DE2121996C3 - Dibasische Äther des 2,6- und 2,7-Dihydroxyanthrachinons der Herstellung und pharmazeutische Zubereitung - Google Patents
Dibasische Äther des 2,6- und 2,7-Dihydroxyanthrachinons der Herstellung und pharmazeutische ZubereitungInfo
- Publication number
- DE2121996C3 DE2121996C3 DE2121996A DE2121996A DE2121996C3 DE 2121996 C3 DE2121996 C3 DE 2121996C3 DE 2121996 A DE2121996 A DE 2121996A DE 2121996 A DE2121996 A DE 2121996A DE 2121996 C3 DE2121996 C3 DE 2121996C3
- Authority
- DE
- Germany
- Prior art keywords
- bis
- anthraquinone
- water
- solution
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000002170 ethers Chemical class 0.000 title claims description 11
- 238000004519 manufacturing process Methods 0.000 title description 5
- 239000000825 pharmaceutical preparation Substances 0.000 title description 2
- 150000004365 2,7-dihydroxyanthraquinones Chemical class 0.000 title 1
- RZTIWMXQXBQJNE-UHFFFAOYSA-N isoanthraflavin Chemical compound C1=C(O)C=C2C(=O)C3=CC(O)=CC=C3C(=O)C2=C1 RZTIWMXQXBQJNE-UHFFFAOYSA-N 0.000 claims description 6
- 239000000203 mixture Substances 0.000 description 41
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 40
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 40
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- 150000001875 compounds Chemical class 0.000 description 36
- 239000000243 solution Substances 0.000 description 35
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 29
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- 238000000034 method Methods 0.000 description 23
- APAJFZPFBHMFQR-UHFFFAOYSA-N anthraflavic acid Chemical compound OC1=CC=C2C(=O)C3=CC(O)=CC=C3C(=O)C2=C1 APAJFZPFBHMFQR-UHFFFAOYSA-N 0.000 description 20
- 238000003756 stirring Methods 0.000 description 20
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- -1 alkyl radical Chemical class 0.000 description 18
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 15
- 239000008096 xylene Substances 0.000 description 15
- 150000004056 anthraquinones Chemical class 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 13
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 12
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- 239000002585 base Substances 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 241000700605 Viruses Species 0.000 description 9
- 150000001412 amines Chemical class 0.000 description 9
- 238000009835 boiling Methods 0.000 description 9
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 9
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 9
- 238000002360 preparation method Methods 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- 208000015181 infectious disease Diseases 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 7
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 7
- 150000004820 halides Chemical class 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- RGCKGOZRHPZPFP-UHFFFAOYSA-N Alizarin Natural products C1=CC=C2C(=O)C3=C(O)C(O)=CC=C3C(=O)C2=C1 RGCKGOZRHPZPFP-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- KKZJGLLVHKMTCM-UHFFFAOYSA-N mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 description 6
- 229960001156 mitoxantrone Drugs 0.000 description 6
- 230000008569 process Effects 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 5
- 239000012429 reaction media Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- OJDMSIRBUMIBJX-UHFFFAOYSA-N 2,6-bis(2-chloroethoxy)anthracene-9,10-dione Chemical compound ClCCOC1=CC=C2C(=O)C3=CC(OCCCl)=CC=C3C(=O)C2=C1 OJDMSIRBUMIBJX-UHFFFAOYSA-N 0.000 description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- IQFVPQOLBLOTPF-HKXUKFGYSA-L congo red Chemical compound [Na+].[Na+].C1=CC=CC2=C(N)C(/N=N/C3=CC=C(C=C3)C3=CC=C(C=C3)/N=N/C3=C(C4=CC=CC=C4C(=C3)S([O-])(=O)=O)N)=CC(S([O-])(=O)=O)=C21 IQFVPQOLBLOTPF-HKXUKFGYSA-L 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 230000002401 inhibitory effect Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- CPEONABTMRSIKA-UHFFFAOYSA-N 1,4$l^{2}-oxazinane Chemical compound C1COCC[N]1 CPEONABTMRSIKA-UHFFFAOYSA-N 0.000 description 3
- KLCGAKGJFWQHFM-UHFFFAOYSA-N 2,6-bis[2-(ethylamino)ethoxy]anthracene-9,10-dione Chemical compound CCNCCOC1=CC=C2C(=O)C3=CC(OCCNCC)=CC=C3C(=O)C2=C1 KLCGAKGJFWQHFM-UHFFFAOYSA-N 0.000 description 3
- YMDNODNLFSHHCV-UHFFFAOYSA-N 2-chloro-n,n-diethylethanamine Chemical compound CCN(CC)CCCl YMDNODNLFSHHCV-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 239000003849 aromatic solvent Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000002026 chloroform extract Substances 0.000 description 3
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 3
- 125000001033 ether group Chemical group 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 229910000039 hydrogen halide Inorganic materials 0.000 description 3
- 239000012433 hydrogen halide Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- IBYHHJPAARCAIE-UHFFFAOYSA-N 1-bromo-2-chloroethane Chemical compound ClCCBr IBYHHJPAARCAIE-UHFFFAOYSA-N 0.000 description 2
- GBBBFMTZXTZGDW-UHFFFAOYSA-N 2,6-bis(2-aminoethoxy)anthracene-9,10-dione Chemical compound NCCOC1=CC=C2C(=O)C3=CC(OCCN)=CC=C3C(=O)C2=C1 GBBBFMTZXTZGDW-UHFFFAOYSA-N 0.000 description 2
- KVISEQPUAZHDEP-UHFFFAOYSA-N 2,6-bis[2-(diethylamino)ethoxy]anthracene-9,10-dione;dihydrochloride Chemical compound [Cl-].[Cl-].CC[NH+](CC)CCOC1=CC=C2C(=O)C3=CC(OCC[NH+](CC)CC)=CC=C3C(=O)C2=C1 KVISEQPUAZHDEP-UHFFFAOYSA-N 0.000 description 2
- JAGSBDQUCXUHPP-UHFFFAOYSA-N 2,6-bis[3-(diethylamino)propoxy]anthracene-9,10-dione;dihydrochloride Chemical compound Cl.Cl.CCN(CC)CCCOC1=CC=C2C(=O)C3=CC(OCCCN(CC)CC)=CC=C3C(=O)C2=C1 JAGSBDQUCXUHPP-UHFFFAOYSA-N 0.000 description 2
- VXXLLFRFPHKWIS-UHFFFAOYSA-N 2,7-bis(2-chloroethoxy)anthracene-9,10-dione Chemical compound C1=C(OCCCl)C=C2C(=O)C3=CC(OCCCl)=CC=C3C(=O)C2=C1 VXXLLFRFPHKWIS-UHFFFAOYSA-N 0.000 description 2
- TWVBIQMXFNPRGH-UHFFFAOYSA-N 2,7-bis[2-(ethylamino)ethoxy]anthracene-9,10-dione Chemical compound C1=C(OCCNCC)C=C2C(=O)C3=CC(OCCNCC)=CC=C3C(=O)C2=C1 TWVBIQMXFNPRGH-UHFFFAOYSA-N 0.000 description 2
- IPBRTIGIUOVNMH-UHFFFAOYSA-N 2-[2-[6-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-9,10-dioxoanthracen-2-yl]oxyethyl]isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCOC1=CC=C(C(=O)C=2C(=CC=C(OCCN3C(C4=CC=CC=C4C3=O)=O)C=2)C2=O)C2=C1 IPBRTIGIUOVNMH-UHFFFAOYSA-N 0.000 description 2
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 2
- RAGSWDIQBBZLLL-UHFFFAOYSA-N 2-chloroethyl(diethyl)azanium;chloride Chemical compound Cl.CCN(CC)CCCl RAGSWDIQBBZLLL-UHFFFAOYSA-N 0.000 description 2
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 2
- RZVHIXYEVGDQDX-UHFFFAOYSA-N 9,10-anthraquinone Chemical group C1=CC=C2C(=O)C3=CC=CC=C3C(=O)C2=C1 RZVHIXYEVGDQDX-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 208000009889 Herpes Simplex Diseases 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 241000709664 Picornaviridae Species 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- 206010046865 Vaccinia virus infection Diseases 0.000 description 2
- 241000700647 Variola virus Species 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- HUKJGKFEENPCBJ-UHFFFAOYSA-N anthracene-9,10-dione;dihydrochloride Chemical compound Cl.Cl.C1=CC=C2C(=O)C3=CC=CC=C3C(=O)C2=C1 HUKJGKFEENPCBJ-UHFFFAOYSA-N 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 150000004341 dihydroxyanthraquinones Chemical class 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 230000001717 pathogenic effect Effects 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- FYRHIOVKTDQVFC-UHFFFAOYSA-M potassium phthalimide Chemical compound [K+].C1=CC=C2C(=O)[N-]C(=O)C2=C1 FYRHIOVKTDQVFC-UHFFFAOYSA-M 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Inorganic materials [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 2
- 208000003265 stomatitis Diseases 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 241001529453 unidentified herpesvirus Species 0.000 description 2
- 208000007089 vaccinia Diseases 0.000 description 2
- 238000001291 vacuum drying Methods 0.000 description 2
- 208000005925 vesicular stomatitis Diseases 0.000 description 2
- HFVMEOPYDLEHBR-UHFFFAOYSA-N (2-fluorophenyl)-phenylmethanol Chemical compound C=1C=CC=C(F)C=1C(O)C1=CC=CC=C1 HFVMEOPYDLEHBR-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 1
- MWFVNDKKTXKOAZ-UHFFFAOYSA-N 1-(2-chloroethoxy)anthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2OCCCl MWFVNDKKTXKOAZ-UHFFFAOYSA-N 0.000 description 1
- WNRWEBKEQARBKV-UHFFFAOYSA-N 1-(2-chloroethyl)piperidine Chemical compound ClCCN1CCCCC1 WNRWEBKEQARBKV-UHFFFAOYSA-N 0.000 description 1
- RMGFLMXDCGQKPS-UHFFFAOYSA-N 1-(2-chloroethyl)pyrrolidine Chemical compound ClCCN1CCCC1 RMGFLMXDCGQKPS-UHFFFAOYSA-N 0.000 description 1
- KGLPWQKSKUVKMJ-UHFFFAOYSA-N 2,3-dihydrophthalazine-1,4-dione Chemical compound C1=CC=C2C(=O)NNC(=O)C2=C1 KGLPWQKSKUVKMJ-UHFFFAOYSA-N 0.000 description 1
- CZXLNSNTTDAVKE-UHFFFAOYSA-N 2,6-bis(2-hydroxyethoxy)anthracene-9,10-dione Chemical compound OCCOC1=CC=C2C(=O)C3=CC(OCCO)=CC=C3C(=O)C2=C1 CZXLNSNTTDAVKE-UHFFFAOYSA-N 0.000 description 1
- XLXLHJBFCBCIGA-UHFFFAOYSA-N 2,6-bis(2-morpholin-4-ylethoxy)anthracene-9,10-dione Chemical compound C1=C2C(=O)C3=CC=C(OCCN4CCOCC4)C=C3C(=O)C2=CC=C1OCCN1CCOCC1 XLXLHJBFCBCIGA-UHFFFAOYSA-N 0.000 description 1
- QFJVPMOBYFIOQY-UHFFFAOYSA-N 2,6-bis(2-piperidin-1-ylethoxy)anthracene-9,10-dione Chemical compound C1=C2C(=O)C3=CC=C(OCCN4CCCCC4)C=C3C(=O)C2=CC=C1OCCN1CCCCC1 QFJVPMOBYFIOQY-UHFFFAOYSA-N 0.000 description 1
- OEEDUNJMCZTXNA-UHFFFAOYSA-N 2,6-bis(2-pyrrolidin-1-ylethoxy)anthracene-9,10-dione Chemical compound C1=C2C(=O)C3=CC=C(OCCN4CCCC4)C=C3C(=O)C2=CC=C1OCCN1CCCC1 OEEDUNJMCZTXNA-UHFFFAOYSA-N 0.000 description 1
- YKBRAOGGIGQFHQ-UHFFFAOYSA-N 2,7-bis(2-aminoethoxy)anthracene-9,10-dione Chemical compound C1=C(OCCN)C=C2C(=O)C3=CC(OCCN)=CC=C3C(=O)C2=C1 YKBRAOGGIGQFHQ-UHFFFAOYSA-N 0.000 description 1
- LYERTTFICFKLII-UHFFFAOYSA-N 2,7-bis(2-morpholin-4-ylethoxy)anthracene-9,10-dione;dihydrochloride Chemical compound Cl.Cl.C1=C2C(=O)C3=CC(OCCN4CCOCC4)=CC=C3C(=O)C2=CC=C1OCCN1CCOCC1 LYERTTFICFKLII-UHFFFAOYSA-N 0.000 description 1
- VWOFCOMCOYCHMG-UHFFFAOYSA-N 2,7-bis(2-piperidin-1-ylethoxy)anthracene-9,10-dione Chemical compound C1=C2C(=O)C3=CC(OCCN4CCCCC4)=CC=C3C(=O)C2=CC=C1OCCN1CCCCC1 VWOFCOMCOYCHMG-UHFFFAOYSA-N 0.000 description 1
- MISYUGONGFFXAF-UHFFFAOYSA-N 2,7-bis(2-pyrrolidin-1-ylethoxy)anthracene-9,10-dione;dihydrochloride Chemical compound Cl.Cl.C1=C2C(=O)C3=CC(OCCN4CCCC4)=CC=C3C(=O)C2=CC=C1OCCN1CCCC1 MISYUGONGFFXAF-UHFFFAOYSA-N 0.000 description 1
- ANVYGEGFIOPHNR-UHFFFAOYSA-N 2,7-bis[2-(dimethylamino)ethoxy]anthracene-9,10-dione;dihydrochloride Chemical compound Cl.Cl.C1=C(OCCN(C)C)C=C2C(=O)C3=CC(OCCN(C)C)=CC=C3C(=O)C2=C1 ANVYGEGFIOPHNR-UHFFFAOYSA-N 0.000 description 1
- IOMZHTJQEDSWEL-UHFFFAOYSA-N 2,7-bis[3-(dimethylamino)propoxy]anthracene-9,10-dione;dihydrochloride Chemical compound Cl.Cl.C1=C(OCCCN(C)C)C=C2C(=O)C3=CC(OCCCN(C)C)=CC=C3C(=O)C2=C1 IOMZHTJQEDSWEL-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-L 2-(carboxymethyl)-2-hydroxysuccinate Chemical compound [O-]C(=O)CC(O)(C(=O)O)CC([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-L 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- LQLJZSJKRYTKTP-UHFFFAOYSA-N 2-dimethylaminoethyl chloride hydrochloride Chemical compound Cl.CN(C)CCCl LQLJZSJKRYTKTP-UHFFFAOYSA-N 0.000 description 1
- RQFUZUMFPRMVDX-UHFFFAOYSA-N 3-Bromo-1-propanol Chemical compound OCCCBr RQFUZUMFPRMVDX-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- WVUULNDRFBHTFG-UHFFFAOYSA-N 3-chloro-n,n-diethylpropan-1-amine Chemical compound CCN(CC)CCCCl WVUULNDRFBHTFG-UHFFFAOYSA-N 0.000 description 1
- LAMUXTNQCICZQX-UHFFFAOYSA-N 3-chloropropan-1-ol Chemical compound OCCCCl LAMUXTNQCICZQX-UHFFFAOYSA-N 0.000 description 1
- ZAPMTSHEXFEPSD-UHFFFAOYSA-N 4-(2-chloroethyl)morpholine Chemical compound ClCCN1CCOCC1 ZAPMTSHEXFEPSD-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 101150019028 Antp gene Proteins 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 244000276331 Citrus maxima Species 0.000 description 1
- 238000007022 Delepine synthesis reaction Methods 0.000 description 1
- 238000010466 Delépine reaction Methods 0.000 description 1
- 241000283073 Equus caballus Species 0.000 description 1
- 238000006824 Eschweiler-Clarke methylation reaction Methods 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Natural products OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 1
- 241000556189 Huso Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 241001500351 Influenzavirus A Species 0.000 description 1
- 241000710185 Mengo virus Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 241000348346 Suta Species 0.000 description 1
- 208000036142 Viral infection Diseases 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000000840 anti-viral effect Effects 0.000 description 1
- 239000003904 antiprotozoal agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000015895 biscuits Nutrition 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- XDGJPYMXPXATNG-UHFFFAOYSA-N chlorobenzene;toluene Chemical compound CC1=CC=CC=C1.ClC1=CC=CC=C1 XDGJPYMXPXATNG-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical class [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 description 1
- AINBZKYUNWUTRE-UHFFFAOYSA-N ethanol;propan-2-ol Chemical compound CCO.CC(C)O AINBZKYUNWUTRE-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 208000037798 influenza B Diseases 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- DBVADBHSJCWFKI-UHFFFAOYSA-N n-(2-chloroethyl)-n-propan-2-ylpropan-2-amine Chemical compound CC(C)N(C(C)C)CCCl DBVADBHSJCWFKI-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C46/00—Preparation of quinones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US3731270A | 1970-05-14 | 1970-05-14 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2121996A1 DE2121996A1 (de) | 1971-12-02 |
| DE2121996B2 DE2121996B2 (de) | 1981-06-04 |
| DE2121996C3 true DE2121996C3 (de) | 1982-04-01 |
Family
ID=21893666
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2121996A Expired DE2121996C3 (de) | 1970-05-14 | 1971-05-04 | Dibasische Äther des 2,6- und 2,7-Dihydroxyanthrachinons der Herstellung und pharmazeutische Zubereitung |
Country Status (20)
| Country | Link |
|---|---|
| JP (1) | JPS5636180B1 (enExample) |
| AR (1) | AR196475A1 (enExample) |
| AT (1) | AT314525B (enExample) |
| BE (1) | BE767201A (enExample) |
| CA (1) | CA956940A (enExample) |
| CH (3) | CH568960A5 (enExample) |
| CS (1) | CS171229B2 (enExample) |
| DE (1) | DE2121996C3 (enExample) |
| DK (1) | DK135801B (enExample) |
| ES (1) | ES391087A1 (enExample) |
| FR (1) | FR2100658B1 (enExample) |
| GB (1) | GB1299566A (enExample) |
| HU (1) | HU162642B (enExample) |
| IE (1) | IE35223B1 (enExample) |
| IL (1) | IL36727A0 (enExample) |
| NL (1) | NL7106689A (enExample) |
| NO (1) | NO133446C (enExample) |
| PH (1) | PH11301A (enExample) |
| SE (1) | SE378239B (enExample) |
| ZA (1) | ZA712539B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3838177A (en) * | 1972-12-21 | 1974-09-24 | Richardson Merrell Inc | Substituted 9,10-dihydroanthracenes |
| US3847953A (en) * | 1972-12-21 | 1974-11-12 | Richardson Merrell Inc | Anthraquinone derivatives |
| JPS5858793A (ja) * | 1981-10-05 | 1983-04-07 | 富士通テン株式会社 | プリント基板の余剰リ−ド線切断装置 |
| JPS5984895U (ja) * | 1982-11-30 | 1984-06-08 | 富士通株式会社 | プリント板のリ−ド切断装置 |
-
1971
- 1971-04-16 CA CA110,552A patent/CA956940A/en not_active Expired
- 1971-04-20 ZA ZA712539A patent/ZA712539B/xx unknown
- 1971-04-23 PH PH12394A patent/PH11301A/en unknown
- 1971-04-27 IL IL36727A patent/IL36727A0/xx unknown
- 1971-04-28 DK DK205471AA patent/DK135801B/da unknown
- 1971-04-30 CH CH644171A patent/CH568960A5/xx not_active IP Right Cessation
- 1971-04-30 CH CH876475A patent/CH576939A5/xx not_active IP Right Cessation
- 1971-04-30 CH CH876575A patent/CH576940A5/xx not_active IP Right Cessation
- 1971-05-04 AT AT387871A patent/AT314525B/de not_active IP Right Cessation
- 1971-05-04 DE DE2121996A patent/DE2121996C3/de not_active Expired
- 1971-05-11 SE SE7106074A patent/SE378239B/xx unknown
- 1971-05-12 CS CS3456A patent/CS171229B2/cs unknown
- 1971-05-12 ES ES391087A patent/ES391087A1/es not_active Expired
- 1971-05-12 HU HURI431A patent/HU162642B/hu unknown
- 1971-05-13 AR AR235518A patent/AR196475A1/es active
- 1971-05-13 JP JP3165371A patent/JPS5636180B1/ja active Pending
- 1971-05-13 NO NO1815/71A patent/NO133446C/no unknown
- 1971-05-13 GB GB04844/71A patent/GB1299566A/en not_active Expired
- 1971-05-14 IE IE613/71A patent/IE35223B1/xx unknown
- 1971-05-14 FR FR7117608A patent/FR2100658B1/fr not_active Expired
- 1971-05-14 NL NL7106689A patent/NL7106689A/xx unknown
- 1971-05-14 BE BE767201A patent/BE767201A/xx unknown
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| IE35223L (en) | 1971-11-14 |
| CH576940A5 (enExample) | 1976-06-30 |
| ZA712539B (en) | 1972-01-26 |
| PH11301A (en) | 1977-11-02 |
| BE767201A (fr) | 1971-10-01 |
| DK135801C (enExample) | 1977-11-28 |
| AR196475A1 (es) | 1974-02-06 |
| AT314525B (de) | 1974-04-10 |
| FR2100658B1 (enExample) | 1975-08-01 |
| DK135801B (da) | 1977-06-27 |
| NL7106689A (enExample) | 1971-11-16 |
| DE2121996A1 (de) | 1971-12-02 |
| GB1299566A (en) | 1972-12-13 |
| IL36727A0 (en) | 1971-06-23 |
| CH568960A5 (enExample) | 1975-11-14 |
| DE2121996B2 (de) | 1981-06-04 |
| ES391087A1 (es) | 1973-07-16 |
| CS171229B2 (enExample) | 1976-10-29 |
| NO133446B (enExample) | 1976-01-26 |
| FR2100658A1 (enExample) | 1972-03-24 |
| JPS5636180B1 (enExample) | 1981-08-22 |
| SE378239B (enExample) | 1975-08-25 |
| CH576939A5 (enExample) | 1976-06-30 |
| CA956940A (en) | 1974-10-29 |
| IE35223B1 (en) | 1975-12-10 |
| HU162642B (enExample) | 1973-03-28 |
| NO133446C (enExample) | 1976-05-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2157424C3 (de) | Therapeutisch wirksame N5N'disubstituierte cyclische Diamine und Verfahren zu deren Herstellung | |
| AT363096B (de) | Verfahren zur herstellung von neuen phthalazinderivaten und deren salzen | |
| DE1138779B (de) | Verfahren zur Herstellung von in der Aminogruppe substituierten 10-(Aminoalkyl)-trifluormethyl-phenthiazinderivaten. | |
| DE2065636A1 (de) | Neue tricyclische verbindungen | |
| DE2047658C3 (de) | 2-Styryl- und 2-Phenyläthinylbenzylaminderivate, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| DE2607305C2 (de) | 6-Oxo-6H-indeno[5,4-b]furan-2-carbonsäuren, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| AT368131B (de) | Verfahren zur herstellung von neuen 9-aminoalkyl- fluorenen und von deren salzen | |
| DE2316920B2 (de) | Benzo eckige klammer auf d eckige klammer zu eckige klammer auf 1,3 eckige klammer zu dioxolderivate, deren herstellung und diese enthaltende arzneimittel | |
| EP1233961B1 (de) | Verfahren zur herstellung von 5-(1-piperazinyl)-benzofuran-2-carboxamid durch übergansmetall-katalysierte aminierung | |
| DE2121996C3 (de) | Dibasische Äther des 2,6- und 2,7-Dihydroxyanthrachinons der Herstellung und pharmazeutische Zubereitung | |
| DE2303427C3 (de) | Dibenzo-(a,d)-cycloheptadiene und -triene, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| CH637107A5 (en) | Process for preparing novel 1-aryloxy-2-hydroxy-3-aminopropanes | |
| DE2609015A1 (de) | Verfahren zur herstellung von benz (f)-2,5-oxazocinen | |
| DE2540552A1 (de) | Cycloalkylderivate von 1-aryloxy-3- amino-2-propanolen | |
| CH635834A5 (de) | Dibenzo(d,g)(1,3,6)dioxazocin-derivate, verfahren zu ihrer herstellung und die diese verbindungen enthaltenden arzneimittelpraeparate. | |
| CH634545A5 (en) | 1-Phenyl-1-methoxy-2-aminoethane derivatives, and a process for their preparation | |
| CH627743A5 (de) | Verfahren zur herstellung neuer substituierter arylalkylamine. | |
| AT226723B (de) | Verfahren zur Umwandlung von Thiaxanthenen | |
| CH564513A5 (en) | Basically substd fluoranthene derivs - with antiviral activity | |
| AT345284B (de) | Verfahren zur herstellung von neuen naphthylenen und deren salzen | |
| DE2120996C3 (de) | Bis-basische Ketone des Dibenzothiophens, Verfahren zu deren Herstellung und ihre Verwendung bei der Bekämpfung von Virusinfektionen | |
| DE2427503B2 (de) | Halogenfusarsäureamide, Verfahren zur Herstellung derselben und Mittel mit einem Gehalt derselben | |
| AT228205B (de) | Verfahren zur Herstellung von basischen Phenothiazin-Derivaten, die in 3-Stellung mit einer einwertigen Schwefelfunktion substituiert sind | |
| AT358587B (de) | Verfahren zur herstellung von neuen 5-(1- hydroxy-2-subst.amino)-alkyl-8-substituierten carbostyryl- und 3,4-dihydrocarbostyryl- derivaten und ihren salzen | |
| DE1468138C3 (de) | Verfahren zur Herstellung von 10,11- Dihydrodibenzo [a,d] -cycloheptenen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |