DE2012389C3 - Verfahren zur Herstellung von lichtempfindlichen Polyvinylestern - Google Patents
Verfahren zur Herstellung von lichtempfindlichen PolyvinylesternInfo
- Publication number
- DE2012389C3 DE2012389C3 DE2012389A DE2012389A DE2012389C3 DE 2012389 C3 DE2012389 C3 DE 2012389C3 DE 2012389 A DE2012389 A DE 2012389A DE 2012389 A DE2012389 A DE 2012389A DE 2012389 C3 DE2012389 C3 DE 2012389C3
- Authority
- DE
- Germany
- Prior art keywords
- chloride
- polyvinyl
- polyvinyl alcohol
- esterification
- photosensitive
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001290 polyvinyl ester Polymers 0.000 title claims description 35
- 238000000034 method Methods 0.000 title claims description 22
- 238000004519 manufacturing process Methods 0.000 title claims description 7
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 40
- 239000004372 Polyvinyl alcohol Substances 0.000 claims description 35
- -1 aroyl chloride Chemical compound 0.000 claims description 34
- 238000005886 esterification reaction Methods 0.000 claims description 19
- 230000032050 esterification Effects 0.000 claims description 18
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 8
- 150000001805 chlorine compounds Chemical class 0.000 claims description 7
- 150000003512 tertiary amines Chemical class 0.000 claims description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical group CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 2
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 38
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 16
- 239000000203 mixture Substances 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 11
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- WOGITNXCNOTRLK-VOTSOKGWSA-N (e)-3-phenylprop-2-enoyl chloride Chemical compound ClC(=O)\C=C\C1=CC=CC=C1 WOGITNXCNOTRLK-VOTSOKGWSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 206010034972 Photosensitivity reaction Diseases 0.000 description 6
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 6
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical group ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 230000036211 photosensitivity Effects 0.000 description 6
- 229920002554 vinyl polymer Polymers 0.000 description 6
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- IBQDPNHVFRFCFK-UHFFFAOYSA-N 4-pentoxybenzoyl chloride Chemical compound CCCCCOC1=CC=C(C(Cl)=O)C=C1 IBQDPNHVFRFCFK-UHFFFAOYSA-N 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- MXMOTZIXVICDSD-UHFFFAOYSA-N anisoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C=C1 MXMOTZIXVICDSD-UHFFFAOYSA-N 0.000 description 3
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 229940114081 cinnamate Drugs 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- WBYWAXJHAXSJNI-VOTSOKGWSA-M trans-cinnamate Chemical compound [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 3
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- ITQTTZVARXURQS-UHFFFAOYSA-N 3-methylpyridine Chemical compound CC1=CC=CN=C1 ITQTTZVARXURQS-UHFFFAOYSA-N 0.000 description 2
- FKNQCJSGGFJEIZ-UHFFFAOYSA-N 4-methylpyridine Chemical compound CC1=CC=NC=C1 FKNQCJSGGFJEIZ-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 206010034960 Photophobia Diseases 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 230000001771 impaired effect Effects 0.000 description 2
- 208000013469 light sensitivity Diseases 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 230000003381 solubilizing effect Effects 0.000 description 2
- 230000008961 swelling Effects 0.000 description 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- OXHNLMTVIGZXSG-UHFFFAOYSA-N 1-Methylpyrrole Chemical compound CN1C=CC=C1 OXHNLMTVIGZXSG-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 1
- YHOYYHYBFSYOSQ-UHFFFAOYSA-N 3-methylbenzoyl chloride Chemical compound CC1=CC=CC(C(Cl)=O)=C1 YHOYYHYBFSYOSQ-UHFFFAOYSA-N 0.000 description 1
- NZSCUDBGUBVDLO-UHFFFAOYSA-N 3h-indene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CCC2=C1 NZSCUDBGUBVDLO-UHFFFAOYSA-N 0.000 description 1
- XUPUSMCUDSTNLR-UHFFFAOYSA-N 4-(3-oxo-3-phenylprop-1-enyl)benzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1C=CC(=O)C1=CC=CC=C1 XUPUSMCUDSTNLR-UHFFFAOYSA-N 0.000 description 1
- XLWQUESMILVIPR-UHFFFAOYSA-N 4-ethoxybenzoyl chloride Chemical compound CCOC1=CC=C(C(Cl)=O)C=C1 XLWQUESMILVIPR-UHFFFAOYSA-N 0.000 description 1
- AVTLLLZVYYPGFX-UHFFFAOYSA-N 4-ethylbenzoyl chloride Chemical compound CCC1=CC=C(C(Cl)=O)C=C1 AVTLLLZVYYPGFX-UHFFFAOYSA-N 0.000 description 1
- OTHIDQZVUQAMEW-UHFFFAOYSA-N 4-heptoxybenzoyl chloride Chemical compound CCCCCCCOC1=CC=C(C(Cl)=O)C=C1 OTHIDQZVUQAMEW-UHFFFAOYSA-N 0.000 description 1
- NEKGDYGTJYCIRI-UHFFFAOYSA-N 4-octylbenzoyl chloride Chemical compound CCCCCCCCC1=CC=C(C(Cl)=O)C=C1 NEKGDYGTJYCIRI-UHFFFAOYSA-N 0.000 description 1
- 125000006414 CCl Chemical group ClC* 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000013505 freshwater Substances 0.000 description 1
- AHAREKHAZNPPMI-UHFFFAOYSA-N hexa-1,3-diene Chemical compound CCC=CC=C AHAREKHAZNPPMI-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000006606 n-butoxy group Chemical group 0.000 description 1
- 125000006608 n-octyloxy group Chemical group 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/14—Esterification
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2810/00—Chemical modification of a polymer
- C08F2810/30—Chemical modification of a polymer leading to the formation or introduction of aliphatic or alicyclic unsaturated groups
Landscapes
- Chemical & Material Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US81238069A | 1969-04-01 | 1969-04-01 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2012389A1 DE2012389A1 (de) | 1970-10-08 |
| DE2012389B2 DE2012389B2 (de) | 1978-05-11 |
| DE2012389C3 true DE2012389C3 (de) | 1979-01-11 |
Family
ID=25209391
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2012389A Expired DE2012389C3 (de) | 1969-04-01 | 1970-03-16 | Verfahren zur Herstellung von lichtempfindlichen Polyvinylestern |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3560465A (enExample) |
| BE (1) | BE748037A (enExample) |
| CH (1) | CH523926A (enExample) |
| DE (1) | DE2012389C3 (enExample) |
| FR (1) | FR2038098B1 (enExample) |
| GB (1) | GB1294962A (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3867318A (en) * | 1969-12-10 | 1975-02-18 | Nippon Oil Seal Ind Co Ltd | Photosensitive polymeric esters produced by the condensation of a chloromethyl groups-containing polymer with a carboxyl salt |
| US3881935A (en) * | 1971-01-07 | 1975-05-06 | Powers Chemco Inc | Photosensitive polymer composition |
| US3912697A (en) * | 1973-04-27 | 1975-10-14 | Eastman Kodak Co | Light-sensitive polymers |
| US3879356A (en) * | 1973-08-29 | 1975-04-22 | Eastman Kodak Co | Light-sensitive polymeric compositions |
| DE3322993A1 (de) * | 1983-06-25 | 1985-01-03 | Basf Ag, 6700 Ludwigshafen | Verfahren zur acylierung von polyvinylalkoholen und so acylierte produkte enthaltende photopolymerisierbare und/oder photovernetzbare mischungen |
| DE3534476A1 (de) * | 1985-09-27 | 1987-04-02 | Basf Ag | Verfahren zur herstellung von carbonsaeureestern hydroxygruppenhaltiger polymerisate |
| GB2207923B (en) * | 1987-08-14 | 1991-02-27 | Nippon Synthetic Chem Ind | Halogen-containing thermoplastic resin composition |
| US5824717A (en) * | 1988-05-27 | 1998-10-20 | Exxon Chemical Patents Inc. | Peroxide and radiation curable compositions containing isobutylenene copolymers having acrylate functionality |
| US5061761A (en) * | 1989-09-29 | 1991-10-29 | Kuraray Co., Ltd. | Polyvinyl ester macromonomer and its uses |
| EP0563251A1 (en) * | 1990-12-20 | 1993-10-06 | Exxon Chemical Patents Inc. | Uv/eb curable butyl copolymers for lithographic and corrosion-resistant coating applications |
| DE69421063T2 (de) * | 1993-11-05 | 2000-03-02 | Elf Atochem S.A., Puteaux | Verpackung mit beschränkter sauerstoffdurchlässigkeit |
| EP1788004B1 (en) * | 2004-07-16 | 2013-10-23 | Nitto Denko Corporation | Novel modified polymer, process for producing the same, and use of said novel modified polymer |
| KR101921094B1 (ko) * | 2013-08-08 | 2019-02-13 | 동우 화인켐 주식회사 | 접착제 조성물 및 이를 이용한 복합 편광판 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1090142A (en) * | 1965-02-26 | 1967-11-08 | Agfa Gevaert Nv | Photochemical insolubilisation of polymers |
| GB1152097A (en) * | 1966-09-01 | 1969-05-14 | Wolfen Filmfab Veb | Photopolymerisable Lacquer |
-
1969
- 1969-04-01 US US812380A patent/US3560465A/en not_active Expired - Lifetime
-
1970
- 1970-03-16 DE DE2012389A patent/DE2012389C3/de not_active Expired
- 1970-03-25 FR FR707010774A patent/FR2038098B1/fr not_active Expired
- 1970-03-26 BE BE748037D patent/BE748037A/xx unknown
- 1970-03-26 GB GB1294962D patent/GB1294962A/en not_active Expired
- 1970-04-01 CH CH483570A patent/CH523926A/fr not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| BE748037A (fr) | 1970-08-31 |
| FR2038098A1 (enExample) | 1971-01-08 |
| CH523926A (fr) | 1972-06-15 |
| GB1294962A (enExample) | 1972-11-01 |
| DE2012389A1 (de) | 1970-10-08 |
| FR2038098B1 (enExample) | 1974-03-01 |
| US3560465A (en) | 1971-02-02 |
| DE2012389B2 (de) | 1978-05-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2012389C3 (de) | Verfahren zur Herstellung von lichtempfindlichen Polyvinylestern | |
| DE2453428C3 (de) | Photopolymerisierbare Masse | |
| DE3411659A1 (de) | Verfahren zur herstellung von polyoxazol- und polythiazol-vorstufen | |
| EP0129902B1 (de) | Verfahren zur Acylierung von Polyvinylalkoholen und so acylierte Produkte enthaltende photopolymerisierbare und/oder photovernetzbare Mischungen | |
| DE3872756T2 (de) | Lineare additionspolymere mit hyperpolarisierbaren seitenketten. | |
| DE2040983A1 (de) | Neue Acrylsaeurederivate und Verfahren zur Herstellung derselben | |
| DE1091335B (de) | Verfahren zur Herstellung von Polymerisaten ungesaettigter, Perfluorkohlenwasserstoffgruppen enthaltender Ester | |
| DE1418995A1 (de) | Diisocyanate und Verfahren zu ihrer Herstellung | |
| DE2919823A1 (de) | N-azidosulfonylaryl-maleinimide sowie deren verwendung | |
| DE2453326A1 (de) | Halogensubstituierte benzimidazolonverbindungen und verfahren zu ihrer herstellung | |
| DE68918360T2 (de) | Blockcopolymere und Verfahren zu deren Herstellung. | |
| EP0457092A2 (de) | Alkenylmethylhydroxypropylcelluloseether und ein Verfahren zu ihrer Herstellung | |
| EP0157931A1 (de) | Verfahren zur Herstellung von Polyimidazol- und Polyimidazopyrrolon-Vorstufen | |
| DE2217158A1 (de) | Verfahren zur Herstellung eines Photopolymeren | |
| EP0025506A1 (de) | Polyoxazol-Vorstufen, deren Herstellung und Verwendung | |
| DE2053186A1 (de) | Verbindungen von hohem Molekular gewicht sowie Verfahren zu deren Herstellung | |
| DE2166449A1 (de) | Mischung aus polymerisierbaren verbindungen | |
| DE2164625A1 (de) | Bilderzeugungsverfahren | |
| DE2750542A1 (de) | Verfahren zur herstellung von polymeren, die freie oder in salzform befindliche aminische gruppen und quaternaere ammoniumgruppen enthalten sowie die dabei erhaltenen produkte | |
| DE1211156B (de) | Verfahren zur Herstellung von ungesaettigten Sulfonsaeurebetainen durch Umsetzen eines tertiaeren Amins mit einem Sulton | |
| DE68916817T2 (de) | Lichtempfindliche Zusammensetzungen. | |
| DE2341787A1 (de) | Neue reaktionsfaehige polymere | |
| DE2337616C2 (de) | Polymere aus Polyvinylakohol und 1,4,5,6,7,7-Hexachlorbicyclo-[2,2,1]hept-5-en-2,3-dicarbonsäureanhydrid, deren Herstellung und Verwendung | |
| DE69309296T2 (de) | Teilweise fluorierte polymere | |
| DE1133133B (de) | Verfahren zur Herstellung linearer thermoplastischer Polykondensate aus Diorganosilandiolen und aromatischen Dioxyverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |