DE2122703C3 - Vorrichtung zur Erzeugung und sichtbaren Darstellung von Bildmustern - Google Patents
Vorrichtung zur Erzeugung und sichtbaren Darstellung von BildmusternInfo
- Publication number
- DE2122703C3 DE2122703C3 DE2122703A DE2122703A DE2122703C3 DE 2122703 C3 DE2122703 C3 DE 2122703C3 DE 2122703 A DE2122703 A DE 2122703A DE 2122703 A DE2122703 A DE 2122703A DE 2122703 C3 DE2122703 C3 DE 2122703C3
- Authority
- DE
- Germany
- Prior art keywords
- solid particles
- particles
- collective
- container
- collectives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002245 particle Substances 0.000 claims description 136
- 239000011521 glass Substances 0.000 claims description 36
- 239000011324 bead Substances 0.000 claims description 31
- 239000007787 solid Substances 0.000 claims description 31
- 238000000034 method Methods 0.000 claims description 8
- 230000000704 physical effect Effects 0.000 claims description 7
- 238000011049 filling Methods 0.000 claims description 4
- 230000009969 flowable effect Effects 0.000 claims description 2
- 238000005204 segregation Methods 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 24
- 239000003973 paint Substances 0.000 description 23
- 239000000463 material Substances 0.000 description 20
- 239000007921 spray Substances 0.000 description 18
- 230000000694 effects Effects 0.000 description 16
- 239000011236 particulate material Substances 0.000 description 16
- 235000002639 sodium chloride Nutrition 0.000 description 16
- 239000003086 colorant Substances 0.000 description 11
- 150000003839 salts Chemical class 0.000 description 10
- 239000013618 particulate matter Substances 0.000 description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 239000011049 pearl Substances 0.000 description 7
- 239000005361 soda-lime glass Substances 0.000 description 7
- 241000167854 Bourreria succulenta Species 0.000 description 6
- 235000019693 cherries Nutrition 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- 239000013078 crystal Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 239000004793 Polystyrene Substances 0.000 description 4
- 239000005388 borosilicate glass Substances 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- 238000003384 imaging method Methods 0.000 description 4
- 229920003023 plastic Polymers 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000000853 adhesive Substances 0.000 description 3
- 230000001070 adhesive effect Effects 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 230000005284 excitation Effects 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 238000005755 formation reaction Methods 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- 238000009825 accumulation Methods 0.000 description 2
- 230000035508 accumulation Effects 0.000 description 2
- 230000001747 exhibiting effect Effects 0.000 description 2
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 2
- 239000010931 gold Substances 0.000 description 2
- 229910052737 gold Inorganic materials 0.000 description 2
- 239000008240 homogeneous mixture Substances 0.000 description 2
- 239000006249 magnetic particle Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 230000000717 retained effect Effects 0.000 description 2
- 238000013517 stratification Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 230000000007 visual effect Effects 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 241000872198 Serjania polyphylla Species 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 238000009500 colour coating Methods 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 150000001875 compounds Chemical group 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000005672 electromagnetic field Effects 0.000 description 1
- 239000005357 flat glass Substances 0.000 description 1
- 238000007667 floating Methods 0.000 description 1
- 238000009432 framing Methods 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 230000003760 hair shine Effects 0.000 description 1
- 239000008241 heterogeneous mixture Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000004020 luminiscence type Methods 0.000 description 1
- 239000000696 magnetic material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 230000001151 other effect Effects 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 238000005424 photoluminescence Methods 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000012256 powdered iron Substances 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 230000007261 regionalization Effects 0.000 description 1
- 239000012763 reinforcing filler Substances 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 239000012798 spherical particle Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B44—DECORATIVE ARTS
- B44F—SPECIAL DESIGNS OR PICTURES
- B44F5/00—Designs characterised by irregular areas, e.g. mottled patterns
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B44—DECORATIVE ARTS
- B44F—SPECIAL DESIGNS OR PICTURES
- B44F1/00—Designs or pictures characterised by special or unusual light effects
- B44F1/08—Designs or pictures characterised by special or unusual light effects characterised by colour effects
- B44F1/10—Changing, amusing, or secret pictures
Landscapes
- Toys (AREA)
- Overhead Projectors And Projection Screens (AREA)
- Paints Or Removers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US3546970A | 1970-05-07 | 1970-05-07 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2122703A1 DE2122703A1 (de) | 1971-12-02 |
| DE2122703B2 DE2122703B2 (de) | 1980-09-18 |
| DE2122703C3 true DE2122703C3 (de) | 1981-11-12 |
Family
ID=21882868
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2122703A Expired DE2122703C3 (de) | 1970-05-07 | 1971-05-07 | Vorrichtung zur Erzeugung und sichtbaren Darstellung von Bildmustern |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3692382A (enExample) |
| JP (1) | JPS5426936B1 (enExample) |
| DE (1) | DE2122703C3 (enExample) |
| FR (1) | FR2101426A5 (enExample) |
| GB (1) | GB1353821A (enExample) |
| HK (1) | HK36877A (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3964194A (en) * | 1975-01-22 | 1976-06-22 | Gugeler William G | Changeable color display device |
| US4215500A (en) * | 1977-08-15 | 1980-08-05 | Gordon Sharp | Visual display device |
| US4190312A (en) * | 1978-09-01 | 1980-02-26 | Bailey Lonnie E | Light display means |
| US4332096A (en) * | 1981-06-01 | 1982-06-01 | The Michael Kohner Corp. | Gravity flow display device |
| GB2117955B (en) * | 1982-03-27 | 1985-11-06 | David Alan Kent | Illuminated sign |
| GB2153577B (en) * | 1984-01-27 | 1988-01-27 | Metaplast Veb | Cuvette for carrying out and projecting chemical experiments |
| GB8520247D0 (en) * | 1985-08-13 | 1985-09-18 | Smithies G | Display devices |
| DE3703979A1 (de) * | 1987-02-10 | 1988-08-18 | Winter & Sohn Ernst | Darstellungsvorrichtung fuer edelsteinkoerner |
| DE3721644A1 (de) * | 1987-03-12 | 1988-09-29 | Hans Donner | Vorrichtung zur erzeugung von bildmustern |
| US5187889A (en) * | 1990-01-10 | 1993-02-23 | Kraselsky Louis J | Novelty scenic display item |
| AUPN278795A0 (en) * | 1995-05-05 | 1995-05-25 | Neumann, Gregory Carl Heinrich | Animated displays |
| DE19626878C2 (de) * | 1996-07-04 | 1999-08-19 | Holtkamp | Projektionssystem, bestehend aus einem bilderzeugenden Projektor und einer Projektionsfläche |
| JP3042752U (ja) * | 1997-04-22 | 1997-10-31 | 辻 輝子 | 万華鏡 |
| US5985379A (en) * | 1997-07-22 | 1999-11-16 | Franklin Mint Company | Decorative display plate |
| USD403982S (en) | 1997-07-22 | 1999-01-12 | Franklin Mint Company | Ornamental plate |
| FR2834668A1 (fr) * | 2002-01-15 | 2003-07-18 | Maurice Alexanian | Paysages mouvants de montagnes avec glaciers et neves, suggeres par ecoulement de sables, renouvellables indefiniment par retournement, et sans cesse differents |
| US7665418B2 (en) * | 2006-07-31 | 2010-02-23 | Church & Dwight Co., Inc. | Non color-transferable animal litter |
| US20110179682A1 (en) * | 2010-01-25 | 2011-07-28 | Cheng-Hsiung Lin | Flowing sand picture |
| US20120117835A1 (en) * | 2010-01-25 | 2012-05-17 | Cheng-Hsiung Lin | Sand-flowing picture device |
| CN103123091A (zh) * | 2013-02-20 | 2013-05-29 | 昆山宏凌电子有限公司 | 用于led光源的反光膜及制备方法 |
| DE102016119401A1 (de) * | 2015-10-30 | 2017-05-04 | Alfred Ewald | Hohlkörper mit attraktiven Bewegungseffekten |
| US20240058721A1 (en) * | 2022-06-24 | 2024-02-22 | Benjamin M. Yeh | Contained erupting powder stress relief toy |
| US20250041756A1 (en) * | 2023-08-03 | 2025-02-06 | Oriana Knox | Visual Stimulation Device |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1078008A (en) * | 1912-12-23 | 1913-11-11 | Turney G Stough | Kaleidoscope. |
| US1294967A (en) * | 1918-03-23 | 1919-02-18 | Anton Stabla | Kaleidoscope. |
| US1518204A (en) * | 1922-09-18 | 1924-12-09 | Addison S Husted | Kaleidoscope |
| US2297767A (en) * | 1941-11-07 | 1942-10-06 | Hunt Donovan Dewey | Electroautomatic advertising machine |
| US2762257A (en) * | 1954-03-11 | 1956-09-11 | Beguelin Andree | Apparatus for projecting kaleidoscopic images |
| FR1166190A (fr) * | 1957-02-07 | 1958-11-04 | Générateur d'images | |
| US3255661A (en) * | 1963-06-20 | 1966-06-14 | Marban Julian Gutierrez | Kaleidoscope device |
| US3383150A (en) * | 1965-08-11 | 1968-05-14 | Edgar A. Powers | Kaleidoscopic viewing device |
| US3358556A (en) * | 1966-10-05 | 1967-12-19 | Brown Mfg Company | Kaleidoscope projector |
| GB1251233A (enExample) * | 1967-11-18 | 1971-10-27 | ||
| US3535805A (en) * | 1968-04-26 | 1970-10-27 | Adam Peiperl | Display device |
-
1970
- 1970-05-07 US US35469A patent/US3692382A/en not_active Expired - Lifetime
-
1971
- 1971-05-06 FR FR7116446A patent/FR2101426A5/fr not_active Expired
- 1971-05-06 GB GB1356971*[A patent/GB1353821A/en not_active Expired
- 1971-05-07 DE DE2122703A patent/DE2122703C3/de not_active Expired
- 1971-05-07 JP JP3037171A patent/JPS5426936B1/ja active Pending
-
1977
- 1977-07-14 HK HK368/77A patent/HK36877A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1353821A (en) | 1974-05-22 |
| HK36877A (en) | 1977-07-22 |
| DE2122703A1 (de) | 1971-12-02 |
| JPS5426936B1 (enExample) | 1979-09-06 |
| US3692382A (en) | 1972-09-19 |
| FR2101426A5 (enExample) | 1972-03-31 |
| DE2122703B2 (de) | 1980-09-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2122703C3 (de) | Vorrichtung zur Erzeugung und sichtbaren Darstellung von Bildmustern | |
| DE1920405C3 (de) | Schaugerät | |
| DE2029463C3 (de) | Bildaufzeichnungs und/oder wieder gärvorrichtung | |
| DE2020808A1 (de) | Optisches Bauelement | |
| EP1904994A2 (de) | Verfahren zum mischen von farben in einem display | |
| DE1257043B (de) | Verfahren zum Herstellen von durchscheinenden Kunststoffmassen | |
| DE2455638A1 (de) | Vorrichtung zur erzeugung von aesthetischen effekten | |
| DE457649C (de) | Verfahren zur Erzielung von plastisch und raeumlich freischwebend erscheinenden, ein bewegliches Bild enthaltenden Darstellungen fuer Reklame- und Unterhaltungszwecke | |
| EP3162421B1 (de) | Hohlkörper mit attraktiven bewegungseffekten | |
| AT369571B (de) | Lichtgrafische reklametafel bzw. modell | |
| WO2001067931A2 (de) | Bildhalter mit magnet | |
| DE19626878C2 (de) | Projektionssystem, bestehend aus einem bilderzeugenden Projektor und einer Projektionsfläche | |
| DE2838277B2 (de) | Vorrichtung zur Beeinflussung der Leuchtdichte und/oder der Farbe eines Lichtstrahles | |
| DE148230C (enExample) | ||
| AT116268B (de) | Verfahren zur Erzeugung besonderer Effekte bei der Projektion von Hintergründen u. dgl. für Theater, Schaustellungen, Reklamen usw. | |
| DE961054C (de) | Leuchtzeichen, z.B. Buchstaben, Figuren, Bilder | |
| DE231363C (enExample) | ||
| DE487920C (de) | Verfahren zur Erzeugung von Bewegungsbildern | |
| DE704980C (de) | Bildschirm | |
| DE463863C (de) | Reklametransparent, auf dem durch einen um eine Lichtquelle sich drehenden Farbenzylinder Helligkeitswechsel erzeugt werden | |
| DE8513088U1 (de) | Verwandlungsbild zur Darstellung von veränderlichen landschaftsartigen Bildern mit Tiefenwirkung | |
| DE1155038B (de) | Buntglas-Bild | |
| DE2243668C3 (de) | Röntgenographisches Aufzeichnungsmaterial zur Herstellung mehrfarbiger Röntgenbilder | |
| DE458410C (de) | Verfahren zur Herstellung von Roentgenschirmen | |
| AT111333B (de) | Vorrichtung zur Erzielung von plastisch und räumlich freischwebend erscheinenden Bildwirkungen für Werbe- oder Unterhaltungszwecke. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |