DE2019821C3 - Phenoxybenzoesäureverbindungen, Verfahren zu deren Herstellung und Verwendung - Google Patents
Phenoxybenzoesäureverbindungen, Verfahren zu deren Herstellung und VerwendungInfo
- Publication number
- DE2019821C3 DE2019821C3 DE2019821A DE2019821A DE2019821C3 DE 2019821 C3 DE2019821 C3 DE 2019821C3 DE 2019821 A DE2019821 A DE 2019821A DE 2019821 A DE2019821 A DE 2019821A DE 2019821 C3 DE2019821 C3 DE 2019821C3
- Authority
- DE
- Germany
- Prior art keywords
- nitro
- compounds
- phenoxybenzoic acid
- emergence
- benzoic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- PKRSYEPBQPFNRB-UHFFFAOYSA-N 2-phenoxybenzoic acid Chemical class OC(=O)C1=CC=CC=C1OC1=CC=CC=C1 PKRSYEPBQPFNRB-UHFFFAOYSA-N 0.000 title claims description 4
- 238000000034 method Methods 0.000 title description 10
- 238000002360 preparation method Methods 0.000 title description 2
- 239000000460 chlorine Substances 0.000 claims description 13
- 230000002363 herbicidal effect Effects 0.000 claims description 10
- -1 alkali metal salt Chemical class 0.000 claims description 9
- 239000004009 herbicide Substances 0.000 claims description 7
- 229910052700 potassium Inorganic materials 0.000 claims description 5
- 229910052708 sodium Inorganic materials 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001408 amides Chemical class 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 125000005210 alkyl ammonium group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims 1
- 238000010702 ether synthesis reaction Methods 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 21
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 14
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 12
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 8
- 239000007921 spray Substances 0.000 description 8
- 241000196324 Embryophyta Species 0.000 description 6
- 244000299507 Gossypium hirsutum Species 0.000 description 6
- 240000008042 Zea mays Species 0.000 description 6
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 6
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 6
- 235000010233 benzoic acid Nutrition 0.000 description 6
- 235000005822 corn Nutrition 0.000 description 6
- 239000005711 Benzoic acid Substances 0.000 description 5
- 235000011293 Brassica napus Nutrition 0.000 description 5
- 240000008100 Brassica rapa Species 0.000 description 5
- 235000000540 Brassica rapa subsp rapa Nutrition 0.000 description 5
- 244000046052 Phaseolus vulgaris Species 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 241000132536 Cirsium Species 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 4
- 244000058871 Echinochloa crus-galli Species 0.000 description 4
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 4
- 235000008515 Setaria glauca Nutrition 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 244000152970 Digitaria sanguinalis Species 0.000 description 3
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 3
- 235000001155 Setaria leucopila Nutrition 0.000 description 3
- 244000010062 Setaria pumila Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 230000018109 developmental process Effects 0.000 description 3
- 230000002262 irrigation Effects 0.000 description 3
- 238000003973 irrigation Methods 0.000 description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 235000001602 Digitaria X umfolozi Nutrition 0.000 description 2
- 235000017898 Digitaria ciliaris Nutrition 0.000 description 2
- 235000005476 Digitaria cruciata Nutrition 0.000 description 2
- 235000006830 Digitaria didactyla Nutrition 0.000 description 2
- 235000005804 Digitaria eriantha ssp. eriantha Nutrition 0.000 description 2
- 235000014716 Eleusine indica Nutrition 0.000 description 2
- 241000287828 Gallus gallus Species 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 240000002439 Sorghum halepense Species 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 230000035784 germination Effects 0.000 description 2
- 229940095102 methyl benzoate Drugs 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 1
- RYAQFHLUEMJOMF-UHFFFAOYSA-N 4-phenoxybenzoic acid Chemical class C1=CC(C(=O)O)=CC=C1OC1=CC=CC=C1 RYAQFHLUEMJOMF-UHFFFAOYSA-N 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- 240000001592 Amaranthus caudatus Species 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- 244000237956 Amaranthus retroflexus Species 0.000 description 1
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 1
- 235000011331 Brassica Nutrition 0.000 description 1
- 241000220243 Brassica sp. Species 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 1
- ILUJQPXNXACGAN-UHFFFAOYSA-N O-methylsalicylic acid Chemical class COC1=CC=CC=C1C(O)=O ILUJQPXNXACGAN-UHFFFAOYSA-N 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 244000115721 Pennisetum typhoides Species 0.000 description 1
- 235000007195 Pennisetum typhoides Nutrition 0.000 description 1
- 241000219833 Phaseolus Species 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 235000012735 amaranth Nutrition 0.000 description 1
- 239000004178 amaranth Substances 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- MBYYOUILTPYXTM-UHFFFAOYSA-N benzamide;sodium Chemical compound [Na].NC(=O)C1=CC=CC=C1 MBYYOUILTPYXTM-UHFFFAOYSA-N 0.000 description 1
- UDEWPOVQBGFNGE-UHFFFAOYSA-N benzoic acid n-propyl ester Natural products CCCOC(=O)C1=CC=CC=C1 UDEWPOVQBGFNGE-UHFFFAOYSA-N 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Inorganic materials [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- ZOMBKNNSYQHRCA-UHFFFAOYSA-J calcium sulfate hemihydrate Chemical compound O.[Ca+2].[Ca+2].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O ZOMBKNNSYQHRCA-UHFFFAOYSA-J 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229940126543 compound 14 Drugs 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 244000013123 dwarf bean Species 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000005909 ethyl alcohol group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 235000021331 green beans Nutrition 0.000 description 1
- 239000011507 gypsum plaster Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- OLXYLDUSSBULGU-UHFFFAOYSA-N methyl pyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC=C1 OLXYLDUSSBULGU-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 238000005121 nitriding Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- FCJSHPDYVMKCHI-UHFFFAOYSA-N phenyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OC1=CC=CC=C1 FCJSHPDYVMKCHI-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 238000004382 potting Methods 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/57—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/59—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US81941269A | 1969-04-25 | 1969-04-25 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2019821A1 DE2019821A1 (de) | 1970-11-12 |
| DE2019821B2 DE2019821B2 (de) | 1979-05-31 |
| DE2019821C3 true DE2019821C3 (de) | 1980-01-31 |
Family
ID=25228078
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2019821A Expired DE2019821C3 (de) | 1969-04-25 | 1970-04-23 | Phenoxybenzoesäureverbindungen, Verfahren zu deren Herstellung und Verwendung |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3652645A (enExample) |
| JP (1) | JPS4843609B1 (enExample) |
| BE (1) | BE749444A (enExample) |
| CA (1) | CA971973A (enExample) |
| DE (1) | DE2019821C3 (enExample) |
| FR (1) | FR2040235B1 (enExample) |
| GB (1) | GB1232368A (enExample) |
| NL (1) | NL163771C (enExample) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USRE32316E (en) * | 1969-04-25 | 1986-12-30 | Rhone-Poulenc Agrochimie | Substituted phenoxybenzoic acids and derivatives thereof |
| USRE32550E (en) * | 1969-04-25 | 1987-11-24 | Rhone-Poulenc Agrochimie | Halophenoxy benzamide herbicides |
| USRE32243E (en) * | 1969-04-25 | 1986-09-09 | Rhone-Poulenc Agrochimie | Esters of substituted phenoxybenzoic acids, compositions of the same and herbicidal use thereof |
| USRE32216E (en) * | 1969-04-25 | 1986-07-29 | Rhone-Poulenc Agrochimie | Salts of substituted phenoxybenzoic acids, compositions of the same and herbicidal use thereof |
| US4001322A (en) * | 1969-05-28 | 1977-01-04 | Eli Lilly And Company | 3-substituted phenylalkyl amines |
| US4164410A (en) * | 1971-02-11 | 1979-08-14 | Mobil Oil Corp. | Esters of substituted phenoxybenzoic acids, compositions of the same and herbicidal use thereof |
| USRE32215E (en) * | 1971-02-11 | 1986-07-22 | Rhone-Poulenc Agrochimie | Substituted phenoxybenzoic acids compositions of the same and herbicidal use thereof |
| US4164409A (en) * | 1971-02-11 | 1979-08-14 | Mobil Oil Corp. | Substituted phenoxybenzoic acids, compositions of the same and herbicidal use thereof |
| USRE31455E (en) * | 1972-03-14 | 1983-12-06 | Rohm And Haas Company | Herbicidal 4-trifluoromethyl-4-nitrodiphenyl ethers |
| USRE31731E (en) * | 1972-03-14 | 1984-11-13 | Herbicidal 4-trifluoromethyl-4-nitrodiphenyl ethers | |
| NL175780C (nl) * | 1972-11-17 | 1985-01-02 | Rhone Poulenc Inc | Werkwijze voor het bereiden van een herbicide preparaat, dat ten minste een fenoxynitrobenzoaat bevat. |
| BE811344R (fr) * | 1973-02-22 | 1974-08-20 | Acides halophenoxybenzoiques herbicides | |
| JPS5013527A (enExample) * | 1973-06-08 | 1975-02-13 | ||
| US3983168A (en) * | 1973-08-13 | 1976-09-28 | Mobil Oil Corporation | Halophenoxy benzoic acid salts |
| JPS5857403B2 (ja) * | 1973-08-20 | 1983-12-20 | ホクコウカガクコウギヨウ カブシキガイシヤ | ジヨソウザイソセイブツ |
| JPS5924122B2 (ja) * | 1973-08-20 | 1984-06-07 | 北興化学工業 (株) | 除草剤組成物 |
| JPS5857402B2 (ja) * | 1973-08-20 | 1983-12-20 | ホクコウカガクコウギヨウ カブシキガイシヤ | ジヨソウザイソセイブツ |
| US4067892A (en) * | 1973-08-23 | 1978-01-10 | Beecham Group Limited | Substituted (4-carboxyphenoxy) phenyl alkane compounds |
| US4681622A (en) * | 1973-09-19 | 1987-07-21 | Rhone-Poulenc Agrochimie | Substituted phenoxybenzoic acids and derivatives thereof as herbicides |
| US4606758A (en) * | 1973-09-19 | 1986-08-19 | Rhone-Poulenc Agrochimie | Substituted phenoxybenzoic acids and derivative thereof as herbicides |
| US4001005A (en) * | 1974-06-07 | 1977-01-04 | Mobil Oil Corporation | Herbicidal compositions comprising halophenoxy benzoic acid esters |
| DK189677A (da) * | 1976-05-07 | 1977-11-08 | Sumitomo Chemical Co | M-phenoxybenzamid-derivater |
| SE7906014L (sv) * | 1978-07-15 | 1980-01-16 | Lilly Industries Ltd | Herbicid |
| US4445930A (en) * | 1978-09-01 | 1984-05-01 | Rohm And Haas Company | Herbicidal 4-trifluoromethyl-4-nitrodiphenyl ethers |
| CA1129665A (en) * | 1978-12-21 | 1982-08-17 | James L. Glasgow | Method of combating weeds in cereal crops and herbicidal formulation therefor |
| US4455437A (en) * | 1979-01-09 | 1984-06-19 | Ciba-Geigy Corporation | Aminoalkyl esters of 2-nitro-5-(o-chloro-p-trifluoromethylphenoxy)-benzoic acid |
| US4344789A (en) * | 1979-05-11 | 1982-08-17 | Ppg Industries, Inc. | Acids and esters of 5-(2-optionally substituted-4-trifluoromethyl-6-optionally substituted phenoxy)-2-nitro, -halo, or-cyano alpha substituted phenyl carboxy oximes, and method of controlling weeds with them |
| US4375981A (en) * | 1979-05-14 | 1983-03-08 | Ppg Industries, Inc. | Method for controlling weed growth using herbicidally 5-(2-chloro-4-trifluoromethyl)-, or (4-trifluoromethyl or 2,6-dichloro-4-trifluoromethylphenoxy)-2-nitro-substituted carbonyl oxime-O-alkyl ethers |
| US4263227A (en) * | 1979-05-14 | 1981-04-21 | Ppg Industries, Inc. | 5-(2-Chloro-4-trifluoromethyl)-, or (4-trifluoromethyl or 2,6-dichloro-4-trifluoromethylphenoxy)-2-nitro-substituted carbonyl oxime-O-alkyl ethers |
| US4415354A (en) * | 1980-01-14 | 1983-11-15 | Rohm And Haas Company | Herbicidal 4-trifluoromethyl-4-nitrodiphenyl ethers |
| US4551171A (en) * | 1980-02-01 | 1985-11-05 | Rhone-Poulenc, Inc. | 2-Nitro-5-(substituted-phenoxy) phenylalkanone oxime and imine derivatives as herbicides |
| DE3161525D1 (en) * | 1980-03-05 | 1984-01-05 | Ciba Geigy Ag | Herbicidally active 2-nitro-5-phenoxyphenyl oxazoles, oxazines, imidazoles, pyrimidines and thiazoles, their preparation and their use |
| ATE14364T1 (de) * | 1981-11-07 | 1985-08-15 | Siegfried Ag | Verfahren zur bekaempfung eines breiten spektrums von unkraeutern in kulturen und zusammensetzung fuer dieses verfahren. |
| EP0109575A3 (de) * | 1982-11-04 | 1984-09-05 | F. HOFFMANN-LA ROCHE & CO. Aktiengesellschaft | Benzoesäurederivate, Verfahren und Mittel zu deren Herstellung |
| HU193466B (en) | 1984-11-12 | 1987-10-28 | Budapesti Vegyimuevek | Fungicidal composition comprising 2-nitrobenzoic acid derivative as active substance |
| US5024691A (en) * | 1985-02-25 | 1991-06-18 | Ici Americas Inc. | Substituted phenoxy benzamide herbicides and methods of use |
| DE3833549A1 (de) * | 1988-10-01 | 1990-04-12 | Bayer Ag | Substituierte phenoxyphenylsulfonylazole, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide und pflanzenwuchsregulatoren |
| PH30449A (en) * | 1991-11-25 | 1997-05-28 | Lilly Co Eli | Substituted phenyl phenol leukotriene antagonists |
| US6335445B1 (en) * | 1997-03-24 | 2002-01-01 | Societe De Conseils De Recherches Et D'applications Scientifiques (S.C.R.A.S.) | Derivatives of 2-(iminomethyl)amino-phenyl, their preparation, their use as medicaments and the pharmaceutical compositions containing them |
| EP2052607A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037622A1 (de) | 2008-08-14 | 2010-02-25 | Bayer Cropscience Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| EP3094179B1 (en) | 2014-01-14 | 2020-10-21 | Adama Agan Ltd. | Herbicidal mixtures, compositions and uses thereof |
-
1969
- 1969-04-25 US US819412A patent/US3652645A/en not_active Expired - Lifetime
-
1970
- 1970-04-20 CA CA080,519A patent/CA971973A/en not_active Expired
- 1970-04-21 NL NL7005783.A patent/NL163771C/xx not_active IP Right Cessation
- 1970-04-22 JP JP45033936A patent/JPS4843609B1/ja active Pending
- 1970-04-23 BE BE749444D patent/BE749444A/xx not_active IP Right Cessation
- 1970-04-23 GB GB1232368D patent/GB1232368A/en not_active Expired
- 1970-04-23 DE DE2019821A patent/DE2019821C3/de not_active Expired
- 1970-04-24 FR FR707015141A patent/FR2040235B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2040235A1 (enExample) | 1971-01-22 |
| CA971973A (en) | 1975-07-29 |
| DE2019821B2 (de) | 1979-05-31 |
| JPS4843609B1 (enExample) | 1973-12-19 |
| NL7005783A (enExample) | 1970-10-27 |
| US3652645B1 (enExample) | 1984-07-24 |
| NL163771B (nl) | 1980-05-16 |
| DE2019821A1 (de) | 1970-11-12 |
| FR2040235B1 (enExample) | 1974-07-12 |
| GB1232368A (enExample) | 1971-05-19 |
| BE749444A (fr) | 1970-10-23 |
| NL163771C (nl) | 1980-10-15 |
| US3652645A (en) | 1972-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2019821C3 (de) | Phenoxybenzoesäureverbindungen, Verfahren zu deren Herstellung und Verwendung | |
| DE2525399C2 (de) | Höhere Halogenphenoxybenzoesäureester und diese enthaltende herbizid wirksame Masse | |
| DE2744137C2 (de) | N,N-Disubstituierte Benzolsulfonamid-Derivate, Verfahren zu deren Herstellung und diese Verbindungen enthaltende herbizide Zusammensetzung | |
| DE2603877C2 (de) | Oxadiazolinonverbindungen, ihre Herstellung und sie enthaltendes Mittel | |
| DE1518432B2 (de) | 2-methoxy-3,6-dichlorbenzylalkohol und dessen ester, verfahren zu ihrer herstellung und ihre verwendung als pestizide bzw. herbizide | |
| DE1137259B (de) | Selektive Bekaempfung von Fingerhirse | |
| DE2356812C3 (de) | Herbizides Mittel auf Basis von Gemischen mit Phenoxynitrobenzoesäurederivaten | |
| DE3029728A1 (de) | Substituierte diphenylaether und sie enthaltende herbizide zusammensetzungen | |
| DE2365677B2 (de) | Verwendung von N-(3,5-Dichlorphenyl)-7-oxabicyclo [2.2.1] heptan-2,3-dicarboximid zur Bekämpfung von Pilzen | |
| DE2061133A1 (de) | Pestizide Verbindung,Verfahren zu ihrer Herstellung und Verwendung | |
| DE1618968C2 (enExample) | ||
| DE2265535B2 (de) | Herbizide Mittel und ihre Verwendung als Pflanzenwuchsregler | |
| DE2644486C2 (de) | Substituierte Phenoxybenzoesäureanhydride, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbicide | |
| DE2408433A1 (de) | Phenoxybenzoesaeureverbindungen und diese enthaltende herbizide mittel | |
| DE2408432C2 (de) | Phenoxybenzoesäureverbindungen sowie diese Verbindungen enthaltende herbizide Mittel | |
| DE2533172C3 (de) | Herbizides Mittel auf Basis von Nitrophenolätherderivaten | |
| DE2013955A1 (de) | Insektizides und fungizides Mittel zur Verwendung in Landwirtschaft und Gartenbau | |
| DE2033454C3 (de) | 1-Oxa- bzw. 1-Thia-3-amlnocarbonyloximino-cyclopentane bzw. cyclohexane, Verfahren zu ihrer Herstellung und deren Verwendung | |
| DE2154634A1 (enExample) | ||
| DE3038083A1 (de) | 5-(2'-chlor-4'-trifluormethylphenoxy)-2-nitrostyrolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende herbizide mittel | |
| DE1542956C3 (de) | N-Carbyloxymethyl-substituierte 2-Alky] 6-tert.-buly]-anilide und herbicide Zubereitungen | |
| DE2152947A1 (en) | Selective herbicide for paddy fields - contg a 1-phenyl -3, 3-dimethyl-urea and a thiocarbamate | |
| DE2000347C (de) | N Polychlorvinylsulfenylharnstoffe und deren Verwendung | |
| DE1493988A1 (de) | Selektive Vorauflaufherbizide | |
| DE1518432C3 (de) | 2-Methoxy-3,6-dichlorbenzylalkohol und dessen Ester, Verfahren zu ihrer Herstellung und ihre Verwendung als Pestizide bzw. Herbizide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: RHONE-POULENC INC., NEW YORK, N.Y:, US |
|
| 8328 | Change in the person/name/address of the agent |
Free format text: KOHLER, M., DIPL.-CHEM. DR.RER.NAT. GERNHARDT, C., DIPL.-ING., 8000 MUENCHEN GLAESER, J., DIPL.-ING., PAT.-ANW., 2000 HAMBURG |
|
| AG | Has addition no. |
Ref country code: DE Ref document number: 2408432 Format of ref document f/p: P |
|
| 8328 | Change in the person/name/address of the agent |
Free format text: KOHLER, M., DIPL.-CHEM. DR.RER.NAT., 8000 MUENCHEN GLAESER, J., DIPL.-ING., PAT.-ANW., 2000 HAMBURG |