DE2050640A1 - Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons - Google Patents
Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-onsInfo
- Publication number
- DE2050640A1 DE2050640A1 DE19702050640 DE2050640A DE2050640A1 DE 2050640 A1 DE2050640 A1 DE 2050640A1 DE 19702050640 DE19702050640 DE 19702050640 DE 2050640 A DE2050640 A DE 2050640A DE 2050640 A1 DE2050640 A1 DE 2050640A1
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- quinazolin
- thion
- atom
- substituted derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- PUPFOFVEHDNUJU-UHFFFAOYSA-N 2-sulfanylidene-1h-quinazolin-4-one Chemical class C1=CC=C2C(=O)NC(S)=NC2=C1 PUPFOFVEHDNUJU-UHFFFAOYSA-N 0.000 title description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 5
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000003341 7 membered heterocyclic group Chemical group 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 150000002440 hydroxy compounds Chemical class 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims 1
- 229940126601 medicinal product Drugs 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- -1 hydroxypropyl Chemical group 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- BUHYMJLFRZAFBF-UHFFFAOYSA-N 3,4,5-trimethoxybenzoyl chloride Chemical compound COC1=CC(C(Cl)=O)=CC(OC)=C1OC BUHYMJLFRZAFBF-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000003218 coronary vasodilator agent Substances 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- UPVUQELOASQBMY-UHFFFAOYSA-N methyl 2-amino-3,4,5-trimethoxybenzoate Chemical compound COC(=O)C1=CC(OC)=C(OC)C(OC)=C1N UPVUQELOASQBMY-UHFFFAOYSA-N 0.000 description 1
- ZAURWALYCYQFTL-UHFFFAOYSA-N methyl 2-isothiocyanato-3,4,5-trimethoxybenzoate Chemical compound COC(=O)C1=CC(OC)=C(OC)C(OC)=C1N=C=S ZAURWALYCYQFTL-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/95—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in positions 2 and 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Priority Applications (22)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702050640 DE2050640A1 (de) | 1970-10-15 | 1970-10-15 | Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons |
| NL7113449A NL7113449A (https=) | 1970-10-15 | 1971-09-30 | |
| US00187562A US3793320A (en) | 1970-10-15 | 1971-10-07 | Basically substituted (1h,3h)-quinazo-line-2-thion-4-one derivatives |
| DK496371A DK128211B (da) | 1970-10-15 | 1971-10-13 | Analogifremgangsmåde til fremstilling af basisk substituerede derivater af (1H,3H)-quinazolin-2-thion-4-oner. |
| SU1705172A SU416944A3 (ru) | 1970-10-15 | 1971-10-13 | Способ получения производных |
| NO380271A NO127581B (https=) | 1970-10-15 | 1971-10-14 | |
| DD15829471A DD98926A6 (https=) | 1970-10-15 | 1971-10-14 | |
| ES395980A ES395980A2 (es) | 1970-10-15 | 1971-10-14 | Procedimiento para la obtencion de derivados basicamente sustituidos de la 2,4-(1h,3h)-quinazolidiona. |
| ZA716869A ZA716869B (en) | 1970-10-15 | 1971-10-14 | Basically substituted(1h,3h)-quinazoline-2-thion-4-one derivatives |
| FR7136929A FR2110444B2 (https=) | 1970-10-15 | 1971-10-14 | |
| GB4786271A GB1327640A (en) | 1970-10-15 | 1971-10-14 | Basically substituted |
| PL15102371A PL81420B1 (https=) | 1970-10-15 | 1971-10-14 | |
| AT889271A AT311977B (de) | 1970-10-15 | 1971-10-14 | Verfahren zur Herstellung neuer basisch substituierter Derivate des (1H, 3H)-Chinazolin-2-thion-4-ons |
| CA125,120A CA947762A (en) | 1970-10-15 | 1971-10-14 | Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivatives |
| BE773965A BE773965R (fr) | 1970-10-15 | 1971-10-14 | Derives de la 2,4-(1h,3h),-quinazoline-dione, leur preparation et les medicaments en |
| AU34585/71A AU3458571A (en) | 1970-10-15 | 1971-10-14 | Basically substituted %1h,3h<-quinazoline-2-thion-4-one derivatives |
| CS723071A CS167926B2 (https=) | 1970-10-15 | 1971-10-14 | |
| RO6847371A RO58560A (https=) | 1970-10-15 | 1971-10-15 | |
| HUCA000315 HU164873B (https=) | 1970-10-15 | 1971-10-15 | |
| US00351830A US3855223A (en) | 1970-10-15 | 1973-04-17 | Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivatives |
| US00351832A US3855225A (en) | 1970-10-15 | 1973-04-17 | Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivatives |
| US00351831A US3855224A (en) | 1970-10-15 | 1973-04-17 | Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivatives |
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702050640 DE2050640A1 (de) | 1970-10-15 | 1970-10-15 | Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons |
| US18756271A | 1971-10-07 | 1971-10-07 | |
| US00351832A US3855225A (en) | 1970-10-15 | 1973-04-17 | Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivatives |
| US00351830A US3855223A (en) | 1970-10-15 | 1973-04-17 | Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivatives |
| US00351831A US3855224A (en) | 1970-10-15 | 1973-04-17 | Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2050640A1 true DE2050640A1 (de) | 1972-04-20 |
Family
ID=27510128
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702050640 Pending DE2050640A1 (de) | 1970-10-15 | 1970-10-15 | Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons |
Country Status (8)
| Country | Link |
|---|---|
| US (4) | US3793320A (https=) |
| AU (1) | AU3458571A (https=) |
| BE (1) | BE773965R (https=) |
| CA (1) | CA947762A (https=) |
| DE (1) | DE2050640A1 (https=) |
| FR (1) | FR2110444B2 (https=) |
| GB (1) | GB1327640A (https=) |
| NL (1) | NL7113449A (https=) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2050640A1 (de) * | 1970-10-15 | 1972-04-20 | Cassella Farbwerke Mainkur Ag, 6000 Frankfurt | Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3296447A (en) * | 1965-10-19 | 1967-01-03 | Searle & Co | 7-ureido-2, 4-dioxo-1, 2, 3, 4, 5, 6-hexahydro-pyrido [2, 3-d]-pyrimidines |
| DE1934036A1 (de) * | 1969-07-04 | 1971-01-07 | Cassella Farbwerke Mainkur Ag | Basisch substituierte Derivate des 2,4-(1H,3H)-Chinazolindions |
| US3712892A (en) * | 1969-08-02 | 1973-01-23 | Sumitomo Chemical Co | Quinazolinone derivatives |
| DE2020233A1 (de) * | 1970-04-25 | 1971-11-18 | Cassella Farbwerke Mainkur Ag | Basisch substituierte Derivate des 4(3H)-Chinazolinons |
| US3764600A (en) * | 1970-10-06 | 1973-10-09 | Sandoz Ag | 1-substituted-quinazoline-2(1h)-thiones |
| DE2050640A1 (de) * | 1970-10-15 | 1972-04-20 | Cassella Farbwerke Mainkur Ag, 6000 Frankfurt | Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons |
-
1970
- 1970-10-15 DE DE19702050640 patent/DE2050640A1/de active Pending
-
1971
- 1971-09-30 NL NL7113449A patent/NL7113449A/xx unknown
- 1971-10-07 US US00187562A patent/US3793320A/en not_active Expired - Lifetime
- 1971-10-14 CA CA125,120A patent/CA947762A/en not_active Expired
- 1971-10-14 AU AU34585/71A patent/AU3458571A/en not_active Expired
- 1971-10-14 GB GB4786271A patent/GB1327640A/en not_active Expired
- 1971-10-14 FR FR7136929A patent/FR2110444B2/fr not_active Expired
- 1971-10-14 BE BE773965A patent/BE773965R/xx active
-
1973
- 1973-04-17 US US00351831A patent/US3855224A/en not_active Expired - Lifetime
- 1973-04-17 US US00351832A patent/US3855225A/en not_active Expired - Lifetime
- 1973-04-17 US US00351830A patent/US3855223A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US3855224A (en) | 1974-12-17 |
| US3855225A (en) | 1974-12-17 |
| AU3458571A (en) | 1973-04-19 |
| BE773965R (fr) | 1972-04-14 |
| FR2110444A2 (https=) | 1972-06-02 |
| FR2110444B2 (https=) | 1974-09-06 |
| NL7113449A (https=) | 1972-04-18 |
| US3793320A (en) | 1974-02-19 |
| US3855223A (en) | 1974-12-17 |
| CA947762A (en) | 1974-05-21 |
| GB1327640A (en) | 1973-08-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0252482A2 (de) | 7-Acyloxy-6-aminoacyloxypolyoxylabdane, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel | |
| DE2330912C3 (de) | Verfahren zur Herstellung von Bromergolinverbindungen | |
| DE1216878B (de) | Verfahren zur Herstellung von coronargefaesserweiternden Derivaten des 7-Hydroxy-2-oxo-1, 2-dihydrochinolins | |
| DE1200831B (de) | Verfahren zur Herstellung von Thioxanthenderivaten | |
| DE1932384A1 (de) | Derivate des 2-Oxo-1,2-dihydro-chinolins | |
| DE2155578B2 (de) | Verfahren zur Herstellung von 8,9-Didehydro-10-alkoxy-ergolenderivaten | |
| DE2050640A1 (de) | Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons | |
| EP0002735A2 (de) | Verfahren zur Herstellung von Piperonylidencrotonsäureamiden | |
| EP0693071A1 (de) | Neue carbonsäureester von 2-amino-7-(1,3-dihydroxy-2-propoxymethyl)purin, deren herstellung sowie deren verwendung | |
| DE829894C (de) | Verfahren zur Herstellung neuer Derivate von 1, 8-Naphthyridin-4-carbonsaeuren | |
| DE1934036A1 (de) | Basisch substituierte Derivate des 2,4-(1H,3H)-Chinazolindions | |
| DE1570034A1 (de) | Verfahren zur Herstellung von Nikotinsaeureamiden | |
| DE922712C (de) | Verfahren zur Herstellung neuer basisch substituierter aliphatischer Carbonsaeureamide | |
| AT223747B (de) | Verfahren zur Herstellung von neuen reserpinähnlichen Pivalinsäureestern | |
| DE2003840A1 (de) | 3-Phenyl-4-acyloxycarbostyrile,Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln | |
| DE964862C (de) | Verfahren zur Herstellung von 4-(Aminopropylmercapto)-chinolinverbindungen | |
| DE2020233A1 (de) | Basisch substituierte Derivate des 4(3H)-Chinazolinons | |
| DE855712C (de) | Verfahren zur Herstellung neuer, in 8-Stellung substituierter 6, 9-Dioxy-2-amino-pteridinderivate | |
| DE1252209B (https=) | ||
| DE1078578B (de) | Verfahren zur Herstellung von Theophyllinderivaten | |
| DE1126883B (de) | Verfahren zur Herstellung von 1-Aminoalkyl-7-aza-benzimidazolen | |
| EP0315097A2 (de) | Neue Acyllabdan-Derivate, ein Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel | |
| DE1926075B2 (de) | 3-(3-Amino-3-benzoxy-propyl)-6,7,8trimethoxy-3H-lr23-benzotriazin-4-on-Derivate ihre Herstellung und Verwendung | |
| DE1010070B (de) | Verfahren zur Herstellung von quaternaeren Tropeinen | |
| DE1670468A1 (de) | Verfahren zur Herstellung von Derivaten des Cumarins |