DE2140438A1 - Substituierte benzoesaeureamide - Google Patents
Substituierte benzoesaeureamideInfo
- Publication number
- DE2140438A1 DE2140438A1 DE2140438A DE2140438A DE2140438A1 DE 2140438 A1 DE2140438 A1 DE 2140438A1 DE 2140438 A DE2140438 A DE 2140438A DE 2140438 A DE2140438 A DE 2140438A DE 2140438 A1 DE2140438 A1 DE 2140438A1
- Authority
- DE
- Germany
- Prior art keywords
- dichlorobenzoic acid
- weight
- acid amide
- parts
- isopropyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical class OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 title 2
- 239000005711 Benzoic acid Substances 0.000 title 1
- 235000010233 benzoic acid Nutrition 0.000 title 1
- -1 N- (I-cyano-isopropyl) -5,5-dichlorobenzoic acid amide Chemical compound 0.000 claims description 7
- 230000002363 herbicidal effect Effects 0.000 claims description 7
- 239000004009 herbicide Substances 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- WXALHTONIYRUCO-UHFFFAOYSA-N peroxycyanic acid Chemical compound OOC#N WXALHTONIYRUCO-UHFFFAOYSA-N 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- DELNZTRPJTUOIP-UHFFFAOYSA-N 3,5-dichlorobenzamide Chemical class NC(=O)C1=CC(Cl)=CC(Cl)=C1 DELNZTRPJTUOIP-UHFFFAOYSA-N 0.000 claims 2
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 150000001721 carbon Chemical group 0.000 claims 1
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 description 17
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- CXKCZFDUOYMOOP-UHFFFAOYSA-N 3,5-dichlorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC(Cl)=C1 CXKCZFDUOYMOOP-UHFFFAOYSA-N 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 6
- 241000219198 Brassica Species 0.000 description 5
- 235000011331 Brassica Nutrition 0.000 description 5
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- 244000292693 Poa annua Species 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 235000010469 Glycine max Nutrition 0.000 description 4
- 240000006597 Poa trivialis Species 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- AFABGHUZZDYHJO-UHFFFAOYSA-N 2-Methylpentane Chemical compound CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 3
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical class NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 3
- 101710189567 Lamin-2 Proteins 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000004359 castor oil Substances 0.000 description 3
- 235000019438 castor oil Nutrition 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- GGHLXLVPNZMBQR-UHFFFAOYSA-N 3,5-dichlorobenzoyl chloride Chemical compound ClC(=O)C1=CC(Cl)=CC(Cl)=C1 GGHLXLVPNZMBQR-UHFFFAOYSA-N 0.000 description 2
- 241001148727 Bromus tectorum Species 0.000 description 2
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 2
- 240000004585 Dactylis glomerata Species 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 244000038559 crop plants Species 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- LZDKZFUFMNSQCJ-UHFFFAOYSA-N 1,2-diethoxyethane Chemical compound CCOCCOCC LZDKZFUFMNSQCJ-UHFFFAOYSA-N 0.000 description 1
- WWNVWCPHYLJYBT-UHFFFAOYSA-N 1,3-dichloro-2-(chloromethyl)propan-2-amine Chemical compound ClCC(N)(CCl)CCl WWNVWCPHYLJYBT-UHFFFAOYSA-N 0.000 description 1
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical compound CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 1
- JCLSEQJEXYHVTC-UHFFFAOYSA-N 2-amino-2-methylbutanenitrile Chemical compound CCC(C)(N)C#N JCLSEQJEXYHVTC-UHFFFAOYSA-N 0.000 description 1
- LOUHLMICRIPPTD-UHFFFAOYSA-N 2-chloro-2-methylpropan-1-amine Chemical compound CC(C)(Cl)CN LOUHLMICRIPPTD-UHFFFAOYSA-N 0.000 description 1
- ONIKNECPXCLUHT-UHFFFAOYSA-N 2-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1Cl ONIKNECPXCLUHT-UHFFFAOYSA-N 0.000 description 1
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 1
- NIDHDQARHFYROK-UHFFFAOYSA-N 3,5-dichloro-N-(2-methylpent-3-yn-2-yl)benzamide Chemical compound CC(C#CC)(C)NC(C1=CC(=CC(=C1)Cl)Cl)=O NIDHDQARHFYROK-UHFFFAOYSA-N 0.000 description 1
- CBLVYCKVKQIRCM-UHFFFAOYSA-N 3,5-dichloro-n-(2-cyanopropan-2-yl)benzamide Chemical compound N#CC(C)(C)NC(=O)C1=CC(Cl)=CC(Cl)=C1 CBLVYCKVKQIRCM-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 244000058871 Echinochloa crus-galli Species 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- 244000152045 Themeda triandra Species 0.000 description 1
- 241001148683 Zostera marina Species 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- JEPPYVOSGKWVSJ-UHFFFAOYSA-N bicyclo[2.2.1]heptan-3-amine Chemical compound C1CC2C(N)CC1C2 JEPPYVOSGKWVSJ-UHFFFAOYSA-N 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- ISRXMEYARGEVIU-UHFFFAOYSA-N n-methyl-n-propan-2-ylpropan-2-amine Chemical compound CC(C)N(C)C(C)C ISRXMEYARGEVIU-UHFFFAOYSA-N 0.000 description 1
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000003799 water insoluble solvent Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE787381D BE787381A (fr) | 1971-08-12 | Amides substitues de l'acide benzoique | |
| DE2140438A DE2140438A1 (de) | 1971-08-12 | 1971-08-12 | Substituierte benzoesaeureamide |
| CH1101172*A CH578829A5 (enExample) | 1971-08-12 | 1972-02-24 | |
| JP47068752A JPS4826918A (enExample) | 1971-08-12 | 1972-07-11 | |
| US272367A US3880903A (en) | 1971-08-12 | 1972-07-17 | N-(cyanoalky)-3,5-dichlorobenzamide |
| IL39925A IL39925A (en) | 1971-08-12 | 1972-07-17 | Substituted benzamides and their use as herbicides |
| AU44661/72A AU4466172A (en) | 1971-08-12 | 1972-07-18 | Substituted benzamides |
| ZA725000A ZA725000B (en) | 1971-08-12 | 1972-07-20 | Substituted benzamides |
| DD164727A DD102273A5 (enExample) | 1971-08-12 | 1972-07-27 | |
| BR5349/72A BR7205349D0 (pt) | 1971-08-12 | 1972-08-08 | Composicoes herbicidas |
| NL7210940A NL7210940A (enExample) | 1971-08-12 | 1972-08-10 | |
| AT696672A AT318297B (de) | 1971-08-12 | 1972-08-11 | Herbizid |
| FR7229128A FR2150088A5 (enExample) | 1971-08-12 | 1972-08-11 | |
| GB3753072A GB1395802A (en) | 1971-08-12 | 1972-08-11 | Substituted benzamides and herbicidal uses thereof |
| IT52139/72A IT965979B (it) | 1971-08-12 | 1972-08-11 | Benzammidi sostituito |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2140438A DE2140438A1 (de) | 1971-08-12 | 1971-08-12 | Substituierte benzoesaeureamide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2140438A1 true DE2140438A1 (de) | 1973-02-22 |
Family
ID=5816567
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2140438A Pending DE2140438A1 (de) | 1971-08-12 | 1971-08-12 | Substituierte benzoesaeureamide |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3880903A (enExample) |
| JP (1) | JPS4826918A (enExample) |
| AT (1) | AT318297B (enExample) |
| AU (1) | AU4466172A (enExample) |
| BE (1) | BE787381A (enExample) |
| BR (1) | BR7205349D0 (enExample) |
| CH (1) | CH578829A5 (enExample) |
| DD (1) | DD102273A5 (enExample) |
| DE (1) | DE2140438A1 (enExample) |
| FR (1) | FR2150088A5 (enExample) |
| GB (1) | GB1395802A (enExample) |
| IL (1) | IL39925A (enExample) |
| IT (1) | IT965979B (enExample) |
| NL (1) | NL7210940A (enExample) |
| ZA (1) | ZA725000B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4515959A (en) * | 1981-09-30 | 1985-05-07 | Imperial Chemical Industries Plc | Biologically active amides |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4087277A (en) * | 1976-05-20 | 1978-05-02 | Stauffer Chemical Company | N-(1,1-substituted acetonitrilo)-α-(3,5-substituted phenoxy) alkyl amides and their use as herbicides |
| US4197114A (en) * | 1978-10-31 | 1980-04-08 | Ppg Industries, Inc. | Alkyl N-3-alkoxy-, and N-3,5-dialkoxybenzoyl-N-isopropylaminoacetate herbicides |
| US4261732A (en) * | 1979-09-17 | 1981-04-14 | Ppg Industries, Inc. | Alkyl and alkoxyalkyl N-3-alkyl and N-3,5-dialkylbenzoyl-N-isopropylaminoacetate herbicides |
| EP0061836B1 (en) * | 1981-03-19 | 1986-12-30 | Imperial Chemical Industries Plc | Amide derivatives, processes for preparing them, their use as fungicides and pesticidal compositions containing them |
| DE3611193A1 (de) * | 1986-04-04 | 1987-10-15 | Bayer Ag | N-substituierte benzamide |
| US5021454A (en) * | 1989-10-06 | 1991-06-04 | Rohm And Haas Company | Benzoylaminoalkanoic acids and esters |
| FR2658818B1 (fr) * | 1990-02-27 | 1993-12-31 | Adir Cie | Nouveaux derives a structure naphtalenique, leur procede de preparation et les compositions pharmaceutiques qui les contiennent. |
| US5659082A (en) * | 1995-04-03 | 1997-08-19 | Centaur Pharmaceuticals, Inc. | Nitro- and aminobenzamide compounds for neurodegenerative disorders |
| US5643965A (en) * | 1995-04-03 | 1997-07-01 | Centaur Pharmaceuticals, Inc. | Aminobenzamide compounds for the treatment of neurodegenerative disorders |
| AR064563A1 (es) * | 2007-01-03 | 2009-04-08 | Bayer Cropscience Ag | Derivados de n-alquinilbenzamida, un procedimiento para su preparacion, una composicion fungicida que lo comprende y su uso en un metodo para combatir hongos fitopatogenos. |
| CN113402411B (zh) * | 2021-03-15 | 2022-11-29 | 深圳市谦陌通辰实验有限公司 | 一种基于氧化反应的炔苯酰草胺的合成方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3457294A (en) * | 1966-04-22 | 1969-07-22 | Abbott Lab | N-(substituted-benzoyl) aminoaceto- and aminopropionitriles |
-
0
- BE BE787381D patent/BE787381A/xx unknown
-
1971
- 1971-08-12 DE DE2140438A patent/DE2140438A1/de active Pending
-
1972
- 1972-02-24 CH CH1101172*A patent/CH578829A5/xx not_active IP Right Cessation
- 1972-07-11 JP JP47068752A patent/JPS4826918A/ja active Pending
- 1972-07-17 IL IL39925A patent/IL39925A/xx unknown
- 1972-07-17 US US272367A patent/US3880903A/en not_active Expired - Lifetime
- 1972-07-18 AU AU44661/72A patent/AU4466172A/en not_active Expired
- 1972-07-20 ZA ZA725000A patent/ZA725000B/xx unknown
- 1972-07-27 DD DD164727A patent/DD102273A5/xx unknown
- 1972-08-08 BR BR5349/72A patent/BR7205349D0/pt unknown
- 1972-08-10 NL NL7210940A patent/NL7210940A/xx unknown
- 1972-08-11 IT IT52139/72A patent/IT965979B/it active
- 1972-08-11 FR FR7229128A patent/FR2150088A5/fr not_active Expired
- 1972-08-11 GB GB3753072A patent/GB1395802A/en not_active Expired
- 1972-08-11 AT AT696672A patent/AT318297B/de not_active IP Right Cessation
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4755605A (en) * | 1981-09-03 | 1988-07-05 | Imperial Chemical Industries Plc | Process for preparing biologically active amides |
| US4515959A (en) * | 1981-09-30 | 1985-05-07 | Imperial Chemical Industries Plc | Biologically active amides |
| US4552887A (en) * | 1981-09-30 | 1985-11-12 | Imperial Chemical Industries Plc | Biologically active amides |
| US4709038A (en) * | 1981-09-30 | 1987-11-24 | Imperial Chemical Industries Plc | Biologically active amides |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7210940A (enExample) | 1973-02-14 |
| BR7205349D0 (pt) | 1973-09-18 |
| AU4466172A (en) | 1974-01-24 |
| FR2150088A5 (enExample) | 1973-03-30 |
| IL39925A0 (en) | 1972-09-28 |
| AT318297B (de) | 1974-10-10 |
| JPS4826918A (enExample) | 1973-04-09 |
| ZA725000B (en) | 1973-05-30 |
| IT965979B (it) | 1974-02-11 |
| DD102273A5 (enExample) | 1973-12-12 |
| US3880903A (en) | 1975-04-29 |
| CH578829A5 (enExample) | 1976-08-31 |
| BE787381A (fr) | 1973-02-09 |
| GB1395802A (en) | 1975-05-29 |
| IL39925A (en) | 1976-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0893434B1 (de) | Zwischenprodukte für die Herstellung von Oximäthern | |
| DE2140438A1 (de) | Substituierte benzoesaeureamide | |
| DE3340595A1 (de) | Imidazolinone, verfahren zu ihrer herstellung und ihre verwendung im pflanzenschutz | |
| EP0013660B1 (de) | Aminoalkylester der 2-Nitro-5-(ortho-chlor-para-trifluor-methylphenoxy)-benzoesäure, deren Herstellung, sie als Wirkstoff enthaltende herbizide Mittel und deren Verwendung | |
| DE2005326A1 (de) | Harnstoffderivate | |
| DE2019536A1 (de) | Oximcarbamate | |
| DE2101698A1 (de) | Substituierte m-Trifluormethylphenylharnstoffderivate | |
| DE2231249A1 (de) | Carbamat | |
| EP0009792B1 (de) | 3-Chlorostyryl-2,2-dimethyl-cyclopropancarbonsäure-(4-fluoro-3-phenoxy-alpha-cyano-benzyl)-ester, Verfahren zu ihrer Herstellung und ihre Verwendung als Ektoparasitizide | |
| DE2946652A1 (de) | Optisch aktive 4-phenoxyphenoxypropionsaeurederivate | |
| DE2041996A1 (de) | Substituierte Uracile | |
| DE2611902C2 (de) | N-(Fluordichlormethylthio)-benzoesäureanilide, Verfahren zu ihrer Herstellung und diese enthaltende Fungizide | |
| DE2131399A1 (de) | Disulfide | |
| DE2010397A1 (de) | Substituierte 1 Phenyl 4 N acetoacetat amino 5 halogenpyndazone (6) und ihre Anwendung als Herbizide | |
| DE2545964C2 (de) | N-Halogenacetyl-N-aryl-glycinamide, Verfahren zu ihrer Herstellung sowie diese Verbindungen enthaltende herbizide Mittel | |
| DE1542853C3 (de) | Substituierte p-Cyanophenylcarbamate und diese enthaltende Schädlingsbekämpfungsmittel | |
| DE2019535A1 (de) | Substituierte Furancarbonsaeurecycloalkylamide | |
| DE2111672A1 (de) | Phosphono-glyoxylester | |
| DE2028168A1 (de) | Substituierte Hexahydroazepincarbon saureamide | |
| DE2601447A1 (de) | Cyclohexen-ester | |
| DE2034242C3 (de) | Acetoacetanilide und Herbizide, die diese Verbindungen als Wirkstoffe enthalten | |
| DE2023291A1 (de) | Substituierte Pyridazone | |
| DE1937551C (de) | Herbizide Mittel | |
| DE2031922A1 (de) | Alkylamino-oxaniloxime | |
| DE2100684A1 (de) | Substituierte Carbaminsäureester |