DE2054342A1 - Neue 1,2,4-Oxdiazole - Google Patents
Neue 1,2,4-OxdiazoleInfo
- Publication number
- DE2054342A1 DE2054342A1 DE19702054342 DE2054342A DE2054342A1 DE 2054342 A1 DE2054342 A1 DE 2054342A1 DE 19702054342 DE19702054342 DE 19702054342 DE 2054342 A DE2054342 A DE 2054342A DE 2054342 A1 DE2054342 A1 DE 2054342A1
- Authority
- DE
- Germany
- Prior art keywords
- oxdiazole
- radical
- trichloromethyl
- chloro
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- BBVIDBNAYOIXOE-UHFFFAOYSA-N 1,2,4-oxadiazole Chemical class C=1N=CON=1 BBVIDBNAYOIXOE-UHFFFAOYSA-N 0.000 title claims description 5
- -1 chlorine Chemical class 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 9
- 150000003254 radicals Chemical class 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 150000005840 aryl radicals Chemical class 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- KQNDRQCJJPCDJO-UHFFFAOYSA-N 3-chloro-5-phenyl-1,2,4-oxadiazole Chemical compound ClC1=NOC(C=2C=CC=CC=2)=N1 KQNDRQCJJPCDJO-UHFFFAOYSA-N 0.000 claims description 2
- DYLKAZGGQBPFEM-UHFFFAOYSA-N 3-phenyl-5-(trichloromethyl)-1,2,4-oxadiazole Chemical compound O1C(C(Cl)(Cl)Cl)=NC(C=2C=CC=CC=2)=N1 DYLKAZGGQBPFEM-UHFFFAOYSA-N 0.000 claims description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 2
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims 2
- HOVDXLWVPKSOJW-UHFFFAOYSA-N 1,1-dichloro-n-(chloromethyl)methanimine Chemical class ClCN=C(Cl)Cl HOVDXLWVPKSOJW-UHFFFAOYSA-N 0.000 claims 1
- MEQMSOHGNAUBMS-UHFFFAOYSA-N 3,5-dichloro-1,2,4-oxadiazole Chemical compound ClC1=NOC(Cl)=N1 MEQMSOHGNAUBMS-UHFFFAOYSA-N 0.000 claims 1
- GSDIIUWHUCOWBB-UHFFFAOYSA-N 3-chloro-5-(chloromethyl)-1,2,4-oxadiazole Chemical compound ClCC1=NC(Cl)=NO1 GSDIIUWHUCOWBB-UHFFFAOYSA-N 0.000 claims 1
- WZRNPOSECGWJKJ-UHFFFAOYSA-N 3-chloro-5-(trichloromethyl)-1,2,4-oxadiazole Chemical compound ClC1=NOC(=N1)C(Cl)(Cl)Cl WZRNPOSECGWJKJ-UHFFFAOYSA-N 0.000 claims 1
- XUXRZYBSHQZCGQ-UHFFFAOYSA-N dichloro(isocyano)methane Chemical compound ClC(Cl)[N+]#[C-] XUXRZYBSHQZCGQ-UHFFFAOYSA-N 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 10
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 9
- WTDHULULXKLSOZ-UHFFFAOYSA-N hydroxylamine hydrochloride Substances Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 8
- WCYJQVALWQMJGE-UHFFFAOYSA-M hydroxylammonium chloride Chemical compound [Cl-].O[NH3+] WCYJQVALWQMJGE-UHFFFAOYSA-M 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- UMHMSROXVXCAOL-UHFFFAOYSA-N 1,1-dichloro-n-[dichloro(phenyl)methyl]methanimine Chemical compound ClC(Cl)=NC(Cl)(Cl)C1=CC=CC=C1 UMHMSROXVXCAOL-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RLAROPIDCNCRNR-UHFFFAOYSA-N Cl.Cl.[C-]#N Chemical compound Cl.Cl.[C-]#N RLAROPIDCNCRNR-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- AFCITYHXNOAOJN-UHFFFAOYSA-N 2,2,2-trichloro-n-(1,1,2,2,2-pentachloroethyl)ethanimidoyl chloride Chemical compound ClC(Cl)(Cl)C(Cl)=NC(Cl)(Cl)C(Cl)(Cl)Cl AFCITYHXNOAOJN-UHFFFAOYSA-N 0.000 description 2
- JXHYSCJLVJAUSR-UHFFFAOYSA-N 2,2,3,3,3-pentachloro-N-(1,1,2,2,2-pentachloroethyl)propanimidoyl chloride Chemical compound ClC(C(N=C(Cl)C(C(Cl)(Cl)Cl)(Cl)Cl)(Cl)Cl)(Cl)Cl JXHYSCJLVJAUSR-UHFFFAOYSA-N 0.000 description 2
- 125000006414 CCl Chemical group ClC* 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 239000012456 homogeneous solution Substances 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 229940035339 tri-chlor Drugs 0.000 description 2
- SXLDBFDRSPKHLY-UHFFFAOYSA-N trichloro(isocyano)methane Chemical compound ClC(Cl)(Cl)[N+]#[C-] SXLDBFDRSPKHLY-UHFFFAOYSA-N 0.000 description 2
- PNQJTGGOQNJSEL-UHFFFAOYSA-N 1,1,1,2,2-pentachloro-2-isocyanoethane Chemical compound ClC(Cl)(Cl)C(Cl)(Cl)[N+]#[C-] PNQJTGGOQNJSEL-UHFFFAOYSA-N 0.000 description 1
- PWKMQDKWSRMCKM-UHFFFAOYSA-N 1,1,2-trichloro-1-isocyanoethane Chemical compound ClC(CCl)(Cl)[N+]#[C-] PWKMQDKWSRMCKM-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- IPFGMRSOQXSOTN-UHFFFAOYSA-N 2,2,3,3,3-pentachloro-N-(trichloromethyl)propanimidoyl chloride Chemical compound ClC(C(Cl)(Cl)Cl)(C(=NC(Cl)(Cl)Cl)Cl)Cl IPFGMRSOQXSOTN-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- SVYKKECYCPFKGB-UHFFFAOYSA-N N,N-dimethylcyclohexylamine Chemical compound CN(C)C1CCCCC1 SVYKKECYCPFKGB-UHFFFAOYSA-N 0.000 description 1
- WFBHRSAKANVBKH-UHFFFAOYSA-N N-hydroxyguanidine Chemical class NC(=N)NO WFBHRSAKANVBKH-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical compound ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000008164 mustard oil Substances 0.000 description 1
- OWRABTHGOKNUDV-UHFFFAOYSA-N n,n-dipropylcarbamoyl chloride Chemical compound CCCN(C(Cl)=O)CCC OWRABTHGOKNUDV-UHFFFAOYSA-N 0.000 description 1
- LHKGBSNQSFSSTB-UHFFFAOYSA-N n-(1,1,2,2,2-pentachloroethyl)benzenecarboximidoyl chloride Chemical compound ClC(Cl)(Cl)C(Cl)(Cl)N=C(Cl)C1=CC=CC=C1 LHKGBSNQSFSSTB-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702054342 DE2054342A1 (de) | 1970-11-05 | 1970-11-05 | Neue 1,2,4-Oxdiazole |
| US194005A US3862168A (en) | 1970-11-05 | 1971-10-29 | 1,2,4-oxadiazoles |
| NL7115080A NL7115080A (OSRAM) | 1970-11-05 | 1971-11-02 | |
| IL38062A IL38062A (en) | 1970-11-05 | 1971-11-02 | The production of 1,2,4-oxadiazoles and a new such compound |
| CA126,659A CA954866A (en) | 1970-11-05 | 1971-11-02 | Partly new 1,2,4 - oxadiazoles |
| IT30707/71A IT969055B (it) | 1970-11-05 | 1971-11-03 | 1 2 4 ossadiazoli e procedimento per la loro preparazione |
| GB5103671A GB1363758A (en) | 1970-11-05 | 1971-11-03 | Process for the production of 1,2,4-oxa-diazoles and novel 1,2,4- oxadiazoles |
| JP8726371A JPS5527059B1 (OSRAM) | 1970-11-05 | 1971-11-04 | |
| CH1613071A CH568998A5 (OSRAM) | 1970-11-05 | 1971-11-04 | |
| ES396648A ES396648A1 (es) | 1970-11-05 | 1971-11-04 | Procedimiento para la obtencion de 1,2,4-oxadiazoles. |
| FR7139824A FR2113642A5 (OSRAM) | 1970-11-05 | 1971-11-05 | |
| BE774971A BE774971A (fr) | 1970-11-05 | 1971-11-05 | 1,2,4-oxadiazols en partie nouveaux |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702054342 DE2054342A1 (de) | 1970-11-05 | 1970-11-05 | Neue 1,2,4-Oxdiazole |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2054342A1 true DE2054342A1 (de) | 1972-05-10 |
Family
ID=5787161
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702054342 Withdrawn DE2054342A1 (de) | 1970-11-05 | 1970-11-05 | Neue 1,2,4-Oxdiazole |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3862168A (OSRAM) |
| JP (1) | JPS5527059B1 (OSRAM) |
| BE (1) | BE774971A (OSRAM) |
| CA (1) | CA954866A (OSRAM) |
| CH (1) | CH568998A5 (OSRAM) |
| DE (1) | DE2054342A1 (OSRAM) |
| ES (1) | ES396648A1 (OSRAM) |
| FR (1) | FR2113642A5 (OSRAM) |
| GB (1) | GB1363758A (OSRAM) |
| IL (1) | IL38062A (OSRAM) |
| IT (1) | IT969055B (OSRAM) |
| NL (1) | NL7115080A (OSRAM) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0000452B1 (fr) * | 1977-07-12 | 1981-05-06 | Synthelabo | Dérivés d'oxadiazole-1,2,4, leur préparation et leur application en thérapeutique. |
| DE3445205A1 (de) * | 1984-12-12 | 1986-06-12 | Bayer Ag, 5090 Leverkusen | N-(3-chlor-1,2,4-oxadiazol-5-yl)-harnstoffe |
| CA2075421A1 (en) * | 1992-08-06 | 1994-02-07 | Mikhail D. Mashkovsky | Pharmaceutical preparation of antihypertensive, antianginal , antiarrhythmic and antiglaucomic action |
| JP3741340B2 (ja) * | 1998-09-21 | 2006-02-01 | 富士写真フイルム株式会社 | 1,2,4−オキサジアゾール系化合物からなる有機発光素子材料およびそれを用いた有機発光素子 |
| CN103145637A (zh) * | 2013-03-17 | 2013-06-12 | 石家庄学院 | 3-苯基-5-溴-1,2,4-噁二唑衍生物的合成新工艺 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3192216A (en) * | 1961-10-30 | 1965-06-29 | Neisler Lab Inc | Phenylhydroxyalkylpyrimidine compounds |
| NL291628A (OSRAM) * | 1962-04-17 | |||
| US3227725A (en) * | 1962-04-17 | 1966-01-04 | Union Carbide Corp | Certain 3,5-disubstituted 1,2,4-oxadiazole compounds |
-
1970
- 1970-11-05 DE DE19702054342 patent/DE2054342A1/de not_active Withdrawn
-
1971
- 1971-10-29 US US194005A patent/US3862168A/en not_active Expired - Lifetime
- 1971-11-02 NL NL7115080A patent/NL7115080A/xx not_active Application Discontinuation
- 1971-11-02 CA CA126,659A patent/CA954866A/en not_active Expired
- 1971-11-02 IL IL38062A patent/IL38062A/xx unknown
- 1971-11-03 IT IT30707/71A patent/IT969055B/it active
- 1971-11-03 GB GB5103671A patent/GB1363758A/en not_active Expired
- 1971-11-04 ES ES396648A patent/ES396648A1/es not_active Expired
- 1971-11-04 JP JP8726371A patent/JPS5527059B1/ja active Pending
- 1971-11-04 CH CH1613071A patent/CH568998A5/xx not_active IP Right Cessation
- 1971-11-05 FR FR7139824A patent/FR2113642A5/fr not_active Expired
- 1971-11-05 BE BE774971A patent/BE774971A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES396648A1 (es) | 1974-05-16 |
| IT969055B (it) | 1974-03-30 |
| FR2113642A5 (OSRAM) | 1972-06-23 |
| JPS5527059B1 (OSRAM) | 1980-07-17 |
| CA954866A (en) | 1974-09-17 |
| CH568998A5 (OSRAM) | 1975-11-14 |
| GB1363758A (en) | 1974-08-14 |
| IL38062A0 (en) | 1972-01-27 |
| IL38062A (en) | 1975-10-15 |
| US3862168A (en) | 1975-01-21 |
| BE774971A (fr) | 1972-05-05 |
| NL7115080A (OSRAM) | 1972-05-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2614240C3 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| DE2054342A1 (de) | Neue 1,2,4-Oxdiazole | |
| DE2124907A1 (de) | 3 Amino 1,2,4 oxadiazole, Verfahren zu ihrer Herstellung und Arzneipraparate | |
| DE2125229C3 (de) | Verfahren zur Herstellung von Chinazolinen | |
| DE2417669A1 (de) | Verfahren zur herstellung von n(halogenaryl)-n',n'-dialkylamidinen | |
| DE1545842C3 (de) | Verfahren zur Herstellung von N-substituierten 3-Halogen-benzisothiazoliumhalogeniden | |
| AT260237B (de) | Verfahren zur Herstellung neuer 3-substituierter 5-(2'-Halogenäthyl)-2-oxazolidinone | |
| DE2008115C3 (de) | Verfahren zur Herstellung von Naralkylsubstituierten N-Acylcarbamidsäurehalogeniden | |
| DE2529549C3 (de) | Verfahren zur Herstellung von Phenylisopropylharnstoffen | |
| EP0073871B1 (de) | Verfahren zur Herstellung von N-substituierten N-Acetyl-2,6-dialkylanilinen | |
| AT228772B (de) | Verfahren zur Herstellung von neuen basisch substituierten Malonsäuredinitrilen | |
| AT258264B (de) | Verfahren zur Herstellung von 5-(3'-Methylaminopropyl)-5H-dibenzo[a,d] cyclohepten | |
| DE1101407B (de) | Verfahren zur Herstellung von Sulfonsaeureamid-N-sulfensaeurechloriden | |
| DE1793287B2 (de) | Verfahren zur herstellung von n- substituierte n-acylcarbamidsaeurehalogeniden | |
| EP0792870A1 (de) | Verfahren zur Herstellung von Ketonoximether durch Boronsäurekupplung | |
| EP0731094A1 (de) | Verfahren zur Herstellung von Pyrazolen | |
| DE3409887A1 (de) | Verfahren zur herstellung von isocyanaten | |
| DE1695188A1 (de) | Verfahren zur Herstellung von 1,2-Dihydrobenzodiazepinen | |
| DE3634926A1 (de) | Verfahren zur herstellung von o-aryl-n'-pyrimidin-2-yl-isoharnstoffen | |
| DE2053840B2 (de) | Verfahren zur Herstellung von N,N-disubstituierten Carbamidsäurechloriden oder -bromiden | |
| DE2137649B2 (OSRAM) | ||
| DE2148225A1 (de) | Perchlor-diaza-polycyclen | |
| DE1224305B (de) | Verfahren zur Herstellung neuartiger Arylimin-Derivate | |
| DE1111196B (de) | Verfahren zur Herstellung von Phosphadiazolen | |
| DE2125476A1 (en) | Herbicidal trifluoromethylimino cpds - as inters eg to plant protection agents |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |