -1 sulphate ions Chemical class 0.000 claims description 5
- 239000003929 acidic solution Substances 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 4
- 229910052797 bismuth Inorganic materials 0.000 claims description 4
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 4
- 229910052793 cadmium Inorganic materials 0.000 claims description 4
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 4
- 230000005592 electrolytic dissociation Effects 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 239000007787 solid Substances 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims 1
- WDIHJSXYQDMJHN-UHFFFAOYSA-L barium chloride Chemical class [Cl-].[Cl-].[Ba+2] WDIHJSXYQDMJHN-UHFFFAOYSA-L 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 235000011164 potassium chloride Nutrition 0.000 claims 1
- GECHUMIMRBOMGK-UHFFFAOYSA-N sulfapyridine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)NC1=CC=CC=N1 GECHUMIMRBOMGK-UHFFFAOYSA-N 0.000 claims 1
- 229960002211 sulfapyridine Drugs 0.000 claims 1
- 239000012141 concentrate Substances 0.000 description 30
- 239000000463 material Substances 0.000 description 19
- 238000002474 experimental method Methods 0.000 description 17
- 229910052500 inorganic mineral Inorganic materials 0.000 description 15
- 235000010755 mineral Nutrition 0.000 description 15
- 239000011707 mineral Substances 0.000 description 15
- 229910052951 chalcopyrite Inorganic materials 0.000 description 13
- DVRDHUBQLOKMHZ-UHFFFAOYSA-N chalcopyrite Chemical compound [S-2].[S-2].[Fe+2].[Cu+2] DVRDHUBQLOKMHZ-UHFFFAOYSA-N 0.000 description 13
- 230000000694 effects Effects 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 10
- 230000005611 electricity Effects 0.000 description 10
- 229910052949 galena Inorganic materials 0.000 description 8
- XCAUINMIESBTBL-UHFFFAOYSA-N lead(ii) sulfide Chemical compound [Pb]=S XCAUINMIESBTBL-UHFFFAOYSA-N 0.000 description 8
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical class [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 description 8
- 239000005083 Zinc sulfide Substances 0.000 description 7
- 229910052984 zinc sulfide Inorganic materials 0.000 description 7
- 230000002378 acidificating effect Effects 0.000 description 6
- 238000004090 dissolution Methods 0.000 description 6
- 238000003912 environmental pollution Methods 0.000 description 6
- 229910052742 iron Inorganic materials 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 4
- 229910052683 pyrite Inorganic materials 0.000 description 4
- NIFIFKQPDTWWGU-UHFFFAOYSA-N pyrite Chemical compound [Fe+2].[S-][S-] NIFIFKQPDTWWGU-UHFFFAOYSA-N 0.000 description 4
- 239000011028 pyrite Substances 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 238000005260 corrosion Methods 0.000 description 3
- 230000007797 corrosion Effects 0.000 description 3
- 229910052955 covellite Inorganic materials 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 239000010439 graphite Substances 0.000 description 3
- 229910002804 graphite Inorganic materials 0.000 description 3
- 238000009853 pyrometallurgy Methods 0.000 description 3
- WWNBZGLDODTKEM-UHFFFAOYSA-N sulfanylidenenickel Chemical compound [Ni]=S WWNBZGLDODTKEM-UHFFFAOYSA-N 0.000 description 3
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 230000033228 biological regulation Effects 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- BWFPGXWASODCHM-UHFFFAOYSA-N copper monosulfide Chemical class [Cu]=S BWFPGXWASODCHM-UHFFFAOYSA-N 0.000 description 2
- 229910052981 lead sulfide Inorganic materials 0.000 description 2
- 229940056932 lead sulfide Drugs 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 238000005192 partition Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 241000920033 Eugenes Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 235000000177 Indigofera tinctoria Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XIUMQSREFXCDGE-UHFFFAOYSA-L S(=O)(=O)([O-])O.[Na+].[Cl-].[Na+] Chemical compound S(=O)(=O)([O-])O.[Na+].[Cl-].[Na+] XIUMQSREFXCDGE-UHFFFAOYSA-L 0.000 description 1
- NHPHQYDQKATMFU-UHFFFAOYSA-N [Cu]=S.[Co] Chemical compound [Cu]=S.[Co] NHPHQYDQKATMFU-UHFFFAOYSA-N 0.000 description 1
- HJCRDHDDIDLLGZ-UHFFFAOYSA-N [Zn].[Ag].[Pb] Chemical compound [Zn].[Ag].[Pb] HJCRDHDDIDLLGZ-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000003915 air pollution Methods 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 239000010953 base metal Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- TVZPLCNGKSPOJA-UHFFFAOYSA-N copper zinc Chemical compound [Cu].[Zn] TVZPLCNGKSPOJA-UHFFFAOYSA-N 0.000 description 1
- OMZSGWSJDCOLKM-UHFFFAOYSA-N copper(II) sulfide Chemical compound [S-2].[Cu+2] OMZSGWSJDCOLKM-UHFFFAOYSA-N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229940097275 indigo Drugs 0.000 description 1
- COHYTHOBJLSHDF-UHFFFAOYSA-N indigo powder Natural products N1C2=CC=CC=C2C(=O)C1=C1C(=O)C2=CC=CC=C2N1 COHYTHOBJLSHDF-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- JQJCSZOEVBFDKO-UHFFFAOYSA-N lead zinc Chemical compound [Zn].[Pb] JQJCSZOEVBFDKO-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000002932 luster Substances 0.000 description 1
- 229910052953 millerite Inorganic materials 0.000 description 1
- YFLLTMUVNFGTIW-UHFFFAOYSA-N nickel;sulfanylidenecopper Chemical compound [Ni].[Cu]=S YFLLTMUVNFGTIW-UHFFFAOYSA-N 0.000 description 1
- 230000010287 polarization Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052950 sphalerite Inorganic materials 0.000 description 1
- 230000019635 sulfation Effects 0.000 description 1
- 238000005670 sulfation reaction Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- FZUJWWOKDIGOKH-UHFFFAOYSA-N sulfuric acid hydrochloride Chemical compound Cl.OS(O)(=O)=O FZUJWWOKDIGOKH-UHFFFAOYSA-N 0.000 description 1
- 210000004243 sweat Anatomy 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-L thiosulfate(2-) Chemical compound [O-]S([S-])(=O)=O DHCDFWKWKRSZHF-UHFFFAOYSA-L 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25C—PROCESSES FOR THE ELECTROLYTIC PRODUCTION, RECOVERY OR REFINING OF METALS; APPARATUS THEREFOR
- C25C1/00—Electrolytic production, recovery or refining of metals by electrolysis of solutions
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electrolytic Production Of Metals (AREA)
- Manufacture And Refinement Of Metals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US11375171A | 1971-02-08 | 1971-02-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2204724A1 true DE2204724A1 (de) | 1972-08-24 |
Family
ID=22351278
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722204724 Pending DE2204724A1 (de) | 1971-02-08 | 1972-02-01 | Elektrolyse-Verfahren zur Gewinnung von Metallen |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3673061A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5133483B1 (cg-RX-API-DMAC7.html) |
| BE (1) | BE779036A (cg-RX-API-DMAC7.html) |
| CA (1) | CA975712A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2204724A1 (cg-RX-API-DMAC7.html) |
| ES (1) | ES399486A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2124519B1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1345102A (cg-RX-API-DMAC7.html) |
| IE (1) | IE36195B1 (cg-RX-API-DMAC7.html) |
| IT (1) | IT949343B (cg-RX-API-DMAC7.html) |
| LU (1) | LU64751A1 (cg-RX-API-DMAC7.html) |
| NL (1) | NL7201463A (cg-RX-API-DMAC7.html) |
| NO (1) | NO133903C (cg-RX-API-DMAC7.html) |
| PH (1) | PH10022A (cg-RX-API-DMAC7.html) |
| SE (1) | SE374566C (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA72641B (cg-RX-API-DMAC7.html) |
| ZM (1) | ZM2172A1 (cg-RX-API-DMAC7.html) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3849265A (en) * | 1971-10-01 | 1974-11-19 | Us Interior | Electro-oxidative method for the recovery of molybdenum from sulfide ores |
| US3766026A (en) * | 1972-05-10 | 1973-10-16 | Cyprus Metallurg Process | Electrolytic process for the recovery of nickel, cobalt and iron from their sulfides |
| US3755106A (en) * | 1972-05-15 | 1973-08-28 | Us Interior | ELECTROLYTIC OXIDATION OF Sb{11 S{11 |
| US3915818A (en) * | 1972-10-13 | 1975-10-28 | Corporacion De Fomento De La P | Electrowinning process for the improved recovery of metal |
| US3956087A (en) * | 1974-05-17 | 1976-05-11 | Mineral Research & Development Corporation | Electrochemical mining of copper |
| US3957603A (en) * | 1974-06-14 | 1976-05-18 | Electromet, Inc. | Electrolytic gold recovery and separation process |
| US3979265A (en) * | 1974-12-19 | 1976-09-07 | Continental Oil Company | Recovery of metals from sulfur bearing ores |
| US3959096A (en) * | 1975-01-17 | 1976-05-25 | Langer Stanley H | Electrochemical recovery of copper from alloy scrap |
| GB1496852A (en) * | 1975-02-14 | 1978-01-05 | Dextec Metallurg | Extraction of copper from ores and concentrates |
| US4107009A (en) * | 1976-02-02 | 1978-08-15 | Dextec Metallurgical Proprietary Limited | Recovery of copper from ores and concentrates |
| IE44899B1 (en) * | 1976-04-01 | 1982-05-05 | Dextec Metallurg | Refining of ferrous and base metal ores and concentrates |
| US4139432A (en) * | 1976-08-16 | 1979-02-13 | Ghiringhelli Hugh A | Process for electrochemically recovering precious metals from ores |
| JPS5352235A (en) * | 1976-10-25 | 1978-05-12 | Nat Res Inst Metals | Electrorefining method of lead |
| US4159232A (en) * | 1977-09-23 | 1979-06-26 | Bacon William G | Electro-hydrometallurgical process for the extraction of base metals and iron |
| US4204922A (en) * | 1977-12-06 | 1980-05-27 | The Broken Hill Propietary Company Limited | Simultaneous electrodissolution and electrowinning of metals from simple sulphides |
| GR67296B (cg-RX-API-DMAC7.html) * | 1979-04-09 | 1981-06-29 | Dextec Metallurg | |
| US4384890A (en) * | 1982-02-10 | 1983-05-24 | Phelps Dodge Corporation | Cupric chloride leaching of copper sulfides |
| US4631176A (en) * | 1982-07-22 | 1986-12-23 | Cato Research Corporation | Recovery of anhydrous zinc chloride |
| US4500498A (en) * | 1984-01-19 | 1985-02-19 | Cato Research, Inc. | Ammonium chloride-ammonium hydroxide strip for the recovery of anhydrous zinc chloride |
| US4594132A (en) * | 1984-06-27 | 1986-06-10 | Phelps Dodge Corporation | Chloride hydrometallurgical process for production of copper |
| ZM7485A1 (en) * | 1984-10-05 | 1986-04-28 | Dextec Metallurg | Production of zinc from ores and concentrates |
| KR900001832B1 (ko) * | 1985-04-25 | 1990-03-24 | 크로닌 엔지니어즈 코포레이션, 리미티드 | 귀금속의 용해 및 회수방법 |
| SE8504140L (sv) * | 1985-09-05 | 1987-03-06 | Boliden Ab | Forfarande for selektiv utvinning av bly fran komplexa sulfidiska icke-jernmetallsliger |
| SE8504500D0 (sv) * | 1985-09-30 | 1985-09-30 | Boliden Ab | Forfarande och anordning for utvinning av koppar ur koppar-jernsulfidmalmer |
| AP538A (en) * | 1992-06-26 | 1996-09-18 | Intec Pty Ltd | Production of metal from minerals |
| CN1034957C (zh) * | 1993-04-24 | 1997-05-21 | 王绍和 | 硫化铜矿直接电解制取电解铜的方法及其电解槽 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE199554C (cg-RX-API-DMAC7.html) * | ||||
| US720235A (en) * | 1900-11-02 | 1903-02-10 | Hans A Frasch | Process of recovering and separating metals from their ores. |
| US1066855A (en) * | 1912-03-13 | 1913-07-08 | Ransom B Shelden | Process of extracting metals from their ores. |
| US1115351A (en) * | 1914-01-27 | 1914-10-27 | Herman A Wagner | Process of separating metals from ores. |
| US3616331A (en) * | 1968-08-03 | 1971-10-26 | Int Nickel Co | Recovery of nickel and copper from sulfides |
-
1971
- 1971-02-08 US US113751A patent/US3673061A/en not_active Expired - Lifetime
-
1972
- 1972-01-27 GB GB379172A patent/GB1345102A/en not_active Expired
- 1972-01-31 IE IE128/72A patent/IE36195B1/xx unknown
- 1972-02-01 FR FR7203920A patent/FR2124519B1/fr not_active Expired
- 1972-02-01 CA CA133,677A patent/CA975712A/en not_active Expired
- 1972-02-01 DE DE19722204724 patent/DE2204724A1/de active Pending
- 1972-02-01 ZA ZA720641A patent/ZA72641B/xx unknown
- 1972-02-02 SE SE7201180A patent/SE374566C/xx unknown
- 1972-02-03 JP JP47012535A patent/JPS5133483B1/ja active Pending
- 1972-02-04 NL NL7201463A patent/NL7201463A/xx unknown
- 1972-02-04 ES ES399486A patent/ES399486A1/es not_active Expired
- 1972-02-04 PH PH13251*A patent/PH10022A/en unknown
- 1972-02-07 ZM ZM21/72A patent/ZM2172A1/xx unknown
- 1972-02-07 BE BE779036A patent/BE779036A/xx unknown
- 1972-02-07 NO NO321/72*[A patent/NO133903C/no unknown
- 1972-02-07 IT IT9338/72A patent/IT949343B/it active
- 1972-02-08 LU LU64751D patent/LU64751A1/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1345102A (en) | 1974-01-30 |
| JPS5133483B1 (cg-RX-API-DMAC7.html) | 1976-09-20 |
| FR2124519A1 (cg-RX-API-DMAC7.html) | 1972-09-22 |
| NO133903B (cg-RX-API-DMAC7.html) | 1976-04-05 |
| PH10022A (en) | 1976-07-13 |
| IE36195B1 (en) | 1976-09-15 |
| ZM2172A1 (en) | 1973-10-22 |
| US3673061A (en) | 1972-06-27 |
| NO133903C (cg-RX-API-DMAC7.html) | 1976-07-14 |
| SE374566C (sv) | 1977-06-27 |
| LU64751A1 (cg-RX-API-DMAC7.html) | 1972-06-30 |
| BE779036A (fr) | 1972-05-30 |
| IT949343B (it) | 1973-06-11 |
| NL7201463A (cg-RX-API-DMAC7.html) | 1972-08-10 |
| CA975712A (en) | 1975-10-07 |
| FR2124519B1 (cg-RX-API-DMAC7.html) | 1976-07-09 |
| ZA72641B (en) | 1972-10-25 |
| SE374566B (cg-RX-API-DMAC7.html) | 1975-03-10 |
| ES399486A1 (es) | 1974-11-01 |
| IE36195L (en) | 1972-08-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2204724A1 (de) | Elektrolyse-Verfahren zur Gewinnung von Metallen | |
| DE69326462T2 (de) | Herstellung von metallen aus mineralien | |
| DE2357280C2 (de) | Verfahren zur Gewinnung von Zink aus zink- und eisenhaltigen Sulfiden | |
| DE2528861A1 (de) | Verfahren zur oxydation von metallsulfiden in waessrigen medien | |
| DE2336764A1 (de) | Verfahren zur gewinnung von kupfer aus seinen mineralien | |
| DE2851885A1 (de) | Verfahren zur gleichzeitigen elektroloesung und elektrogewinnung von metallen aus sulfidmineralien | |
| DE2257519C3 (de) | Verfahren zur Gewinnung von Edelmetallen | |
| DE2508890B2 (de) | Verfahren zur selektiven aufloesung der in den pyrithaltigen erzen enthaltenen nichteisenmetalle | |
| DE2315284A1 (de) | Elektrolytisches verfahren zur abscheidung von metallen aus ihrer sulfiden und gemischten sulfiden | |
| DE2605887C2 (de) | Verfahren zur Gewinnung von Kupfer aus kupfer- und eisenhaltigem sulfidischen Erz und Konzentrat durch Elektrolyse | |
| DE2548620C2 (de) | Verfahren zur Gewinnung vonretoem Elektrolytkupfer durch Reduktionselektrolyse | |
| DE2248178C3 (de) | Verfahren zur Aufbereitung und Gewinnung von Molybdän und/oder Rhenium | |
| DE3137678C2 (de) | Verfahren zur Gewinnung von Blei, Silber und Gold aus eisenhaltigem Abfall des elektrolytischen Zinkgewinnungsprozesses | |
| DE69420314T2 (de) | Verfahren zur Elektrogewinnung von schweren Metallen | |
| DE4407448C2 (de) | Elektrolyseverfahren zum Regenerieren einer Eisen-III-Chlorid- oder Eisen-III-Sulfatlösung, insbesondere zum Sprühätzen von Stahl | |
| DE2823714A1 (de) | Verfahren zur gewinnung von blei aus bleisulfid enthaltendem material | |
| DE2311242C3 (de) | Verfahren zur Gewinnung von Kupfer, Zink oder Nickel aus sulfidischen Erzen | |
| EP0748396B1 (de) | Elektrolyseverfahren zum regenerieren einer eisen-iii-chlorid oder eisen-iii-sulfatlösung, insbesondere zum sprühätzen von stahl | |
| DE69710870T2 (de) | Elektrolytische Gewinnung von Reinzink aus einer Mangan enthaltenden Laugungslösung durch vorhergehender Entmanganisierung der Lösung mittels kalter Elektrolyse | |
| DE293908C (cg-RX-API-DMAC7.html) | ||
| DE102021115850B4 (de) | Verfahren zur Laugung metallhaltiger Erze mittels elektrochemisch hergestellter Laugungslösung | |
| DE3041437T1 (de) | Production of lead from ores and concentrates | |
| DE2943533A1 (de) | Verfahren zur elektrochemischen gewinnung von metallen | |
| DE2732817C2 (de) | Hydrometallurgisches Verfahren zum selektiven Auflösen von Blei aus sulfidischen Mineralien und Konzentraten | |
| DE2303881A1 (de) | Verfahren zum extrahieren von metallmengen aus einem metallsulfiderz |