DE2129479A1 - Schlichte fuer Giessereiformen und Kerne - Google Patents
Schlichte fuer Giessereiformen und KerneInfo
- Publication number
- DE2129479A1 DE2129479A1 DE19712129479 DE2129479A DE2129479A1 DE 2129479 A1 DE2129479 A1 DE 2129479A1 DE 19712129479 DE19712129479 DE 19712129479 DE 2129479 A DE2129479 A DE 2129479A DE 2129479 A1 DE2129479 A1 DE 2129479A1
- Authority
- DE
- Germany
- Prior art keywords
- salt
- water
- pref
- soluble
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000003839 salts Chemical class 0.000 title claims abstract description 24
- 150000001735 carboxylic acids Chemical class 0.000 title claims abstract description 8
- 238000005266 casting Methods 0.000 title abstract description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 title description 5
- 239000011230 binding agent Substances 0.000 claims abstract description 28
- 229910052751 metal Inorganic materials 0.000 claims abstract description 23
- 239000002184 metal Substances 0.000 claims abstract description 23
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical class CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 claims abstract description 5
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims abstract description 4
- 239000002518 antifoaming agent Substances 0.000 claims abstract description 4
- 239000003755 preservative agent Substances 0.000 claims abstract description 4
- 239000011819 refractory material Substances 0.000 claims abstract description 4
- 239000003381 stabilizer Substances 0.000 claims abstract description 4
- 239000000080 wetting agent Substances 0.000 claims abstract description 4
- 235000011054 acetic acid Nutrition 0.000 claims abstract description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims abstract description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims abstract description 3
- 239000000470 constituent Substances 0.000 claims abstract description 3
- 235000019253 formic acid Nutrition 0.000 claims abstract description 3
- 235000014655 lactic acid Nutrition 0.000 claims abstract description 3
- -1 monocarboxylic acid salt Chemical class 0.000 claims abstract description 3
- 235000019260 propionic acid Nutrition 0.000 claims abstract description 3
- 239000000843 powder Substances 0.000 claims description 10
- 238000004513 sizing Methods 0.000 claims description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 6
- 229920003002 synthetic resin Polymers 0.000 claims description 6
- 239000000057 synthetic resin Substances 0.000 claims description 6
- 229920001353 Dextrin Polymers 0.000 claims description 4
- 239000004375 Dextrin Substances 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 150000001734 carboxylic acid salts Chemical class 0.000 claims description 4
- 235000019425 dextrin Nutrition 0.000 claims description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 4
- 239000010450 olivine Substances 0.000 claims description 4
- 229910052609 olivine Inorganic materials 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- 235000000346 sugar Nutrition 0.000 claims description 4
- 239000005995 Aluminium silicate Substances 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- 229920001800 Shellac Polymers 0.000 claims description 3
- 229920001807 Urea-formaldehyde Polymers 0.000 claims description 3
- 239000000654 additive Substances 0.000 claims description 3
- 229920000615 alginic acid Polymers 0.000 claims description 3
- 235000010443 alginic acid Nutrition 0.000 claims description 3
- 235000012211 aluminium silicate Nutrition 0.000 claims description 3
- 239000000440 bentonite Substances 0.000 claims description 3
- 229910000278 bentonite Inorganic materials 0.000 claims description 3
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 claims description 3
- 239000003292 glue Substances 0.000 claims description 3
- 239000010439 graphite Substances 0.000 claims description 3
- 229910002804 graphite Inorganic materials 0.000 claims description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 claims description 3
- 229920000609 methyl cellulose Polymers 0.000 claims description 3
- 239000001923 methylcellulose Substances 0.000 claims description 3
- 235000010981 methylcellulose Nutrition 0.000 claims description 3
- 235000013379 molasses Nutrition 0.000 claims description 3
- 239000000025 natural resin Substances 0.000 claims description 3
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 3
- 239000010453 quartz Substances 0.000 claims description 3
- 239000004208 shellac Substances 0.000 claims description 3
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 claims description 3
- 229940113147 shellac Drugs 0.000 claims description 3
- 235000013874 shellac Nutrition 0.000 claims description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 claims description 3
- 239000002699 waste material Substances 0.000 claims description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 2
- 235000012216 bentonite Nutrition 0.000 claims description 2
- 239000004310 lactic acid Substances 0.000 claims description 2
- 150000002763 monocarboxylic acids Chemical class 0.000 claims description 2
- 229920001568 phenolic resin Polymers 0.000 claims description 2
- 239000005011 phenolic resin Substances 0.000 claims description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims description 2
- 229920005989 resin Polymers 0.000 claims description 2
- 239000011347 resin Substances 0.000 claims description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 claims 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 claims 1
- 239000001768 carboxy methyl cellulose Substances 0.000 claims 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 claims 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 claims 1
- 150000002505 iron Chemical class 0.000 claims 1
- 159000000003 magnesium salts Chemical group 0.000 claims 1
- 150000002739 metals Chemical class 0.000 abstract description 5
- 150000001342 alkaline earth metals Chemical class 0.000 abstract description 2
- 229910052782 aluminium Inorganic materials 0.000 abstract description 2
- 229910052742 iron Inorganic materials 0.000 abstract description 2
- 239000002253 acid Substances 0.000 abstract 2
- 150000007513 acids Chemical class 0.000 abstract 1
- 239000011147 inorganic material Substances 0.000 abstract 1
- 239000011368 organic material Substances 0.000 abstract 1
- 238000004519 manufacturing process Methods 0.000 description 6
- 239000004927 clay Substances 0.000 description 5
- 235000013312 flour Nutrition 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 235000019353 potassium silicate Nutrition 0.000 description 3
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 229920000877 Melamine resin Polymers 0.000 description 2
- 239000004568 cement Substances 0.000 description 2
- 239000000571 coke Substances 0.000 description 2
- 238000010304 firing Methods 0.000 description 2
- 238000005058 metal casting Methods 0.000 description 2
- 229910052845 zircon Inorganic materials 0.000 description 2
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- VSGNNIFQASZAOI-UHFFFAOYSA-L calcium acetate Chemical compound [Ca+2].CC([O-])=O.CC([O-])=O VSGNNIFQASZAOI-UHFFFAOYSA-L 0.000 description 1
- 239000001639 calcium acetate Substances 0.000 description 1
- 235000011092 calcium acetate Nutrition 0.000 description 1
- 229960005147 calcium acetate Drugs 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000003110 molding sand Substances 0.000 description 1
- 229920003986 novolac Polymers 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B22—CASTING; POWDER METALLURGY
- B22C—FOUNDRY MOULDING
- B22C3/00—Selection of compositions for coating the surfaces of moulds, cores, or patterns
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Mold Materials And Core Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT545370A AT301059B (de) | 1970-06-17 | 1970-06-17 | Schlichte für Gießereiformen und Kerne |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2129479A1 true DE2129479A1 (de) | 1971-12-23 |
Family
ID=3575959
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712129479 Pending DE2129479A1 (de) | 1970-06-17 | 1971-06-14 | Schlichte fuer Giessereiformen und Kerne |
Country Status (3)
| Country | Link |
|---|---|
| AT (1) | AT301059B (enExample) |
| CH (1) | CH560564A5 (enExample) |
| DE (1) | DE2129479A1 (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2556995A1 (fr) * | 1983-12-23 | 1985-06-28 | Grunhain Elektromotorenwerk | Procede de moulage sous pression pour les metaux legers et leurs alliages |
| DE102005024207A1 (de) * | 2005-05-25 | 2006-11-30 | Ashland-Südchemie-Kernfest GmbH | Verfahren zur Trocknung von Wasserschlichten |
| DE102006028398A1 (de) * | 2006-06-19 | 2007-12-20 | Gerd Greve | Baustoff für brandschutztechnische Bauteile und Verfahren zur Herstellung eines derartigen Baustoffs sowie brandschutztechnisches Bauteil und Verfahren zur Herstellung desselben |
| DE102011115024A1 (de) * | 2011-10-07 | 2013-04-11 | Ask Chemicals Gmbh | Beschichtungsmassen für anorganische Gießformen und Kerne umfassend Ameisensäureester und deren Verwendung |
| US20140352910A1 (en) * | 2011-10-07 | 2014-12-04 | Ask Chemicals Gmbh | Coating compositions for inorganic casting molds and cores, containing salts, and use thereof |
-
1970
- 1970-06-17 AT AT545370A patent/AT301059B/de not_active IP Right Cessation
-
1971
- 1971-06-14 DE DE19712129479 patent/DE2129479A1/de active Pending
- 1971-06-17 CH CH887571A patent/CH560564A5/xx not_active IP Right Cessation
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2556995A1 (fr) * | 1983-12-23 | 1985-06-28 | Grunhain Elektromotorenwerk | Procede de moulage sous pression pour les metaux legers et leurs alliages |
| DE102005024207A1 (de) * | 2005-05-25 | 2006-11-30 | Ashland-Südchemie-Kernfest GmbH | Verfahren zur Trocknung von Wasserschlichten |
| DE102006028398A1 (de) * | 2006-06-19 | 2007-12-20 | Gerd Greve | Baustoff für brandschutztechnische Bauteile und Verfahren zur Herstellung eines derartigen Baustoffs sowie brandschutztechnisches Bauteil und Verfahren zur Herstellung desselben |
| DE102011115024A1 (de) * | 2011-10-07 | 2013-04-11 | Ask Chemicals Gmbh | Beschichtungsmassen für anorganische Gießformen und Kerne umfassend Ameisensäureester und deren Verwendung |
| WO2013050023A3 (de) * | 2011-10-07 | 2013-05-30 | Ask Chemicals Gmbh | Beschichtungsmassen für anorganische giessformen und kerne umfassend ameisensäureester und deren verwendung |
| US20140352910A1 (en) * | 2011-10-07 | 2014-12-04 | Ask Chemicals Gmbh | Coating compositions for inorganic casting molds and cores, containing salts, and use thereof |
Also Published As
| Publication number | Publication date |
|---|---|
| CH560564A5 (enExample) | 1975-04-15 |
| AT301059B (de) | 1972-08-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3212671C2 (de) | Feuerfeste kohlenstoffhaltige Steine und Verfahren zu deren Herstellung | |
| DE2048488A1 (de) | Feuerfeste Mischungen mit hydrauh scher Abbindung | |
| DE2615714A1 (de) | Formsandmassen fuer den metallguss | |
| DE1508668C3 (de) | Masse für hochwarmfeste Gießformen und -kerne | |
| DE1646945B1 (de) | Gemisch zur Herstellung feuerfester Massen auf der Basis von Magnesiumoxid | |
| DE2129479A1 (de) | Schlichte fuer Giessereiformen und Kerne | |
| DE3326270C2 (de) | Verfahren zur Herstellung eines feuerfesten Leichtsteines | |
| DE3105533C2 (de) | Trockenmasse zur Verwendung als Faserspritzmasse | |
| DE2231747B2 (de) | Feuerfeste masse, insbesondere stampfmasse | |
| DE3736680C1 (de) | Verfahren zur Herstellung von kohlenstoffgebundenen Feuerfestformteilen | |
| DE569426C (de) | Verfahren und Bindemittel zum Herstellen von Kern- und Formmassen fuer Giessereizwecke | |
| DE3105579A1 (de) | Verfahren zur herstellung von keramische fasern enthaltenden, koernigen, feuerbestaendigen oder feuerfesten materialien, nach dem verfahren hergestellte materialien und ihre verwendung | |
| DE2000708A1 (de) | Vorgeformte Kerne zum Giessen von UEbergangsmetallen der Gruppe IV des Periodensystems und Verfahren zu ihrer Herstellung | |
| DE670231C (de) | Verfahren zur Herstellung von keramischen Formkoerpern | |
| CH551818A (de) | Verfahren zur herstellung einer waessrigen fluessigkeit, die als bindemittel fuer eine giessformsandmischung geeignet ist. | |
| DE874202C (de) | Form- und Kernsandbindemittel | |
| DE897618C (de) | Bindemittel fuer Zementformmassen | |
| DE2518485A1 (de) | Bindemittel fuer giesserei-form- und kernmassen und verfahren zu seiner herstellung | |
| DE1433948A1 (de) | Keramische Zusammensetzungen | |
| DE1646456C3 (de) | Verfahren zur Herstellung einer feuerfesten Auskleidung | |
| DE929177C (de) | Verfahren zur Herstellung eines hochfeuerfesten keramischen Koerpers | |
| DE884622C (de) | Verfahren zur Herstellung dielektrisch hochwertiger keramischer Stoffe | |
| AT163659B (de) | Verfahren zur Herstellung von wasserdichten Tongeschirren in einem Brande | |
| DE746787C (de) | Gusswachse, insbesondere fuer zahnaerztlichez Zwecke | |
| DE2244928A1 (de) | Feuerfestes material |