DE2132963C3 - Wasserlösliche, reaktive Xanthenfarbstoffe, ihre Herstellung und ihre Verwendung - Google Patents
Wasserlösliche, reaktive Xanthenfarbstoffe, ihre Herstellung und ihre VerwendungInfo
- Publication number
- DE2132963C3 DE2132963C3 DE2132963A DE2132963A DE2132963C3 DE 2132963 C3 DE2132963 C3 DE 2132963C3 DE 2132963 A DE2132963 A DE 2132963A DE 2132963 A DE2132963 A DE 2132963A DE 2132963 C3 DE2132963 C3 DE 2132963C3
- Authority
- DE
- Germany
- Prior art keywords
- formula
- general formula
- group
- compound
- methylsulfonyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000001018 xanthene dye Substances 0.000 title claims description 6
- 238000004519 manufacturing process Methods 0.000 title description 2
- -1 naphthylene radical Chemical class 0.000 claims description 61
- 239000000975 dye Substances 0.000 claims description 37
- 150000001875 compounds Chemical class 0.000 claims description 24
- 150000001412 amines Chemical class 0.000 claims description 12
- 150000003254 radicals Chemical class 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 10
- 125000001424 substituent group Chemical group 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000000623 heterocyclic group Chemical group 0.000 claims description 6
- 238000011282 treatment Methods 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 239000007795 chemical reaction product Substances 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 claims description 4
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- KZTYYGOKRVBIMI-UHFFFAOYSA-N S-phenyl benzenesulfonothioate Natural products C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 claims description 2
- 239000004305 biphenyl Substances 0.000 claims description 2
- 235000010290 biphenyl Nutrition 0.000 claims description 2
- 125000006267 biphenyl group Chemical group 0.000 claims description 2
- LTYMSROWYAPPGB-UHFFFAOYSA-N diphenyl sulfide Chemical compound C=1C=CC=CC=1SC1=CC=CC=C1 LTYMSROWYAPPGB-UHFFFAOYSA-N 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000004957 naphthylene group Chemical group 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 241001083878 Licania tomentosa Species 0.000 claims 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 16
- 239000002253 acid Substances 0.000 description 13
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 11
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 10
- 239000003795 chemical substances by application Substances 0.000 description 10
- 238000004043 dyeing Methods 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 235000002639 sodium chloride Nutrition 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- 239000011780 sodium chloride Substances 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 239000000835 fiber Substances 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 229920003043 Cellulose fiber Polymers 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 239000004952 Polyamide Substances 0.000 description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 229920002647 polyamide Polymers 0.000 description 4
- 125000000714 pyrimidinyl group Chemical group 0.000 description 4
- 239000001632 sodium acetate Substances 0.000 description 4
- 235000017281 sodium acetate Nutrition 0.000 description 4
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 4
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 4
- 210000002268 wool Anatomy 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 3
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 238000006482 condensation reaction Methods 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 239000002657 fibrous material Substances 0.000 description 3
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 235000011164 potassium chloride Nutrition 0.000 description 3
- 239000001103 potassium chloride Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Inorganic materials O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 3
- QQOWHRYOXYEMTL-UHFFFAOYSA-N triazin-4-amine Chemical compound N=C1C=CN=NN1 QQOWHRYOXYEMTL-UHFFFAOYSA-N 0.000 description 3
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 230000002140 halogenating effect Effects 0.000 description 2
- 239000010985 leather Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 230000000865 phosphorylative effect Effects 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 229920006306 polyurethane fiber Polymers 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- 230000001180 sulfating effect Effects 0.000 description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- SWLJARIIAARGGG-UHFFFAOYSA-N 12h-benzo[a]thioxanthene-1,2-dicarboxylic acid Chemical compound S1C2=CC=CC=C2CC2=C1C=CC1=CC=C(C(=O)O)C(C(O)=O)=C12 SWLJARIIAARGGG-UHFFFAOYSA-N 0.000 description 1
- KESAPMAPWGLLQL-UHFFFAOYSA-N 2,2,3,3-tetrafluorocyclobutane-1-carbonyl chloride Chemical compound FC1(F)CC(C(Cl)=O)C1(F)F KESAPMAPWGLLQL-UHFFFAOYSA-N 0.000 description 1
- BCOSEZGCLGPUSL-UHFFFAOYSA-N 2,3,3-trichloroprop-2-enoyl chloride Chemical compound ClC(Cl)=C(Cl)C(Cl)=O BCOSEZGCLGPUSL-UHFFFAOYSA-N 0.000 description 1
- SPSSDDOTEZKOOV-UHFFFAOYSA-N 2,3-dichloroquinoxaline Chemical class C1=CC=C2N=C(Cl)C(Cl)=NC2=C1 SPSSDDOTEZKOOV-UHFFFAOYSA-N 0.000 description 1
- VEPOHXYIFQMVHW-XOZOLZJESA-N 2,3-dihydroxybutanedioic acid (2S,3S)-3,4-dimethyl-2-phenylmorpholine Chemical compound OC(C(O)C(O)=O)C(O)=O.C[C@H]1[C@@H](OCCN1C)c1ccccc1 VEPOHXYIFQMVHW-XOZOLZJESA-N 0.000 description 1
- FYSHPROTETTWKB-UHFFFAOYSA-N 2,4,5,6-tetrabromopyrimidine Chemical compound BrC1=NC(Br)=C(Br)C(Br)=N1 FYSHPROTETTWKB-UHFFFAOYSA-N 0.000 description 1
- KZMWBUVUQLGBBP-UHFFFAOYSA-N 2,4,5,6-tetrafluoropyrimidine Chemical compound FC1=NC(F)=C(F)C(F)=N1 KZMWBUVUQLGBBP-UHFFFAOYSA-N 0.000 description 1
- VHYBUUMUUNCHCK-UHFFFAOYSA-N 2,4,6-tribromo-1,3,5-triazine Chemical compound BrC1=NC(Br)=NC(Br)=N1 VHYBUUMUUNCHCK-UHFFFAOYSA-N 0.000 description 1
- MLLSXQLOUGEEGV-UHFFFAOYSA-N 2,4,6-trifluoro-5-nitropyrimidine Chemical compound [O-][N+](=O)C1=C(F)N=C(F)N=C1F MLLSXQLOUGEEGV-UHFFFAOYSA-N 0.000 description 1
- VFIWQBCLEGAHDR-UHFFFAOYSA-N 2,4,6-tris(benzenesulfonyl)-1,3,5-triazine Chemical compound N=1C(S(=O)(=O)C=2C=CC=CC=2)=NC(S(=O)(=O)C=2C=CC=CC=2)=NC=1S(=O)(=O)C1=CC=CC=C1 VFIWQBCLEGAHDR-UHFFFAOYSA-N 0.000 description 1
- VAOWDUICNHWGRL-UHFFFAOYSA-N 2,4,6-tris(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=CC(S(C)(=O)=O)=NC(S(C)(=O)=O)=N1 VAOWDUICNHWGRL-UHFFFAOYSA-N 0.000 description 1
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 1
- MIVVPUZFDSCZJE-UHFFFAOYSA-N 2,4-bis(methylsulfonyl)-1,3,5-triazine Chemical compound CS(=O)(=O)C1=NC=NC(S(C)(=O)=O)=N1 MIVVPUZFDSCZJE-UHFFFAOYSA-N 0.000 description 1
- NIAMELKDNLLWRH-UHFFFAOYSA-N 2,4-difluoro-5-methylpyrimidine Chemical compound CC1=CN=C(F)N=C1F NIAMELKDNLLWRH-UHFFFAOYSA-N 0.000 description 1
- YKLOPWRWWFKUBX-UHFFFAOYSA-N 2,4-difluoro-6-methylpyrimidine Chemical compound CC1=CC(F)=NC(F)=N1 YKLOPWRWWFKUBX-UHFFFAOYSA-N 0.000 description 1
- HEAHMJLHQCESBZ-UHFFFAOYSA-N 2,5-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(N)C(S(O)(=O)=O)=C1 HEAHMJLHQCESBZ-UHFFFAOYSA-N 0.000 description 1
- PLVFHLAXDQSLCL-UHFFFAOYSA-N 2,6-dichloro-1h-triazin-4-amine Chemical compound NC1=NN(Cl)NC(Cl)=C1 PLVFHLAXDQSLCL-UHFFFAOYSA-N 0.000 description 1
- VYLHZPZYNPDQBR-UHFFFAOYSA-N 2,6-dichloro-4-(4-methylphenyl)-1h-triazine-5-thiol Chemical compound C1=CC(C)=CC=C1C1=NN(Cl)NC(Cl)=C1S VYLHZPZYNPDQBR-UHFFFAOYSA-N 0.000 description 1
- AMBBZHXGKGNTMI-UHFFFAOYSA-N 2,6-dichloro-4-ethoxy-1h-triazine Chemical compound CCOC1=NN(Cl)NC(Cl)=C1 AMBBZHXGKGNTMI-UHFFFAOYSA-N 0.000 description 1
- NNZQKAANXSXDNP-UHFFFAOYSA-N 2,6-dichloro-4-ethylsulfanyl-1h-triazine Chemical compound CCSC1=NN(Cl)NC(Cl)=C1 NNZQKAANXSXDNP-UHFFFAOYSA-N 0.000 description 1
- IOXIFBCDVPDGJV-UHFFFAOYSA-N 2,6-dichloro-4-methoxy-1h-triazine Chemical compound COC1=NN(Cl)NC(Cl)=C1 IOXIFBCDVPDGJV-UHFFFAOYSA-N 0.000 description 1
- DLMSWGCJMRVWCD-UHFFFAOYSA-N 2,6-dichloro-4-phenoxy-1h-triazine Chemical compound ClN1NC(Cl)=CC(OC=2C=CC=CC=2)=N1 DLMSWGCJMRVWCD-UHFFFAOYSA-N 0.000 description 1
- WFJGZGDYFGUMCA-UHFFFAOYSA-N 2,6-difluoropyrimidine-4-carbonitrile Chemical compound FC1=CC(C#N)=NC(F)=N1 WFJGZGDYFGUMCA-UHFFFAOYSA-N 0.000 description 1
- IDDLHNUKISKRRT-UHFFFAOYSA-N 2-(4-chloro-6-methylpyrimidin-2-yl)sulfonylethanesulfonic acid Chemical compound CC1=CC(Cl)=NC(S(=O)(=O)CCS(O)(=O)=O)=N1 IDDLHNUKISKRRT-UHFFFAOYSA-N 0.000 description 1
- GSCQMQCAMLKDEI-UHFFFAOYSA-N 2-(benzenesulfonyl)-4-chloropyrimidine Chemical compound ClC1=CC=NC(S(=O)(=O)C=2C=CC=CC=2)=N1 GSCQMQCAMLKDEI-UHFFFAOYSA-N 0.000 description 1
- WCBVOPMSONYWEB-UHFFFAOYSA-N 2-aminoacetyl chloride Chemical compound NCC(Cl)=O WCBVOPMSONYWEB-UHFFFAOYSA-N 0.000 description 1
- ZXTHWIZHGLNEPG-UHFFFAOYSA-N 2-phenyl-4,5-dihydro-1,3-oxazole Chemical compound O1CCN=C1C1=CC=CC=C1 ZXTHWIZHGLNEPG-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- AGIJRRREJXSQJR-UHFFFAOYSA-N 2h-thiazine Chemical compound N1SC=CC=C1 AGIJRRREJXSQJR-UHFFFAOYSA-N 0.000 description 1
- QPZGKMLYCRNKCK-UHFFFAOYSA-N 3-(benzenesulfonyl)propanoyl chloride Chemical compound ClC(=O)CCS(=O)(=O)C1=CC=CC=C1 QPZGKMLYCRNKCK-UHFFFAOYSA-N 0.000 description 1
- NYSDPBMBAHKMFA-UHFFFAOYSA-N 3-[2-[2-(3-aminophenoxy)ethylsulfonyl]ethoxy]aniline Chemical compound NC1=CC=CC(OCCS(=O)(=O)CCOC=2C=C(N)C=CC=2)=C1 NYSDPBMBAHKMFA-UHFFFAOYSA-N 0.000 description 1
- SPKNJYDIRCHCHG-UHFFFAOYSA-N 3-bromo-2,4,6-trifluoropyridine Chemical compound FC1=CC(F)=C(Br)C(F)=N1 SPKNJYDIRCHCHG-UHFFFAOYSA-N 0.000 description 1
- QIMCIIVGSIZXFU-UHFFFAOYSA-N 3-chloroquinoxaline-2-carbonyl chloride Chemical compound C1=CC=C2N=C(Cl)C(C(=O)Cl)=NC2=C1 QIMCIIVGSIZXFU-UHFFFAOYSA-N 0.000 description 1
- XJCVRTZCHMZPBD-UHFFFAOYSA-N 3-nitroaniline Chemical compound NC1=CC=CC([N+]([O-])=O)=C1 XJCVRTZCHMZPBD-UHFFFAOYSA-N 0.000 description 1
- TVFFVYDLWNCZBH-UHFFFAOYSA-N 4,5-dichloro-2-ethylsulfonyl-6-methylpyrimidine Chemical compound CCS(=O)(=O)C1=NC(C)=C(Cl)C(Cl)=N1 TVFFVYDLWNCZBH-UHFFFAOYSA-N 0.000 description 1
- YJPYVNMIARMZEK-UHFFFAOYSA-N 4,5-dichloro-6-(chloromethyl)-2-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=NC(Cl)=C(Cl)C(CCl)=N1 YJPYVNMIARMZEK-UHFFFAOYSA-N 0.000 description 1
- FBDGJZXFKQZWLX-UHFFFAOYSA-N 4,6-bis(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=CC(S(C)(=O)=O)=NC=N1 FBDGJZXFKQZWLX-UHFFFAOYSA-N 0.000 description 1
- DROUVIKCNOHKBA-UHFFFAOYSA-N 4,6-dichloro-2-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=NC(Cl)=CC(Cl)=N1 DROUVIKCNOHKBA-UHFFFAOYSA-N 0.000 description 1
- SLCUSSPKUGKMGA-UHFFFAOYSA-N 4-bromo-2,6-difluoropyrimidine Chemical compound FC1=CC(Br)=NC(F)=N1 SLCUSSPKUGKMGA-UHFFFAOYSA-N 0.000 description 1
- VJMKIDUNVPFBOB-UHFFFAOYSA-N 4-chloro-2,6-difluoro-5-methylpyrimidine Chemical compound CC1=C(F)N=C(F)N=C1Cl VJMKIDUNVPFBOB-UHFFFAOYSA-N 0.000 description 1
- BWVZLXTZQHILRC-UHFFFAOYSA-N 4-chloro-2-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=NC=CC(Cl)=N1 BWVZLXTZQHILRC-UHFFFAOYSA-N 0.000 description 1
- NDHIIWMVAUTCNX-UHFFFAOYSA-N 4-chloro-2-methylsulfonylpyrimidine-5-sulfonic acid Chemical compound CS(=O)(=O)C1=NC=C(S(O)(=O)=O)C(Cl)=N1 NDHIIWMVAUTCNX-UHFFFAOYSA-N 0.000 description 1
- KKQNFFCRRVCNJP-UHFFFAOYSA-N 4-chloro-6-methoxy-2-methylsulfonylpyrimidine-5-carbonitrile Chemical compound COC1=NC(S(C)(=O)=O)=NC(Cl)=C1C#N KKQNFFCRRVCNJP-UHFFFAOYSA-N 0.000 description 1
- WGNKUINKIVFGBC-UHFFFAOYSA-N 4-chloro-6-methyl-2-methylsulfonyl-5-nitropyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(Cl)=C1[N+]([O-])=O WGNKUINKIVFGBC-UHFFFAOYSA-N 0.000 description 1
- BYJUMOSWVALFCO-UHFFFAOYSA-N 4-chloro-6-methyl-2-methylsulfonylpyrimidine-5-sulfonyl chloride Chemical compound CC1=NC(S(C)(=O)=O)=NC(Cl)=C1S(Cl)(=O)=O BYJUMOSWVALFCO-UHFFFAOYSA-N 0.000 description 1
- LNJVTFNEAPYZIU-UHFFFAOYSA-N 4-chloro-6-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=CC(Cl)=NC=N1 LNJVTFNEAPYZIU-UHFFFAOYSA-N 0.000 description 1
- UYCCTQPHCSKTTN-UHFFFAOYSA-N 4-methyl-2,6-bis(methylsulfonyl)pyrimidine Chemical compound CC1=CC(S(C)(=O)=O)=NC(S(C)(=O)=O)=N1 UYCCTQPHCSKTTN-UHFFFAOYSA-N 0.000 description 1
- WZAGWFIDIMWLIY-UHFFFAOYSA-N 4-methyl-3,6-bis(methylsulfonyl)pyridazine Chemical compound CC1=CC(S(C)(=O)=O)=NN=C1S(C)(=O)=O WZAGWFIDIMWLIY-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- FRSCGYMSBBDAKE-UHFFFAOYSA-N 5-(chloromethyl)-2,4,6-trifluoropyrimidine Chemical compound FC1=NC(F)=C(CCl)C(F)=N1 FRSCGYMSBBDAKE-UHFFFAOYSA-N 0.000 description 1
- GOYNRDSJTYLXBU-UHFFFAOYSA-N 5-chloro-2,4,6-trifluoropyrimidine Chemical compound FC1=NC(F)=C(Cl)C(F)=N1 GOYNRDSJTYLXBU-UHFFFAOYSA-N 0.000 description 1
- HLWJZTCAFDZNCD-UHFFFAOYSA-N 5-chloro-2,4,6-tris(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=NC(S(C)(=O)=O)=C(Cl)C(S(C)(=O)=O)=N1 HLWJZTCAFDZNCD-UHFFFAOYSA-N 0.000 description 1
- RMULVUFPLMJWOK-UHFFFAOYSA-N 5-chloro-2,4-difluoro-6-methylpyrimidine Chemical compound CC1=NC(F)=NC(F)=C1Cl RMULVUFPLMJWOK-UHFFFAOYSA-N 0.000 description 1
- XZSZSTCLQANXKU-UHFFFAOYSA-N 5-chloro-2,4-difluoropyrimidine Chemical compound FC1=NC=C(Cl)C(F)=N1 XZSZSTCLQANXKU-UHFFFAOYSA-N 0.000 description 1
- FCMIDLUGAKOJNR-UHFFFAOYSA-N 5-chloro-4-methyl-2,6-bis(methylsulfonyl)pyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(S(C)(=O)=O)=C1Cl FCMIDLUGAKOJNR-UHFFFAOYSA-N 0.000 description 1
- 125000004008 6 membered carbocyclic group Chemical group 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 1
- QEIQEORTEYHSJH-UHFFFAOYSA-N Armin Natural products C1=CC(=O)OC2=C(O)C(OCC(CCO)C)=CC=C21 QEIQEORTEYHSJH-UHFFFAOYSA-N 0.000 description 1
- QBHRKOXWQPJDIE-UHFFFAOYSA-N C1=CC=CC=2C=CC=3OC=4C=CC=CC4C(C3C21)C(=O)OC(=O)C2C=1C3=C(C=CC1OC=1C=CC=CC21)C=CC=C3 Chemical compound C1=CC=CC=2C=CC=3OC=4C=CC=CC4C(C3C21)C(=O)OC(=O)C2C=1C3=C(C=CC1OC=1C=CC=CC21)C=CC=C3 QBHRKOXWQPJDIE-UHFFFAOYSA-N 0.000 description 1
- NRNHMWDFFNINFO-UHFFFAOYSA-N COC(C=C(C=CC1=C2CC(C=CC=C3)=C3O1)C2=C1C(O2)=O)=C1C2=O Chemical compound COC(C=C(C=CC1=C2CC(C=CC=C3)=C3O1)C2=C1C(O2)=O)=C1C2=O NRNHMWDFFNINFO-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 229940072056 alginate Drugs 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- GEKOHRZGXRUJIN-UHFFFAOYSA-N chloromethane;sulfurochloridic acid Chemical compound ClC.OS(Cl)(=O)=O GEKOHRZGXRUJIN-UHFFFAOYSA-N 0.000 description 1
- WCZVZNOTHYJIEI-UHFFFAOYSA-N cinnoline Chemical compound N1=NC=CC2=CC=CC=C21 WCZVZNOTHYJIEI-UHFFFAOYSA-N 0.000 description 1
- CSEBQCRCMWJLGU-UHFFFAOYSA-N ctk8g9296 Chemical compound C1=CC2=CC=C3SC4=CC=CC=C4CC3=C2C2=C1C(=O)OC2=O CSEBQCRCMWJLGU-UHFFFAOYSA-N 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 150000004891 diazines Chemical class 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000004982 dihaloalkyl group Chemical group 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- AFOSIXZFDONLBT-UHFFFAOYSA-N divinyl sulfone Chemical compound C=CS(=O)(=O)C=C AFOSIXZFDONLBT-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- ZOOODBUHSVUZEM-UHFFFAOYSA-N ethoxymethanedithioic acid Chemical compound CCOC(S)=S ZOOODBUHSVUZEM-UHFFFAOYSA-N 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical class F* 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-O hydrazinium(1+) Chemical compound [NH3+]N OAKJQQAXSVQMHS-UHFFFAOYSA-O 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- YSEQKGHEMQCJCC-UHFFFAOYSA-N methyl 2,6-difluoropyrimidine-4-carboxylate Chemical compound COC(=O)C1=CC(F)=NC(F)=N1 YSEQKGHEMQCJCC-UHFFFAOYSA-N 0.000 description 1
- YIROBCYPXUTGAN-UHFFFAOYSA-N methyl 5-chloro-2,6-difluoropyrimidine-4-carboxylate Chemical compound COC(=O)C1=NC(F)=NC(F)=C1Cl YIROBCYPXUTGAN-UHFFFAOYSA-N 0.000 description 1
- FSQBCNBFHWRUGG-UHFFFAOYSA-N methyl 6-chloro-2-methylsulfonylpyrimidine-4-carboxylate Chemical compound COC(=O)C1=CC(Cl)=NC(S(C)(=O)=O)=N1 FSQBCNBFHWRUGG-UHFFFAOYSA-N 0.000 description 1
- PQIOSYKVBBWRRI-UHFFFAOYSA-N methylphosphonyl difluoride Chemical group CP(F)(F)=O PQIOSYKVBBWRRI-UHFFFAOYSA-N 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- RDOWQLZANAYVLL-UHFFFAOYSA-N phenanthridine Chemical group C1=CC=C2C3=CC=CC=C3C=NC2=C1 RDOWQLZANAYVLL-UHFFFAOYSA-N 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 239000002964 rayon Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000000985 reactive dye Substances 0.000 description 1
- 239000001044 red dye Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- JBJWASZNUJCEKT-UHFFFAOYSA-M sodium;hydroxide;hydrate Chemical compound O.[OH-].[Na+] JBJWASZNUJCEKT-UHFFFAOYSA-M 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- SEEPANYCNGTZFQ-UHFFFAOYSA-N sulfadiazine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)NC1=NC=CC=N1 SEEPANYCNGTZFQ-UHFFFAOYSA-N 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 230000019635 sulfation Effects 0.000 description 1
- 238000005670 sulfation reaction Methods 0.000 description 1
- BUUPQKDIAURBJP-UHFFFAOYSA-N sulfinic acid Chemical compound OS=O BUUPQKDIAURBJP-UHFFFAOYSA-N 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical class OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000003245 working effect Effects 0.000 description 1
- 239000012991 xanthate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B57/00—Other synthetic dyes of known constitution
- C09B57/14—Benzoxanthene dyes; Benzothioxanthene dyes
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/002—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the linkage of the reactive group being alternatively specified
- C09B62/0025—Specific dyes not provided for in groups C09B62/004 - C09B62/018
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE785792D BE785792A (fr) | 1971-07-02 | Colorants xantheniques reactifs et leur preparation | |
| DE2132963A DE2132963C3 (de) | 1971-07-02 | 1971-07-02 | Wasserlösliche, reaktive Xanthenfarbstoffe, ihre Herstellung und ihre Verwendung |
| CH978472A CH559279A (enExample) | 1971-07-02 | 1972-06-29 | |
| CH978472D CH978472A4 (enExample) | 1971-07-02 | 1972-06-29 | |
| US267958A US3888862A (en) | 1971-07-02 | 1972-06-30 | Water-soluble reactive xanthene dyestuffs and process for preparing them |
| JP47065097A JPS5828302B1 (enExample) | 1971-07-02 | 1972-06-30 | |
| GB3073772A GB1392253A (en) | 1971-07-02 | 1972-06-30 | Water-soluble reactive benzoxanthene and benzothioxanthene dyestuffs and process for preparing them |
| IT26487/72A IT956997B (it) | 1971-07-02 | 1972-06-30 | Coloranti xantenici idrosolubili reattivi e processo per la loro preparazione |
| FR7223994A FR2144737B1 (enExample) | 1971-07-02 | 1972-07-03 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2132963A DE2132963C3 (de) | 1971-07-02 | 1971-07-02 | Wasserlösliche, reaktive Xanthenfarbstoffe, ihre Herstellung und ihre Verwendung |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2132963A1 DE2132963A1 (de) | 1973-01-18 |
| DE2132963B2 DE2132963B2 (de) | 1980-04-24 |
| DE2132963C3 true DE2132963C3 (de) | 1981-01-15 |
Family
ID=5812494
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2132963A Expired DE2132963C3 (de) | 1971-07-02 | 1971-07-02 | Wasserlösliche, reaktive Xanthenfarbstoffe, ihre Herstellung und ihre Verwendung |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3888862A (enExample) |
| JP (1) | JPS5828302B1 (enExample) |
| BE (1) | BE785792A (enExample) |
| CH (2) | CH559279A (enExample) |
| DE (1) | DE2132963C3 (enExample) |
| FR (1) | FR2144737B1 (enExample) |
| GB (1) | GB1392253A (enExample) |
| IT (1) | IT956997B (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2446989C3 (de) * | 1974-10-02 | 1981-09-10 | Hoechst Ag, 6000 Frankfurt | Verfahren zum Färben und Bedrucken von synthetischen Polyamiden |
| DE2804530C2 (de) * | 1978-02-03 | 1986-04-30 | Hoechst Ag, 6230 Frankfurt | Verwendung von wasserlöslichen Benzoxanthenfarbstoffen für fluoreszierende Tinten |
| US4507146A (en) * | 1982-12-28 | 1985-03-26 | Ciba-Geigy Corporation | 2,4-Diamino-6-halo-5-trifluoromethylpyrimidines having herbicidal activity |
| DE69110701T2 (de) * | 1990-02-21 | 1996-04-11 | Hoechst Mitsubishi Kasei | Wasserunlösliche Naphthalimidfarbstoffe. |
| US5290931A (en) * | 1990-02-21 | 1994-03-01 | Hoechst Mitsubishi Kasei Co., Ltd. | Water-insoluble naphthalic acid imide dyestuffs |
| DE4216796A1 (de) * | 1992-05-21 | 1993-11-25 | Cassella Ag | Verfahren zur Herstellung von 4-(2-Aminophenylthio)- naphthalsäureanhydrid-Derivaten |
| DE10331178A1 (de) * | 2003-07-10 | 2005-02-17 | Dystar Textilfarben Gmbh & Co. Deutschland Kg | Tinten für digitalen Textildruck mit reaktiven gelben Fluoreszenzfarbstoffen |
| US9751789B2 (en) | 2012-12-28 | 2017-09-05 | Ecolab Usa Inc. | Fluorescent monomers and tagged treatment polymers containing same for use in industrial water systems |
| DE102017124041B4 (de) * | 2017-10-16 | 2022-12-15 | Joanneum Research Forschungsgesellschaft Mbh | Kopplung an Imidfarbstoffe und Verfahren zu deren Herstellung |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2096295A (en) * | 1934-07-14 | 1937-10-19 | Gen Aniline Works Inc | Dyestuffs capable of being chromed |
| BE507417A (enExample) * | 1950-01-09 | |||
| DE2017764C3 (de) * | 1970-04-14 | 1974-04-04 | Farbwerke Hoechst Ag, Vormals Meister Lucius & Bruening, 6000 Frankfurt | Benzoxanthen- und Benzothioxanthenfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung. Anmi Farbwerke Hoechst AG, vormals Meister Lucius & Brüning, 6000 Frankfurt |
-
0
- BE BE785792D patent/BE785792A/xx not_active IP Right Cessation
-
1971
- 1971-07-02 DE DE2132963A patent/DE2132963C3/de not_active Expired
-
1972
- 1972-06-29 CH CH978472A patent/CH559279A/xx not_active IP Right Cessation
- 1972-06-29 CH CH978472D patent/CH978472A4/xx unknown
- 1972-06-30 US US267958A patent/US3888862A/en not_active Expired - Lifetime
- 1972-06-30 JP JP47065097A patent/JPS5828302B1/ja active Granted
- 1972-06-30 GB GB3073772A patent/GB1392253A/en not_active Expired
- 1972-06-30 IT IT26487/72A patent/IT956997B/it active
- 1972-07-03 FR FR7223994A patent/FR2144737B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1392253A (en) | 1975-04-30 |
| IT956997B (it) | 1973-10-10 |
| CH978472A4 (enExample) | 1974-08-15 |
| CH559279A (enExample) | 1975-02-28 |
| JPS5828302B1 (enExample) | 1983-06-15 |
| US3888862A (en) | 1975-06-10 |
| DE2132963A1 (de) | 1973-01-18 |
| BE785792A (fr) | 1973-01-03 |
| FR2144737A1 (enExample) | 1973-02-16 |
| DE2132963B2 (de) | 1980-04-24 |
| FR2144737B1 (enExample) | 1976-05-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1644204A1 (de) | Reaktivfarbstoffe und Verfahren zu deren Herstellung | |
| DE2748965B2 (de) | Wasserlösliche Farbstoffe, Verfahren zu deren Herstellung, ihre Verwendung als faserreaktive Farbstoffe zum Färben und Bedrucken von Fasermaterialien | |
| DE2132963C3 (de) | Wasserlösliche, reaktive Xanthenfarbstoffe, ihre Herstellung und ihre Verwendung | |
| DE1117245B (de) | Verfahren zur Herstellung von Farbstoffen der Anthrachinonreihe | |
| EP0197418B1 (de) | Azoreaktivfarbstoffe | |
| DE1955849C3 (de) | Wasserlösliche, reaktive Xanthenfarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung zum Färben oder Bedrucken | |
| DE2114158A1 (de) | Reaktivfarbstoffe | |
| CH467838A (de) | Verfahren zur Herstellung metallfreier Azofarbstoffe | |
| EP0071168B1 (de) | Wasserlösliche Disazoverbindungen und neue Bis-(aminophenoxy)-äthan-Verbindungen mit faserreaktiven Gruppen als Tetrazokomponenten, Verfahren zur Herstellung dieser Verbindungen und Verwendung der Disazoverbindungen als Farbstoffe | |
| DE3717667A1 (de) | Wasserloesliche naphthyl-azo-pyrazolon-verbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe | |
| CH497512A (de) | Verfahren zur Herstellung von wasserlöslichen Monoazofarbstoffen | |
| DE3023855A1 (de) | Reaktivfarbstoffe, verfahren zu ihrer herstellung und ihre verwendung zum faerben und bedrucken hydroxylgruppenhaltiger oder stickstoffhaltiger fasermaterialien | |
| DE2515137A1 (de) | Azofarbstoffe, deren herstellung und verwendung | |
| DE2854481A1 (de) | Anthrachinon-reaktivfarbstoffe | |
| DE1644611C3 (de) | Anthrachinon-Reaktivfarbstoffe | |
| DE2161553C3 (de) | Wasserlösliche, faserreaktive Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von Leder, Wolle, Seide und Materialien aus Polyamid- oder Polyurethanfasern oder negativen oder regenerierten Cellulosefasern | |
| DE2161698C3 (de) | Wasserlösliche, faserreaktive Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von Leder, Wolle, Seide, Polyamidfasern, Polyurethanfasern, nativen oder regenerierten Cellulosefasern | |
| DE1644347C (de) | Verfahren zur Herstellung wasserlos licher, kupferhaltiger Reaktivfarbstoffe | |
| DE2848671A1 (de) | Reaktivfarbstoffe | |
| DE1544561A1 (de) | Reaktivfarbstoffe und Verfahren zu deren Herstellung | |
| DE1644374B1 (de) | Verfahren zur Herstellung von Reaktivfarbstoffen | |
| DE1644206A1 (de) | Reaktivfarbstoffe | |
| DE1544499B2 (de) | Reaktivfarbstoffe | |
| DE2064104B2 (de) | Wasserlösliche faserreaktive Azofarbstoffe, deren Metallkomplexverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von Seide, Wolle, Leder, synthetischen Polyamid- und Polyurethanfasern, regenerierten Proteinfasern, nativen oder regenerierten Cellulosefasern oder modifizierten AcrylnitrUfasermaterialien | |
| DE2015157B2 (de) | Anthrachinonfarbstoffe, deren herstellung und deren verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |