DE2115186C3 - Verfahren zur Herstellung von Organo-H-silanen - Google Patents
Verfahren zur Herstellung von Organo-H-silanenInfo
- Publication number
- DE2115186C3 DE2115186C3 DE2115186A DE2115186A DE2115186C3 DE 2115186 C3 DE2115186 C3 DE 2115186C3 DE 2115186 A DE2115186 A DE 2115186A DE 2115186 A DE2115186 A DE 2115186A DE 2115186 C3 DE2115186 C3 DE 2115186C3
- Authority
- DE
- Germany
- Prior art keywords
- chj
- disilanes
- organo
- silanes
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 15
- 238000004519 manufacturing process Methods 0.000 title description 3
- 239000003054 catalyst Substances 0.000 claims description 13
- 229910052723 transition metal Inorganic materials 0.000 claims description 5
- -1 transition metal salt Chemical class 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- PZPGRFITIJYNEJ-UHFFFAOYSA-N disilane Chemical compound [SiH3][SiH3] PZPGRFITIJYNEJ-UHFFFAOYSA-N 0.000 claims description 3
- 230000001419 dependent effect Effects 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 230000007704 transition Effects 0.000 claims 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 11
- 101150003085 Pdcl gene Proteins 0.000 description 6
- 229910052763 palladium Inorganic materials 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 150000003624 transition metals Chemical class 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000000962 organic group Chemical group 0.000 description 2
- 229910052703 rhodium Inorganic materials 0.000 description 2
- 239000010948 rhodium Substances 0.000 description 2
- 229910052707 ruthenium Inorganic materials 0.000 description 2
- 229910000077 silane Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- YULFFYZCWUUTNC-YWPNNVDBSA-N (1r)-1-[(4r,4ar,8as)-2,6-bis(4-chlorophenyl)-4-methyl-8,8a-dihydro-4ah-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol Chemical compound C([C@@H]1OC(O[C@]([C@@H]1O1)(C)[C@H](O)CO)C=2C=CC(Cl)=CC=2)OC1C1=CC=C(Cl)C=C1 YULFFYZCWUUTNC-YWPNNVDBSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 229910020175 SiOH Inorganic materials 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- RQJRLVCBMAKXFG-UHFFFAOYSA-N phenyl(silyl)silane Chemical class [SiH3][SiH2]C1=CC=CC=C1 RQJRLVCBMAKXFG-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000011158 quantitative evaluation Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/0896—Compounds with a Si-H linkage
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US2344370A | 1970-03-27 | 1970-03-27 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2115186A1 DE2115186A1 (de) | 1971-10-14 |
| DE2115186B2 DE2115186B2 (de) | 1973-08-16 |
| DE2115186C3 true DE2115186C3 (de) | 1974-04-11 |
Family
ID=21815142
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2115186A Expired DE2115186C3 (de) | 1970-03-27 | 1971-03-29 | Verfahren zur Herstellung von Organo-H-silanen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3639105A (enExample) |
| BE (1) | BE764883A (enExample) |
| DE (1) | DE2115186C3 (enExample) |
| FR (1) | FR2085143A5 (enExample) |
| GB (1) | GB1285167A (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2342981A1 (fr) * | 1976-03-05 | 1977-09-30 | Rhone Poulenc Ind | Procede de preparation d'hydrogenosilanes |
| US4079071A (en) * | 1977-03-28 | 1978-03-14 | Union Carbide Corporation | Synthesis of hydrosilanes from methylchloropolysilanes |
| US4291167A (en) * | 1980-07-28 | 1981-09-22 | Nalco Chemical Company | Preparation of tetramethyldisilane from 1,2-tetramethyldichlorodisilane |
| US4973725A (en) * | 1988-06-28 | 1990-11-27 | Union Carbide Chemicals And Plastics Company Inc. | Direct synthesis process for organohalohydrosilanes |
| JPH0635466B2 (ja) * | 1988-09-28 | 1994-05-11 | 信越化学工業株式会社 | ジオルガノハロゲノシランの製造方法 |
| DE4134422A1 (de) * | 1991-10-17 | 1993-04-22 | Wacker Chemie Gmbh | Verfahren zur herstellung von methylchlorsilanen |
| US5175329A (en) * | 1992-04-03 | 1992-12-29 | Dow Corning Corporation | Production of organosilanes from polysilanes |
| US5326896A (en) * | 1993-07-14 | 1994-07-05 | Dow Corning Corporation | Conversion of direct process high-boiling component to silane monomers in the presence of hydrogen gas |
| US5292909A (en) * | 1993-07-14 | 1994-03-08 | Dow Corning Corporation | Catalytic conversion of direct process high-boiling component to chlorosilane monomers in the presence of hydrogen chloride and hydrogen |
| US5321147A (en) * | 1993-07-16 | 1994-06-14 | Dow Corning Corporation | Conversion of direct process high-boiling component to chlorosilane monomers in the presence of chlorine |
| US5292912A (en) * | 1993-07-19 | 1994-03-08 | Dow Corning Corporation | Catalytic conversion of direct process high-boiling component to chlorosilane monomers in the presence of hydrogen chloride |
| US5430168A (en) * | 1994-10-27 | 1995-07-04 | Dow Corning Corporation | Alumimum trichloride catalyzed hydrogenation of high-boiling residue from direct process |
| US5606090A (en) * | 1996-06-13 | 1997-02-25 | Dow Corning Corporation | Conversion of high-boiling residue from direct process to monosilanes |
| US5907050A (en) * | 1998-09-30 | 1999-05-25 | Dow Corning Corporation | Process for converting polymeric silicon containing compounds to monosilanes |
| US5922894A (en) * | 1998-10-28 | 1999-07-13 | Dow Corning Corporation | Process for converting polymeric silicon containing compounds to monosilanes |
| US6013824A (en) * | 1998-12-01 | 2000-01-11 | Dow Corning Corporation | Redistributing silalkylenes in an alkyl-rich silalkylene-containing residue |
| US6013235A (en) * | 1999-07-19 | 2000-01-11 | Dow Corning Corporation | Conversion of direct process high-boiling residue to monosilanes |
| DE102007055732A1 (de) | 2007-12-07 | 2008-12-24 | Wacker Chemie Ag | Verfahren zur Herstellung von Silanen aus Dislanen |
| US8697901B2 (en) | 2011-12-30 | 2014-04-15 | Momentive Performance Materials Inc. | Synthesis of organohalosilane monomers via enhanced cleavage of direct process residue |
| US8637695B2 (en) | 2011-12-30 | 2014-01-28 | Momentive Performance Materials Inc. | Synthesis of organohalosilane monomers from conventionally uncleavable Direct Process Residue |
| CN116854722A (zh) * | 2023-05-10 | 2023-10-10 | 研峰科技(北京)有限公司 | 一种二苯基硅烷的制备工艺 |
-
1970
- 1970-03-27 US US23443A patent/US3639105A/en not_active Expired - Lifetime
-
1971
- 1971-03-25 FR FR7110595A patent/FR2085143A5/fr not_active Expired
- 1971-03-26 BE BE764883A patent/BE764883A/xx not_active IP Right Cessation
- 1971-03-29 DE DE2115186A patent/DE2115186C3/de not_active Expired
- 1971-04-19 GB GB22684/71A patent/GB1285167A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2085143A5 (enExample) | 1971-12-17 |
| GB1285167A (en) | 1972-08-09 |
| DE2115186A1 (de) | 1971-10-14 |
| BE764883A (fr) | 1971-09-27 |
| US3639105A (en) | 1972-02-01 |
| DE2115186B2 (de) | 1973-08-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2115186B2 (de) | Verfahren zur herstellung von organo-h-silanen | |
| DE2366359C2 (de) | ω-Alkenylsilane, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE69928617T2 (de) | Hydrosilylierungsverfahren mit hoher Ausbeute | |
| DE19644561C2 (de) | Verfahren zur Herstellung von Fluoralkyl-Gruppen tragenden Silicium-organischen Verbindungen | |
| DE68905356T2 (de) | Rhodiumkolloid, verfahren zur herstellung und verwendung. | |
| DE60130776T2 (de) | Verfahren zur herstellung von silikonölen durch hydrosilylierung von sauerstoff-enthaltenden zyklischen kohlenwasserstoffen in anwesenheit von metallkomplexen | |
| DE3518605A1 (de) | Verfahren zur herstellung von organo(poly)siloxanen mit an silicium direkt gebundenem halogen | |
| EP0003514B1 (de) | Verfahren zur Addition von Dialkylhalogenhydrogensilanen an ungesättigte Kohlenwasserstoffverbindungen und die erhaltenen Silane | |
| DE69130433T2 (de) | Verfahren zur Herstellung von Cyclopentyl-trichlorosilan | |
| DE1929724B2 (de) | Verfahren zur herstellung von organosiliciumverbindungen | |
| DE3702631C2 (de) | Verfahren zur Herstellung primärer Aminosiloxane | |
| DE60013971T2 (de) | Umsetzung von hochsiedenden Rückständen der Direktsynthese in Monosilane | |
| DE69219741T2 (de) | Hydrolisylierungsverfahren | |
| DE1127898B (de) | Verfahren zur Herstellung von ª‰-Cyanaethylphenyldichlorsilan | |
| DE1165028B (de) | Verfahren zur Herstellung von siliciumhaltigen Kohlenwasserstoffen durch Addition von Hydrogensilanen an ungesaettigte Kohlenwasserstoffe | |
| DE1568869A1 (de) | Verfahren zur Herstellung von organischen Siliciumverbindungen | |
| DE102014203770A1 (de) | Verfahren zur Hydrosilylierung unter Zusatz organischer Salze | |
| DE19837906C1 (de) | Verfahren zur Herstellung von Silanen mit einer tertiären Kohlenwasserstoff-Gruppe in alpha-Position zum Silicium-Atom | |
| DE69114570T2 (de) | Alkoxysilane. | |
| DE1231240B (de) | Verfahren zur Herstellung von Silylacylmetallocenen | |
| DE69325079T2 (de) | Verfahren zur Herstellung von Triorganochlorsilane | |
| DE2554403A1 (de) | Verfahren zur katalytischen kupplung von allylverbindungen an substituierte olefine | |
| DE69219739T2 (de) | 2-Trimethoxysilylpropionat | |
| DE102010028454A1 (de) | Festbett-Hydrosilylierungs-Katalysator-Komplex und Verfahren hierzu | |
| DE1518236A1 (de) | Katalytische Verfahren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee |