DE2109273C3 - Verfahren zur Polymerisation von Äthylen - Google Patents
Verfahren zur Polymerisation von ÄthylenInfo
- Publication number
- DE2109273C3 DE2109273C3 DE2109273A DE2109273A DE2109273C3 DE 2109273 C3 DE2109273 C3 DE 2109273C3 DE 2109273 A DE2109273 A DE 2109273A DE 2109273 A DE2109273 A DE 2109273A DE 2109273 C3 DE2109273 C3 DE 2109273C3
- Authority
- DE
- Germany
- Prior art keywords
- solid
- compound
- metal
- radical
- product
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 16
- 238000006116 polymerization reaction Methods 0.000 title claims description 15
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 title claims description 13
- 239000005977 Ethylene Substances 0.000 title claims description 13
- 239000007787 solid Substances 0.000 claims description 37
- 239000003054 catalyst Substances 0.000 claims description 21
- 150000001875 compounds Chemical class 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 229910052751 metal Inorganic materials 0.000 claims description 15
- 239000002184 metal Substances 0.000 claims description 15
- 150000002902 organometallic compounds Chemical class 0.000 claims description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 12
- 239000000047 product Substances 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 9
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 9
- 229910052723 transition metal Inorganic materials 0.000 claims description 8
- 150000003624 transition metals Chemical class 0.000 claims description 8
- 239000007795 chemical reaction product Substances 0.000 claims description 7
- 239000001257 hydrogen Chemical group 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 230000000737 periodic effect Effects 0.000 claims description 7
- 238000005406 washing Methods 0.000 claims description 7
- 150000002366 halogen compounds Chemical class 0.000 claims description 6
- 239000000377 silicon dioxide Substances 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- 229930195733 hydrocarbon Natural products 0.000 claims description 5
- 150000002430 hydrocarbons Chemical class 0.000 claims description 5
- 239000004215 Carbon black (E152) Substances 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- 238000000926 separation method Methods 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 235000012239 silicon dioxide Nutrition 0.000 claims description 3
- HHUIAYDQMNHELC-UHFFFAOYSA-N [O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O HHUIAYDQMNHELC-UHFFFAOYSA-N 0.000 claims description 2
- 150000004791 alkyl magnesium halides Chemical class 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 230000002035 prolonged effect Effects 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- -1 polyethylene Polymers 0.000 description 30
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 27
- 239000004698 Polyethylene Substances 0.000 description 26
- 229920000573 polyethylene Polymers 0.000 description 26
- 239000010936 titanium Substances 0.000 description 24
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 13
- 229910052719 titanium Inorganic materials 0.000 description 12
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 11
- 239000003085 diluting agent Substances 0.000 description 10
- 238000005470 impregnation Methods 0.000 description 10
- 230000003197 catalytic effect Effects 0.000 description 9
- 239000011777 magnesium Substances 0.000 description 9
- 229920000642 polymer Polymers 0.000 description 9
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 238000009826 distribution Methods 0.000 description 8
- 229910052749 magnesium Inorganic materials 0.000 description 8
- 239000012265 solid product Substances 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000011148 porous material Substances 0.000 description 5
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- 150000001336 alkenes Chemical class 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical compound CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- 238000001125 extrusion Methods 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 125000002524 organometallic group Chemical group 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 239000001273 butane Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- HQWPLXHWEZZGKY-UHFFFAOYSA-N diethylzinc Chemical compound CC[Zn]CC HQWPLXHWEZZGKY-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 150000004795 grignard reagents Chemical class 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 150000002901 organomagnesium compounds Chemical class 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000007873 sieving Methods 0.000 description 2
- 229910052720 vanadium Inorganic materials 0.000 description 2
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- CMAOLVNGLTWICC-UHFFFAOYSA-N 2-fluoro-5-methylbenzonitrile Chemical compound CC1=CC=C(F)C(C#N)=C1 CMAOLVNGLTWICC-UHFFFAOYSA-N 0.000 description 1
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ONJXMLOOLFUVAT-UHFFFAOYSA-N C(=CC(C)=C)[AlH2] Chemical class C(=CC(C)=C)[AlH2] ONJXMLOOLFUVAT-UHFFFAOYSA-N 0.000 description 1
- CTFVDOIUNCUDDT-UHFFFAOYSA-N C(CCC)[Zn](CCCC)(CCCC)CCCC Chemical compound C(CCC)[Zn](CCCC)(CCCC)CCCC CTFVDOIUNCUDDT-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241001676573 Minium Species 0.000 description 1
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- XSIVVMHGRUGOQD-UHFFFAOYSA-H [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Mn+6] Chemical compound [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Mn+6] XSIVVMHGRUGOQD-UHFFFAOYSA-H 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- HQMRIBYCTLBDAK-UHFFFAOYSA-M bis(2-methylpropyl)alumanylium;chloride Chemical compound CC(C)C[Al](Cl)CC(C)C HQMRIBYCTLBDAK-UHFFFAOYSA-M 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- UJYLYGDHTIVYRI-UHFFFAOYSA-N cadmium(2+);ethane Chemical compound [Cd+2].[CH2-]C.[CH2-]C UJYLYGDHTIVYRI-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- HASGOCLZFTZSTN-UHFFFAOYSA-N cyclohexane;hexane Chemical compound CCCCCC.C1CCCCC1 HASGOCLZFTZSTN-UHFFFAOYSA-N 0.000 description 1
- 238000007872 degassing Methods 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- CQYBWJYIKCZXCN-UHFFFAOYSA-N diethylaluminum Chemical compound CC[Al]CC CQYBWJYIKCZXCN-UHFFFAOYSA-N 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 150000002681 magnesium compounds Chemical class 0.000 description 1
- 229910001641 magnesium iodide Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- LWLPYZUDBNFNAH-UHFFFAOYSA-M magnesium;butane;bromide Chemical compound [Mg+2].[Br-].CCC[CH2-] LWLPYZUDBNFNAH-UHFFFAOYSA-M 0.000 description 1
- VXWPONVCMVLXBW-UHFFFAOYSA-M magnesium;carbanide;iodide Chemical compound [CH3-].[Mg+2].[I-] VXWPONVCMVLXBW-UHFFFAOYSA-M 0.000 description 1
- YCCXQARVHOPWFJ-UHFFFAOYSA-M magnesium;ethane;chloride Chemical compound [Mg+2].[Cl-].[CH2-]C YCCXQARVHOPWFJ-UHFFFAOYSA-M 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 238000009304 pastoral farming Methods 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000007669 thermal treatment Methods 0.000 description 1
- 150000003609 titanium compounds Chemical class 0.000 description 1
- 150000003623 transition metal compounds Chemical class 0.000 description 1
- YGRHYJIWZFEDBT-UHFFFAOYSA-N tridecylaluminum Chemical compound CCCCCCCCCCCCC[Al] YGRHYJIWZFEDBT-UHFFFAOYSA-N 0.000 description 1
- XBEXIHMRFRFRAM-UHFFFAOYSA-N tridodecylalumane Chemical compound CCCCCCCCCCCC[Al](CCCCCCCCCCCC)CCCCCCCCCCCC XBEXIHMRFRFRAM-UHFFFAOYSA-N 0.000 description 1
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 1
- UKHQRARQNZOXRL-UHFFFAOYSA-N trimethyltin Chemical compound C[SnH](C)C UKHQRARQNZOXRL-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S526/00—Synthetic resins or natural rubbers -- part of the class 520 series
- Y10S526/907—Specified means of reacting components of transition metal catalyst
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7007852A FR2082153A5 (fr) | 1970-03-05 | 1970-03-05 | Catalyseurs et procede perfectionnes pour la polymerisation et la copolymerisation des olefines |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2109273A1 DE2109273A1 (de) | 1971-09-16 |
| DE2109273B2 DE2109273B2 (de) | 1976-07-08 |
| DE2109273C3 true DE2109273C3 (de) | 1980-04-30 |
Family
ID=9051714
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2109273A Expired DE2109273C3 (de) | 1970-03-05 | 1971-02-26 | Verfahren zur Polymerisation von Äthylen |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3787384A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5136309B1 (cg-RX-API-DMAC10.html) |
| AT (1) | AT303381B (cg-RX-API-DMAC10.html) |
| BE (1) | BE763296A (cg-RX-API-DMAC10.html) |
| CA (1) | CA975738A (cg-RX-API-DMAC10.html) |
| CH (1) | CH522433A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2109273C3 (cg-RX-API-DMAC10.html) |
| ES (1) | ES388922A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2082153A5 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1306044A (cg-RX-API-DMAC10.html) |
| NL (1) | NL145868B (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA71813B (cg-RX-API-DMAC10.html) |
Families Citing this family (124)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT951956B (it) * | 1971-12-27 | 1973-07-10 | Sir Soc Italiana Resine Spa | Procedimento per la polimerizzazio ne di olefine |
| GB1430073A (en) * | 1972-07-13 | 1976-03-31 | Ici Ltd | Polymerisation proces |
| US3907759A (en) * | 1972-10-06 | 1975-09-23 | Nissan Chemical Ind Ltd | Catalyst for polymerization of olefins and process for polymerization of olefins with use of said catalyst |
| GB1492174A (en) * | 1973-12-13 | 1977-11-16 | British Petroleum Co | Polymerisation catalyst |
| US3956255A (en) * | 1974-01-02 | 1976-05-11 | Monsanto Company | Catalyst for the polymerization of olefins |
| JPS5810403B2 (ja) * | 1974-01-02 | 1983-02-25 | シティ−ズ・サ−ヴイス・カンパニ− | シヨクバイソセイブツ |
| DE2621591C2 (de) * | 1975-05-14 | 1986-03-13 | Nissan Chemical Industries, Ltd., Tokio/Tokyo | Verfahren zur Polymerisation von Äthylen |
| DE2543181C2 (de) * | 1975-09-27 | 1986-08-28 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Polymerisation von Äthylen oder zu dessen Copolymerisation mit C↓3↓- bis C↓1↓↓0↓-α-Monoolefinen |
| DE2553179A1 (de) * | 1975-11-27 | 1977-06-08 | Hoechst Ag | Verfahren zur herstellung eines katalysators |
| DE2603919C2 (de) * | 1976-02-03 | 1984-08-09 | Basf Ag, 6700 Ludwigshafen | Verfahren zum Herstellen von Homo- und Copolymerisaten von C↓2↓-bisC↓6↓-α-Monoolefinen |
| DE2633109A1 (de) * | 1976-07-23 | 1978-02-02 | Basf Ag | Verfahren zum herstellen von homo- und copolymerisaten von alpha- monoolefinen |
| US4507450A (en) * | 1976-08-18 | 1985-03-26 | Mitsubishi Chemical Industries Limited | Process for preparing polyolefin |
| IT1077073B (it) * | 1976-10-19 | 1985-04-27 | Sarda Off Mecc Spa | Procedimento di polimerizzazione di olefine e relativi catalizzatori |
| US4277371A (en) * | 1978-05-29 | 1981-07-07 | Montedison S.P.A. | Catalyst-forming components, process for preparing same, and catalysts for stereospecifically polymerizing olefins prepared therefrom |
| CA1141368A (en) | 1979-01-10 | 1983-02-15 | Imperial Chemical Industries Limited | Olefine polymerisation catalyst and the production and use thereof |
| US4263168A (en) | 1979-01-10 | 1981-04-21 | Imperial Chemical Industries Limited | Olefine polymerization catalyst |
| US4383095A (en) * | 1979-02-16 | 1983-05-10 | Union Carbide Corporation | Process for the preparation of high density ethylene polymers in fluid bed reactor |
| US4383096A (en) * | 1979-08-01 | 1983-05-10 | Chemplex Company | Method of polymerizing 1-olefins |
| US4263171A (en) * | 1979-08-01 | 1981-04-21 | Chemplex Company | Polymerization catalyst |
| EP0026986A1 (en) * | 1979-10-04 | 1981-04-15 | Imperial Chemical Industries Plc | Polymerisation catalysts and process for the homo- or co-polymerisation of alpha-olefins |
| CA1130269A (en) * | 1979-10-19 | 1982-08-24 | James J. Harris | Process and supported catalysts for polymerization of alpha-monoolefins |
| US4843133A (en) * | 1979-12-07 | 1989-06-27 | Phillips Petroleum Company | Polymerization and catalysts |
| US4565795A (en) * | 1979-12-07 | 1986-01-21 | Phillips Petroleum Company | Polymerization and catalysts |
| US4530913A (en) * | 1980-01-16 | 1985-07-23 | Chemplex Company | Polymerization catalyst and method |
| US4578440A (en) * | 1980-01-16 | 1986-03-25 | Norchem, Inc. | Polymerization catalyst and method |
| EP0044665A1 (en) * | 1980-07-14 | 1982-01-27 | Imperial Chemical Industries Plc | Transition metal composition, production and use |
| JPS57108107A (en) * | 1980-12-25 | 1982-07-06 | Asahi Chem Ind Co Ltd | Catalyst for olefin polymerization |
| US4434281A (en) | 1981-01-23 | 1984-02-28 | Gulf Research & Development Company | Polymerizing olefins with a novel catalyst |
| US4359403A (en) * | 1981-04-13 | 1982-11-16 | Chemplex Company | Polymerization catalyst and method |
| US4446288A (en) * | 1981-05-05 | 1984-05-01 | Chemplex Company | Polymerization method |
| US4384983A (en) * | 1981-05-26 | 1983-05-24 | Standard Oil Company (Indiana) | Catalyst and process for production of polyolefins of improved morphology |
| US4376064A (en) * | 1981-05-26 | 1983-03-08 | Standard Oil Co. (Indiana) | Catalyst and process for production of polyolefins of improved morphology |
| US4458058A (en) * | 1981-06-03 | 1984-07-03 | Chemplex Company | Polymerization method |
| US4530912A (en) * | 1981-06-04 | 1985-07-23 | Chemplex Company | Polymerization catalyst and method |
| NL8103704A (nl) | 1981-08-06 | 1983-03-01 | Stamicarbon | Werkwijze voor de bereiding van een katalysatorcomponent en polymerizatie van 1-alkenen daarmee. |
| ZA828776B (en) * | 1981-12-04 | 1984-07-25 | Mobil Oil Corp | Preparation of a catalyst for and a method of producing linear low density polyethylene |
| US4605638A (en) * | 1981-12-04 | 1986-08-12 | Mobil Oil Corporation | Highly active catalyst composition for polymerizing alpha-olefins |
| US4397762A (en) | 1982-01-27 | 1983-08-09 | Bp Chemicals Limited | Polymerization catalyst |
| US4396533A (en) | 1982-01-27 | 1983-08-02 | Bp Chemicals Limited | Polymerization catalyst |
| US5064795A (en) * | 1982-08-27 | 1991-11-12 | Phillips Petroleum Company | Polymerization of olefins |
| US4477586A (en) * | 1982-08-27 | 1984-10-16 | Phillips Petroleum Company | Polymerization of olefins |
| JPS5940317A (ja) * | 1982-08-30 | 1984-03-06 | Arupain Kk | 記録装置のヘツド使用時間検出器 |
| US4665138A (en) * | 1982-11-24 | 1987-05-12 | Cities Service Oil & Gas Corp | Process for polymerizing a monomer charge |
| US4665139A (en) * | 1982-11-24 | 1987-05-12 | Cities Service Oil & Gas Corp. | Process for polymerizing a monomer charge |
| US4435519A (en) * | 1982-11-24 | 1984-03-06 | Cities Service Co. | Novel catalyst composition |
| US4435518A (en) * | 1982-11-24 | 1984-03-06 | Cities Service Co. | Polymerization catalyst |
| US4665141A (en) * | 1982-11-24 | 1987-05-12 | Cities Service Oil & Gas Corp. | Process for polymerizing a monomer |
| US4426317A (en) * | 1982-11-24 | 1984-01-17 | Cities Service Company | Process for making olefin polymerization catalyst |
| US4434242A (en) * | 1982-11-24 | 1984-02-28 | Cities Service Co. | Polymerization catalyst |
| US4707530A (en) * | 1983-01-31 | 1987-11-17 | Exxon Research & Engineering Co. | Polymerization catalyst |
| US4663403A (en) * | 1983-02-04 | 1987-05-05 | Phillips Petroleum Company | Polymerization of olefins |
| US4499199A (en) * | 1983-07-25 | 1985-02-12 | Phillips Petroleum Company | TiCl4 Treated with organomagnesium/protonating agent |
| US5006619A (en) * | 1984-02-27 | 1991-04-09 | Quantum Chemical Corporation | Polymerization catalyst and method |
| US4593009A (en) * | 1984-04-04 | 1986-06-03 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefins |
| US4672096A (en) * | 1984-04-04 | 1987-06-09 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefins |
| US4618662A (en) * | 1984-04-23 | 1986-10-21 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefins |
| US4565797A (en) * | 1984-08-03 | 1986-01-21 | Exxon Research & Engineering Co. | Polymerization catalyst, production and use (P-1010) |
| US4634746A (en) * | 1984-08-03 | 1987-01-06 | Exxon Research & Engineering Co. | Polymerization catalyst, production and use (P-1010) |
| US4564606A (en) * | 1984-08-06 | 1986-01-14 | Exxon Research & Engineering Co. | Polymerization catalyst, production and use |
| US4639428A (en) * | 1984-08-06 | 1987-01-27 | Exxon Research & Engineering Co. | Polymerization catalyst, production and use |
| US4640907A (en) * | 1984-08-06 | 1987-02-03 | Exxon Research & Engineering Co. | Polymerization catalyst, production and use |
| US4634749A (en) * | 1984-08-06 | 1987-01-06 | Exxon Research & Engineering Co. | Polymerization catalyst, production and use |
| US4634748A (en) * | 1984-08-06 | 1987-01-06 | Exxon Research & Engineering Co. | Polymerization catalyst, production and use |
| US4634747A (en) * | 1984-08-06 | 1987-01-06 | Exxon Research & Engineering Co. | Polymerization catalyst, production and use |
| US4558024A (en) * | 1984-08-06 | 1985-12-10 | Exxon Research & Engineering Co. | Polymerization catalyst, production and use |
| US4558025A (en) * | 1984-08-06 | 1985-12-10 | Exxon Research & Engineering Co. | Polymerization catalyst, production and use |
| US4568658A (en) * | 1984-09-05 | 1986-02-04 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefins at low reactants partial pressures |
| US4675369A (en) * | 1984-09-05 | 1987-06-23 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefins at low reactants partial pressures |
| US4560733A (en) * | 1984-10-01 | 1985-12-24 | Phillips Petroleum Company | Polymerization and catalyst |
| US4540757A (en) * | 1984-10-01 | 1985-09-10 | Phillips Petroleum Company | Polymerization and catalyst |
| US4562169A (en) * | 1984-10-04 | 1985-12-31 | Mobil Oil Corporation | Alpha-olefins polymerization catalyst of high productivity |
| US4634752A (en) * | 1984-10-04 | 1987-01-06 | Mobil Oil Corporation | Process for preparing alpha-olefin polymers |
| US4537869A (en) * | 1984-11-19 | 1985-08-27 | Phillips Petroleum Company | Tetravalent titanium treated calcined vanadium catalyst with trialkylaluminum cocatalyst |
| US4613712A (en) * | 1984-12-31 | 1986-09-23 | Mobil Oil Corporation | Alpha-olefin polymers as lubricant viscosity properties improvers |
| US4677087A (en) * | 1986-01-03 | 1987-06-30 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefin polymers of relatively narrow molecular weight distribution |
| US4668650A (en) * | 1986-01-03 | 1987-05-26 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefin polymers of relatively narrow molecular weight distribution |
| US4876321A (en) * | 1986-01-03 | 1989-10-24 | Mobil Oil Corporation | Preparation of alpha-olefin polymers of relatively narrow molecular weight distribution |
| USRE33683E (en) * | 1986-01-24 | 1991-09-03 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefins |
| US5055533A (en) * | 1986-01-24 | 1991-10-08 | Mobil Oil Corporation | Process for polymerizing alpha-olefins with trimethylaluminum-activated catalyst |
| US4732882A (en) | 1986-01-24 | 1988-03-22 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefins |
| FR2597486B1 (fr) * | 1986-04-18 | 1992-09-11 | Chemopetrol Koncernova Ucelova | Catalyseur et procede pour la production de polymeres et de copolymeres de 1-alcenes. |
| US4937300A (en) * | 1987-06-22 | 1990-06-26 | Phillips Petroleum Company | Catalyst and polymerization of olefins |
| US4855271A (en) * | 1987-06-22 | 1989-08-08 | Phillips Petroleum Company | Catalyst and polymerization of olefins |
| US4833111A (en) * | 1988-01-14 | 1989-05-23 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefin polymers of narrow molecular weight distribution |
| US5093443A (en) * | 1988-01-14 | 1992-03-03 | Mobil Oil Corporation | Alpha-olefins polymerization with chlorinated alcohol-containing catalyst composition |
| US4849389A (en) * | 1988-01-14 | 1989-07-18 | Mobil Oil Corporation | Catalyst composition for polymerizing alpha-olefin polymers of narrow molecular weight distribution |
| US4954470A (en) * | 1988-01-14 | 1990-09-04 | Mobil Oil Corporation | Chlorinated alcohol-containing catalyst composition for polymerizing alpha-olefins |
| US6248702B1 (en) | 1990-01-16 | 2001-06-19 | Mobil Oil Corporation | Dispersant and dispersant viscosity index improvers from selectively hydrogenated aryl-substituted olefin containing diene copolymers |
| US6172173B1 (en) | 1991-01-18 | 2001-01-09 | The Dow Chemical Company | Silica supported transition metal catalyst |
| US6747113B1 (en) | 1991-01-18 | 2004-06-08 | The Dow Chemical Company | Silica supported transition metal catalyst |
| US5231151A (en) * | 1991-01-18 | 1993-07-27 | The Dow Chemical Company | Silica supported transition metal catalyst |
| IT1245250B (it) * | 1991-03-27 | 1994-09-13 | Himont Inc | Componenti e catalizzatori per la polimerizzazione di olefine |
| IT1245249B (it) * | 1991-03-27 | 1994-09-13 | Himont Inc | Componenti e catalizzatori per la polimerizzazione di olefine |
| US5693583A (en) * | 1991-06-10 | 1997-12-02 | Mobil Oil Corporation | High activity polyethylene catalysts which produce bimodal or trimodal product molecular weight distributions |
| US5470812A (en) * | 1991-11-06 | 1995-11-28 | Mobil Oil Corporation | High activity polyethylene catalysts prepared with alkoxysilane reagents |
| US5514634A (en) * | 1991-11-06 | 1996-05-07 | Mobil Oil Corporation | High activity polyethylene catalysts |
| US5336652A (en) * | 1991-11-06 | 1994-08-09 | Mobil Oil Corporation | High activity polyethylene catalysts prepared with alkoxysilane reagents |
| US5939348A (en) * | 1991-11-06 | 1999-08-17 | Mobil Oil Corporation | Catalyst for the manufacture of polythylene with a narrow molecular weight distribution |
| US5210167A (en) * | 1991-11-25 | 1993-05-11 | Mobil Oil Corporation | LLDPE films with improved optical properties |
| US5461017A (en) * | 1991-12-13 | 1995-10-24 | Mobil Oil Corporation | Olefin polymerization catalysts |
| US5362824A (en) * | 1991-12-13 | 1994-11-08 | Mobil Oil Corporation | Olefin polymerization catalysts |
| US5583083A (en) * | 1991-12-31 | 1996-12-10 | Neste Oy | Procatalyst composition for homo- and copolymerization of alpha olefins, its preparation and its use |
| US5416051A (en) * | 1992-03-24 | 1995-05-16 | Exxon Research & Engineering Co. | Pillared metakandite clay compositions as sorbents, catalysts and ceramic and refractory precursors |
| US5260245A (en) * | 1992-10-19 | 1993-11-09 | Mobil Oil Corporation | High activity polyethylene catalysts |
| US5258345A (en) * | 1992-11-20 | 1993-11-02 | Mobil Oil Corporation | High-activity polyethylene catalysts |
| CA2174766C (en) * | 1993-11-18 | 2005-06-21 | Robert Ivan Mink | A catalyst composition for the copolymerization of ethylene |
| CN1117500A (zh) | 1994-08-08 | 1996-02-28 | 菲利浦石油公司 | 烯烃聚合反应及催化剂 |
| US5661097A (en) * | 1994-08-12 | 1997-08-26 | The Dow Chemical Company | Supported olefin polymerization catalyst |
| US5895770A (en) * | 1995-02-28 | 1999-04-20 | Pq Corporation | Olefin polymerization catalysts with specific silica supports |
| US5723402A (en) * | 1996-05-30 | 1998-03-03 | Pq Corporation | Silicas with specific contents of cations as supports for olefin polymerization catalysts |
| US6177375B1 (en) | 1998-03-09 | 2001-01-23 | Pq Corporation | High activity olefin polymerization catalysts |
| US6096678A (en) * | 1998-04-22 | 2000-08-01 | Ray; Sabyasachi Sinha | Process for the preparation of supported aluminium chloride catalyst containing organo aluminium compound |
| US6001764A (en) * | 1998-05-08 | 1999-12-14 | Pq Corporation | Olefin polymerization catalysts with specific silica supports |
| US6215033B1 (en) | 1998-12-11 | 2001-04-10 | Mobil Oil Corporation | Dispersants and dispersant viscosity index improvers from selectively hydrogenated polymers: blends with lower molecular weight components |
| US6319881B1 (en) | 1998-06-23 | 2001-11-20 | Exxonmobil Oil Corporation | Haze free oil additive compositions containing dispersants from selectively hydrogenated diene copolymers |
| JP2002527584A (ja) | 1998-10-16 | 2002-08-27 | サウディ ベーシック インダストリーズ コーポレーション | オレフィン重合用高活性坦持チーグラー−ナッタ触媒系、その製造方法及びその使用 |
| WO2000023481A1 (en) | 1998-10-16 | 2000-04-27 | Saudi Basic Industries Corporation | Process for polymerizing olefins with supported ziegler-natta catalyst systems |
| DE60204306T2 (de) * | 2002-07-12 | 2005-10-20 | Saudi Basic Industries Corp. | Geträgerter Ziegler - Metallocenepolymerisationskatalysator und dessen Benutzung für die Polymerisation von Olefinen |
| CN1213081C (zh) * | 2002-10-16 | 2005-08-03 | 中国石油化工股份有限公司 | 用于乙烯聚合的催化剂组分、制备方法以及催化剂 |
| US7307036B2 (en) * | 2004-07-22 | 2007-12-11 | Formosa Plastics Corporation U.S.A. | Highly active alpha-olefin polymerization catalyst |
| KR101075404B1 (ko) * | 2004-12-17 | 2011-10-24 | 양지 페트로케미컬 컴퍼니 코., 리미티드. | 지지된 비메탈로센 올레핀 중합 촉매, 제조 방법 및 그용도 |
| US9068025B2 (en) | 2010-08-19 | 2015-06-30 | China Petroleum & Chemical Corporation | Catalyst component for polymerization of olefin and preparation method |
| EP2800766B1 (en) | 2012-03-05 | 2019-09-04 | Univation Technologies, LLC | Methods for making catalyst compositions and polymer products produced therefrom |
| WO2018064048A1 (en) | 2016-09-27 | 2018-04-05 | Univation Technologies, Llc | Method for long chain branching control in polyethylene production |
-
1970
- 1970-03-05 FR FR7007852A patent/FR2082153A5/fr not_active Expired
-
1971
- 1971-02-09 ZA ZA710813A patent/ZA71813B/xx unknown
- 1971-02-09 CH CH192071A patent/CH522433A/fr not_active IP Right Cessation
- 1971-02-17 CA CA105,654A patent/CA975738A/en not_active Expired
- 1971-02-19 NL NL717102252A patent/NL145868B/xx unknown
- 1971-02-23 BE BE763296A patent/BE763296A/xx not_active IP Right Cessation
- 1971-02-26 DE DE2109273A patent/DE2109273C3/de not_active Expired
- 1971-03-04 ES ES388922A patent/ES388922A1/es not_active Expired
- 1971-03-05 JP JP46011378A patent/JPS5136309B1/ja active Pending
- 1971-03-05 AT AT192771A patent/AT303381B/de active
- 1971-03-05 US US00121541A patent/US3787384A/en not_active Expired - Lifetime
- 1971-04-19 GB GB2323971*A patent/GB1306044A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH522433A (fr) | 1972-06-30 |
| GB1306044A (cg-RX-API-DMAC10.html) | 1973-02-07 |
| JPS5136309B1 (cg-RX-API-DMAC10.html) | 1976-10-07 |
| ZA71813B (en) | 1971-10-27 |
| AT303381B (de) | 1972-11-27 |
| NL7102252A (cg-RX-API-DMAC10.html) | 1971-09-07 |
| NL145868B (nl) | 1975-05-15 |
| DE2109273A1 (de) | 1971-09-16 |
| US3787384A (en) | 1974-01-22 |
| CA975738A (en) | 1975-10-07 |
| FR2082153A5 (fr) | 1971-12-10 |
| DE2109273B2 (de) | 1976-07-08 |
| ES388922A1 (es) | 1973-05-01 |
| BE763296A (fr) | 1971-08-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2109273C3 (de) | Verfahren zur Polymerisation von Äthylen | |
| DE2822783C2 (cg-RX-API-DMAC10.html) | ||
| DE2822809C2 (cg-RX-API-DMAC10.html) | ||
| DE69323478T2 (de) | Komponenten und Katalysatoren für Olefinpolymerisation | |
| DE69221181T2 (de) | Bestandteile und Katalysatoren für die Olefinpolymerisation | |
| DE69106085T2 (de) | Feste Komponente eines Katalysators zur (Co)polymerisation von Ethylen. | |
| DE2350196C2 (de) | Verfahren zur Polymerisation von Äthylen | |
| DE2352154C3 (de) | Verfahren zur Niederdruckpolymerisation von Äthylen | |
| DE69210454T2 (de) | Bestandteile und Katalisatoren für die Olefinpolymerisation | |
| DE2356937B2 (de) | Verfahren zur Polymerisation von Äthylen, Propylen oder Buten-(1) sowie zur Mischpolymerisation von jeweils zwei dieser Monomeren miteinander | |
| DE2809272A1 (de) | Katalysator fuer die herstellung von polyalkylenen | |
| DD298935A5 (de) | Katalysatorkomponente zur polymerisation von olefinen | |
| DE2000834A1 (de) | Verfahren zur Polymerisation und Mischpolymerisation von Olefinen | |
| DE2615390A1 (de) | Verfahren zur polymerisation von olefinen | |
| DE2626097A1 (de) | Katalysatorkomponenten fuer die olefinpolymerisation, ihre herstellung und verwendung | |
| DE2724974A1 (de) | Katalysatorkomponente, verfahren zu ihrer herstellung und die sie enthaltenden katalysatoren | |
| DE3007419A1 (de) | Verfahren zur herstellung eines nicht oder wenig kristallinen weichen copolymeren | |
| DE2448178C2 (de) | Verfahren zur Polymerisation von α-Olefinen und titan- und/oder vanadinhaltiger Trägerkatalysator | |
| DE2721058A1 (de) | Verfahren zum herstellen von homo- und copolymerisaten von alpha-monoolefinen | |
| DE2654940A1 (de) | Polymerisationsverfahren | |
| DE3918646A1 (de) | Verfahren zur herstellung eines poly-l-olefins | |
| DE2600593C2 (de) | Verfahren zur Polymerisation von Äthylen und pulverförmiger fester titanhaltiger Trägerkatalysator zur Durchführung dieses Verfahrens | |
| DE2543219A1 (de) | Verfahren zum herstellen einer uebergangsmetall-katalysatorkomponente fuer ziegler-katalysatoren zur polymerisation von olefinen | |
| EP0056229B1 (de) | Verfahren zur Herstellung von Trägerkatalysatoren für die Polymerisation von alpha-Olefinen | |
| DE69216825T2 (de) | Magnesiumchlorid-Komplexe, Verfahren und Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |