DE2050484C3 - Verfahren zu deren Herstellung - Google Patents
Verfahren zu deren HerstellungInfo
- Publication number
- DE2050484C3 DE2050484C3 DE2050484A DE2050484A DE2050484C3 DE 2050484 C3 DE2050484 C3 DE 2050484C3 DE 2050484 A DE2050484 A DE 2050484A DE 2050484 A DE2050484 A DE 2050484A DE 2050484 C3 DE2050484 C3 DE 2050484C3
- Authority
- DE
- Germany
- Prior art keywords
- acid
- inhibition
- kallikrein
- mmol
- guanidinocaproic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title description 3
- 238000004519 manufacturing process Methods 0.000 title description 2
- RKHOXYUPLFGJIK-UHFFFAOYSA-N phenyl 6-(diaminomethylideneamino)hexanoate Chemical compound NC(=N)NCCCCCC(=O)OC1=CC=CC=C1 RKHOXYUPLFGJIK-UHFFFAOYSA-N 0.000 claims 1
- 230000005764 inhibitory process Effects 0.000 description 12
- 102000001399 Kallikrein Human genes 0.000 description 10
- 108060005987 Kallikrein Proteins 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- -1 phenol compound Chemical class 0.000 description 5
- NXZLTYWPOAOYOA-UHFFFAOYSA-N phenyl 2-(diaminomethylideneamino)hexanoate Chemical class C1(=CC=CC=C1)OC(C(CCCC)NC(=N)N)=O NXZLTYWPOAOYOA-UHFFFAOYSA-N 0.000 description 5
- XUTCRESVECITBR-UHFFFAOYSA-N 2-(diaminomethylideneamino)hexanoic acid Chemical compound CCCCC(C(O)=O)N=C(N)N XUTCRESVECITBR-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 108010039627 Aprotinin Proteins 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 108010088842 Fibrinolysin Proteins 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 210000004907 gland Anatomy 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 230000000937 inactivator Effects 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 229940012957 plasmin Drugs 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229940108519 trasylol Drugs 0.000 description 3
- 101800004538 Bradykinin Proteins 0.000 description 2
- 241000700198 Cavia Species 0.000 description 2
- QXZGBUJJYSLZLT-UHFFFAOYSA-N H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg-OH Natural products NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)N1C(C(=O)NCC(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CO)C(=O)N2C(CCC2)C(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CCCN=C(N)N)C(O)=O)CCC1 QXZGBUJJYSLZLT-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- 102100035792 Kininogen-1 Human genes 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 108090000631 Trypsin Proteins 0.000 description 2
- 102000004142 Trypsin Human genes 0.000 description 2
- QXZGBUJJYSLZLT-FDISYFBBSA-N bradykinin Chemical compound NC(=N)NCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1[C@H](C(=O)NCC(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CO)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)CCC1 QXZGBUJJYSLZLT-FDISYFBBSA-N 0.000 description 2
- 230000004856 capillary permeability Effects 0.000 description 2
- 239000005018 casein Substances 0.000 description 2
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 2
- 235000021240 caseins Nutrition 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000013065 commercial product Substances 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 229940076279 serotonin Drugs 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 239000012588 trypsin Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- KFNRNFXZFIRNEO-NSHDSACASA-N (2s)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoic acid Chemical compound CC1=CC=C(S(=O)(=O)N[C@@H](CCCN=C(N)N)C(O)=O)C=C1 KFNRNFXZFIRNEO-NSHDSACASA-N 0.000 description 1
- YGYOCOKNINCICB-UHFFFAOYSA-N 2-(diaminomethylideneamino)hexanoyl chloride Chemical compound N(\C(=N\[H])\N)C(C(=O)Cl)CCCC YGYOCOKNINCICB-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- YKGYIDJEEQRWQH-UHFFFAOYSA-N 4-[6-(diaminomethylideneamino)-1-oxohexoxy]benzoic acid ethyl ester Chemical compound CCOC(=O)C1=CC=C(OC(=O)CCCCCN=C(N)N)C=C1 YKGYIDJEEQRWQH-UHFFFAOYSA-N 0.000 description 1
- GXJWXKZNWSFMQU-UHFFFAOYSA-N 6-(diaminomethylideneamino)hexanoyl chloride Chemical compound N(C(=N[H])N)CCCCCC(=O)Cl GXJWXKZNWSFMQU-UHFFFAOYSA-N 0.000 description 1
- NSDYIDKTTPXCRH-UHFFFAOYSA-N 6-guanidinohexanoic acid Chemical compound NC(=N)NCCCCCC(O)=O NSDYIDKTTPXCRH-UHFFFAOYSA-N 0.000 description 1
- 101710081722 Antitrypsin Proteins 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 102000003827 Plasma Kallikrein Human genes 0.000 description 1
- 108090000113 Plasma Kallikrein Proteins 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 1
- 230000001475 anti-trypsic effect Effects 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000000963 caseinolytic effect Effects 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010931 ester hydrolysis Methods 0.000 description 1
- 230000000058 esterolytic effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 230000001471 fibrinogenolytic effect Effects 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 239000002753 trypsin inhibitor Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C277/00—Preparation of guanidine or its derivatives, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C277/08—Preparation of guanidine or its derivatives, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups of substituted guanidines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C279/00—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C279/04—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of guanidine groups bound to acyclic carbon atoms of a carbon skeleton
- C07C279/14—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of guanidine groups bound to acyclic carbon atoms of a carbon skeleton being further substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/76—Esters of carboxylic acids having a carboxyl group bound to a carbon atom of a six-membered aromatic ring
- C07C69/84—Esters of carboxylic acids having a carboxyl group bound to a carbon atom of a six-membered aromatic ring of monocyclic hydroxy carboxylic acids, the hydroxy groups and the carboxyl groups of which are bound to carbon atoms of a six-membered aromatic ring
- C07C69/90—Esters of carboxylic acids having a carboxyl group bound to a carbon atom of a six-membered aromatic ring of monocyclic hydroxy carboxylic acids, the hydroxy groups and the carboxyl groups of which are bound to carbon atoms of a six-membered aromatic ring with esterified hydroxyl and carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Description
worin X ein Wasserstoffatom, ein Chloratom, eine Nitrogruppe, eine Methylgruppe, eine Methoxygruppe,
eine Carboxylgruppe, eine Hydroxylgruppe, eine Carbäthoxygruppe oder ein ε-Guanidinocaproyloxyrest
ist.
2. ε-Guanidinocapronsäure-p-carbäthoxyphenylester.
3. Verfahren zur Herstellung von Guanidinocapronsäurephenylestern
nach Anspruch 1, dadurch gekennzeichnet, daß man in an sich bekannter Weise ε-Guanidinocapronsäurechlorid mit einer Phenolverbindung
der allgemeinen Formel:
Die Erfindung betrifft Guanidinocapronsäurephenylester
und ein Verfahren zu ihrer Herstellung.
Die erfindungsgemäßen Guanidinocapronsäurephenylester
werden durch die folgende allgemeine Formel wiedergegeben:
C -NH- CH2(CH2LiCH2COO
(D
worin X ein Wasserstoffatom, ein Chloratom, eine Nitrogruppe, eine Methylgruppe, eine Methoxygruppe,
eine Carboxylgruppe, eine Hydroxylgruppe, ein Carbäthoxyrest oder ein ε-Guanidinocaproyloxyrest ist.
Niedere Alkyl- bzw. Alkoxyreste sind solche mit 1 bis 4 C-Atomen. Gemäß der Erfindung können die Verbindungen
der obengenannten Formel (I) hergestellt werden, indem das Säurechlorid von ε-Guanidinocapronsäure
mit einer Phenolverbindung der allgemeinen Formel:
ίο
HO
worin X die im Anspruch 1 angegebene Bedeutung besitzt, in Anwesenheit eines Chlorwasserstoff
abspaltenden Mittels umsetzt.
Das Säurechlorid der Guanidinocapronsäure kann in üblicher, an sich für die Herstellung von Säurechloriden
aus ihren Carbonsäuren bekannter Weise hergestellt werden. So kann Guanidinocapronsäure mit einem
Chlorierungsmittel wie SOCl2, POCl3, PCl3 oder PCl5 zur
Herstellung des Säurechlorids umgesetzt werden.
Als chlorwasserstoffabspaltendes Mittel kann ein beliebiges, bekanntes, organisches, basisches, Chlorwasserstoffsäure
abspaltendes Mittel, wie Pyridin oder Collidin verwendet werden.
Die Veresterungsreaktion zwischen dem Guanidinocapronsäurechlorid und der Phenolverbindung der
allgemeinen Formel (II) wird in Anwesenheit eines inerten, nichtpolaren, organischen Lösungsmittels für
beide Reaktionsteilnehmer, z. B. Tetrahydrofuran, Benzol oder Toluol, durchgeführt.
Da die Guanidinocapronsäurephenylester der allgemeinen
Formel (I) basisch sind, werden sie vorteilhafterweise nach der Veresterungsreaktion, jedoch vor der
Isolierung und Reinigung in Säuresalze überführt. Beispiele von Säuren, die mit den Guanidinocapronsäurephenylestern
Säuresalze bilden können, sind Chlorwasserstoffsäure, Schwefelsäure, Oxalsäure, Weinsäure,
Toluolsulfonsäure. Ebenfalls ist es möglich, die Guanidinocapronsäure in das Säuresalz umzuwandeln, bevor
diese in das Säurechlorid umgewandelt wird, oder bevor dieses mit der Phenol verbindung umgesetzt wird.
Die folgenden Beispiele erläutern die Herstellung der erfindungsgemäßen Verbindungen:
7 g e-Guanidinocapronsäure-p-tosylsalz und 21 g
Thionylchlorid wurden zusammen vermischt, um bei Raumtemperatur miteinander zu reagieren. Es trat eine
endotherme Reaktion auf und die Säure löste sich allmählich auf. Dann wurde das Reaktionsgemisch 1 bis
2 h stehengelassen und mit 100 ml Äther extrahiert. Die untere, ölige Schicht und die Ätherschicht wurden
voneinander getrennt, und die untere Schicht wurde wiederholt mit Äther gewaschen. Dann wurde die ölige
Substanz (Säurechlorid) mit 2 g Phenol in 50 ml Tetrahydrofuran versetzt, und das Gemisch wurde
gerührt. Nachdem die Mischung zu einer einheitlichen Lösung geworden war, wurden 2 g Pyridin allmählich
zugefügt. Es trat eine exotherme Reaktion auf, und in der unteren Schicht trennte sich eine ölige Substanz ab.
Nach Abschluß der Reaktion wurde die ölige Substanz mit Wasser gewaschen und dann aus heißem Wasser
ein- oder zweimal umkristallisicrl. Auf diese Weise wurde das e-Guanidinocapronsäurephenylester-p-tosylsalz
als weiße Krislalle mit einem Schmelzpunkt von 101 — 1030C erhalten. Die Elemenlar-Analyse auf
C20H27N jOiS ergab folgende Werte:
Il
Gefunden (%)
Berechnet ("/„)
Berechnet ("/„)
56,87
56,99
56,99
6,34
6,46
6,46
9,84
9,98
9,98
(H)
worin X die oben angegebene Bedeutung besitzt, in Anwesenheit eines Chlorwasserstoff abspaltenden Mittels
umgesetzt wird.
Beispiele 2 bis 9
In einer gleichartigen Weise wie im Beispiel I wurden
die folgenden Verbindungen als p-Tosylsal/.c hergestellt:
Η-,Ν
HN
C— NHCH2(CH2UCh2COO -<fV-X
| Beispiel | χ | CNHCH,(CH,)3CH,COO | Schmelzpunkt |
| (°C) | |||
| 2 | CI | 108—110 | |
| 3 | NO, | 114—115 | |
| 4 | CH3 | 108—109 | |
| 5 | CH3O | 112—114 | |
| 6 | COOH | 186—188 | |
| 7 | OH | 111—113 | |
| 8 | C2H5OCO | 130—133 | |
| Η,Ν | |||
| " \ | |||
| 9 | 172—174 |
HN
Die e-Guanidinocapronsäurephenylester der Erfindung sind neue Verbindungen. Sie besitzen eine niedrige
Toxizität (siehe Tabelle I), und sie besitzen eine inhibitorische Wirkung auf die Hydrolyse von N-Tosyl-L-argininmeihylester
durch Kallikrein, auf die Hydrolyse von Casein durch Trypsin und die fibrinogenoiytische
Aktivität von Plasmin (siehe Tabellen II, 111 und IV). J<
> Darüber hinaus besitzen sie eine inhibitorische Wirkung auf die Kapillarpermeabilität von Histamin, Serotonin,
Bradykinin und Kallikrein in Albino-Meerschweinchen (sieheTabelle V).
Daher sind die erfindungsgemäßen Ester für medizi- 3r>
nische Zwecke als Antikallikrcin-, Antitrypsin- und Antiplasminmittel brauchbar.
Aus der DE-OS 18 04 999 sind bereits ähnliche Verbindungen bekannt, die ebenfalls inhibierend auf die
Esterhydrolyse durch Kallikrein und auf die Caseinhy- 4<i
drolyse durch Plasmin wirken. Diese bekannten Verbindungen haben jedoch eine bis zu hundertfach
inhibierung der esterolytischen Aktivität von Plasma-Kallikrein
geringere Wirkung als die erfindungsgemäßen Verbindungen (vgl. die Zahlenangaben auf S. 4 der DE-OS
18 04 999).
| Tabelle I | LD50 mg/kg |
| Beispiel | (Mäuse i. p.) |
| 190 | |
| 1 | 178 |
| 2 | 118 |
| 3 | 227 |
| 4 | 212 |
| 5 | 200 |
| 6 | 112 |
| 7 | 156 |
| 8 | 129 |
| 9 | |
% Inhihicrung
molare Konzentration des Inhibitors
| 0,5 niMol | 0,1 mMol | 0,05 mMol | 0,01 mMol | 0,005 mMol |
| 94,6 | 80,5 | ■ 71,5 | 31,7 | 20,6 |
| 100 | 90,0 | 82,6 | 59,5 | 42,0 |
| 100 | 97,0 | 94,5 | 81,0 | 51,0 |
| 100 | 89,0 | 80,6 | 38,0 | 12,7 |
| 100 | 85,5 | 73,9 | 46,4 | 30,3 |
| 72,0 | 37,5 | 21,8 | 14,0 | - |
| 92,0 | 74,0 | 53,2 | 25,8 | 11,3 |
| 100 | 97,0 | 87,0 | 67,7 | 42,2 |
| 100 | 94,8 | 92,5 | 73,2 | 51,0 |
| 8,2 | 5,5 | 0 | 0 | 0 |
| (5KlE**)) | (IKIE) | (OJ. KIE) | (0,1 KIE) | (0,05KIE) |
Trasylol*)
*) llandclsprodukt von Bayer (aus tierischen Drüsen gewonnener Kallikrein-Inaktivator).
**) KI12 = Kallikrein-Inhibicrungs-Einhcit,
Inhibierung der caseinolytischen Aktivität von Trypsin
% Inhibierung molare Konzentration des Inhibitors
| 1 mMol | 0,5 mMol | 0,1 mMol | 0,05 r.)Mol | 0,01 |
| 91,8 | 83,7 | 48,3 | 32,7 | 2,5 |
| 96,6 | 89,4 | 73,6 | 63,2 | 27,7 |
| 96,2 | 93,6 | 87,6 | 84,3 | 51,7 |
| 95,4 | 91,6 | 63,5 | 39,5 | 18,0 |
| 98,0 | 88,4 | 45,0 | 35,5 | 6,5 |
| 97,4 | 89,0 | 61,6 | 41,3 | 15,7 |
| 94,5 | 82,0 | 47,2 | 30,3 | 2,2 |
| 96,3 | 95,6 | 94,0 | 90,5 | 62,6 |
| 100 | 97,1 | 93,5 | 90,6 | 71,4 |
| 83,0 | 35,8 | 12,2 | - | - |
| (10 KIE**)) | (5 KIE) | (IKIE) |
Trasylol*)
*) Handelsprodukt von Bayer (aus tierischen Drüsen gewonnener Kallikrein-Inaktivator).
**) KIE = Kallikrein-Inhibiemngs-EinheiL
Inhibierung der fibrinogenolytischen Aktivität von Plasmin
% Inhibierung molare Konzentration des Inhibitors
1 mMol 0,5 mMol
0,1 mMol
| 0,05 mMol | 0,01 mMol |
| 15,8 | _ |
| 63,0 | 21,2 |
| 83,5 | 40,5 |
| 42,5 | 10,2 |
| 45,5 | 7,5 |
| 53,2 | 13,4 |
| 15,8 | 8,5 |
| 82,0 | 39,5 |
| 70,5 | 32,6 |
2 3 4 5 6 7 8 9 Trasylol*)
100 100 100 97,5 92,5 100 94,6 100 100
80,7 (10 KIE**))
83,5 100 100
96,0
89,5
97,0
90,3 100 100
29,7 (5 KIE)
32,6 84,0 93,0 57,5 63,5 71,3 34,2 90,2 89,5
19,9 (IKIE)
*) Handelsprodukt von Bayer (aus tierischen Drüsen gewonnener Kallikrein-Inaktivator).
**) KIE = Kallikrein-Inhibierungs-Einheit.
Inhibitorische Wirkung von p-Carbäthoxyphenyl-r-guanidinocaproat (Beispiel 8) auf die Kapillarpermeabilität
bei Meerschweinchen
| Dosis | Histamin- | Serotonin- | Bradykinin- | Kallikrein- |
| (mg/kg) | Inhibierung | Inhibierung | Inhibierung | Inhibierung |
| 1. p. | (%) | (%) | (%) | (%) |
| 50 | 0 | 0 | 15 | 17 |
| 100 | 33 | 34 | 33 | 29 |
| 200 | 59 | 50 | 53 | 60 |
Claims (1)
1. ε-Guanidinocapronsäurephenylester der allgemeinen
Formel:
, N
HN
C-NHCH2(CH2J3Ch2COO-
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP44082103A JPS492107B1 (de) | 1969-10-14 | 1969-10-14 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2050484A1 DE2050484A1 (de) | 1971-04-22 |
| DE2050484B2 DE2050484B2 (de) | 1979-06-21 |
| DE2050484C3 true DE2050484C3 (de) | 1980-02-28 |
Family
ID=13765063
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2050484A Expired DE2050484C3 (de) | 1969-10-14 | 1970-10-14 | Verfahren zu deren Herstellung |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3751447A (de) |
| JP (1) | JPS492107B1 (de) |
| BE (1) | BE757496A (de) |
| CH (1) | CH538454A (de) |
| DE (1) | DE2050484C3 (de) |
| FR (1) | FR2070129B1 (de) |
| GB (1) | GB1324714A (de) |
| SE (1) | SE361470B (de) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS51131124A (en) * | 1975-05-10 | 1976-11-15 | Sekisui Chemical Co Ltd | Form keeping method of air beam |
| JPS5622020U (de) * | 1979-07-31 | 1981-02-27 | ||
| JPS58218533A (ja) * | 1982-06-12 | 1983-12-19 | 村井 邦彦 | 全空気袋テント |
| US4812590A (en) * | 1987-06-25 | 1989-03-14 | Merck & Co., Inc. | Carbamates of 4-hydroxyanisole as prodrugs for chemotherapy of melanoma |
| ATE119523T1 (de) * | 1989-12-28 | 1995-03-15 | Snow Brand Milk Products Co Ltd | Isochinolinderivate und ihre salze als proteasehemmer. |
| JPH0656396U (ja) * | 1992-12-30 | 1994-08-05 | アキレス株式会社 | エアーチューブテント |
| JPH07243272A (ja) * | 1994-03-07 | 1995-09-19 | Mamoru Okamitsu | 簡易テント |
| EP0893437A4 (de) | 1996-04-10 | 2000-12-27 | Ono Pharmaceutical Co | Tryptase-Inhibitor und Guanidino-Derivate |
| AU736951C (en) | 1998-03-19 | 2003-02-20 | Bristol-Myers Squibb Company | Biphasic controlled release delivery system for high solubility pharmaceuticals and method |
| JP2006096668A (ja) * | 2002-11-08 | 2006-04-13 | Ono Pharmaceut Co Ltd | エラスターゼ阻害剤と血液凝固系および／または線溶系酵素阻害剤との組み合わせからなる医薬 |
| JP6042330B2 (ja) | 2010-07-09 | 2016-12-14 | ビーエイチヴィ ファーマ、インコーポレイテッド | レモグリフロジンを含めた半減期が短い医薬品のための組合せ即時／遅延放出送達システム |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1238894A (de) * | 1967-10-24 | 1971-07-14 |
-
0
- BE BE757496D patent/BE757496A/xx not_active IP Right Cessation
-
1969
- 1969-10-14 JP JP44082103A patent/JPS492107B1/ja active Pending
-
1970
- 1970-10-13 FR FR7036984A patent/FR2070129B1/fr not_active Expired
- 1970-10-13 SE SE13842/70A patent/SE361470B/xx unknown
- 1970-10-14 US US00080800A patent/US3751447A/en not_active Expired - Lifetime
- 1970-10-14 CH CH1519570A patent/CH538454A/de not_active IP Right Cessation
- 1970-10-14 GB GB4892170A patent/GB1324714A/en not_active Expired
- 1970-10-14 DE DE2050484A patent/DE2050484C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2070129B1 (de) | 1974-05-24 |
| DE2050484B2 (de) | 1979-06-21 |
| JPS492107B1 (de) | 1974-01-18 |
| DE2050484A1 (de) | 1971-04-22 |
| US3751447A (en) | 1973-08-07 |
| BE757496A (fr) | 1971-03-16 |
| CH538454A (de) | 1973-06-30 |
| GB1324714A (en) | 1973-07-25 |
| FR2070129A1 (de) | 1971-09-10 |
| SE361470B (de) | 1973-11-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2050484C3 (de) | Verfahren zu deren Herstellung | |
| DE2310141A1 (de) | Verfahren zur herstellung von 1phenyl-2-aminoaethanolderivaten | |
| DE3150005A1 (de) | Verfahren zur herstellung von chinolinsaeure | |
| DE2627223C2 (de) | ||
| DE1227914B (de) | Verfahren zur Herstellung von 3-(1, 2-Dithia-cyclopentyl)-5-pentansaeure | |
| CH616416A5 (de) | ||
| DE2627985C3 (de) | 4-Homoisotwistan-3-carbonsäureester und Verfahren zu ihrer Herstellung | |
| DE3223877A1 (de) | Isocarbostyrilderivate, verfahren zu deren herstellung und diese enthaltende arzneimittel | |
| EP0533131B1 (de) | Verfahren zur selektiven Mono-ortho-Hydroxyalkylierung von 4-substituierten Pyridin-Derivaten | |
| EP0003107B1 (de) | Verfahren zur Herstellung von Furancarbonsäureanilid | |
| DE940828C (de) | Verfahren zur Herstellung von Estern des Penicillins mit Phenolen und Thiophenolen | |
| DE2221123C2 (de) | Reserpsäurederivate, Verfahren zu deren Herstellung und Arzneimittel | |
| AT372680B (de) | Verfahren zur herstellung von 1-hydroxy-aporphinderivaten | |
| AT219602B (de) | Verfahren zur Herstellung von neuen Thioxanthen-Derivaten | |
| AT222653B (de) | Verfahren zur Herstellung von neuen Azepinderivaten | |
| AT358059B (de) | Verfahren zur herstellung von neuen oxiranen | |
| AT232993B (de) | Verfahren zur Herstellung von Methylestern aromatischer Polyhalogencarbonsäuren | |
| AT339477B (de) | Verfahren zur herstellung von cephalosporansaurederivaten | |
| DE2513952C2 (de) | Verfahren zur herstellung von monochlorbenzoesaeuren | |
| AT219605B (de) | Verfahren zur Herstellung von neuen Thioxanthen-Derivaten | |
| AT225185B (de) | Verfahren zur Herstellung von neuen substituierten Triphenylcarbinolen | |
| DE3120909A1 (de) | Verfahren zur gewinnung von bamifyllin und nach diesem verfahren hergestelltes bamifyllin | |
| DE1545764C (de) | p Chlorphenvhsopropylcarbinol nico tinsaureester | |
| DE3834029A1 (de) | Verfahren zur herstellung von symmetrischen und unsymmetrischen monoacetalen aromatischer 1,2-diketone | |
| DE2307248C3 (de) | 4-NKrodiphenyläthersulfide, -sulfoxide und -sulfone, Verfahren zu ihrer Herstellung und ihre Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |