DE2151626C3 - - Google Patents
Info
- Publication number
- DE2151626C3 DE2151626C3 DE19712151626 DE2151626A DE2151626C3 DE 2151626 C3 DE2151626 C3 DE 2151626C3 DE 19712151626 DE19712151626 DE 19712151626 DE 2151626 A DE2151626 A DE 2151626A DE 2151626 C3 DE2151626 C3 DE 2151626C3
- Authority
- DE
- Germany
- Prior art keywords
- electrically conductive
- heat
- layer
- conductive film
- rigid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000010438 heat treatment Methods 0.000 claims description 25
- 239000006185 dispersion Substances 0.000 claims description 17
- 239000006260 foam Substances 0.000 claims description 12
- 239000002245 particle Substances 0.000 claims description 9
- 239000006229 carbon black Substances 0.000 claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 7
- 229920003023 plastic Polymers 0.000 claims description 7
- 239000004033 plastic Substances 0.000 claims description 7
- 229920002635 polyurethane Polymers 0.000 claims description 7
- 239000004814 polyurethane Substances 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- 239000004925 Acrylic resin Substances 0.000 claims description 5
- 229920000178 Acrylic resin Polymers 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 241001251094 Formica Species 0.000 claims description 4
- 238000001035 drying Methods 0.000 claims description 4
- 229910000510 noble metal Inorganic materials 0.000 claims description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000011541 reaction mixture Substances 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 230000005611 electricity Effects 0.000 claims description 2
- 229910002804 graphite Inorganic materials 0.000 claims description 2
- 239000010439 graphite Substances 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims 1
- 229910052700 potassium Inorganic materials 0.000 claims 1
- 239000011591 potassium Substances 0.000 claims 1
- 239000000377 silicon dioxide Substances 0.000 claims 1
- 229910052708 sodium Inorganic materials 0.000 claims 1
- 239000011734 sodium Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- 229920005830 Polyurethane Foam Polymers 0.000 description 7
- 239000011496 polyurethane foam Substances 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000005187 foaming Methods 0.000 description 4
- 235000019353 potassium silicate Nutrition 0.000 description 4
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 3
- 239000004111 Potassium silicate Substances 0.000 description 3
- 239000004115 Sodium Silicate Substances 0.000 description 3
- 239000006230 acetylene black Substances 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052913 potassium silicate Inorganic materials 0.000 description 3
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 3
- 229910052911 sodium silicate Inorganic materials 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- RLQWHDODQVOVKU-UHFFFAOYSA-N tetrapotassium;silicate Chemical compound [K+].[K+].[K+].[K+].[O-][Si]([O-])([O-])[O-] RLQWHDODQVOVKU-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- NEIHULKJZQTQKJ-UHFFFAOYSA-N [Cu].[Ag] Chemical compound [Cu].[Ag] NEIHULKJZQTQKJ-UHFFFAOYSA-N 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000004870 electrical engineering Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 230000017525 heat dissipation Effects 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 239000002923 metal particle Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 229910052755 nonmetal Inorganic materials 0.000 description 1
- 150000002843 nonmetals Chemical class 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- -1 polytetrafluoroethylene Polymers 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- NNHHDJVEYQHLHG-UHFFFAOYSA-N potassium silicate Chemical compound [K+].[K+].[O-][Si]([O-])=O NNHHDJVEYQHLHG-UHFFFAOYSA-N 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 230000035882 stress Effects 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
Priority Applications (22)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2151626A DE2151626B2 (de) | 1971-10-16 | 1971-10-16 | Verfahren zur Herstellung eines starren, durch Elektrizität aufheizbaren Flächenheizelementes |
| FR7233606A FR2154552B1 (enExample) | 1971-09-27 | 1972-09-22 | |
| JP47096561A JPS5245066B2 (enExample) | 1971-09-27 | 1972-09-26 | |
| IT29700/72A IT967885B (it) | 1971-09-27 | 1972-09-26 | Elementi riscaldanti a pannello riscaldabili elettricamente |
| DD165884A DD102266A1 (enExample) | 1971-09-27 | 1972-09-26 | |
| SE7212405A SE389592B (sv) | 1971-09-27 | 1972-09-26 | Styv elektrisk vermeplatta och forfarande for dess tillverkning |
| CH1399072A CH570095A5 (enExample) | 1971-09-27 | 1972-09-26 | |
| GB4441672A GB1396590A (en) | 1971-09-27 | 1972-09-26 | Electrically heatable area heating elements |
| CA152,551A CA991690A (en) | 1971-09-27 | 1972-09-26 | Electrically heatable area heating elements |
| CH838575A CH572966A5 (enExample) | 1971-10-16 | 1972-09-26 | |
| IL40453A IL40453A (en) | 1971-09-27 | 1972-09-27 | Rigid electrical area heating elements and method for their manufacture |
| IL48162A IL48162A (en) | 1971-10-16 | 1972-09-27 | Electrically conductive paint |
| US05/504,192 US4060710A (en) | 1971-09-27 | 1974-09-09 | Rigid electric surface heating element |
| JP50112512A JPS5159932A (en) | 1971-10-16 | 1975-09-17 | Dodenseitoryo |
| IL48162A IL48162A0 (en) | 1971-10-16 | 1975-09-24 | Electrically conductive paint |
| US05/621,767 US4051094A (en) | 1971-09-27 | 1975-10-09 | Electrical conductive lacquer |
| FR7531764A FR2282147A1 (fr) | 1971-10-16 | 1975-10-17 | Laque conductrice d'electricite |
| SE7514134A SE423245B (sv) | 1971-10-16 | 1975-12-15 | Elektrisk ledande lack innehallande som bindemedel en vattenhaltig plastdispersion i en vattenhaltig silikatlosning |
| BR7508568A BR7508568A (pt) | 1971-09-27 | 1975-12-23 | Composicao de verniz condutor |
| CA250,231A CA1011893A (en) | 1971-10-16 | 1976-04-14 | Conductive lacquer |
| CA250,232A CA1005845A (en) | 1971-09-27 | 1976-04-14 | Flexible electrically heatable area heating elements |
| FR7622810A FR2326827A1 (fr) | 1971-09-27 | 1976-07-27 | Element chauffant electrique plat rigide |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2151626A DE2151626B2 (de) | 1971-10-16 | 1971-10-16 | Verfahren zur Herstellung eines starren, durch Elektrizität aufheizbaren Flächenheizelementes |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2151626A1 DE2151626A1 (de) | 1973-04-26 |
| DE2151626B2 DE2151626B2 (de) | 1975-10-23 |
| DE2151626C3 true DE2151626C3 (enExample) | 1977-06-23 |
Family
ID=5822545
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2151626A Granted DE2151626B2 (de) | 1971-09-27 | 1971-10-16 | Verfahren zur Herstellung eines starren, durch Elektrizität aufheizbaren Flächenheizelementes |
Country Status (6)
| Country | Link |
|---|---|
| JP (1) | JPS5159932A (enExample) |
| CH (1) | CH572966A5 (enExample) |
| DE (1) | DE2151626B2 (enExample) |
| FR (1) | FR2282147A1 (enExample) |
| IL (2) | IL48162A (enExample) |
| SE (1) | SE423245B (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2417233A1 (fr) * | 1978-02-14 | 1979-09-07 | Le Cardinal Gilles | Dispositif de chauffage regule au moyen d'une pellicule electriquement conductrice |
| JPS5865325U (ja) * | 1981-10-23 | 1983-05-02 | 日東電工株式会社 | 積層吸液材 |
| JPS58194962A (ja) * | 1982-05-08 | 1983-11-14 | Hitachi Powdered Metals Co Ltd | 耐水性導電塗料 |
| DE3325204A1 (de) * | 1983-07-13 | 1985-01-24 | Reimbold & Strick GmbH & Co, 5000 Köln | Auf einem traeger aus elektrisch isolierenden werkstoffen aufgebrachtes heizelement aus elektrisch leitenden werkstoffen, seine herstellung und verwendung |
| JPS6061021U (ja) * | 1983-10-04 | 1985-04-27 | 日東電工株式会社 | 皮膚外傷、火傷手当用救急包帯材 |
| DK162004C (da) * | 1984-02-29 | 1992-02-10 | Buchtal Gmbh | Rumopvarmningselement |
| FI83720C (fi) * | 1984-02-29 | 1991-08-12 | Buchtal Gmbh | Plan keramisk formkropp. |
| US4867150A (en) * | 1987-01-20 | 1989-09-19 | The B. F. Goodrich Company | Perforated elastomeric soft film and wound dressing made therewith |
| GB8710634D0 (en) * | 1987-05-05 | 1987-06-10 | Hill R G Q S | Electric heaters |
| JPH0636672A (ja) * | 1992-07-16 | 1994-02-10 | Sumitomo Wiring Syst Ltd | カード型ヒューズおよびその製造方法 |
| DE19538686A1 (de) * | 1995-10-17 | 1997-04-24 | Magnus Dr Kluge | Elektrische Widerstandsheizung zur Raumklimatisierung in Wohnungen und Gebäuden |
| DE19647935C5 (de) * | 1996-11-20 | 2009-08-20 | Ts Thermo Systeme Gmbh | Elektrische Innenraumheizung für Wohnwagen |
| ATA40398A (de) | 1998-03-09 | 1999-09-15 | Wolfgang Dr Schwarz | Elektrisch leitende mikrokapillare verbundmatrix und verfahren zu deren herstellung |
| DE20314061U1 (de) * | 2003-09-10 | 2003-11-20 | Haug, Rainer, 70191 Stuttgart | Heizplatte zum elektrischen Heizen von Gebäuderäumen |
| DE202017001454U1 (de) | 2017-03-19 | 2017-06-22 | Dynamic Solar Systems Ag | Geregelte, gedruckte Heizung |
| DE102017107540A1 (de) | 2017-04-07 | 2018-10-11 | ALTERHEAT GmbH | Elektrische Direktheizvorrichtung und Verfahren zur Steuerung einer solchen |
| CN108867390A (zh) * | 2018-07-13 | 2018-11-23 | 永嘉县博宇建设有限公司 | 一种桩基施工平台 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1045159A (fr) * | 1951-11-15 | 1953-11-24 | éléments de chauffage électrique | |
| US2977928A (en) * | 1958-08-15 | 1961-04-04 | Illinois Tool Works | Resistor tape sprayer |
| DE2007866A1 (de) * | 1970-02-20 | 1971-09-09 | Hoechst Ag | Verfahren zum Herstellen von Flachen heizleitern und nach diesem Verfahren her gestellte Flachenheizleiter |
-
1971
- 1971-10-16 DE DE2151626A patent/DE2151626B2/de active Granted
-
1972
- 1972-09-26 CH CH838575A patent/CH572966A5/xx not_active IP Right Cessation
- 1972-09-27 IL IL48162A patent/IL48162A/en unknown
-
1975
- 1975-09-17 JP JP50112512A patent/JPS5159932A/ja active Granted
- 1975-09-24 IL IL48162A patent/IL48162A0/xx unknown
- 1975-10-17 FR FR7531764A patent/FR2282147A1/fr active Granted
- 1975-12-15 SE SE7514134A patent/SE423245B/xx unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2151626C3 (enExample) | ||
| DE2151626B2 (de) | Verfahren zur Herstellung eines starren, durch Elektrizität aufheizbaren Flächenheizelementes | |
| DE69027113T2 (de) | Elektrische heizanordnung und verfahren zu derer herstellung | |
| DE2425141C3 (de) | Flexibles Überzugsmaterial für Zündkabel u.dgl. Substrate | |
| DE2148191C3 (de) | Drahtlose Flächenheizelemente und Verfahren zu ihrer Herstellung | |
| DE2616287A1 (de) | Buegeleisen mit einem mindestens teilweise aus glaswerkstoff bestehenden sohlenkoerper | |
| US4051094A (en) | Electrical conductive lacquer | |
| IL40453A (en) | Rigid electrical area heating elements and method for their manufacture | |
| DE2138580A1 (de) | Zusammengesetztes, polymeres, elektrisches Heizelement und Verfahren zu dessen Herstellung | |
| DE3424203A1 (de) | Diaphragma fuer alkalische elektrolysen und verfahren zur herstellung desselben | |
| DE2616855A1 (de) | Verfahren zum isolieren von organopolysiloxanelastomer als bindemittel enthaltendem widerstandsmaterial von flaechenheizwiderstaenden und isoliertes widerstandsmaterial von flaechen | |
| RU2074521C1 (ru) | Электронагреватель и способ его изготовления | |
| US3595720A (en) | Heating elements | |
| DE2152546A1 (de) | Kompressibles, elektrisch leitfaehiges und/oder magnetisches material aus elastischen, zelligen polymeren und verfahren zu seiner herstellung | |
| DE2234216C3 (de) | Verfahren zur Herstellung eines starren, durch Elektrizität aufheizbaren Flächenheizelementes | |
| CH356810A (de) | Kunststoffkörper, der auf der Oberfläche eine Metallfolie aufweist | |
| DE102020124533A1 (de) | Heizvorrichtung und Verfahren zum Herstellen derselben | |
| DE10336427A1 (de) | Elektrische Spiegelheizung mit elektronischer Invertertechnologie als Stromquelle | |
| EP0157179A1 (de) | Mit einer elektrischen Widerstandsbeschichtung versehener flächiger keramischer Formkörper und Verfahren zur Einstellung des Widerstandswertes der Widerstandsbeschichtung | |
| FI72631B (fi) | Saett foer framstaellning av en plastmatta. | |
| DE7031230U (de) | Heizbare deckengipsplatte. | |
| DE2726791A1 (de) | Heizelement, insbesondere mit grosser heizflaeche | |
| DE1945948C3 (de) | Elektrisches Heizelement und Verfahren zu seiner Herstellung | |
| DE2101338A1 (en) | Surface heater prodn - using carbon black loaded plastic esp polyester resin | |
| DE2166805A1 (de) | Leitlack |